commit ce35abffeff11e26fa248ca934366941b721aacc Author: Rushil Umaretiya Date: Sun Jan 24 00:15:44 2021 -0500 Initial commit diff --git a/Astute-Engineering-Leaflet.pdf b/Astute-Engineering-Leaflet.pdf new file mode 100755 index 0000000..463d6bd Binary files /dev/null and b/Astute-Engineering-Leaflet.pdf differ diff --git a/about-us.html b/about-us.html new file mode 100755 index 0000000..611461f --- /dev/null +++ b/about-us.html @@ -0,0 +1,216 @@ + + + + + + + + + + + Astute Engineering - About Us + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ + +
+ + +
+
+
+
+

About Us

+
+
+
+
+

As an emerging Engineering Company, Astute envisions serving federal, state and municipal clients for developing and executing smart & innovative electrical engineering designs and solutions for their electrical power systems.

+

Astute has the capaibility to deliver projects on-time, even when working with aggressive schedules. This ability is due in-part to the structure and resources of our organization as well as the depth of experience developed over many years of handling quality engineering projects.

+

On-time delieveries, high quality & low-cost designs are the hallmark of Astute.

+ +

Our involvement, commitment, dedication, creativity and insight evolve comprehensive designs that simplify construction and installation efforts. Through our construciton period services, including careful scrutinty, complete testing and thorough inspection of equipment & installations, we ensure accomplishing projects within the allocated time and budget.

+ +

Astute brings deep-rooted knowledge of product and processes backed by solid experience in providing entire array of high quality electrical engineering services at low cost to their clients. With variety of services included in their portfolio, Astute confidently promises to provide a true one-stop shopping experience in Electrical Engineering.

+
We understand and are structured to manage:
+
    +
  • Development of clear concepts
    • +
  • Challenging & complex design assignments
    • +
  • Aggressive design schedules
    • +
  • Design changes on-the-go
    • +
  • Accurate & on-time deliveries
    • +
+
+
+
+
+
+
+
+

Our Approach

+
+
+
+

Every project is unique, presenting specific needs and challenges for the design team. Our Project leads and engineering team members are assigned to each project according to specific needs of clients.

+
+
+
+
+

Our engineers and designers approach each project as a team, pooling thoughts and ideas to converge on a best possible solution for each special issue or problem. Thus, we create an operating structure that enables us to generate designs that meet and exceed our client’s needs.

+
+
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + diff --git a/careers.html b/careers.html new file mode 100755 index 0000000..77650ed --- /dev/null +++ b/careers.html @@ -0,0 +1,226 @@ + + + + + + + + + + + Astute Engineering - Careers + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ + +
+ + +
+
+
+
+

Careers

+
+
+
+

Astute recognizes that our business is about people. The people we work with, the people we serve, and the people who live and work in the facilities we design. As such, we are always on the lookout for best people who share our love of engineering and our vision for technical leadership.

+

We recognize the contribution that each individual makes to our success. In turn, we strive to provide a stimulating work environment that fosters innovation, creativity and teamwork. We also provide in-house training and professional development programs to help you reach your full potential.

+

Astute offers all qualified employees a competitive benefits package.

+

If you are interested in joining our team, please send your resume to contact@astuteng.com

+
+
+
+
+
+
+
+
+
+

Current Openings

+
+

Electrical Engineer - Mid Level Experience

+ POSITION SUMMARY: +

Reports to the Chief Engineer. Works in a project team environment with other engineers and designers involved in the detailed electrical design and project management. Takes an active role in project conceptualization, work planning, and project execution. Works on challenging assignments that include investigating, trouble-shooting, and solving a wide variety of electrical engineering issues. Prepare reports that present technical and project information in a clear and concise manner and meet client requirements and Astute formats. Travels to client sites as needed.

+ COMPETENCIES: +
    +
  • + Education: +

    Requires a Bachelor’s degree in Electrical Engineering.

    +
    • +
  • + Knowledge: +

    Ability to prepare load calculations substation grounding calculations, direct stroke shielding calculations, battery & charger sizing calculations, etc. Physical layout and protection & controls experience. Ability to work with Designer to develop power distribution system &substation single line diagrams, relaying & metering diagrams, DC schematic diagrams, plans, elevations& sections, grounding plans, MCC & panelboard schedules, cable & conduit sizing and schedules, conduit routing & underground distribution systems, etc. Familiarity with NEC/NFPA/ANSI/IEEE/NEMA codes &standards as they relate to distribution system &substation design. This includes the National Electrical Safety Code (ANSI - C2).Should have basic understanding of AutoCAD. Familiarity with specifications is essential. Ability to prepare specifications is preferred.

    +
    • +
  • + Skills: +

    Requires excellent verbal and written communication skills, professional telephone manner, and interpersonal skills to interact with prospective or current clients. Requires ability to prioritize work. Excellent follow-up tasks management and organizational skills. Operating knowledge of AutoCAD is desired but not essential.

    +
    • +
  • + Work Experience: +

    Requires 8-10 years of engineering experience including minimum 2-3 years of field experience for an Electrical Engineering Baccalaureate (undergraduate degree) or 5-7 years of engineering experience including minimum 3-4 years of field experience for a graduate degree holder

    +
    • +
  • + Software & Computer Skills: +

    AutoCAD Design Tool, Microsoft Office, Cost Estimating

    +
    • +
+ WORKING CONDITIONS: +

Works in a normal office environment where there are no physical discomforts due to temperature, noise, dust and the like. Requires using a keyboard to interact with computer systems and visual acuity (including close vision and some color vision for close computer work) and long stretches of sitting at a work station in a busy office environment with attention to detail. Work requires undertaking frequent field visits for indoor/oudoor electrical equipment and infrastructure surveys (including undergroundmanholes, handholes, ductbanks, cables & conduits, etc.), opening and handling panelboard covers, reaching and grasping objects, stooping, bending,.

+
+
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + diff --git a/commercial.html b/commercial.html new file mode 100755 index 0000000..bf8932d --- /dev/null +++ b/commercial.html @@ -0,0 +1,243 @@ + + + + + + + + + + + Astute Engineering - Commercial + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ + +
+ + +
+
+
+
+
    +
  1. Home
    2. +
  2. Markets
    3. +
  3. Commercial
    4. +
+
+
+

Commercial

+
+
+
+

Astute can engineer electrical power systems for variety of projects ranging from high-rise, mixed-use developments to large warehouses, data centers and office complexes. Our smart system designs and built-in redundancies ensure reliability and minimize unplanned outages & failures. We work hand-in-hand with architects in careful selection of equipment and components to maintain the aesthetic appeal of their creations. Our due diligence in disposition & layouts allows ease of installation and maintenance. At the end, the winners are our project owners who get the best product within time and budget. Our designs and engineering solutions are tailored for all commercial establishments like office buildings, commercial complexes, malls/shopping centers, repair & maintenance facilities, central utility plants and mission critical facilities.

+
+
+
+
+
+
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + diff --git a/contact.html b/contact.html new file mode 100755 index 0000000..2198a83 --- /dev/null +++ b/contact.html @@ -0,0 +1,273 @@ + + + + + + + + + + + Astute Engineering - Contact + + + + + + + + + + + + + + + + + + +
+ +
+ +
+
+
+

Contact

+
+
+ +
+ + +
+ +
+
+
+
+
+
Primary Office
+
+ +
+

+ + 8450D Tyco Road
+ Vienna, VA 22182 + +

+
+
+
+
+
Email
+
+ +
+

+ contact@astuteng.com +

+
+
+
+
+
Phone
+
+ +
+

+ 202-400-2004 +

+
+
+
+
+
Connect with us
+
+ +
+
+ +
+
+
+
+
+
+ +
+
+

Other Locations

+
+
+
+
Fredericksburg, VA
+
+ + 2310 Plank Road
+ Suite 101
+ Fredericksburg, VA 22401 +
+
+
+
+
+
Baltimore, MD
+
+ + 1001 Aviation Blvd.
+ Suite 2700, Cargo Bldg. F
+ Baltimore MD-21240 +
+
+
+
+
+
Raleigh, NC
+
+ + 4030 Wake Forest Road,
+ Suite 349
+ Raleigh, NC 27609 +
+
+
+
+
+
Marlton , NJ
+
+ + Five Greentree Centre, 525
+ Route 73 North, STE 104
+ Marlton , NJ 08053 +
+
+
+
+ +
+
+ + + +
+ + + + + + + + + + + + + + + + + + + + + + + diff --git a/css/animate.css b/css/animate.css new file mode 100755 index 0000000..dbba6b6 --- /dev/null +++ b/css/animate.css @@ -0,0 +1,3382 @@ +@charset "UTF-8"; + +/*! + * animate.css -http://daneden.me/animate + * Version - 3.5.1 + * Licensed under the MIT license - http://opensource.org/licenses/MIT + * + * Copyright (c) 2016 Daniel Eden + */ + +.animated { + -webkit-animation-duration: 1s; + animation-duration: 1s; + -webkit-animation-fill-mode: both; + animation-fill-mode: both; +} + +.animated.infinite { + -webkit-animation-iteration-count: infinite; + animation-iteration-count: infinite; +} + +.animated.hinge { + -webkit-animation-duration: 2s; + animation-duration: 2s; +} + +.animated.flipOutX, +.animated.flipOutY, +.animated.bounceIn, +.animated.bounceOut { + -webkit-animation-duration: .75s; + animation-duration: .75s; +} + +@-webkit-keyframes bounce { + from, 20%, 53%, 80%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + -webkit-transform: translate3d(0,0,0); + transform: translate3d(0,0,0); + } + + 40%, 43% { + -webkit-animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060); + animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060); + -webkit-transform: translate3d(0, -30px, 0); + transform: translate3d(0, -30px, 0); + } + + 70% { + -webkit-animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060); + animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060); + -webkit-transform: translate3d(0, -15px, 0); + transform: translate3d(0, -15px, 0); + } + + 90% { + -webkit-transform: translate3d(0,-4px,0); + transform: translate3d(0,-4px,0); + } +} + +@keyframes bounce { + from, 20%, 53%, 80%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + -webkit-transform: translate3d(0,0,0); + transform: translate3d(0,0,0); + } + + 40%, 43% { + -webkit-animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060); + animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060); + -webkit-transform: translate3d(0, -30px, 0); + transform: translate3d(0, -30px, 0); + } + + 70% { + -webkit-animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060); + animation-timing-function: cubic-bezier(0.755, 0.050, 0.855, 0.060); + -webkit-transform: translate3d(0, -15px, 0); + transform: translate3d(0, -15px, 0); + } + + 90% { + -webkit-transform: translate3d(0,-4px,0); + transform: translate3d(0,-4px,0); + } +} + +.bounce { + -webkit-animation-name: bounce; + animation-name: bounce; + -webkit-transform-origin: center bottom; + transform-origin: center bottom; +} + +@-webkit-keyframes flash { + from, 50%, to { + opacity: 1; + } + + 25%, 75% { + opacity: 0; + } +} + +@keyframes flash { + from, 50%, to { + opacity: 1; + } + + 25%, 75% { + opacity: 0; + } +} + +.flash { + -webkit-animation-name: flash; + animation-name: flash; +} + +/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */ + +@-webkit-keyframes pulse { + from { + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } + + 50% { + -webkit-transform: scale3d(1.05, 1.05, 1.05); + transform: scale3d(1.05, 1.05, 1.05); + } + + to { + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } +} + +@keyframes pulse { + from { + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } + + 50% { + -webkit-transform: scale3d(1.05, 1.05, 1.05); + transform: scale3d(1.05, 1.05, 1.05); + } + + to { + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } +} + +.pulse { + -webkit-animation-name: pulse; + animation-name: pulse; +} + +@-webkit-keyframes rubberBand { + from { + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } + + 30% { + -webkit-transform: scale3d(1.25, 0.75, 1); + transform: scale3d(1.25, 0.75, 1); + } + + 40% { + -webkit-transform: scale3d(0.75, 1.25, 1); + transform: scale3d(0.75, 1.25, 1); + } + + 50% { + -webkit-transform: scale3d(1.15, 0.85, 1); + transform: scale3d(1.15, 0.85, 1); + } + + 65% { + -webkit-transform: scale3d(.95, 1.05, 1); + transform: scale3d(.95, 1.05, 1); + } + + 75% { + -webkit-transform: scale3d(1.05, .95, 1); + transform: scale3d(1.05, .95, 1); + } + + to { + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } +} + +@keyframes rubberBand { + from { + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } + + 30% { + -webkit-transform: scale3d(1.25, 0.75, 1); + transform: scale3d(1.25, 0.75, 1); + } + + 40% { + -webkit-transform: scale3d(0.75, 1.25, 1); + transform: scale3d(0.75, 1.25, 1); + } + + 50% { + -webkit-transform: scale3d(1.15, 0.85, 1); + transform: scale3d(1.15, 0.85, 1); + } + + 65% { + -webkit-transform: scale3d(.95, 1.05, 1); + transform: scale3d(.95, 1.05, 1); + } + + 75% { + -webkit-transform: scale3d(1.05, .95, 1); + transform: scale3d(1.05, .95, 1); + } + + to { + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } +} + +.rubberBand { + -webkit-animation-name: rubberBand; + animation-name: rubberBand; +} + +@-webkit-keyframes shake { + from, to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } + + 10%, 30%, 50%, 70%, 90% { + -webkit-transform: translate3d(-10px, 0, 0); + transform: translate3d(-10px, 0, 0); + } + + 20%, 40%, 60%, 80% { + -webkit-transform: translate3d(10px, 0, 0); + transform: translate3d(10px, 0, 0); + } +} + +@keyframes shake { + from, to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } + + 10%, 30%, 50%, 70%, 90% { + -webkit-transform: translate3d(-10px, 0, 0); + transform: translate3d(-10px, 0, 0); + } + + 20%, 40%, 60%, 80% { + -webkit-transform: translate3d(10px, 0, 0); + transform: translate3d(10px, 0, 0); + } +} + +.shake { + -webkit-animation-name: shake; + animation-name: shake; +} + +@-webkit-keyframes headShake { + 0% { + -webkit-transform: translateX(0); + transform: translateX(0); + } + + 6.5% { + -webkit-transform: translateX(-6px) rotateY(-9deg); + transform: translateX(-6px) rotateY(-9deg); + } + + 18.5% { + -webkit-transform: translateX(5px) rotateY(7deg); + transform: translateX(5px) rotateY(7deg); + } + + 31.5% { + -webkit-transform: translateX(-3px) rotateY(-5deg); + transform: translateX(-3px) rotateY(-5deg); + } + + 43.5% { + -webkit-transform: translateX(2px) rotateY(3deg); + transform: translateX(2px) rotateY(3deg); + } + + 50% { + -webkit-transform: translateX(0); + transform: translateX(0); + } +} + +@keyframes headShake { + 0% { + -webkit-transform: translateX(0); + transform: translateX(0); + } + + 6.5% { + -webkit-transform: translateX(-6px) rotateY(-9deg); + transform: translateX(-6px) rotateY(-9deg); + } + + 18.5% { + -webkit-transform: translateX(5px) rotateY(7deg); + transform: translateX(5px) rotateY(7deg); + } + + 31.5% { + -webkit-transform: translateX(-3px) rotateY(-5deg); + transform: translateX(-3px) rotateY(-5deg); + } + + 43.5% { + -webkit-transform: translateX(2px) rotateY(3deg); + transform: translateX(2px) rotateY(3deg); + } + + 50% { + -webkit-transform: translateX(0); + transform: translateX(0); + } +} + +.headShake { + -webkit-animation-timing-function: ease-in-out; + animation-timing-function: ease-in-out; + -webkit-animation-name: headShake; + animation-name: headShake; +} + +@-webkit-keyframes swing { + 20% { + -webkit-transform: rotate3d(0, 0, 1, 15deg); + transform: rotate3d(0, 0, 1, 15deg); + } + + 40% { + -webkit-transform: rotate3d(0, 0, 1, -10deg); + transform: rotate3d(0, 0, 1, -10deg); + } + + 60% { + -webkit-transform: rotate3d(0, 0, 1, 5deg); + transform: rotate3d(0, 0, 1, 5deg); + } + + 80% { + -webkit-transform: rotate3d(0, 0, 1, -5deg); + transform: rotate3d(0, 0, 1, -5deg); + } + + to { + -webkit-transform: rotate3d(0, 0, 1, 0deg); + transform: rotate3d(0, 0, 1, 0deg); + } +} + +@keyframes swing { + 20% { + -webkit-transform: rotate3d(0, 0, 1, 15deg); + transform: rotate3d(0, 0, 1, 15deg); + } + + 40% { + -webkit-transform: rotate3d(0, 0, 1, -10deg); + transform: rotate3d(0, 0, 1, -10deg); + } + + 60% { + -webkit-transform: rotate3d(0, 0, 1, 5deg); + transform: rotate3d(0, 0, 1, 5deg); + } + + 80% { + -webkit-transform: rotate3d(0, 0, 1, -5deg); + transform: rotate3d(0, 0, 1, -5deg); + } + + to { + -webkit-transform: rotate3d(0, 0, 1, 0deg); + transform: rotate3d(0, 0, 1, 0deg); + } +} + +.swing { + -webkit-transform-origin: top center; + transform-origin: top center; + -webkit-animation-name: swing; + animation-name: swing; +} + +@-webkit-keyframes tada { + from { + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } + + 10%, 20% { + -webkit-transform: scale3d(.9, .9, .9) rotate3d(0, 0, 1, -3deg); + transform: scale3d(.9, .9, .9) rotate3d(0, 0, 1, -3deg); + } + + 30%, 50%, 70%, 90% { + -webkit-transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, 3deg); + transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, 3deg); + } + + 40%, 60%, 80% { + -webkit-transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, -3deg); + transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, -3deg); + } + + to { + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } +} + +@keyframes tada { + from { + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } + + 10%, 20% { + -webkit-transform: scale3d(.9, .9, .9) rotate3d(0, 0, 1, -3deg); + transform: scale3d(.9, .9, .9) rotate3d(0, 0, 1, -3deg); + } + + 30%, 50%, 70%, 90% { + -webkit-transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, 3deg); + transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, 3deg); + } + + 40%, 60%, 80% { + -webkit-transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, -3deg); + transform: scale3d(1.1, 1.1, 1.1) rotate3d(0, 0, 1, -3deg); + } + + to { + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } +} + +.tada { + -webkit-animation-name: tada; + animation-name: tada; +} + +/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */ + +@-webkit-keyframes wobble { + from { + -webkit-transform: none; + transform: none; + } + + 15% { + -webkit-transform: translate3d(-25%, 0, 0) rotate3d(0, 0, 1, -5deg); + transform: translate3d(-25%, 0, 0) rotate3d(0, 0, 1, -5deg); + } + + 30% { + -webkit-transform: translate3d(20%, 0, 0) rotate3d(0, 0, 1, 3deg); + transform: translate3d(20%, 0, 0) rotate3d(0, 0, 1, 3deg); + } + + 45% { + -webkit-transform: translate3d(-15%, 0, 0) rotate3d(0, 0, 1, -3deg); + transform: translate3d(-15%, 0, 0) rotate3d(0, 0, 1, -3deg); + } + + 60% { + -webkit-transform: translate3d(10%, 0, 0) rotate3d(0, 0, 1, 2deg); + transform: translate3d(10%, 0, 0) rotate3d(0, 0, 1, 2deg); + } + + 75% { + -webkit-transform: translate3d(-5%, 0, 0) rotate3d(0, 0, 1, -1deg); + transform: translate3d(-5%, 0, 0) rotate3d(0, 0, 1, -1deg); + } + + to { + -webkit-transform: none; + transform: none; + } +} + +@keyframes wobble { + from { + -webkit-transform: none; + transform: none; + } + + 15% { + -webkit-transform: translate3d(-25%, 0, 0) rotate3d(0, 0, 1, -5deg); + transform: translate3d(-25%, 0, 0) rotate3d(0, 0, 1, -5deg); + } + + 30% { + -webkit-transform: translate3d(20%, 0, 0) rotate3d(0, 0, 1, 3deg); + transform: translate3d(20%, 0, 0) rotate3d(0, 0, 1, 3deg); + } + + 45% { + -webkit-transform: translate3d(-15%, 0, 0) rotate3d(0, 0, 1, -3deg); + transform: translate3d(-15%, 0, 0) rotate3d(0, 0, 1, -3deg); + } + + 60% { + -webkit-transform: translate3d(10%, 0, 0) rotate3d(0, 0, 1, 2deg); + transform: translate3d(10%, 0, 0) rotate3d(0, 0, 1, 2deg); + } + + 75% { + -webkit-transform: translate3d(-5%, 0, 0) rotate3d(0, 0, 1, -1deg); + transform: translate3d(-5%, 0, 0) rotate3d(0, 0, 1, -1deg); + } + + to { + -webkit-transform: none; + transform: none; + } +} + +.wobble { + -webkit-animation-name: wobble; + animation-name: wobble; +} + +@-webkit-keyframes jello { + from, 11.1%, to { + -webkit-transform: none; + transform: none; + } + + 22.2% { + -webkit-transform: skewX(-12.5deg) skewY(-12.5deg); + transform: skewX(-12.5deg) skewY(-12.5deg); + } + + 33.3% { + -webkit-transform: skewX(6.25deg) skewY(6.25deg); + transform: skewX(6.25deg) skewY(6.25deg); + } + + 44.4% { + -webkit-transform: skewX(-3.125deg) skewY(-3.125deg); + transform: skewX(-3.125deg) skewY(-3.125deg); + } + + 55.5% { + -webkit-transform: skewX(1.5625deg) skewY(1.5625deg); + transform: skewX(1.5625deg) skewY(1.5625deg); + } + + 66.6% { + -webkit-transform: skewX(-0.78125deg) skewY(-0.78125deg); + transform: skewX(-0.78125deg) skewY(-0.78125deg); + } + + 77.7% { + -webkit-transform: skewX(0.390625deg) skewY(0.390625deg); + transform: skewX(0.390625deg) skewY(0.390625deg); + } + + 88.8% { + -webkit-transform: skewX(-0.1953125deg) skewY(-0.1953125deg); + transform: skewX(-0.1953125deg) skewY(-0.1953125deg); + } +} + +@keyframes jello { + from, 11.1%, to { + -webkit-transform: none; + transform: none; + } + + 22.2% { + -webkit-transform: skewX(-12.5deg) skewY(-12.5deg); + transform: skewX(-12.5deg) skewY(-12.5deg); + } + + 33.3% { + -webkit-transform: skewX(6.25deg) skewY(6.25deg); + transform: skewX(6.25deg) skewY(6.25deg); + } + + 44.4% { + -webkit-transform: skewX(-3.125deg) skewY(-3.125deg); + transform: skewX(-3.125deg) skewY(-3.125deg); + } + + 55.5% { + -webkit-transform: skewX(1.5625deg) skewY(1.5625deg); + transform: skewX(1.5625deg) skewY(1.5625deg); + } + + 66.6% { + -webkit-transform: skewX(-0.78125deg) skewY(-0.78125deg); + transform: skewX(-0.78125deg) skewY(-0.78125deg); + } + + 77.7% { + -webkit-transform: skewX(0.390625deg) skewY(0.390625deg); + transform: skewX(0.390625deg) skewY(0.390625deg); + } + + 88.8% { + -webkit-transform: skewX(-0.1953125deg) skewY(-0.1953125deg); + transform: skewX(-0.1953125deg) skewY(-0.1953125deg); + } +} + +.jello { + -webkit-animation-name: jello; + animation-name: jello; + -webkit-transform-origin: center; + transform-origin: center; +} + +@-webkit-keyframes bounceIn { + from, 20%, 40%, 60%, 80%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + 0% { + opacity: 0; + -webkit-transform: scale3d(.3, .3, .3); + transform: scale3d(.3, .3, .3); + } + + 20% { + -webkit-transform: scale3d(1.1, 1.1, 1.1); + transform: scale3d(1.1, 1.1, 1.1); + } + + 40% { + -webkit-transform: scale3d(.9, .9, .9); + transform: scale3d(.9, .9, .9); + } + + 60% { + opacity: 1; + -webkit-transform: scale3d(1.03, 1.03, 1.03); + transform: scale3d(1.03, 1.03, 1.03); + } + + 80% { + -webkit-transform: scale3d(.97, .97, .97); + transform: scale3d(.97, .97, .97); + } + + to { + opacity: 1; + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } +} + +@keyframes bounceIn { + from, 20%, 40%, 60%, 80%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + 0% { + opacity: 0; + -webkit-transform: scale3d(.3, .3, .3); + transform: scale3d(.3, .3, .3); + } + + 20% { + -webkit-transform: scale3d(1.1, 1.1, 1.1); + transform: scale3d(1.1, 1.1, 1.1); + } + + 40% { + -webkit-transform: scale3d(.9, .9, .9); + transform: scale3d(.9, .9, .9); + } + + 60% { + opacity: 1; + -webkit-transform: scale3d(1.03, 1.03, 1.03); + transform: scale3d(1.03, 1.03, 1.03); + } + + 80% { + -webkit-transform: scale3d(.97, .97, .97); + transform: scale3d(.97, .97, .97); + } + + to { + opacity: 1; + -webkit-transform: scale3d(1, 1, 1); + transform: scale3d(1, 1, 1); + } +} + +.bounceIn { + -webkit-animation-name: bounceIn; + animation-name: bounceIn; +} + +@-webkit-keyframes bounceInDown { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + 0% { + opacity: 0; + -webkit-transform: translate3d(0, -3000px, 0); + transform: translate3d(0, -3000px, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(0, 25px, 0); + transform: translate3d(0, 25px, 0); + } + + 75% { + -webkit-transform: translate3d(0, -10px, 0); + transform: translate3d(0, -10px, 0); + } + + 90% { + -webkit-transform: translate3d(0, 5px, 0); + transform: translate3d(0, 5px, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + +@keyframes bounceInDown { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + 0% { + opacity: 0; + -webkit-transform: translate3d(0, -3000px, 0); + transform: translate3d(0, -3000px, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(0, 25px, 0); + transform: translate3d(0, 25px, 0); + } + + 75% { + -webkit-transform: translate3d(0, -10px, 0); + transform: translate3d(0, -10px, 0); + } + + 90% { + -webkit-transform: translate3d(0, 5px, 0); + transform: translate3d(0, 5px, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + +.bounceInDown { + -webkit-animation-name: bounceInDown; + animation-name: bounceInDown; +} + +@-webkit-keyframes bounceInLeft { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + 0% { + opacity: 0; + -webkit-transform: translate3d(-3000px, 0, 0); + transform: translate3d(-3000px, 0, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(25px, 0, 0); + transform: translate3d(25px, 0, 0); + } + + 75% { + -webkit-transform: translate3d(-10px, 0, 0); + transform: translate3d(-10px, 0, 0); + } + + 90% { + -webkit-transform: translate3d(5px, 0, 0); + transform: translate3d(5px, 0, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + +@keyframes bounceInLeft { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + 0% { + opacity: 0; + -webkit-transform: translate3d(-3000px, 0, 0); + transform: translate3d(-3000px, 0, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(25px, 0, 0); + transform: translate3d(25px, 0, 0); + } + + 75% { + -webkit-transform: translate3d(-10px, 0, 0); + transform: translate3d(-10px, 0, 0); + } + + 90% { + -webkit-transform: translate3d(5px, 0, 0); + transform: translate3d(5px, 0, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + +.bounceInLeft { + -webkit-animation-name: bounceInLeft; + animation-name: bounceInLeft; +} + +@-webkit-keyframes bounceInRight { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + from { + opacity: 0; + -webkit-transform: translate3d(3000px, 0, 0); + transform: translate3d(3000px, 0, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(-25px, 0, 0); + transform: translate3d(-25px, 0, 0); + } + + 75% { + -webkit-transform: translate3d(10px, 0, 0); + transform: translate3d(10px, 0, 0); + } + + 90% { + -webkit-transform: translate3d(-5px, 0, 0); + transform: translate3d(-5px, 0, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + +@keyframes bounceInRight { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + from { + opacity: 0; + -webkit-transform: translate3d(3000px, 0, 0); + transform: translate3d(3000px, 0, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(-25px, 0, 0); + transform: translate3d(-25px, 0, 0); + } + + 75% { + -webkit-transform: translate3d(10px, 0, 0); + transform: translate3d(10px, 0, 0); + } + + 90% { + -webkit-transform: translate3d(-5px, 0, 0); + transform: translate3d(-5px, 0, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + +.bounceInRight { + -webkit-animation-name: bounceInRight; + animation-name: bounceInRight; +} + +@-webkit-keyframes bounceInUp { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + from { + opacity: 0; + -webkit-transform: translate3d(0, 3000px, 0); + transform: translate3d(0, 3000px, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(0, -20px, 0); + transform: translate3d(0, -20px, 0); + } + + 75% { + -webkit-transform: translate3d(0, 10px, 0); + transform: translate3d(0, 10px, 0); + } + + 90% { + -webkit-transform: translate3d(0, -5px, 0); + transform: translate3d(0, -5px, 0); + } + + to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +@keyframes bounceInUp { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + from { + opacity: 0; + -webkit-transform: translate3d(0, 3000px, 0); + transform: translate3d(0, 3000px, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(0, -20px, 0); + transform: translate3d(0, -20px, 0); + } + + 75% { + -webkit-transform: translate3d(0, 10px, 0); + transform: translate3d(0, 10px, 0); + } + + 90% { + -webkit-transform: translate3d(0, -5px, 0); + transform: translate3d(0, -5px, 0); + } + + to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.bounceInUp { + -webkit-animation-name: bounceInUp; + animation-name: bounceInUp; +} + +@-webkit-keyframes bounceOut { + 20% { + -webkit-transform: scale3d(.9, .9, .9); + transform: scale3d(.9, .9, .9); + } + + 50%, 55% { + opacity: 1; + -webkit-transform: scale3d(1.1, 1.1, 1.1); + transform: scale3d(1.1, 1.1, 1.1); + } + + to { + opacity: 0; + -webkit-transform: scale3d(.3, .3, .3); + transform: scale3d(.3, .3, .3); + } +} + +@keyframes bounceOut { + 20% { + -webkit-transform: scale3d(.9, .9, .9); + transform: scale3d(.9, .9, .9); + } + + 50%, 55% { + opacity: 1; + -webkit-transform: scale3d(1.1, 1.1, 1.1); + transform: scale3d(1.1, 1.1, 1.1); + } + + to { + opacity: 0; + -webkit-transform: scale3d(.3, .3, .3); + transform: scale3d(.3, .3, .3); + } +} + +.bounceOut { + -webkit-animation-name: bounceOut; + animation-name: bounceOut; +} + +@-webkit-keyframes bounceOutDown { + 20% { + -webkit-transform: translate3d(0, 10px, 0); + transform: translate3d(0, 10px, 0); + } + + 40%, 45% { + opacity: 1; + -webkit-transform: translate3d(0, -20px, 0); + transform: translate3d(0, -20px, 0); + } + + to { + opacity: 0; + -webkit-transform: translate3d(0, 2000px, 0); + transform: translate3d(0, 2000px, 0); + } +} + +@keyframes bounceOutDown { + 20% { + -webkit-transform: translate3d(0, 10px, 0); + transform: translate3d(0, 10px, 0); + } + + 40%, 45% { + opacity: 1; + -webkit-transform: translate3d(0, -20px, 0); + transform: translate3d(0, -20px, 0); + } + + to { + opacity: 0; + -webkit-transform: translate3d(0, 2000px, 0); + transform: translate3d(0, 2000px, 0); + } +} + +.bounceOutDown { + -webkit-animation-name: bounceOutDown; + animation-name: bounceOutDown; +} + +@-webkit-keyframes bounceOutLeft { + 20% { + opacity: 1; + -webkit-transform: translate3d(20px, 0, 0); + transform: translate3d(20px, 0, 0); + } + + to { + opacity: 0; + -webkit-transform: translate3d(-2000px, 0, 0); + transform: translate3d(-2000px, 0, 0); + } +} + +@keyframes bounceOutLeft { + 20% { + opacity: 1; + -webkit-transform: translate3d(20px, 0, 0); + transform: translate3d(20px, 0, 0); + } + + to { + opacity: 0; + -webkit-transform: translate3d(-2000px, 0, 0); + transform: translate3d(-2000px, 0, 0); + } +} + +.bounceOutLeft { + -webkit-animation-name: bounceOutLeft; + animation-name: bounceOutLeft; +} + +@-webkit-keyframes bounceOutRight { + 20% { + opacity: 1; + -webkit-transform: translate3d(-20px, 0, 0); + transform: translate3d(-20px, 0, 0); + } + + to { + opacity: 0; + -webkit-transform: translate3d(2000px, 0, 0); + transform: translate3d(2000px, 0, 0); + } +} + +@keyframes bounceOutRight { + 20% { + opacity: 1; + -webkit-transform: translate3d(-20px, 0, 0); + transform: translate3d(-20px, 0, 0); + } + + to { + opacity: 0; + -webkit-transform: translate3d(2000px, 0, 0); + transform: translate3d(2000px, 0, 0); + } +} + +.bounceOutRight { + -webkit-animation-name: bounceOutRight; + animation-name: bounceOutRight; +} + +@-webkit-keyframes bounceOutUp { + 20% { + -webkit-transform: translate3d(0, -10px, 0); + transform: translate3d(0, -10px, 0); + } + + 40%, 45% { + opacity: 1; + -webkit-transform: translate3d(0, 20px, 0); + transform: translate3d(0, 20px, 0); + } + + to { + opacity: 0; + -webkit-transform: translate3d(0, -2000px, 0); + transform: translate3d(0, -2000px, 0); + } +} + +@keyframes bounceOutUp { + 20% { + -webkit-transform: translate3d(0, -10px, 0); + transform: translate3d(0, -10px, 0); + } + + 40%, 45% { + opacity: 1; + -webkit-transform: translate3d(0, 20px, 0); + transform: translate3d(0, 20px, 0); + } + + to { + opacity: 0; + -webkit-transform: translate3d(0, -2000px, 0); + transform: translate3d(0, -2000px, 0); + } +} + +.bounceOutUp { + -webkit-animation-name: bounceOutUp; + animation-name: bounceOutUp; +} + +@-webkit-keyframes fadeIn { + from { + opacity: 0; + } + + to { + opacity: 1; + } +} + +@keyframes fadeIn { + from { + opacity: 0; + } + + to { + opacity: 1; + } +} + +.fadeIn { + -webkit-animation-name: fadeIn; + animation-name: fadeIn; +} + +@-webkit-keyframes fadeInDown { + from { + opacity: 0; + -webkit-transform: translate3d(0, -100%, 0); + transform: translate3d(0, -100%, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +@keyframes fadeInDown { + from { + opacity: 0; + -webkit-transform: translate3d(0, -100%, 0); + transform: translate3d(0, -100%, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +.fadeInDown { + -webkit-animation-name: fadeInDown; + animation-name: fadeInDown; +} + +@-webkit-keyframes fadeInDownBig { + from { + opacity: 0; + -webkit-transform: translate3d(0, -2000px, 0); + transform: translate3d(0, -2000px, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +@keyframes fadeInDownBig { + from { + opacity: 0; + -webkit-transform: translate3d(0, -2000px, 0); + transform: translate3d(0, -2000px, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +.fadeInDownBig { + -webkit-animation-name: fadeInDownBig; + animation-name: fadeInDownBig; +} + +@-webkit-keyframes fadeInLeft { + from { + opacity: 0; + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +@keyframes fadeInLeft { + from { + opacity: 0; + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +.fadeInLeft { + -webkit-animation-name: fadeInLeft; + animation-name: fadeInLeft; +} + +@-webkit-keyframes fadeInLeftBig { + from { + opacity: 0; + -webkit-transform: translate3d(-2000px, 0, 0); + transform: translate3d(-2000px, 0, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +@keyframes fadeInLeftBig { + from { + opacity: 0; + -webkit-transform: translate3d(-2000px, 0, 0); + transform: translate3d(-2000px, 0, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +.fadeInLeftBig { + -webkit-animation-name: fadeInLeftBig; + animation-name: fadeInLeftBig; +} + +@-webkit-keyframes fadeInRight { + from { + opacity: 0; + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +@keyframes fadeInRight { + from { + opacity: 0; + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +.fadeInRight { + -webkit-animation-name: fadeInRight; + animation-name: fadeInRight; +} + +@-webkit-keyframes fadeInRightBig { + from { + opacity: 0; + -webkit-transform: translate3d(2000px, 0, 0); + transform: translate3d(2000px, 0, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +@keyframes fadeInRightBig { + from { + opacity: 0; + -webkit-transform: translate3d(2000px, 0, 0); + transform: translate3d(2000px, 0, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +.fadeInRightBig { + -webkit-animation-name: fadeInRightBig; + animation-name: fadeInRightBig; +} + +@-webkit-keyframes fadeInUp { + from { + opacity: 0; + -webkit-transform: translate3d(0, 100%, 0); + transform: translate3d(0, 100%, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +@keyframes fadeInUp { + from { + opacity: 0; + -webkit-transform: translate3d(0, 100%, 0); + transform: translate3d(0, 100%, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +.fadeInUp { + -webkit-animation-name: fadeInUp; + animation-name: fadeInUp; +} + +@-webkit-keyframes fadeInUpBig { + from { + opacity: 0; + -webkit-transform: translate3d(0, 2000px, 0); + transform: translate3d(0, 2000px, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +@keyframes fadeInUpBig { + from { + opacity: 0; + -webkit-transform: translate3d(0, 2000px, 0); + transform: translate3d(0, 2000px, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +.fadeInUpBig { + -webkit-animation-name: fadeInUpBig; + animation-name: fadeInUpBig; +} + +@-webkit-keyframes fadeOut { + from { + opacity: 1; + } + + to { + opacity: 0; + } +} + +@keyframes fadeOut { + from { + opacity: 1; + } + + to { + opacity: 0; + } +} + +.fadeOut { + -webkit-animation-name: fadeOut; + animation-name: fadeOut; +} + +@-webkit-keyframes fadeOutDown { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(0, 100%, 0); + transform: translate3d(0, 100%, 0); + } +} + +@keyframes fadeOutDown { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(0, 100%, 0); + transform: translate3d(0, 100%, 0); + } +} + +.fadeOutDown { + -webkit-animation-name: fadeOutDown; + animation-name: fadeOutDown; +} + +@-webkit-keyframes fadeOutDownBig { + from { + opacity: 1; + } + + + to { + opacity: 0; + -webkit-transform: translate3d(0, 2000px, 0); + transform: translate3d(0, 2000px, 0); + } +} + +@keyframes fadeOutDownBig { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(0, 2000px, 0); + transform: translate3d(0, 2000px, 0); + } +} + +.fadeOutDownBig { + -webkit-animation-name: fadeOutDownBig; + animation-name: fadeOutDownBig; +} + +@-webkit-keyframes fadeOutLeft { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } +} + +@keyframes fadeOutLeft { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } +} + +.fadeOutLeft { + -webkit-animation-name: fadeOutLeft; + animation-name: fadeOutLeft; +} + +@-webkit-keyframes fadeOutLeftBig { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(-2000px, 0, 0); + transform: translate3d(-2000px, 0, 0); + } +} + +@keyframes fadeOutLeftBig { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(-2000px, 0, 0); + transform: translate3d(-2000px, 0, 0); + } +} + +.fadeOutLeftBig { + -webkit-animation-name: fadeOutLeftBig; + animation-name: fadeOutLeftBig; +} + +@-webkit-keyframes fadeOutRight { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } +} + +@keyframes fadeOutRight { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } +} + +.fadeOutRight { + -webkit-animation-name: fadeOutRight; + animation-name: fadeOutRight; +} + +@-webkit-keyframes fadeOutRightBig { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(2000px, 0, 0); + transform: translate3d(2000px, 0, 0); + } +} + +@keyframes fadeOutRightBig { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(2000px, 0, 0); + transform: translate3d(2000px, 0, 0); + } +} + +.fadeOutRightBig { + -webkit-animation-name: fadeOutRightBig; + animation-name: fadeOutRightBig; +} + +@-webkit-keyframes fadeOutUp { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(0, -100%, 0); + transform: translate3d(0, -100%, 0); + } +} + +@keyframes fadeOutUp { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(0, -100%, 0); + transform: translate3d(0, -100%, 0); + } +} + +.fadeOutUp { + -webkit-animation-name: fadeOutUp; + animation-name: fadeOutUp; +} + +@-webkit-keyframes fadeOutUpBig { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(0, -2000px, 0); + transform: translate3d(0, -2000px, 0); + } +} + +@keyframes fadeOutUpBig { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(0, -2000px, 0); + transform: translate3d(0, -2000px, 0); + } +} + +.fadeOutUpBig { + -webkit-animation-name: fadeOutUpBig; + animation-name: fadeOutUpBig; +} + +@-webkit-keyframes flip { + from { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -360deg); + transform: perspective(400px) rotate3d(0, 1, 0, -360deg); + -webkit-animation-timing-function: ease-out; + animation-timing-function: ease-out; + } + + 40% { + -webkit-transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -190deg); + transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -190deg); + -webkit-animation-timing-function: ease-out; + animation-timing-function: ease-out; + } + + 50% { + -webkit-transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -170deg); + transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -170deg); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + } + + 80% { + -webkit-transform: perspective(400px) scale3d(.95, .95, .95); + transform: perspective(400px) scale3d(.95, .95, .95); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + } + + to { + -webkit-transform: perspective(400px); + transform: perspective(400px); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + } +} + +@keyframes flip { + from { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -360deg); + transform: perspective(400px) rotate3d(0, 1, 0, -360deg); + -webkit-animation-timing-function: ease-out; + animation-timing-function: ease-out; + } + + 40% { + -webkit-transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -190deg); + transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -190deg); + -webkit-animation-timing-function: ease-out; + animation-timing-function: ease-out; + } + + 50% { + -webkit-transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -170deg); + transform: perspective(400px) translate3d(0, 0, 150px) rotate3d(0, 1, 0, -170deg); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + } + + 80% { + -webkit-transform: perspective(400px) scale3d(.95, .95, .95); + transform: perspective(400px) scale3d(.95, .95, .95); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + } + + to { + -webkit-transform: perspective(400px); + transform: perspective(400px); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + } +} + +.animated.flip { + -webkit-backface-visibility: visible; + backface-visibility: visible; + -webkit-animation-name: flip; + animation-name: flip; +} + +@-webkit-keyframes flipInX { + from { + -webkit-transform: perspective(400px) rotate3d(1, 0, 0, 90deg); + transform: perspective(400px) rotate3d(1, 0, 0, 90deg); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + opacity: 0; + } + + 40% { + -webkit-transform: perspective(400px) rotate3d(1, 0, 0, -20deg); + transform: perspective(400px) rotate3d(1, 0, 0, -20deg); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + } + + 60% { + -webkit-transform: perspective(400px) rotate3d(1, 0, 0, 10deg); + transform: perspective(400px) rotate3d(1, 0, 0, 10deg); + opacity: 1; + } + + 80% { + -webkit-transform: perspective(400px) rotate3d(1, 0, 0, -5deg); + transform: perspective(400px) rotate3d(1, 0, 0, -5deg); + } + + to { + -webkit-transform: perspective(400px); + transform: perspective(400px); + } +} + +@keyframes flipInX { + from { + -webkit-transform: perspective(400px) rotate3d(1, 0, 0, 90deg); + transform: perspective(400px) rotate3d(1, 0, 0, 90deg); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + opacity: 0; + } + + 40% { + -webkit-transform: perspective(400px) rotate3d(1, 0, 0, -20deg); + transform: perspective(400px) rotate3d(1, 0, 0, -20deg); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + } + + 60% { + -webkit-transform: perspective(400px) rotate3d(1, 0, 0, 10deg); + transform: perspective(400px) rotate3d(1, 0, 0, 10deg); + opacity: 1; + } + + 80% { + -webkit-transform: perspective(400px) rotate3d(1, 0, 0, -5deg); + transform: perspective(400px) rotate3d(1, 0, 0, -5deg); + } + + to { + -webkit-transform: perspective(400px); + transform: perspective(400px); + } +} + +.flipInX { + -webkit-backface-visibility: visible !important; + backface-visibility: visible !important; + -webkit-animation-name: flipInX; + animation-name: flipInX; +} + +@-webkit-keyframes flipInY { + from { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, 90deg); + transform: perspective(400px) rotate3d(0, 1, 0, 90deg); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + opacity: 0; + } + + 40% { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -20deg); + transform: perspective(400px) rotate3d(0, 1, 0, -20deg); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + } + + 60% { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, 10deg); + transform: perspective(400px) rotate3d(0, 1, 0, 10deg); + opacity: 1; + } + + 80% { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -5deg); + transform: perspective(400px) rotate3d(0, 1, 0, -5deg); + } + + to { + -webkit-transform: perspective(400px); + transform: perspective(400px); + } +} + +@keyframes flipInY { + from { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, 90deg); + transform: perspective(400px) rotate3d(0, 1, 0, 90deg); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + opacity: 0; + } + + 40% { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -20deg); + transform: perspective(400px) rotate3d(0, 1, 0, -20deg); + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; + } + + 60% { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, 10deg); + transform: perspective(400px) rotate3d(0, 1, 0, 10deg); + opacity: 1; + } + + 80% { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -5deg); + transform: perspective(400px) rotate3d(0, 1, 0, -5deg); + } + + to { + -webkit-transform: perspective(400px); + transform: perspective(400px); + } +} + +.flipInY { + -webkit-backface-visibility: visible !important; + backface-visibility: visible !important; + -webkit-animation-name: flipInY; + animation-name: flipInY; +} + +@-webkit-keyframes flipOutX { + from { + -webkit-transform: perspective(400px); + transform: perspective(400px); + } + + 30% { + -webkit-transform: perspective(400px) rotate3d(1, 0, 0, -20deg); + transform: perspective(400px) rotate3d(1, 0, 0, -20deg); + opacity: 1; + } + + to { + -webkit-transform: perspective(400px) rotate3d(1, 0, 0, 90deg); + transform: perspective(400px) rotate3d(1, 0, 0, 90deg); + opacity: 0; + } +} + +@keyframes flipOutX { + from { + -webkit-transform: perspective(400px); + transform: perspective(400px); + } + + 30% { + -webkit-transform: perspective(400px) rotate3d(1, 0, 0, -20deg); + transform: perspective(400px) rotate3d(1, 0, 0, -20deg); + opacity: 1; + } + + to { + -webkit-transform: perspective(400px) rotate3d(1, 0, 0, 90deg); + transform: perspective(400px) rotate3d(1, 0, 0, 90deg); + opacity: 0; + } +} + +.flipOutX { + -webkit-animation-name: flipOutX; + animation-name: flipOutX; + -webkit-backface-visibility: visible !important; + backface-visibility: visible !important; +} + +@-webkit-keyframes flipOutY { + from { + -webkit-transform: perspective(400px); + transform: perspective(400px); + } + + 30% { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -15deg); + transform: perspective(400px) rotate3d(0, 1, 0, -15deg); + opacity: 1; + } + + to { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, 90deg); + transform: perspective(400px) rotate3d(0, 1, 0, 90deg); + opacity: 0; + } +} + +@keyframes flipOutY { + from { + -webkit-transform: perspective(400px); + transform: perspective(400px); + } + + 30% { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, -15deg); + transform: perspective(400px) rotate3d(0, 1, 0, -15deg); + opacity: 1; + } + + to { + -webkit-transform: perspective(400px) rotate3d(0, 1, 0, 90deg); + transform: perspective(400px) rotate3d(0, 1, 0, 90deg); + opacity: 0; + } +} + +.flipOutY { + -webkit-backface-visibility: visible !important; + backface-visibility: visible !important; + -webkit-animation-name: flipOutY; + animation-name: flipOutY; +} + +@-webkit-keyframes lightSpeedIn { + from { + -webkit-transform: translate3d(100%, 0, 0) skewX(-30deg); + transform: translate3d(100%, 0, 0) skewX(-30deg); + opacity: 0; + } + + 60% { + -webkit-transform: skewX(20deg); + transform: skewX(20deg); + opacity: 1; + } + + 80% { + -webkit-transform: skewX(-5deg); + transform: skewX(-5deg); + opacity: 1; + } + + to { + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +@keyframes lightSpeedIn { + from { + -webkit-transform: translate3d(100%, 0, 0) skewX(-30deg); + transform: translate3d(100%, 0, 0) skewX(-30deg); + opacity: 0; + } + + 60% { + -webkit-transform: skewX(20deg); + transform: skewX(20deg); + opacity: 1; + } + + 80% { + -webkit-transform: skewX(-5deg); + transform: skewX(-5deg); + opacity: 1; + } + + to { + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +.lightSpeedIn { + -webkit-animation-name: lightSpeedIn; + animation-name: lightSpeedIn; + -webkit-animation-timing-function: ease-out; + animation-timing-function: ease-out; +} + +@-webkit-keyframes lightSpeedOut { + from { + opacity: 1; + } + + to { + -webkit-transform: translate3d(100%, 0, 0) skewX(30deg); + transform: translate3d(100%, 0, 0) skewX(30deg); + opacity: 0; + } +} + +@keyframes lightSpeedOut { + from { + opacity: 1; + } + + to { + -webkit-transform: translate3d(100%, 0, 0) skewX(30deg); + transform: translate3d(100%, 0, 0) skewX(30deg); + opacity: 0; + } +} + +.lightSpeedOut { + -webkit-animation-name: lightSpeedOut; + animation-name: lightSpeedOut; + -webkit-animation-timing-function: ease-in; + animation-timing-function: ease-in; +} + +@-webkit-keyframes rotateIn { + from { + -webkit-transform-origin: center; + transform-origin: center; + -webkit-transform: rotate3d(0, 0, 1, -200deg); + transform: rotate3d(0, 0, 1, -200deg); + opacity: 0; + } + + to { + -webkit-transform-origin: center; + transform-origin: center; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +@keyframes rotateIn { + from { + -webkit-transform-origin: center; + transform-origin: center; + -webkit-transform: rotate3d(0, 0, 1, -200deg); + transform: rotate3d(0, 0, 1, -200deg); + opacity: 0; + } + + to { + -webkit-transform-origin: center; + transform-origin: center; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +.rotateIn { + -webkit-animation-name: rotateIn; + animation-name: rotateIn; +} + +@-webkit-keyframes rotateInDownLeft { + from { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: rotate3d(0, 0, 1, -45deg); + transform: rotate3d(0, 0, 1, -45deg); + opacity: 0; + } + + to { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +@keyframes rotateInDownLeft { + from { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: rotate3d(0, 0, 1, -45deg); + transform: rotate3d(0, 0, 1, -45deg); + opacity: 0; + } + + to { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +.rotateInDownLeft { + -webkit-animation-name: rotateInDownLeft; + animation-name: rotateInDownLeft; +} + +@-webkit-keyframes rotateInDownRight { + from { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: rotate3d(0, 0, 1, 45deg); + transform: rotate3d(0, 0, 1, 45deg); + opacity: 0; + } + + to { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +@keyframes rotateInDownRight { + from { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: rotate3d(0, 0, 1, 45deg); + transform: rotate3d(0, 0, 1, 45deg); + opacity: 0; + } + + to { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +.rotateInDownRight { + -webkit-animation-name: rotateInDownRight; + animation-name: rotateInDownRight; +} + +@-webkit-keyframes rotateInUpLeft { + from { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: rotate3d(0, 0, 1, 45deg); + transform: rotate3d(0, 0, 1, 45deg); + opacity: 0; + } + + to { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +@keyframes rotateInUpLeft { + from { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: rotate3d(0, 0, 1, 45deg); + transform: rotate3d(0, 0, 1, 45deg); + opacity: 0; + } + + to { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +.rotateInUpLeft { + -webkit-animation-name: rotateInUpLeft; + animation-name: rotateInUpLeft; +} + +@-webkit-keyframes rotateInUpRight { + from { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: rotate3d(0, 0, 1, -90deg); + transform: rotate3d(0, 0, 1, -90deg); + opacity: 0; + } + + to { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +@keyframes rotateInUpRight { + from { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: rotate3d(0, 0, 1, -90deg); + transform: rotate3d(0, 0, 1, -90deg); + opacity: 0; + } + + to { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +.rotateInUpRight { + -webkit-animation-name: rotateInUpRight; + animation-name: rotateInUpRight; +} + +@-webkit-keyframes rotateOut { + from { + -webkit-transform-origin: center; + transform-origin: center; + opacity: 1; + } + + to { + -webkit-transform-origin: center; + transform-origin: center; + -webkit-transform: rotate3d(0, 0, 1, 200deg); + transform: rotate3d(0, 0, 1, 200deg); + opacity: 0; + } +} + +@keyframes rotateOut { + from { + -webkit-transform-origin: center; + transform-origin: center; + opacity: 1; + } + + to { + -webkit-transform-origin: center; + transform-origin: center; + -webkit-transform: rotate3d(0, 0, 1, 200deg); + transform: rotate3d(0, 0, 1, 200deg); + opacity: 0; + } +} + +.rotateOut { + -webkit-animation-name: rotateOut; + animation-name: rotateOut; +} + +@-webkit-keyframes rotateOutDownLeft { + from { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + opacity: 1; + } + + to { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: rotate3d(0, 0, 1, 45deg); + transform: rotate3d(0, 0, 1, 45deg); + opacity: 0; + } +} + +@keyframes rotateOutDownLeft { + from { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + opacity: 1; + } + + to { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: rotate3d(0, 0, 1, 45deg); + transform: rotate3d(0, 0, 1, 45deg); + opacity: 0; + } +} + +.rotateOutDownLeft { + -webkit-animation-name: rotateOutDownLeft; + animation-name: rotateOutDownLeft; +} + +@-webkit-keyframes rotateOutDownRight { + from { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + opacity: 1; + } + + to { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: rotate3d(0, 0, 1, -45deg); + transform: rotate3d(0, 0, 1, -45deg); + opacity: 0; + } +} + +@keyframes rotateOutDownRight { + from { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + opacity: 1; + } + + to { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: rotate3d(0, 0, 1, -45deg); + transform: rotate3d(0, 0, 1, -45deg); + opacity: 0; + } +} + +.rotateOutDownRight { + -webkit-animation-name: rotateOutDownRight; + animation-name: rotateOutDownRight; +} + +@-webkit-keyframes rotateOutUpLeft { + from { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + opacity: 1; + } + + to { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: rotate3d(0, 0, 1, -45deg); + transform: rotate3d(0, 0, 1, -45deg); + opacity: 0; + } +} + +@keyframes rotateOutUpLeft { + from { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + opacity: 1; + } + + to { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: rotate3d(0, 0, 1, -45deg); + transform: rotate3d(0, 0, 1, -45deg); + opacity: 0; + } +} + +.rotateOutUpLeft { + -webkit-animation-name: rotateOutUpLeft; + animation-name: rotateOutUpLeft; +} + +@-webkit-keyframes rotateOutUpRight { + from { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + opacity: 1; + } + + to { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: rotate3d(0, 0, 1, 90deg); + transform: rotate3d(0, 0, 1, 90deg); + opacity: 0; + } +} + +@keyframes rotateOutUpRight { + from { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + opacity: 1; + } + + to { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: rotate3d(0, 0, 1, 90deg); + transform: rotate3d(0, 0, 1, 90deg); + opacity: 0; + } +} + +.rotateOutUpRight { + -webkit-animation-name: rotateOutUpRight; + animation-name: rotateOutUpRight; +} + +@-webkit-keyframes hinge { + 0% { + -webkit-transform-origin: top left; + transform-origin: top left; + -webkit-animation-timing-function: ease-in-out; + animation-timing-function: ease-in-out; + } + + 20%, 60% { + -webkit-transform: rotate3d(0, 0, 1, 80deg); + transform: rotate3d(0, 0, 1, 80deg); + -webkit-transform-origin: top left; + transform-origin: top left; + -webkit-animation-timing-function: ease-in-out; + animation-timing-function: ease-in-out; + } + + 40%, 80% { + -webkit-transform: rotate3d(0, 0, 1, 60deg); + transform: rotate3d(0, 0, 1, 60deg); + -webkit-transform-origin: top left; + transform-origin: top left; + -webkit-animation-timing-function: ease-in-out; + animation-timing-function: ease-in-out; + opacity: 1; + } + + to { + -webkit-transform: translate3d(0, 700px, 0); + transform: translate3d(0, 700px, 0); + opacity: 0; + } +} + +@keyframes hinge { + 0% { + -webkit-transform-origin: top left; + transform-origin: top left; + -webkit-animation-timing-function: ease-in-out; + animation-timing-function: ease-in-out; + } + + 20%, 60% { + -webkit-transform: rotate3d(0, 0, 1, 80deg); + transform: rotate3d(0, 0, 1, 80deg); + -webkit-transform-origin: top left; + transform-origin: top left; + -webkit-animation-timing-function: ease-in-out; + animation-timing-function: ease-in-out; + } + + 40%, 80% { + -webkit-transform: rotate3d(0, 0, 1, 60deg); + transform: rotate3d(0, 0, 1, 60deg); + -webkit-transform-origin: top left; + transform-origin: top left; + -webkit-animation-timing-function: ease-in-out; + animation-timing-function: ease-in-out; + opacity: 1; + } + + to { + -webkit-transform: translate3d(0, 700px, 0); + transform: translate3d(0, 700px, 0); + opacity: 0; + } +} + +.hinge { + -webkit-animation-name: hinge; + animation-name: hinge; +} + +/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */ + +@-webkit-keyframes rollIn { + from { + opacity: 0; + -webkit-transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg); + transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +@keyframes rollIn { + from { + opacity: 0; + -webkit-transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg); + transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +.rollIn { + -webkit-animation-name: rollIn; + animation-name: rollIn; +} + +/* originally authored by Nick Pettit - https://github.com/nickpettit/glide */ + +@-webkit-keyframes rollOut { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(100%, 0, 0) rotate3d(0, 0, 1, 120deg); + transform: translate3d(100%, 0, 0) rotate3d(0, 0, 1, 120deg); + } +} + +@keyframes rollOut { + from { + opacity: 1; + } + + to { + opacity: 0; + -webkit-transform: translate3d(100%, 0, 0) rotate3d(0, 0, 1, 120deg); + transform: translate3d(100%, 0, 0) rotate3d(0, 0, 1, 120deg); + } +} + +.rollOut { + -webkit-animation-name: rollOut; + animation-name: rollOut; +} + +@-webkit-keyframes zoomIn { + from { + opacity: 0; + -webkit-transform: scale3d(.3, .3, .3); + transform: scale3d(.3, .3, .3); + } + + 50% { + opacity: 1; + } +} + +@keyframes zoomIn { + from { + opacity: 0; + -webkit-transform: scale3d(.3, .3, .3); + transform: scale3d(.3, .3, .3); + } + + 50% { + opacity: 1; + } +} + +.zoomIn { + -webkit-animation-name: zoomIn; + animation-name: zoomIn; +} + +@-webkit-keyframes zoomInDown { + from { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(0, -1000px, 0); + transform: scale3d(.1, .1, .1) translate3d(0, -1000px, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + 60% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0); + transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0); + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +@keyframes zoomInDown { + from { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(0, -1000px, 0); + transform: scale3d(.1, .1, .1) translate3d(0, -1000px, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + 60% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0); + transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0); + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +.zoomInDown { + -webkit-animation-name: zoomInDown; + animation-name: zoomInDown; +} + +@-webkit-keyframes zoomInLeft { + from { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(-1000px, 0, 0); + transform: scale3d(.1, .1, .1) translate3d(-1000px, 0, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + 60% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(10px, 0, 0); + transform: scale3d(.475, .475, .475) translate3d(10px, 0, 0); + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +@keyframes zoomInLeft { + from { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(-1000px, 0, 0); + transform: scale3d(.1, .1, .1) translate3d(-1000px, 0, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + 60% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(10px, 0, 0); + transform: scale3d(.475, .475, .475) translate3d(10px, 0, 0); + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +.zoomInLeft { + -webkit-animation-name: zoomInLeft; + animation-name: zoomInLeft; +} + +@-webkit-keyframes zoomInRight { + from { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(1000px, 0, 0); + transform: scale3d(.1, .1, .1) translate3d(1000px, 0, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + 60% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(-10px, 0, 0); + transform: scale3d(.475, .475, .475) translate3d(-10px, 0, 0); + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +@keyframes zoomInRight { + from { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(1000px, 0, 0); + transform: scale3d(.1, .1, .1) translate3d(1000px, 0, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + 60% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(-10px, 0, 0); + transform: scale3d(.475, .475, .475) translate3d(-10px, 0, 0); + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +.zoomInRight { + -webkit-animation-name: zoomInRight; + animation-name: zoomInRight; +} + +@-webkit-keyframes zoomInUp { + from { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0); + transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + 60% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0); + transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0); + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +@keyframes zoomInUp { + from { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0); + transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + 60% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0); + transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0); + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +.zoomInUp { + -webkit-animation-name: zoomInUp; + animation-name: zoomInUp; +} + +@-webkit-keyframes zoomOut { + from { + opacity: 1; + } + + 50% { + opacity: 0; + -webkit-transform: scale3d(.3, .3, .3); + transform: scale3d(.3, .3, .3); + } + + to { + opacity: 0; + } +} + +@keyframes zoomOut { + from { + opacity: 1; + } + + 50% { + opacity: 0; + -webkit-transform: scale3d(.3, .3, .3); + transform: scale3d(.3, .3, .3); + } + + to { + opacity: 0; + } +} + +.zoomOut { + -webkit-animation-name: zoomOut; + animation-name: zoomOut; +} + +@-webkit-keyframes zoomOutDown { + 40% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0); + transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + to { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(0, 2000px, 0); + transform: scale3d(.1, .1, .1) translate3d(0, 2000px, 0); + -webkit-transform-origin: center bottom; + transform-origin: center bottom; + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +@keyframes zoomOutDown { + 40% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0); + transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + to { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(0, 2000px, 0); + transform: scale3d(.1, .1, .1) translate3d(0, 2000px, 0); + -webkit-transform-origin: center bottom; + transform-origin: center bottom; + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +.zoomOutDown { + -webkit-animation-name: zoomOutDown; + animation-name: zoomOutDown; +} + +@-webkit-keyframes zoomOutLeft { + 40% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(42px, 0, 0); + transform: scale3d(.475, .475, .475) translate3d(42px, 0, 0); + } + + to { + opacity: 0; + -webkit-transform: scale(.1) translate3d(-2000px, 0, 0); + transform: scale(.1) translate3d(-2000px, 0, 0); + -webkit-transform-origin: left center; + transform-origin: left center; + } +} + +@keyframes zoomOutLeft { + 40% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(42px, 0, 0); + transform: scale3d(.475, .475, .475) translate3d(42px, 0, 0); + } + + to { + opacity: 0; + -webkit-transform: scale(.1) translate3d(-2000px, 0, 0); + transform: scale(.1) translate3d(-2000px, 0, 0); + -webkit-transform-origin: left center; + transform-origin: left center; + } +} + +.zoomOutLeft { + -webkit-animation-name: zoomOutLeft; + animation-name: zoomOutLeft; +} + +@-webkit-keyframes zoomOutRight { + 40% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(-42px, 0, 0); + transform: scale3d(.475, .475, .475) translate3d(-42px, 0, 0); + } + + to { + opacity: 0; + -webkit-transform: scale(.1) translate3d(2000px, 0, 0); + transform: scale(.1) translate3d(2000px, 0, 0); + -webkit-transform-origin: right center; + transform-origin: right center; + } +} + +@keyframes zoomOutRight { + 40% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(-42px, 0, 0); + transform: scale3d(.475, .475, .475) translate3d(-42px, 0, 0); + } + + to { + opacity: 0; + -webkit-transform: scale(.1) translate3d(2000px, 0, 0); + transform: scale(.1) translate3d(2000px, 0, 0); + -webkit-transform-origin: right center; + transform-origin: right center; + } +} + +.zoomOutRight { + -webkit-animation-name: zoomOutRight; + animation-name: zoomOutRight; +} + +@-webkit-keyframes zoomOutUp { + 40% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0); + transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + to { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(0, -2000px, 0); + transform: scale3d(.1, .1, .1) translate3d(0, -2000px, 0); + -webkit-transform-origin: center bottom; + transform-origin: center bottom; + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +@keyframes zoomOutUp { + 40% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0); + transform: scale3d(.475, .475, .475) translate3d(0, 60px, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + to { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(0, -2000px, 0); + transform: scale3d(.1, .1, .1) translate3d(0, -2000px, 0); + -webkit-transform-origin: center bottom; + transform-origin: center bottom; + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +.zoomOutUp { + -webkit-animation-name: zoomOutUp; + animation-name: zoomOutUp; +} + +@-webkit-keyframes slideInDown { + from { + -webkit-transform: translate3d(0, -100%, 0); + transform: translate3d(0, -100%, 0); + visibility: visible; + } + + to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +@keyframes slideInDown { + from { + -webkit-transform: translate3d(0, -100%, 0); + transform: translate3d(0, -100%, 0); + visibility: visible; + } + + to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.slideInDown { + -webkit-animation-name: slideInDown; + animation-name: slideInDown; +} + +@-webkit-keyframes slideInLeft { + from { + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + visibility: visible; + } + + to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +@keyframes slideInLeft { + from { + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + visibility: visible; + } + + to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.slideInLeft { + -webkit-animation-name: slideInLeft; + animation-name: slideInLeft; +} + +@-webkit-keyframes slideInRight { + from { + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + visibility: visible; + } + + to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +@keyframes slideInRight { + from { + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + visibility: visible; + } + + to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.slideInRight { + -webkit-animation-name: slideInRight; + animation-name: slideInRight; +} + +@-webkit-keyframes slideInUp { + from { + -webkit-transform: translate3d(0, 100%, 0); + transform: translate3d(0, 100%, 0); + visibility: visible; + } + + to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +@keyframes slideInUp { + from { + -webkit-transform: translate3d(0, 100%, 0); + transform: translate3d(0, 100%, 0); + visibility: visible; + } + + to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.slideInUp { + -webkit-animation-name: slideInUp; + animation-name: slideInUp; +} + +@-webkit-keyframes slideOutDown { + from { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } + + to { + visibility: hidden; + -webkit-transform: translate3d(0, 100%, 0); + transform: translate3d(0, 100%, 0); + } +} + +@keyframes slideOutDown { + from { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } + + to { + visibility: hidden; + -webkit-transform: translate3d(0, 100%, 0); + transform: translate3d(0, 100%, 0); + } +} + +.slideOutDown { + -webkit-animation-name: slideOutDown; + animation-name: slideOutDown; +} + +@-webkit-keyframes slideOutLeft { + from { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } + + to { + visibility: hidden; + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } +} + +@keyframes slideOutLeft { + from { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } + + to { + visibility: hidden; + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } +} + +.slideOutLeft { + -webkit-animation-name: slideOutLeft; + animation-name: slideOutLeft; +} + +@-webkit-keyframes slideOutRight { + from { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } + + to { + visibility: hidden; + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } +} + +@keyframes slideOutRight { + from { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } + + to { + visibility: hidden; + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } +} + +.slideOutRight { + -webkit-animation-name: slideOutRight; + animation-name: slideOutRight; +} + +@-webkit-keyframes slideOutUp { + from { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } + + to { + visibility: hidden; + -webkit-transform: translate3d(0, -100%, 0); + transform: translate3d(0, -100%, 0); + } +} + +@keyframes slideOutUp { + from { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } + + to { + visibility: hidden; + -webkit-transform: translate3d(0, -100%, 0); + transform: translate3d(0, -100%, 0); + } +} + +.slideOutUp { + -webkit-animation-name: slideOutUp; + animation-name: slideOutUp; +} + +@-webkit-keyframes leftRight { + from { + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + +@keyframes leftRight { + from { + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} +@-webkit-keyframes avia_appear { + 0% { -webkit-transform:scale(0.5); opacity: 0.1; } + 100% { -webkit-transform:scale(1); opacity: 1; } +} +@-moz-keyframes avia_appear { + 0% { -moz-transform:scale(0.5); opacity: 0.1; } + 100% { -moz-transform:scale(1);opacity: 1; } +} +@keyframes avia_appear { + 0% { transform:scale(0.5); opacity: 0.1; } + 100% { transform:scale(1); opacity: 1; } +} + +.centerTotop { + -webkit-animation-name: avia_appear; + animation-name: avia_appear; +} \ No newline at end of file diff --git a/css/bootstrap.min.css b/css/bootstrap.min.css new file mode 100755 index 0000000..76836cf --- /dev/null +++ b/css/bootstrap.min.css @@ -0,0 +1,7031 @@ +/*! + * Bootstrap v3.3.2 (http://getbootstrap.com) + * Copyright 2011-2015 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + *//*! normalize.css v3.0.2 | MIT License | git.io/normalize */html { + font-family: sans-serif; + -webkit-text-size-adjust: 100%; + -ms-text-size-adjust: 100%; +} + +body { + margin: 0; +} + +article, aside, details, figcaption, figure, footer, header, hgroup, main, menu, nav, section, summary { + display: block; +} + +audio, canvas, progress, video { + display: inline-block; + vertical-align: baseline; +} + +audio:not([controls]) { + display: none; + height: 0; +} + +[hidden], template { + display: none; +} + +a { + background-color: transparent; +} + +a:active, a:hover { + outline: 0; +} + +abbr[title] { + border-bottom: 1px dotted; +} + +b, strong { + font-weight: 700; +} + +dfn { + font-style: italic; +} + +h1 { + margin: .67em 0; + font-size: 2em; +} + +mark { + color: #000; + background: #ff0; +} + +small { + font-size: 80%; +} + +sub, sup { + position: relative; + font-size: 75%; + line-height: 0; + vertical-align: baseline; +} + +sup { + top: -.5em; +} + +sub { + bottom: -.25em; +} + +img { + border: 0; +} + +svg:not(:root) { + overflow: hidden; +} + +figure { + margin: 1em 40px; +} + +hr { + height: 0; + -webkit-box-sizing: content-box; + -moz-box-sizing: content-box; + box-sizing: content-box; +} + +pre { + overflow: auto; +} + +code, kbd, pre, samp { + font-family: monospace, monospace; + font-size: 1em; +} + +button, input, optgroup, select, textarea { + margin: 0; + font: inherit; + color: inherit; +} + +button { + overflow: visible; +} + +button, select { + text-transform: none; +} + +button, html input[type=button], input[type=reset], input[type=submit] { + -webkit-appearance: button; + cursor: pointer; +} + +button[disabled], html input[disabled] { + cursor: default; +} + +button::-moz-focus-inner, input::-moz-focus-inner { + padding: 0; + border: 0; +} + +input { + line-height: normal; +} + +input[type=checkbox], input[type=radio] { + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; + padding: 0; +} + +input[type=number]::-webkit-inner-spin-button, input[type=number]::-webkit-outer-spin-button { + height: auto; +} + +input[type=search] { + -webkit-box-sizing: content-box; + -moz-box-sizing: content-box; + box-sizing: content-box; + -webkit-appearance: textfield; +} + +input[type=search]::-webkit-search-cancel-button, input[type=search]::-webkit-search-decoration { + -webkit-appearance: none; +} + +fieldset { + padding: .35em .625em .75em; + margin: 0 2px; + border: 1px solid silver; +} + +legend { + padding: 0; + border: 0; +} + +textarea { + overflow: auto; +} + +optgroup { + font-weight: 700; +} + +table { + border-spacing: 0; + border-collapse: collapse; +} + +td, th { + padding: 0; +}/*! Source: https://github.com/h5bp/html5-boilerplate/blob/master/src/css/main.css */ +@media print { + *, :after, :before { + color: #000!important; + text-shadow: none!important; + background: 0 0!important; + -webkit-box-shadow: none!important; + box-shadow: none!important; + } + + a, a:visited { + text-decoration: underline; + } + + a[href]:after { + content: " (" attr(href) ")"; + } + + abbr[title]:after { + content: " (" attr(title) ")"; + } + + a[href^="javascript:"]:after, a[href^="#"]:after { + content: ""; + } + + blockquote, pre { + border: 1px solid #999; + page-break-inside: avoid; + } + + thead { + display: table-header-group; + } + + img, tr { + page-break-inside: avoid; + } + + img { + max-width: 100%!important; + } + + h2, h3, p { + orphans: 3; + widows: 3; + } + + h2, h3 { + page-break-after: avoid; + } + + select { + background: #fff!important; + } + + .navbar { + display: none; + } + + .btn>.caret, .dropup>.btn>.caret { + border-top-color: #000!important; + } + + .label { + border: 1px solid #000; + } + + .table { + border-collapse: collapse!important; + } + + .table td, .table th { + background-color: #fff!important; + } + + .table-bordered td, .table-bordered th { + border: 1px solid #ddd!important; + } +} + +@font-face { + font-family: 'Glyphicons Halflings'; + src: url(../fonts/glyphicons-halflings-regular.eot); + src: url(../fonts/glyphicons-halflings-regular.eot?#iefix) format('embedded-opentype'), url(../fonts/glyphicons-halflings-regular.woff2) format('woff2'), url(../fonts/glyphicons-halflings-regular.woff) format('woff'), url(../fonts/glyphicons-halflings-regular.ttf) format('truetype'), url(../fonts/glyphicons-halflings-regular.svg#glyphicons_halflingsregular) format('svg'); +} + +.glyphicon { + position: relative; + top: 1px; + display: inline-block; + font-family: 'Glyphicons Halflings'; + font-style: normal; + font-weight: 400; + line-height: 1; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} + +.glyphicon-asterisk:before { + content: "\2a"; +} + +.glyphicon-plus:before { + content: "\2b"; +} + +.glyphicon-eur:before, .glyphicon-euro:before { + content: "\20ac"; +} + +.glyphicon-minus:before { + content: "\2212"; +} + +.glyphicon-cloud:before { + content: "\2601"; +} + +.glyphicon-envelope:before { + content: "\2709"; +} + +.glyphicon-pencil:before { + content: "\270f"; +} + +.glyphicon-glass:before { + content: "\e001"; +} + +.glyphicon-music:before { + content: "\e002"; +} + +.glyphicon-search:before { + content: "\e003"; +} + +.glyphicon-heart:before { + content: "\e005"; +} + +.glyphicon-star:before { + content: "\e006"; +} + +.glyphicon-star-empty:before { + content: "\e007"; +} + +.glyphicon-user:before { + content: "\e008"; +} + +.glyphicon-film:before { + content: "\e009"; +} + +.glyphicon-th-large:before { + content: "\e010"; +} + +.glyphicon-th:before { + content: "\e011"; +} + +.glyphicon-th-list:before { + content: "\e012"; +} + +.glyphicon-ok:before { + content: "\e013"; +} + +.glyphicon-remove:before { + content: "\e014"; +} + +.glyphicon-zoom-in:before { + content: "\e015"; +} + +.glyphicon-zoom-out:before { + content: "\e016"; +} + +.glyphicon-off:before { + content: "\e017"; +} + +.glyphicon-signal:before { + content: "\e018"; +} + +.glyphicon-cog:before { + content: "\e019"; +} + +.glyphicon-trash:before { + content: "\e020"; +} + +.glyphicon-home:before { + content: "\e021"; +} + +.glyphicon-file:before { + content: "\e022"; +} + +.glyphicon-time:before { + content: "\e023"; +} + +.glyphicon-road:before { + content: "\e024"; +} + +.glyphicon-download-alt:before { + content: "\e025"; +} + +.glyphicon-download:before { + content: "\e026"; +} + +.glyphicon-upload:before { + content: "\e027"; +} + +.glyphicon-inbox:before { + content: "\e028"; +} + +.glyphicon-play-circle:before { + content: "\e029"; +} + +.glyphicon-repeat:before { + content: "\e030"; +} + +.glyphicon-refresh:before { + content: "\e031"; +} + +.glyphicon-list-alt:before { + content: "\e032"; +} + +.glyphicon-lock:before { + content: "\e033"; +} + +.glyphicon-flag:before { + content: "\e034"; +} + +.glyphicon-headphones:before { + content: "\e035"; +} + +.glyphicon-volume-off:before { + content: "\e036"; +} + +.glyphicon-volume-down:before { + content: "\e037"; +} + +.glyphicon-volume-up:before { + content: "\e038"; +} + +.glyphicon-qrcode:before { + content: "\e039"; +} + +.glyphicon-barcode:before { + content: "\e040"; +} + +.glyphicon-tag:before { + content: "\e041"; +} + +.glyphicon-tags:before { + content: "\e042"; +} + +.glyphicon-book:before { + content: "\e043"; +} + +.glyphicon-bookmark:before { + content: "\e044"; +} + +.glyphicon-print:before { + content: "\e045"; +} + +.glyphicon-camera:before { + content: "\e046"; +} + +.glyphicon-font:before { + content: "\e047"; +} + +.glyphicon-bold:before { + content: "\e048"; +} + +.glyphicon-italic:before { + content: "\e049"; +} + +.glyphicon-text-height:before { + content: "\e050"; +} + +.glyphicon-text-width:before { + content: "\e051"; +} + +.glyphicon-align-left:before { + content: "\e052"; +} + +.glyphicon-align-center:before { + content: "\e053"; +} + +.glyphicon-align-right:before { + content: "\e054"; +} + +.glyphicon-align-justify:before { + content: "\e055"; +} + +.glyphicon-list:before { + content: "\e056"; +} + +.glyphicon-indent-left:before { + content: "\e057"; +} + +.glyphicon-indent-right:before { + content: "\e058"; +} + +.glyphicon-facetime-video:before { + content: "\e059"; +} + +.glyphicon-picture:before { + content: "\e060"; +} + +.glyphicon-map-marker:before { + content: "\e062"; +} + +.glyphicon-adjust:before { + content: "\e063"; +} + +.glyphicon-tint:before { + content: "\e064"; +} + +.glyphicon-edit:before { + content: "\e065"; +} + +.glyphicon-share:before { + content: "\e066"; +} + +.glyphicon-check:before { + content: "\e067"; +} + +.glyphicon-move:before { + content: "\e068"; +} + +.glyphicon-step-backward:before { + content: "\e069"; +} + +.glyphicon-fast-backward:before { + content: "\e070"; +} + +.glyphicon-backward:before { + content: "\e071"; +} + +.glyphicon-play:before { + content: "\e072"; +} + +.glyphicon-pause:before { + content: "\e073"; +} + +.glyphicon-stop:before { + content: "\e074"; +} + +.glyphicon-forward:before { + content: "\e075"; +} + +.glyphicon-fast-forward:before { + content: "\e076"; +} + +.glyphicon-step-forward:before { + content: "\e077"; +} + +.glyphicon-eject:before { + content: "\e078"; +} + +.glyphicon-chevron-left:before { + content: "\e079"; +} + +.glyphicon-chevron-right:before { + content: "\e080"; +} + +.glyphicon-plus-sign:before { + content: "\e081"; +} + +.glyphicon-minus-sign:before { + content: "\e082"; +} + +.glyphicon-remove-sign:before { + content: "\e083"; +} + +.glyphicon-ok-sign:before { + content: "\e084"; +} + +.glyphicon-question-sign:before { + content: "\e085"; +} + +.glyphicon-info-sign:before { + content: "\e086"; +} + +.glyphicon-screenshot:before { + content: "\e087"; +} + +.glyphicon-remove-circle:before { + content: "\e088"; +} + +.glyphicon-ok-circle:before { + content: "\e089"; +} + +.glyphicon-ban-circle:before { + content: "\e090"; +} + +.glyphicon-arrow-left:before { + content: "\e091"; +} + +.glyphicon-arrow-right:before { + content: "\e092"; +} + +.glyphicon-arrow-up:before { + content: "\e093"; +} + +.glyphicon-arrow-down:before { + content: "\e094"; +} + +.glyphicon-share-alt:before { + content: "\e095"; +} + +.glyphicon-resize-full:before { + content: "\e096"; +} + +.glyphicon-resize-small:before { + content: "\e097"; +} + +.glyphicon-exclamation-sign:before { + content: "\e101"; +} + +.glyphicon-gift:before { + content: "\e102"; +} + +.glyphicon-leaf:before { + content: "\e103"; +} + +.glyphicon-fire:before { + content: "\e104"; +} + +.glyphicon-eye-open:before { + content: "\e105"; +} + +.glyphicon-eye-close:before { + content: "\e106"; +} + +.glyphicon-warning-sign:before { + content: "\e107"; +} + +.glyphicon-plane:before { + content: "\e108"; +} + +.glyphicon-calendar:before { + content: "\e109"; +} + +.glyphicon-random:before { + content: "\e110"; +} + +.glyphicon-comment:before { + content: "\e111"; +} + +.glyphicon-magnet:before { + content: "\e112"; +} + +.glyphicon-chevron-up:before { + content: "\e113"; +} + +.glyphicon-chevron-down:before { + content: "\e114"; +} + +.glyphicon-retweet:before { + content: "\e115"; +} + +.glyphicon-shopping-cart:before { + content: "\e116"; +} + +.glyphicon-folder-close:before { + content: "\e117"; +} + +.glyphicon-folder-open:before { + content: "\e118"; +} + +.glyphicon-resize-vertical:before { + content: "\e119"; +} + +.glyphicon-resize-horizontal:before { + content: "\e120"; +} + +.glyphicon-hdd:before { + content: "\e121"; +} + +.glyphicon-bullhorn:before { + content: "\e122"; +} + +.glyphicon-bell:before { + content: "\e123"; +} + +.glyphicon-certificate:before { + content: "\e124"; +} + +.glyphicon-thumbs-up:before { + content: "\e125"; +} + +.glyphicon-thumbs-down:before { + content: "\e126"; +} + +.glyphicon-hand-right:before { + content: "\e127"; +} + +.glyphicon-hand-left:before { + content: "\e128"; +} + +.glyphicon-hand-up:before { + content: "\e129"; +} + +.glyphicon-hand-down:before { + content: "\e130"; +} + +.glyphicon-circle-arrow-right:before { + content: "\e131"; +} + +.glyphicon-circle-arrow-left:before { + content: "\e132"; +} + +.glyphicon-circle-arrow-up:before { + content: "\e133"; +} + +.glyphicon-circle-arrow-down:before { + content: "\e134"; +} + +.glyphicon-globe:before { + content: "\e135"; +} + +.glyphicon-wrench:before { + content: "\e136"; +} + +.glyphicon-tasks:before { + content: "\e137"; +} + +.glyphicon-filter:before { + content: "\e138"; +} + +.glyphicon-briefcase:before { + content: "\e139"; +} + +.glyphicon-fullscreen:before { + content: "\e140"; +} + +.glyphicon-dashboard:before { + content: "\e141"; +} + +.glyphicon-paperclip:before { + content: "\e142"; +} + +.glyphicon-heart-empty:before { + content: "\e143"; +} + +.glyphicon-link:before { + content: "\e144"; +} + +.glyphicon-phone:before { + content: "\e145"; +} + +.glyphicon-pushpin:before { + content: "\e146"; +} + +.glyphicon-usd:before { + content: "\e148"; +} + +.glyphicon-gbp:before { + content: "\e149"; +} + +.glyphicon-sort:before { + content: "\e150"; +} + +.glyphicon-sort-by-alphabet:before { + content: "\e151"; +} + +.glyphicon-sort-by-alphabet-alt:before { + content: "\e152"; +} + +.glyphicon-sort-by-order:before { + content: "\e153"; +} + +.glyphicon-sort-by-order-alt:before { + content: "\e154"; +} + +.glyphicon-sort-by-attributes:before { + content: "\e155"; +} + +.glyphicon-sort-by-attributes-alt:before { + content: "\e156"; +} + +.glyphicon-unchecked:before { + content: "\e157"; +} + +.glyphicon-expand:before { + content: "\e158"; +} + +.glyphicon-collapse-down:before { + content: "\e159"; +} + +.glyphicon-collapse-up:before { + content: "\e160"; +} + +.glyphicon-log-in:before { + content: "\e161"; +} + +.glyphicon-flash:before { + content: "\e162"; +} + +.glyphicon-log-out:before { + content: "\e163"; +} + +.glyphicon-new-window:before { + content: "\e164"; +} + +.glyphicon-record:before { + content: "\e165"; +} + +.glyphicon-save:before { + content: "\e166"; +} + +.glyphicon-open:before { + content: "\e167"; +} + +.glyphicon-saved:before { + content: "\e168"; +} + +.glyphicon-import:before { + content: "\e169"; +} + +.glyphicon-export:before { + content: "\e170"; +} + +.glyphicon-send:before { + content: "\e171"; +} + +.glyphicon-floppy-disk:before { + content: "\e172"; +} + +.glyphicon-floppy-saved:before { + content: "\e173"; +} + +.glyphicon-floppy-remove:before { + content: "\e174"; +} + +.glyphicon-floppy-save:before { + content: "\e175"; +} + +.glyphicon-floppy-open:before { + content: "\e176"; +} + +.glyphicon-credit-card:before { + content: "\e177"; +} + +.glyphicon-transfer:before { + content: "\e178"; +} + +.glyphicon-cutlery:before { + content: "\e179"; +} + +.glyphicon-header:before { + content: "\e180"; +} + +.glyphicon-compressed:before { + content: "\e181"; +} + +.glyphicon-earphone:before { + content: "\e182"; +} + +.glyphicon-phone-alt:before { + content: "\e183"; +} + +.glyphicon-tower:before { + content: "\e184"; +} + +.glyphicon-stats:before { + content: "\e185"; +} + +.glyphicon-sd-video:before { + content: "\e186"; +} + +.glyphicon-hd-video:before { + content: "\e187"; +} + +.glyphicon-subtitles:before { + content: "\e188"; +} + +.glyphicon-sound-stereo:before { + content: "\e189"; +} + +.glyphicon-sound-dolby:before { + content: "\e190"; +} + +.glyphicon-sound-5-1:before { + content: "\e191"; +} + +.glyphicon-sound-6-1:before { + content: "\e192"; +} + +.glyphicon-sound-7-1:before { + content: "\e193"; +} + +.glyphicon-copyright-mark:before { + content: "\e194"; +} + +.glyphicon-registration-mark:before { + content: "\e195"; +} + +.glyphicon-cloud-download:before { + content: "\e197"; +} + +.glyphicon-cloud-upload:before { + content: "\e198"; +} + +.glyphicon-tree-conifer:before { + content: "\e199"; +} + +.glyphicon-tree-deciduous:before { + content: "\e200"; +} + +.glyphicon-cd:before { + content: "\e201"; +} + +.glyphicon-save-file:before { + content: "\e202"; +} + +.glyphicon-open-file:before { + content: "\e203"; +} + +.glyphicon-level-up:before { + content: "\e204"; +} + +.glyphicon-copy:before { + content: "\e205"; +} + +.glyphicon-paste:before { + content: "\e206"; +} + +.glyphicon-alert:before { + content: "\e209"; +} + +.glyphicon-equalizer:before { + content: "\e210"; +} + +.glyphicon-king:before { + content: "\e211"; +} + +.glyphicon-queen:before { + content: "\e212"; +} + +.glyphicon-pawn:before { + content: "\e213"; +} + +.glyphicon-bishop:before { + content: "\e214"; +} + +.glyphicon-knight:before { + content: "\e215"; +} + +.glyphicon-baby-formula:before { + content: "\e216"; +} + +.glyphicon-tent:before { + content: "\26fa"; +} + +.glyphicon-blackboard:before { + content: "\e218"; +} + +.glyphicon-bed:before { + content: "\e219"; +} + +.glyphicon-apple:before { + content: "\f8ff"; +} + +.glyphicon-erase:before { + content: "\e221"; +} + +.glyphicon-hourglass:before { + content: "\231b"; +} + +.glyphicon-lamp:before { + content: "\e223"; +} + +.glyphicon-duplicate:before { + content: "\e224"; +} + +.glyphicon-piggy-bank:before { + content: "\e225"; +} + +.glyphicon-scissors:before { + content: "\e226"; +} + +.glyphicon-bitcoin:before { + content: "\e227"; +} + +.glyphicon-yen:before { + content: "\00a5"; +} + +.glyphicon-ruble:before { + content: "\20bd"; +} + +.glyphicon-scale:before { + content: "\e230"; +} + +.glyphicon-ice-lolly:before { + content: "\e231"; +} + +.glyphicon-ice-lolly-tasted:before { + content: "\e232"; +} + +.glyphicon-education:before { + content: "\e233"; +} + +.glyphicon-option-horizontal:before { + content: "\e234"; +} + +.glyphicon-option-vertical:before { + content: "\e235"; +} + +.glyphicon-menu-hamburger:before { + content: "\e236"; +} + +.glyphicon-modal-window:before { + content: "\e237"; +} + +.glyphicon-oil:before { + content: "\e238"; +} + +.glyphicon-grain:before { + content: "\e239"; +} + +.glyphicon-sunglasses:before { + content: "\e240"; +} + +.glyphicon-text-size:before { + content: "\e241"; +} + +.glyphicon-text-color:before { + content: "\e242"; +} + +.glyphicon-text-background:before { + content: "\e243"; +} + +.glyphicon-object-align-top:before { + content: "\e244"; +} + +.glyphicon-object-align-bottom:before { + content: "\e245"; +} + +.glyphicon-object-align-horizontal:before { + content: "\e246"; +} + +.glyphicon-object-align-left:before { + content: "\e247"; +} + +.glyphicon-object-align-vertical:before { + content: "\e248"; +} + +.glyphicon-object-align-right:before { + content: "\e249"; +} + +.glyphicon-triangle-right:before { + content: "\e250"; +} + +.glyphicon-triangle-left:before { + content: "\e251"; +} + +.glyphicon-triangle-bottom:before { + content: "\e252"; +} + +.glyphicon-triangle-top:before { + content: "\e253"; +} + +.glyphicon-console:before { + content: "\e254"; +} + +.glyphicon-superscript:before { + content: "\e255"; +} + +.glyphicon-subscript:before { + content: "\e256"; +} + +.glyphicon-menu-left:before { + content: "\e257"; +} + +.glyphicon-menu-right:before { + content: "\e258"; +} + +.glyphicon-menu-down:before { + content: "\e259"; +} + +.glyphicon-menu-up:before { + content: "\e260"; +} + +* { + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} + +:after, :before { + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} + +html { + font-size: 10px; + -webkit-tap-highlight-color: rgba(0,0,0,0); +} + +body { + font-family: 'robotoregular'; + font-size: 16px; + line-height: 18px; + color: #333333; + background-color: #fff; +} + +button, input, select, textarea { + font-family: inherit; + font-size: inherit; + line-height: inherit; +} + +a { + color: #337ab7; + text-decoration: none; +} + +a:focus, a:hover { + color: #23527c; + text-decoration: none; +} + +a:focus { + outline: none; +} + +figure { + margin: 0; +} + +img { + vertical-align: middle; +} + +.carousel-inner>.item>a>img, .carousel-inner>.item>img, .img-responsive, .thumbnail a>img, .thumbnail>img { + display: block; + max-width: 100%; + height: auto; +} + +.img-rounded { + border-radius: 6px; +} + +.img-thumbnail { + display: inline-block; + max-width: 100%; + height: auto; + padding: 4px; + line-height: 1.42857143; + background-color: #fff; + border: 1px solid #ddd; + border-radius: 4px; + -webkit-transition: all .2s ease-in-out; + -o-transition: all .2s ease-in-out; + transition: all .2s ease-in-out; +} + +.img-circle { + border-radius: 50%; +} + +hr { + margin-top: 20px; + margin-bottom: 20px; + border: 0; + border-top: 1px solid #eee; +} + +.sr-only { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + margin: -1px; + overflow: hidden; + clip: rect(0,0,0,0); + border: 0; +} + +.sr-only-focusable:active, .sr-only-focusable:focus { + position: static; + width: auto; + height: auto; + margin: 0; + overflow: visible; + clip: auto; +} + +.h1, .h2, .h3, .h4, .h5, .h6, h1, h2, h3, h4, h5, h6 { + font-family: inherit; + font-weight: 500; + line-height: 1.1; + color: inherit; +} + +.h1 .small, .h1 small, .h2 .small, .h2 small, .h3 .small, .h3 small, .h4 .small, .h4 small, .h5 .small, .h5 small, .h6 .small, .h6 small, h1 .small, h1 small, h2 .small, h2 small, h3 .small, h3 small, h4 .small, h4 small, h5 .small, h5 small, h6 .small, h6 small { + font-weight: 400; + line-height: 1; + color: #777; +} + +.h1, .h2, .h3, h1, h2, h3 { + margin-top: 20px; + margin-bottom: 10px; +} + +.h1 .small, .h1 small, .h2 .small, .h2 small, .h3 .small, .h3 small, h1 .small, h1 small, h2 .small, h2 small, h3 .small, h3 small { + font-size: 65%; +} + +.h4, .h5, .h6, h4, h5, h6 { + margin-top: 10px; + margin-bottom: 10px; +} + +.h4 .small, .h4 small, .h5 .small, .h5 small, .h6 .small, .h6 small, h4 .small, h4 small, h5 .small, h5 small, h6 .small, h6 small { + font-size: 75%; +} + +.h1, h1 { + font-size: 36px; +} + +.h2, h2 { + font-size: 30px; +} + +.h3, h3 { + font-size: 24px; +} + +.h4, h4 { + font-size: 18px; +} + +.h5, h5 { + font-size: 14px; +} + +.h6, h6 { + font-size: 12px; +} + +p { + margin: 0 0 10px; +} + +.lead { + margin-bottom: 20px; + font-size: 16px; + font-weight: 300; + line-height: 1.4; +} + +@media (min-width:768px) { + .lead { + font-size: 21px; + } +} + +.small, small { + font-size: 85%; +} + +.mark, mark { + padding: .2em; + background-color: #fcf8e3; +} + +.text-left { + text-align: left; +} + +.text-right { + text-align: right; +} + +.text-center { + text-align: center; +} + +.text-justify { + text-align: justify; +} + +.text-nowrap { + white-space: nowrap; +} + +.text-lowercase { + text-transform: lowercase; +} + +.text-uppercase { + text-transform: uppercase; +} + +.text-capitalize { + text-transform: capitalize; +} + +.text-muted { + color: #777; +} + +.text-primary { + color: #337ab7; +} + +a.text-primary:hover { + color: #286090; +} + +.text-success { + color: #3c763d; +} + +a.text-success:hover { + color: #2b542c; +} + +.text-info { + color: #31708f; +} + +a.text-info:hover { + color: #245269; +} + +.text-warning { + color: #8a6d3b; +} + +a.text-warning:hover { + color: #66512c; +} + +.text-danger { + color: #a94442; +} + +a.text-danger:hover { + color: #843534; +} + +.bg-primary { + color: #fff; + background-color: #337ab7; +} + +a.bg-primary:hover { + background-color: #286090; +} + +.bg-success { + background-color: #dff0d8; +} + +a.bg-success:hover { + background-color: #c1e2b3; +} + +.bg-info { + background-color: #d9edf7; +} + +a.bg-info:hover { + background-color: #afd9ee; +} + +.bg-warning { + background-color: #fcf8e3; +} + +a.bg-warning:hover { + background-color: #f7ecb5; +} + +.bg-danger { + background-color: #f2dede; +} + +a.bg-danger:hover { + background-color: #e4b9b9; +} + +.page-header { + padding-bottom: 9px; + margin: 40px 0 20px; + border-bottom: 1px solid #eee; +} + +ol, ul { + margin-top: 0; + margin-bottom: 10px; +} + +ol ol, ol ul, ul ol, ul ul { + margin-bottom: 0; +} + +.list-unstyled { + padding-left: 0; + list-style: none; +} + +.list-inline { + padding-left: 0; + margin-left: -5px; + list-style: none; +} + +.list-inline>li { + display: inline-block; + padding-right: 5px; + padding-left: 5px; +} + +dl { + margin-top: 0; + margin-bottom: 20px; +} + +dd, dt { + line-height: 1.42857143; +} + +dt { + font-weight: 700; +} + +dd { + margin-left: 0; +} + +@media (min-width:768px) { + .dl-horizontal dt { + float: left; + width: 160px; + overflow: hidden; + clear: left; + text-align: right; + text-overflow: ellipsis; + white-space: nowrap; + } + + .dl-horizontal dd { + margin-left: 180px; + } +} + +abbr[data-original-title], abbr[title] { + cursor: help; + border-bottom: 1px dotted #777; +} + +.initialism { + font-size: 90%; + text-transform: uppercase; +} + +blockquote { + padding: 10px 20px; + margin: 0 0 20px; + font-size: 17.5px; + border-left: 5px solid #eee; +} + +blockquote ol:last-child, blockquote p:last-child, blockquote ul:last-child { + margin-bottom: 0; +} + +blockquote .small, blockquote footer, blockquote small { + display: block; + font-size: 80%; + line-height: 1.42857143; + color: #777; +} + +blockquote .small:before, blockquote footer:before, blockquote small:before { + content: '\2014 \00A0'; +} + +.blockquote-reverse, blockquote.pull-right { + padding-right: 15px; + padding-left: 0; + text-align: right; + border-right: 5px solid #eee; + border-left: 0; +} + +.blockquote-reverse .small:before, .blockquote-reverse footer:before, .blockquote-reverse small:before, blockquote.pull-right .small:before, blockquote.pull-right footer:before, blockquote.pull-right small:before { + content: ''; +} + +.blockquote-reverse .small:after, .blockquote-reverse footer:after, .blockquote-reverse small:after, blockquote.pull-right .small:after, blockquote.pull-right footer:after, blockquote.pull-right small:after { + content: '\00A0 \2014'; +} + +address { + margin-bottom: 20px; + font-style: normal; + line-height: 1.42857143; +} + +code, kbd, pre, samp { + font-family: Menlo, Monaco, Consolas, "Courier New", monospace; +} + +code { + padding: 2px 4px; + font-size: 90%; + color: #c7254e; + background-color: #f9f2f4; + border-radius: 4px; +} + +kbd { + padding: 2px 4px; + font-size: 90%; + color: #fff; + background-color: #333; + border-radius: 3px; + -webkit-box-shadow: inset 0 -1px 0 rgba(0,0,0,.25); + box-shadow: inset 0 -1px 0 rgba(0,0,0,.25); +} + +kbd kbd { + padding: 0; + font-size: 100%; + font-weight: 700; + -webkit-box-shadow: none; + box-shadow: none; +} + +pre { + display: block; + padding: 9.5px; + margin: 0 0 10px; + font-size: 13px; + line-height: 1.42857143; + color: #333; + word-break: break-all; + word-wrap: break-word; + background-color: #f5f5f5; + border: 1px solid #ccc; + border-radius: 4px; +} + +pre code { + padding: 0; + font-size: inherit; + color: inherit; + white-space: pre-wrap; + background-color: transparent; + border-radius: 0; +} + +.pre-scrollable { + max-height: 340px; + overflow-y: scroll; +} + +.container { + padding-right: 15px; + padding-left: 15px; + margin-right: auto; + margin-left: auto; +} + +@media (min-width:768px) { + .container { + width: 750px; + } +} + +@media (min-width:992px) { + .container { + width: 970px; + } +} + +@media (min-width:1200px) { + .container { + width: 1200px; padding:0; + } +} + +.container-fluid { + padding-right: 15px; + padding-left: 15px; + margin-right: auto; + margin-left: auto; +} + +.row { + margin-right: -15px; + margin-left: -15px; +} + +.col-lg-1, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-md-1, .col-md-10, .col-md-11, .col-md-12, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-sm-1, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-xs-1, .col-xs-10, .col-xs-11, .col-xs-12, .col-xs-2, .col-xs-3, .col-xs-4, .col-xs-5, .col-xs-6, .col-xs-7, .col-xs-8, .col-xs-9 { + position: relative; + min-height: 1px; + padding-right: 15px; + padding-left: 15px; +} + +.col-xs-1, .col-xs-10, .col-xs-11, .col-xs-12, .col-xs-2, .col-xs-3, .col-xs-4, .col-xs-5, .col-xs-6, .col-xs-7, .col-xs-8, .col-xs-9 { + float: left; +} + +.col-xs-12 { + width: 100%; +} + +.col-xs-11 { + width: 91.66666667%; +} + +.col-xs-10 { + width: 83.33333333%; +} + +.col-xs-9 { + width: 75%; +} + +.col-xs-8 { + width: 66.66666667%; +} + +.col-xs-7 { + width: 58.33333333%; +} + +.col-xs-6 { + width: 50%; +} + +.col-xs-5 { + width: 41.66666667%; +} + +.col-xs-4 { + width: 33.33333333%; +} + +.col-xs-3 { + width: 25%; +} + +.col-xs-2 { + width: 16.66666667%; +} + +.col-xs-1 { + width: 8.33333333%; +} + +.col-xs-pull-12 { + right: 100%; +} + +.col-xs-pull-11 { + right: 91.66666667%; +} + +.col-xs-pull-10 { + right: 83.33333333%; +} + +.col-xs-pull-9 { + right: 75%; +} + +.col-xs-pull-8 { + right: 66.66666667%; +} + +.col-xs-pull-7 { + right: 58.33333333%; +} + +.col-xs-pull-6 { + right: 50%; +} + +.col-xs-pull-5 { + right: 41.66666667%; +} + +.col-xs-pull-4 { + right: 33.33333333%; +} + +.col-xs-pull-3 { + right: 25%; +} + +.col-xs-pull-2 { + right: 16.66666667%; +} + +.col-xs-pull-1 { + right: 8.33333333%; +} + +.col-xs-pull-0 { + right: auto; +} + +.col-xs-push-12 { + left: 100%; +} + +.col-xs-push-11 { + left: 91.66666667%; +} + +.col-xs-push-10 { + left: 83.33333333%; +} + +.col-xs-push-9 { + left: 75%; +} + +.col-xs-push-8 { + left: 66.66666667%; +} + +.col-xs-push-7 { + left: 58.33333333%; +} + +.col-xs-push-6 { + left: 50%; +} + +.col-xs-push-5 { + left: 41.66666667%; +} + +.col-xs-push-4 { + left: 33.33333333%; +} + +.col-xs-push-3 { + left: 25%; +} + +.col-xs-push-2 { + left: 16.66666667%; +} + +.col-xs-push-1 { + left: 8.33333333%; +} + +.col-xs-push-0 { + left: auto; +} + +.col-xs-offset-12 { + margin-left: 100%; +} + +.col-xs-offset-11 { + margin-left: 91.66666667%; +} + +.col-xs-offset-10 { + margin-left: 83.33333333%; +} + +.col-xs-offset-9 { + margin-left: 75%; +} + +.col-xs-offset-8 { + margin-left: 66.66666667%; +} + +.col-xs-offset-7 { + margin-left: 58.33333333%; +} + +.col-xs-offset-6 { + margin-left: 50%; +} + +.col-xs-offset-5 { + margin-left: 41.66666667%; +} + +.col-xs-offset-4 { + margin-left: 33.33333333%; +} + +.col-xs-offset-3 { + margin-left: 25%; +} + +.col-xs-offset-2 { + margin-left: 16.66666667%; +} + +.col-xs-offset-1 { + margin-left: 8.33333333%; +} + +.col-xs-offset-0 { + margin-left: 0; +} + +@media (min-width:768px) { + .col-sm-1, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9 { + float: left; + } + + .col-sm-12 { + width: 100%; + } + + .col-sm-11 { + width: 91.66666667%; + } + + .col-sm-10 { + width: 83.33333333%; + } + + .col-sm-9 { + width: 75%; + } + + .col-sm-8 { + width: 66.66666667%; + } + + .col-sm-7 { + width: 58.33333333%; + } + + .col-sm-6 { + width: 50%; + } + + .col-sm-5 { + width: 41.66666667%; + } + + .col-sm-4 { + width: 33.33333333%; + } + + .col-sm-3 { + width: 25%; + } + + .col-sm-2 { + width: 16.66666667%; + } + + .col-sm-1 { + width: 8.33333333%; + } + + .col-sm-pull-12 { + right: 100%; + } + + .col-sm-pull-11 { + right: 91.66666667%; + } + + .col-sm-pull-10 { + right: 83.33333333%; + } + + .col-sm-pull-9 { + right: 75%; + } + + .col-sm-pull-8 { + right: 66.66666667%; + } + + .col-sm-pull-7 { + right: 58.33333333%; + } + + .col-sm-pull-6 { + right: 50%; + } + + .col-sm-pull-5 { + right: 41.66666667%; + } + + .col-sm-pull-4 { + right: 33.33333333%; + } + + .col-sm-pull-3 { + right: 25%; + } + + .col-sm-pull-2 { + right: 16.66666667%; + } + + .col-sm-pull-1 { + right: 8.33333333%; + } + + .col-sm-pull-0 { + right: auto; + } + + .col-sm-push-12 { + left: 100%; + } + + .col-sm-push-11 { + left: 91.66666667%; + } + + .col-sm-push-10 { + left: 83.33333333%; + } + + .col-sm-push-9 { + left: 75%; + } + + .col-sm-push-8 { + left: 66.66666667%; + } + + .col-sm-push-7 { + left: 58.33333333%; + } + + .col-sm-push-6 { + left: 50%; + } + + .col-sm-push-5 { + left: 41.66666667%; + } + + .col-sm-push-4 { + left: 33.33333333%; + } + + .col-sm-push-3 { + left: 25%; + } + + .col-sm-push-2 { + left: 16.66666667%; + } + + .col-sm-push-1 { + left: 8.33333333%; + } + + .col-sm-push-0 { + left: auto; + } + + .col-sm-offset-12 { + margin-left: 100%; + } + + .col-sm-offset-11 { + margin-left: 91.66666667%; + } + + .col-sm-offset-10 { + margin-left: 83.33333333%; + } + + .col-sm-offset-9 { + margin-left: 75%; + } + + .col-sm-offset-8 { + margin-left: 66.66666667%; + } + + .col-sm-offset-7 { + margin-left: 58.33333333%; + } + + .col-sm-offset-6 { + margin-left: 50%; + } + + .col-sm-offset-5 { + margin-left: 41.66666667%; + } + + .col-sm-offset-4 { + margin-left: 33.33333333%; + } + + .col-sm-offset-3 { + margin-left: 25%; + } + + .col-sm-offset-2 { + margin-left: 16.66666667%; + } + + .col-sm-offset-1 { + margin-left: 8.33333333%; + } + + .col-sm-offset-0 { + margin-left: 0; + } +} + +@media (min-width:992px) { + .col-md-1, .col-md-10, .col-md-11, .col-md-12, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9 { + float: left; + } + + .col-md-12 { + width: 100%; + } + + .col-md-11 { + width: 91.66666667%; + } + + .col-md-10 { + width: 83.33333333%; + } + + .col-md-9 { + width: 75%; + } + + .col-md-8 { + width: 66.66666667%; + } + + .col-md-7 { + width: 58.33333333%; + } + + .col-md-6 { + width: 50%; + } + + .col-md-5 { + width: 41.66666667%; + } + + .col-md-4 { + width: 33.33333333%; + } + + .col-md-3 { + width: 25%; + } + + .col-md-2 { + width: 16.66666667%; + } + + .col-md-1 { + width: 8.33333333%; + } + + .col-md-pull-12 { + right: 100%; + } + + .col-md-pull-11 { + right: 91.66666667%; + } + + .col-md-pull-10 { + right: 83.33333333%; + } + + .col-md-pull-9 { + right: 75%; + } + + .col-md-pull-8 { + right: 66.66666667%; + } + + .col-md-pull-7 { + right: 58.33333333%; + } + + .col-md-pull-6 { + right: 50%; + } + + .col-md-pull-5 { + right: 41.66666667%; + } + + .col-md-pull-4 { + right: 33.33333333%; + } + + .col-md-pull-3 { + right: 25%; + } + + .col-md-pull-2 { + right: 16.66666667%; + } + + .col-md-pull-1 { + right: 8.33333333%; + } + + .col-md-pull-0 { + right: auto; + } + + .col-md-push-12 { + left: 100%; + } + + .col-md-push-11 { + left: 91.66666667%; + } + + .col-md-push-10 { + left: 83.33333333%; + } + + .col-md-push-9 { + left: 75%; + } + + .col-md-push-8 { + left: 66.66666667%; + } + + .col-md-push-7 { + left: 58.33333333%; + } + + .col-md-push-6 { + left: 50%; + } + + .col-md-push-5 { + left: 41.66666667%; + } + + .col-md-push-4 { + left: 33.33333333%; + } + + .col-md-push-3 { + left: 25%; + } + + .col-md-push-2 { + left: 16.66666667%; + } + + .col-md-push-1 { + left: 8.33333333%; + } + + .col-md-push-0 { + left: auto; + } + + .col-md-offset-12 { + margin-left: 100%; + } + + .col-md-offset-11 { + margin-left: 91.66666667%; + } + + .col-md-offset-10 { + margin-left: 83.33333333%; + } + + .col-md-offset-9 { + margin-left: 75%; + } + + .col-md-offset-8 { + margin-left: 66.66666667%; + } + + .col-md-offset-7 { + margin-left: 58.33333333%; + } + + .col-md-offset-6 { + margin-left: 50%; + } + + .col-md-offset-5 { + margin-left: 41.66666667%; + } + + .col-md-offset-4 { + margin-left: 33.33333333%; + } + + .col-md-offset-3 { + margin-left: 25%; + } + + .col-md-offset-2 { + margin-left: 16.66666667%; + } + + .col-md-offset-1 { + margin-left: 8.33333333%; + } + + .col-md-offset-0 { + margin-left: 0; + } +} + +@media (min-width:1200px) { + .col-lg-1, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9 { + float: left; + } + + .col-lg-12 { + width: 100%; + } + + .col-lg-11 { + width: 91.66666667%; + } + + .col-lg-10 { + width: 83.33333333%; + } + + .col-lg-9 { + width: 75%; + } + + .col-lg-8 { + width: 66.66666667%; + } + + .col-lg-7 { + width: 58.33333333%; + } + + .col-lg-6 { + width: 50%; + } + + .col-lg-5 { + width: 41.66666667%; + } + + .col-lg-4 { + width: 33.33333333%; + } + + .col-lg-3 { + width: 25%; + } + + .col-lg-2 { + width: 16.66666667%; + } + + .col-lg-1 { + width: 8.33333333%; + } + + .col-lg-pull-12 { + right: 100%; + } + + .col-lg-pull-11 { + right: 91.66666667%; + } + + .col-lg-pull-10 { + right: 83.33333333%; + } + + .col-lg-pull-9 { + right: 75%; + } + + .col-lg-pull-8 { + right: 66.66666667%; + } + + .col-lg-pull-7 { + right: 58.33333333%; + } + + .col-lg-pull-6 { + right: 50%; + } + + .col-lg-pull-5 { + right: 41.66666667%; + } + + .col-lg-pull-4 { + right: 33.33333333%; + } + + .col-lg-pull-3 { + right: 25%; + } + + .col-lg-pull-2 { + right: 16.66666667%; + } + + .col-lg-pull-1 { + right: 8.33333333%; + } + + .col-lg-pull-0 { + right: auto; + } + + .col-lg-push-12 { + left: 100%; + } + + .col-lg-push-11 { + left: 91.66666667%; + } + + .col-lg-push-10 { + left: 83.33333333%; + } + + .col-lg-push-9 { + left: 75%; + } + + .col-lg-push-8 { + left: 66.66666667%; + } + + .col-lg-push-7 { + left: 58.33333333%; + } + + .col-lg-push-6 { + left: 50%; + } + + .col-lg-push-5 { + left: 41.66666667%; + } + + .col-lg-push-4 { + left: 33.33333333%; + } + + .col-lg-push-3 { + left: 25%; + } + + .col-lg-push-2 { + left: 16.66666667%; + } + + .col-lg-push-1 { + left: 8.33333333%; + } + + .col-lg-push-0 { + left: auto; + } + + .col-lg-offset-12 { + margin-left: 100%; + } + + .col-lg-offset-11 { + margin-left: 91.66666667%; + } + + .col-lg-offset-10 { + margin-left: 83.33333333%; + } + + .col-lg-offset-9 { + margin-left: 75%; + } + + .col-lg-offset-8 { + margin-left: 66.66666667%; + } + + .col-lg-offset-7 { + margin-left: 58.33333333%; + } + + .col-lg-offset-6 { + margin-left: 50%; + } + + .col-lg-offset-5 { + margin-left: 41.66666667%; + } + + .col-lg-offset-4 { + margin-left: 33.33333333%; + } + + .col-lg-offset-3 { + margin-left: 25%; + } + + .col-lg-offset-2 { + margin-left: 16.66666667%; + } + + .col-lg-offset-1 { + margin-left: 8.33333333%; + } + + .col-lg-offset-0 { + margin-left: 0; + } +} + +table { + background-color: transparent; +} + +caption { + padding-top: 8px; + padding-bottom: 8px; + color: #777; + text-align: left; +} + +th { + text-align: left; +} + +.table { + width: 100%; + max-width: 100%; + margin-bottom: 20px; +} + +.table>tbody>tr>td, .table>tbody>tr>th, .table>tfoot>tr>td, .table>tfoot>tr>th, .table>thead>tr>td, .table>thead>tr>th { + padding: 8px; + line-height: 1.42857143; + vertical-align: top; + border-top: 1px solid #ddd; +} + +.table>thead>tr>th { + vertical-align: bottom; + border-bottom: 2px solid #ddd; +} + +.table>caption+thead>tr:first-child>td, .table>caption+thead>tr:first-child>th, .table>colgroup+thead>tr:first-child>td, .table>colgroup+thead>tr:first-child>th, .table>thead:first-child>tr:first-child>td, .table>thead:first-child>tr:first-child>th { + border-top: 0; +} + +.table>tbody+tbody { + border-top: 2px solid #ddd; +} + +.table .table { + background-color: #fff; +} + +.table-condensed>tbody>tr>td, .table-condensed>tbody>tr>th, .table-condensed>tfoot>tr>td, .table-condensed>tfoot>tr>th, .table-condensed>thead>tr>td, .table-condensed>thead>tr>th { + padding: 5px; +} + +.table-bordered { + border: 1px solid #ddd; +} + +.table-bordered>tbody>tr>td, .table-bordered>tbody>tr>th, .table-bordered>tfoot>tr>td, .table-bordered>tfoot>tr>th, .table-bordered>thead>tr>td, .table-bordered>thead>tr>th { + border: 1px solid #ddd; +} + +.table-bordered>thead>tr>td, .table-bordered>thead>tr>th { + border-bottom-width: 2px; +} + +.table-striped>tbody>tr:nth-of-type(odd) { + background-color: #f9f9f9; +} + +.table-hover>tbody>tr:hover { + background-color: #f5f5f5; +} + +table col[class*=col-] { + position: static; + display: table-column; + float: none; +} + +table td[class*=col-], table th[class*=col-] { + position: static; + display: table-cell; + float: none; +} + +.table>tbody>tr.active>td, .table>tbody>tr.active>th, .table>tbody>tr>td.active, .table>tbody>tr>th.active, .table>tfoot>tr.active>td, .table>tfoot>tr.active>th, .table>tfoot>tr>td.active, .table>tfoot>tr>th.active, .table>thead>tr.active>td, .table>thead>tr.active>th, .table>thead>tr>td.active, .table>thead>tr>th.active { + background-color: #f5f5f5; +} + +.table-hover>tbody>tr.active:hover>td, .table-hover>tbody>tr.active:hover>th, .table-hover>tbody>tr:hover>.active, .table-hover>tbody>tr>td.active:hover, .table-hover>tbody>tr>th.active:hover { + background-color: #e8e8e8; +} + +.table>tbody>tr.success>td, .table>tbody>tr.success>th, .table>tbody>tr>td.success, .table>tbody>tr>th.success, .table>tfoot>tr.success>td, .table>tfoot>tr.success>th, .table>tfoot>tr>td.success, .table>tfoot>tr>th.success, .table>thead>tr.success>td, .table>thead>tr.success>th, .table>thead>tr>td.success, .table>thead>tr>th.success { + background-color: #dff0d8; +} + +.table-hover>tbody>tr.success:hover>td, .table-hover>tbody>tr.success:hover>th, .table-hover>tbody>tr:hover>.success, .table-hover>tbody>tr>td.success:hover, .table-hover>tbody>tr>th.success:hover { + background-color: #d0e9c6; +} + +.table>tbody>tr.info>td, .table>tbody>tr.info>th, .table>tbody>tr>td.info, .table>tbody>tr>th.info, .table>tfoot>tr.info>td, .table>tfoot>tr.info>th, .table>tfoot>tr>td.info, .table>tfoot>tr>th.info, .table>thead>tr.info>td, .table>thead>tr.info>th, .table>thead>tr>td.info, .table>thead>tr>th.info { + background-color: #d9edf7; +} + +.table-hover>tbody>tr.info:hover>td, .table-hover>tbody>tr.info:hover>th, .table-hover>tbody>tr:hover>.info, .table-hover>tbody>tr>td.info:hover, .table-hover>tbody>tr>th.info:hover { + background-color: #c4e3f3; +} + +.table>tbody>tr.warning>td, .table>tbody>tr.warning>th, .table>tbody>tr>td.warning, .table>tbody>tr>th.warning, .table>tfoot>tr.warning>td, .table>tfoot>tr.warning>th, .table>tfoot>tr>td.warning, .table>tfoot>tr>th.warning, .table>thead>tr.warning>td, .table>thead>tr.warning>th, .table>thead>tr>td.warning, .table>thead>tr>th.warning { + background-color: #fcf8e3; +} + +.table-hover>tbody>tr.warning:hover>td, .table-hover>tbody>tr.warning:hover>th, .table-hover>tbody>tr:hover>.warning, .table-hover>tbody>tr>td.warning:hover, .table-hover>tbody>tr>th.warning:hover { + background-color: #faf2cc; +} + +.table>tbody>tr.danger>td, .table>tbody>tr.danger>th, .table>tbody>tr>td.danger, .table>tbody>tr>th.danger, .table>tfoot>tr.danger>td, .table>tfoot>tr.danger>th, .table>tfoot>tr>td.danger, .table>tfoot>tr>th.danger, .table>thead>tr.danger>td, .table>thead>tr.danger>th, .table>thead>tr>td.danger, .table>thead>tr>th.danger { + background-color: #f2dede; +} + +.table-hover>tbody>tr.danger:hover>td, .table-hover>tbody>tr.danger:hover>th, .table-hover>tbody>tr:hover>.danger, .table-hover>tbody>tr>td.danger:hover, .table-hover>tbody>tr>th.danger:hover { + background-color: #ebcccc; +} + +.table-responsive { + min-height: .01%; + overflow-x: auto; +} + +@media screen and (max-width:767px) { + .table-responsive { + width: 100%; + margin-bottom: 15px; + overflow-y: hidden; + -ms-overflow-style: -ms-autohiding-scrollbar; + border: 1px solid #ddd; + } + + .table-responsive>.table { + margin-bottom: 0; + } + + .table-responsive>.table>tbody>tr>td, .table-responsive>.table>tbody>tr>th, .table-responsive>.table>tfoot>tr>td, .table-responsive>.table>tfoot>tr>th, .table-responsive>.table>thead>tr>td, .table-responsive>.table>thead>tr>th { + white-space: nowrap; + } + + .table-responsive>.table-bordered { + border: 0; + } + + .table-responsive>.table-bordered>tbody>tr>td:first-child, .table-responsive>.table-bordered>tbody>tr>th:first-child, .table-responsive>.table-bordered>tfoot>tr>td:first-child, .table-responsive>.table-bordered>tfoot>tr>th:first-child, .table-responsive>.table-bordered>thead>tr>td:first-child, .table-responsive>.table-bordered>thead>tr>th:first-child { + border-left: 0; + } + + .table-responsive>.table-bordered>tbody>tr>td:last-child, .table-responsive>.table-bordered>tbody>tr>th:last-child, .table-responsive>.table-bordered>tfoot>tr>td:last-child, .table-responsive>.table-bordered>tfoot>tr>th:last-child, .table-responsive>.table-bordered>thead>tr>td:last-child, .table-responsive>.table-bordered>thead>tr>th:last-child { + border-right: 0; + } + + .table-responsive>.table-bordered>tbody>tr:last-child>td, .table-responsive>.table-bordered>tbody>tr:last-child>th, .table-responsive>.table-bordered>tfoot>tr:last-child>td, .table-responsive>.table-bordered>tfoot>tr:last-child>th { + border-bottom: 0; + } +} + +fieldset { + min-width: 0; + padding: 0; + margin: 0; + border: 0; +} + +legend { + display: block; + width: 100%; + padding: 0; + margin-bottom: 20px; + font-size: 21px; + line-height: inherit; + color: #333; + border: 0; + border-bottom: 1px solid #e5e5e5; +} + +label { + display: inline-block; + max-width: 100%; + margin-bottom: 5px; + font-weight: 700; +} + +input[type=search] { + -webkit-box-sizing: border-box; + -moz-box-sizing: border-box; + box-sizing: border-box; +} + +input[type=checkbox], input[type=radio] { + margin: 4px 0 0; + margin-top: 1px \9; + line-height: normal; +} + +input[type=file] { + display: block; +} + +input[type=range] { + display: block; + width: 100%; +} + +select[multiple], select[size] { + height: auto; +} + +input[type=file]:focus, input[type=checkbox]:focus, input[type=radio]:focus { + outline: thin dotted; + outline: 5px auto -webkit-focus-ring-color; + outline-offset: -2px; +} + +output { + display: block; + padding-top: 7px; + font-size: 14px; + line-height: 1.42857143; + color: #555; +} + +.form-control { + display: block; + width: 100%; + height: 34px; + padding: 6px 12px; + font-size: 14px; + line-height: 1.42857143; + color: #555; + background-color: #fff; + background-image: none; + border: 1px solid #ccc; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075); + box-shadow: inset 0 1px 1px rgba(0,0,0,.075); + -webkit-transition: border-color ease-in-out .15s, -webkit-box-shadow ease-in-out .15s; + -o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; + transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s; +} + +.form-control:focus { + border-color: #66afe9; + outline: 0; + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102,175,233,.6); + box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102,175,233,.6); +} + +.form-control::-moz-placeholder { + color: #7c7c7c; + opacity: 1; +} + +.form-control:-ms-input-placeholder { + color: #7c7c7c; + opacity: 1; +} + +.form-control::-webkit-input-placeholder { + color: #7c7c7c; + opacity: 1; +} + +.form-control[disabled], .form-control[readonly], fieldset[disabled] .form-control { + cursor: not-allowed; + background-color: #eee; + opacity: 1; +} + +textarea.form-control { + height: auto; +} + +input[type=search] { + -webkit-appearance: none; +} + +@media screen and (-webkit-min-device-pixel-ratio:0) { + input[type=date], input[type=time], input[type=datetime-local], input[type=month] { + line-height: 34px; + } + + .input-group-sm input[type=date], .input-group-sm input[type=time], .input-group-sm input[type=datetime-local], .input-group-sm input[type=month], input[type=date].input-sm, input[type=time].input-sm, input[type=datetime-local].input-sm, input[type=month].input-sm { + line-height: 30px; + } + + .input-group-lg input[type=date], .input-group-lg input[type=time], .input-group-lg input[type=datetime-local], .input-group-lg input[type=month], input[type=date].input-lg, input[type=time].input-lg, input[type=datetime-local].input-lg, input[type=month].input-lg { + line-height: 46px; + } +} + +.form-group { + margin-bottom: 15px; +} + +.checkbox, .radio { + position: relative; + display: block; + margin-top: 10px; + margin-bottom: 10px; +} + +.checkbox label, .radio label { + min-height: 20px; + padding-left: 20px; + margin-bottom: 0; + font-weight: 400; + cursor: pointer; +} + +.checkbox input[type=checkbox], .checkbox-inline input[type=checkbox], .radio input[type=radio], .radio-inline input[type=radio] { + position: absolute; + margin-top: 4px \9; + margin-left: -20px; +} + +.checkbox+.checkbox, .radio+.radio { + margin-top: -5px; +} + +.checkbox-inline, .radio-inline { + display: inline-block; + padding-left: 20px; + margin-bottom: 0; + font-weight: 400; + vertical-align: middle; + cursor: pointer; +} + +.checkbox-inline+.checkbox-inline, .radio-inline+.radio-inline { + margin-top: 0; + margin-left: 10px; +} + +fieldset[disabled] input[type=checkbox], fieldset[disabled] input[type=radio], input[type=checkbox].disabled, input[type=checkbox][disabled], input[type=radio].disabled, input[type=radio][disabled] { + cursor: not-allowed; +} + +.checkbox-inline.disabled, .radio-inline.disabled, fieldset[disabled] .checkbox-inline, fieldset[disabled] .radio-inline { + cursor: not-allowed; +} + +.checkbox.disabled label, .radio.disabled label, fieldset[disabled] .checkbox label, fieldset[disabled] .radio label { + cursor: not-allowed; +} + +.form-control-static { + padding-top: 7px; + padding-bottom: 7px; + margin-bottom: 0; +} + +.form-control-static.input-lg, .form-control-static.input-sm { + padding-right: 0; + padding-left: 0; +} + +.input-sm { + height: 30px; + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} + +select.input-sm { + height: 30px; + line-height: 30px; +} + +select[multiple].input-sm, textarea.input-sm { + height: auto; +} + +.form-group-sm .form-control { + height: 30px; + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} + +select.form-group-sm .form-control { + height: 30px; + line-height: 30px; +} + +select[multiple].form-group-sm .form-control, textarea.form-group-sm .form-control { + height: auto; +} + +.form-group-sm .form-control-static { + height: 30px; + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; +} + +.input-lg { + height: 46px; + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; + border-radius: 6px; +} + +select.input-lg { + height: 46px; + line-height: 46px; +} + +select[multiple].input-lg, textarea.input-lg { + height: auto; +} + +.form-group-lg .form-control { + height: 46px; + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; + border-radius: 6px; +} + +select.form-group-lg .form-control { + height: 46px; + line-height: 46px; +} + +select[multiple].form-group-lg .form-control, textarea.form-group-lg .form-control { + height: auto; +} + +.form-group-lg .form-control-static { + height: 46px; + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; +} + +.has-feedback { + position: relative; +} + +.has-feedback .form-control { + padding-right: 42.5px; +} + +.form-control-feedback { + position: absolute; + top: 0; + right: 0; + z-index: 2; + display: block; + width: 34px; + height: 34px; + line-height: 34px; + text-align: center; + pointer-events: none; +} + +.input-lg+.form-control-feedback { + width: 46px; + height: 46px; + line-height: 46px; +} + +.input-sm+.form-control-feedback { + width: 30px; + height: 30px; + line-height: 30px; +} + +.has-success .checkbox, .has-success .checkbox-inline, .has-success .control-label, .has-success .help-block, .has-success .radio, .has-success .radio-inline, .has-success.checkbox label, .has-success.checkbox-inline label, .has-success.radio label, .has-success.radio-inline label { + color: #3c763d; +} + +.has-success .form-control { + border-color: #3c763d; + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075); + box-shadow: inset 0 1px 1px rgba(0,0,0,.075); +} + +.has-success .form-control:focus { + border-color: #2b542c; + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 6px #67b168; + box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 6px #67b168; +} + +.has-success .input-group-addon { + color: #3c763d; + background-color: #dff0d8; + border-color: #3c763d; +} + +.has-success .form-control-feedback { + color: #3c763d; +} + +.has-warning .checkbox, .has-warning .checkbox-inline, .has-warning .control-label, .has-warning .help-block, .has-warning .radio, .has-warning .radio-inline, .has-warning.checkbox label, .has-warning.checkbox-inline label, .has-warning.radio label, .has-warning.radio-inline label { + color: #8a6d3b; +} + +.has-warning .form-control { + border-color: #8a6d3b; + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075); + box-shadow: inset 0 1px 1px rgba(0,0,0,.075); +} + +.has-warning .form-control:focus { + border-color: #66512c; + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 6px #c0a16b; + box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 6px #c0a16b; +} + +.has-warning .input-group-addon { + color: #8a6d3b; + background-color: #fcf8e3; + border-color: #8a6d3b; +} + +.has-warning .form-control-feedback { + color: #8a6d3b; +} + +.has-error .checkbox, .has-error .checkbox-inline, .has-error .control-label, .has-error .help-block, .has-error .radio, .has-error .radio-inline, .has-error.checkbox label, .has-error.checkbox-inline label, .has-error.radio label, .has-error.radio-inline label { + color: #a94442; +} + +.has-error .form-control { + border-color: #a94442; + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075); + box-shadow: inset 0 1px 1px rgba(0,0,0,.075); +} + +.has-error .form-control:focus { + border-color: #843534; + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 6px #ce8483; + box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 6px #ce8483; +} + +.has-error .input-group-addon { + color: #a94442; + background-color: #f2dede; + border-color: #a94442; +} + +.has-error .form-control-feedback { + color: #a94442; +} + +.has-feedback label~.form-control-feedback { + top: 25px; +} + +.has-feedback label.sr-only~.form-control-feedback { + top: 0; +} + +.help-block { + display: block; + margin-top: 5px; + margin-bottom: 10px; + color: #737373; +} + +@media (min-width:768px) { + .form-inline .form-group { + display: inline-block; + margin-bottom: 0; + vertical-align: middle; + } + + .form-inline .form-control { + display: inline-block; + width: auto; + vertical-align: middle; + } + + .form-inline .form-control-static { + display: inline-block; + } + + .form-inline .input-group { + display: inline-table; + vertical-align: middle; + } + + .form-inline .input-group .form-control, .form-inline .input-group .input-group-addon, .form-inline .input-group .input-group-btn { + width: auto; + } + + .form-inline .input-group>.form-control { + width: 100%; + } + + .form-inline .control-label { + margin-bottom: 0; + vertical-align: middle; + } + + .form-inline .checkbox, .form-inline .radio { + display: inline-block; + margin-top: 0; + margin-bottom: 0; + vertical-align: middle; + } + + .form-inline .checkbox label, .form-inline .radio label { + padding-left: 0; + } + + .form-inline .checkbox input[type=checkbox], .form-inline .radio input[type=radio] { + position: relative; + margin-left: 0; + } + + .form-inline .has-feedback .form-control-feedback { + top: 0; + } +} + +.form-horizontal .checkbox, .form-horizontal .checkbox-inline, .form-horizontal .radio, .form-horizontal .radio-inline { + padding-top: 7px; + margin-top: 0; + margin-bottom: 0; +} + +.form-horizontal .checkbox, .form-horizontal .radio { + min-height: 27px; +} + +.form-horizontal .form-group { + margin-right: -15px; + margin-left: -15px; +} + +@media (min-width:768px) { + .form-horizontal .control-label { + padding-top: 7px; + margin-bottom: 0; + text-align: right; + } +} + +.form-horizontal .has-feedback .form-control-feedback { + right: 15px; +} + +@media (min-width:768px) { + .form-horizontal .form-group-lg .control-label { + padding-top: 14.33px; + } +} + +@media (min-width:768px) { + .form-horizontal .form-group-sm .control-label { + padding-top: 6px; + } +} + +.btn { + display: inline-block; + padding: 6px 12px; + margin-bottom: 0; + font-size: 14px; + font-weight: 400; + line-height: 1.42857143; + text-align: center; + white-space: nowrap; + vertical-align: middle; + -ms-touch-action: manipulation; + touch-action: manipulation; + cursor: pointer; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + background-image: none; + border: 1px solid transparent; + border-radius: 4px; +} + +.btn.active.focus, .btn.active:focus, .btn.focus, .btn:active.focus, .btn:active:focus, .btn:focus { + outline: thin dotted; + outline: 5px auto -webkit-focus-ring-color; + outline-offset: -2px; +} + +.btn.focus, .btn:focus, .btn:hover { + color: #333; + text-decoration: none; +} + +.btn.active, .btn:active { + background-image: none; + outline: 0; + -webkit-box-shadow: inset 0 3px 5px rgba(0,0,0,.125); + box-shadow: inset 0 3px 5px rgba(0,0,0,.125); +} + +.btn.disabled, .btn[disabled], fieldset[disabled] .btn { + pointer-events: none; + cursor: not-allowed; + filter: alpha(opacity=65); + -webkit-box-shadow: none; + box-shadow: none; + opacity: .65; +} + +.btn-default { + color: #333; + background-color: #fff; + border-color: #ccc; +} + +.btn-default.active, .btn-default.focus, .btn-default:active, .btn-default:focus, .btn-default:hover, .open>.dropdown-toggle.btn-default { + color: #333; + background-color: #e6e6e6; + border-color: #adadad; +} + +.btn-default.active, .btn-default:active, .open>.dropdown-toggle.btn-default { + background-image: none; +} + +.btn-default.disabled, .btn-default.disabled.active, .btn-default.disabled.focus, .btn-default.disabled:active, .btn-default.disabled:focus, .btn-default.disabled:hover, .btn-default[disabled], .btn-default[disabled].active, .btn-default[disabled].focus, .btn-default[disabled]:active, .btn-default[disabled]:focus, .btn-default[disabled]:hover, fieldset[disabled] .btn-default, fieldset[disabled] .btn-default.active, fieldset[disabled] .btn-default.focus, fieldset[disabled] .btn-default:active, fieldset[disabled] .btn-default:focus, fieldset[disabled] .btn-default:hover { + background-color: #fff; + border-color: #ccc; +} + +.btn-default .badge { + color: #fff; + background-color: #333; +} + +.btn-primary { + color: #fff; + background-color: #337ab7; + border-color: #2e6da4; +} + +.btn-primary.active, .btn-primary.focus, .btn-primary:active, .btn-primary:focus, .btn-primary:hover, .open>.dropdown-toggle.btn-primary { + color: #fff; + background-color: #286090; + border-color: #204d74; +} + +.btn-primary.active, .btn-primary:active, .open>.dropdown-toggle.btn-primary { + background-image: none; +} + +.btn-primary.disabled, .btn-primary.disabled.active, .btn-primary.disabled.focus, .btn-primary.disabled:active, .btn-primary.disabled:focus, .btn-primary.disabled:hover, .btn-primary[disabled], .btn-primary[disabled].active, .btn-primary[disabled].focus, .btn-primary[disabled]:active, .btn-primary[disabled]:focus, .btn-primary[disabled]:hover, fieldset[disabled] .btn-primary, fieldset[disabled] .btn-primary.active, fieldset[disabled] .btn-primary.focus, fieldset[disabled] .btn-primary:active, fieldset[disabled] .btn-primary:focus, fieldset[disabled] .btn-primary:hover { + background-color: #337ab7; + border-color: #2e6da4; +} + +.btn-primary .badge { + color: #337ab7; + background-color: #fff; +} + +.btn-success { + color: #fff; + background-color: #5cb85c; + border-color: #4cae4c; +} + +.btn-success.active, .btn-success.focus, .btn-success:active, .btn-success:focus, .btn-success:hover, .open>.dropdown-toggle.btn-success { + color: #fff; + background-color: #449d44; + border-color: #398439; +} + +.btn-success.active, .btn-success:active, .open>.dropdown-toggle.btn-success { + background-image: none; +} + +.btn-success.disabled, .btn-success.disabled.active, .btn-success.disabled.focus, .btn-success.disabled:active, .btn-success.disabled:focus, .btn-success.disabled:hover, .btn-success[disabled], .btn-success[disabled].active, .btn-success[disabled].focus, .btn-success[disabled]:active, .btn-success[disabled]:focus, .btn-success[disabled]:hover, fieldset[disabled] .btn-success, fieldset[disabled] .btn-success.active, fieldset[disabled] .btn-success.focus, fieldset[disabled] .btn-success:active, fieldset[disabled] .btn-success:focus, fieldset[disabled] .btn-success:hover { + background-color: #5cb85c; + border-color: #4cae4c; +} + +.btn-success .badge { + color: #5cb85c; + background-color: #fff; +} + +.btn-info { + color: #fff; + background-color: #5bc0de; + border-color: #46b8da; +} + +.btn-info.active, .btn-info.focus, .btn-info:active, .btn-info:focus, .btn-info:hover, .open>.dropdown-toggle.btn-info { + color: #fff; + background-color: #31b0d5; + border-color: #269abc; +} + +.btn-info.active, .btn-info:active, .open>.dropdown-toggle.btn-info { + background-image: none; +} + +.btn-info.disabled, .btn-info.disabled.active, .btn-info.disabled.focus, .btn-info.disabled:active, .btn-info.disabled:focus, .btn-info.disabled:hover, .btn-info[disabled], .btn-info[disabled].active, .btn-info[disabled].focus, .btn-info[disabled]:active, .btn-info[disabled]:focus, .btn-info[disabled]:hover, fieldset[disabled] .btn-info, fieldset[disabled] .btn-info.active, fieldset[disabled] .btn-info.focus, fieldset[disabled] .btn-info:active, fieldset[disabled] .btn-info:focus, fieldset[disabled] .btn-info:hover { + background-color: #5bc0de; + border-color: #46b8da; +} + +.btn-info .badge { + color: #5bc0de; + background-color: #fff; +} + +.btn-warning { + color: #fff; + background-color: #f0ad4e; + border-color: #eea236; +} + +.btn-warning.active, .btn-warning.focus, .btn-warning:active, .btn-warning:focus, .btn-warning:hover, .open>.dropdown-toggle.btn-warning { + color: #fff; + background-color: #ec971f; + border-color: #d58512; +} + +.btn-warning.active, .btn-warning:active, .open>.dropdown-toggle.btn-warning { + background-image: none; +} + +.btn-warning.disabled, .btn-warning.disabled.active, .btn-warning.disabled.focus, .btn-warning.disabled:active, .btn-warning.disabled:focus, .btn-warning.disabled:hover, .btn-warning[disabled], .btn-warning[disabled].active, .btn-warning[disabled].focus, .btn-warning[disabled]:active, .btn-warning[disabled]:focus, .btn-warning[disabled]:hover, fieldset[disabled] .btn-warning, fieldset[disabled] .btn-warning.active, fieldset[disabled] .btn-warning.focus, fieldset[disabled] .btn-warning:active, fieldset[disabled] .btn-warning:focus, fieldset[disabled] .btn-warning:hover { + background-color: #f0ad4e; + border-color: #eea236; +} + +.btn-warning .badge { + color: #f0ad4e; + background-color: #fff; +} + +.btn-danger { + color: #fff; + background-color: #d9534f; + border-color: #d43f3a; +} + +.btn-danger.active, .btn-danger.focus, .btn-danger:active, .btn-danger:focus, .btn-danger:hover, .open>.dropdown-toggle.btn-danger { + color: #fff; + background-color: #c9302c; + border-color: #ac2925; +} + +.btn-danger.active, .btn-danger:active, .open>.dropdown-toggle.btn-danger { + background-image: none; +} + +.btn-danger.disabled, .btn-danger.disabled.active, .btn-danger.disabled.focus, .btn-danger.disabled:active, .btn-danger.disabled:focus, .btn-danger.disabled:hover, .btn-danger[disabled], .btn-danger[disabled].active, .btn-danger[disabled].focus, .btn-danger[disabled]:active, .btn-danger[disabled]:focus, .btn-danger[disabled]:hover, fieldset[disabled] .btn-danger, fieldset[disabled] .btn-danger.active, fieldset[disabled] .btn-danger.focus, fieldset[disabled] .btn-danger:active, fieldset[disabled] .btn-danger:focus, fieldset[disabled] .btn-danger:hover { + background-color: #d9534f; + border-color: #d43f3a; +} + +.btn-danger .badge { + color: #d9534f; + background-color: #fff; +} + +.btn-link { + font-weight: 400; + color: #337ab7; + border-radius: 0; +} + +.btn-link, .btn-link.active, .btn-link:active, .btn-link[disabled], fieldset[disabled] .btn-link { + background-color: transparent; + -webkit-box-shadow: none; + box-shadow: none; +} + +.btn-link, .btn-link:active, .btn-link:focus, .btn-link:hover { + border-color: transparent; +} + +.btn-link:focus, .btn-link:hover { + color: #23527c; + text-decoration: underline; + background-color: transparent; +} + +.btn-link[disabled]:focus, .btn-link[disabled]:hover, fieldset[disabled] .btn-link:focus, fieldset[disabled] .btn-link:hover { + color: #777; + text-decoration: none; +} + +.btn-group-lg>.btn, .btn-lg { + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; + border-radius: 6px; +} + +.btn-group-sm>.btn, .btn-sm { + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} + +.btn-group-xs>.btn, .btn-xs { + padding: 1px 5px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} + +.btn-block { + display: block; + width: 100%; +} + +.btn-block+.btn-block { + margin-top: 5px; +} + +input[type=button].btn-block, input[type=reset].btn-block, input[type=submit].btn-block { + width: 100%; +} + +.fade { + opacity: 0; + -webkit-transition: opacity .15s linear; + -o-transition: opacity .15s linear; + transition: opacity .15s linear; +} + +.fade.in { + opacity: 1; +} + +.collapse { + display: none; + visibility: hidden; +} + +.collapse.in { + display: block; + visibility: visible; +} + +tr.collapse.in { + display: table-row; +} + +tbody.collapse.in { + display: table-row-group; +} + +.collapsing { + position: relative; + height: 0; + overflow: hidden; + -webkit-transition-timing-function: ease; + -o-transition-timing-function: ease; + transition-timing-function: ease; + -webkit-transition-duration: .35s; + -o-transition-duration: .35s; + transition-duration: .35s; + -webkit-transition-property: height, visibility; + -o-transition-property: height, visibility; + transition-property: height, visibility; +} + +.caret { + display: inline-block; + width: 0; + height: 0; + margin-left: 2px; + vertical-align: middle; + border-top: 4px solid; + border-right: 4px solid transparent; + border-left: 4px solid transparent; +} + +.dropdown, .dropup { + position: relative; +} + +.dropdown-toggle:focus { + outline: 0; +} + +.dropdown-menu { + position: absolute; + top: 100%; + left: 0; + z-index: 1000; + display: none; + float: left; + min-width: 160px; + padding: 5px 0; + margin: 2px 0 0; + font-size: 14px; + text-align: left; + list-style: none; + background-color: #fff; + -webkit-background-clip: padding-box; + background-clip: padding-box; + border: 1px solid #ccc; + border: 1px solid rgba(0,0,0,.15); + border-radius: 4px; + -webkit-box-shadow: 0 6px 12px rgba(0,0,0,.175); + box-shadow: 0 6px 12px rgba(0,0,0,.175); +} + +.dropdown-menu.pull-right { + right: 0; + left: auto; +} + +.dropdown-menu .divider { + height: 1px; + margin: 9px 0; + overflow: hidden; + background-color: #e5e5e5; +} + +.dropdown-menu>li>a { + display: block; + padding: 3px 20px; + clear: both; + font-weight: 400; + line-height: 1.42857143; + color: #333; + white-space: nowrap; +} + +.dropdown-menu>li>a:focus, .dropdown-menu>li>a:hover { + color: #262626; + text-decoration: none; + background-color: #f5f5f5; +} + +.dropdown-menu>.active>a, .dropdown-menu>.active>a:focus, .dropdown-menu>.active>a:hover { + color: #fff; + text-decoration: none; + background-color: #337ab7; + outline: 0; +} + +.dropdown-menu>.disabled>a, .dropdown-menu>.disabled>a:focus, .dropdown-menu>.disabled>a:hover { + color: #777; +} + +.dropdown-menu>.disabled>a:focus, .dropdown-menu>.disabled>a:hover { + text-decoration: none; + cursor: not-allowed; + background-color: transparent; + background-image: none; + filter: progid:DXImageTransform.Microsoft.gradient(enabled=false); +} + +.open>.dropdown-menu { + display: block; +} + +.open>a { + outline: 0; +} + +.dropdown-menu-right { + right: 0; + left: auto; +} + +.dropdown-menu-left { + right: auto; + left: 0; +} + +.dropdown-header { + display: block; + padding: 3px 20px; + font-size: 12px; + line-height: 1.42857143; + color: #777; + white-space: nowrap; +} + +.dropdown-backdrop { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 990; +} + +.pull-right>.dropdown-menu { + right: 0; + left: auto; +} + +.dropup .caret, .navbar-fixed-bottom .dropdown .caret { + content: ""; + border-top: 0; + border-bottom: 4px solid; +} + +.dropup .dropdown-menu, .navbar-fixed-bottom .dropdown .dropdown-menu { + top: auto; + bottom: 100%; + margin-bottom: 2px; +} + +@media (min-width:768px) { + .navbar-right .dropdown-menu { + right: 0; + left: auto; + } + + .navbar-right .dropdown-menu-left { + right: auto; + left: 0; + } +} + +.btn-group, .btn-group-vertical { + position: relative; + display: inline-block; + vertical-align: middle; +} + +.btn-group-vertical>.btn, .btn-group>.btn { + position: relative; + float: left; +} + +.btn-group-vertical>.btn.active, .btn-group-vertical>.btn:active, .btn-group-vertical>.btn:focus, .btn-group-vertical>.btn:hover, .btn-group>.btn.active, .btn-group>.btn:active, .btn-group>.btn:focus, .btn-group>.btn:hover { + z-index: 2; +} + +.btn-group .btn+.btn, .btn-group .btn+.btn-group, .btn-group .btn-group+.btn, .btn-group .btn-group+.btn-group { + margin-left: -1px; +} + +.btn-toolbar { + margin-left: -5px; +} + +.btn-toolbar .btn-group, .btn-toolbar .input-group { + float: left; +} + +.btn-toolbar>.btn, .btn-toolbar>.btn-group, .btn-toolbar>.input-group { + margin-left: 5px; +} + +.btn-group>.btn:not(:first-child):not(:last-child):not(.dropdown-toggle) { + border-radius: 0; +} + +.btn-group>.btn:first-child { + margin-left: 0; +} + +.btn-group>.btn:first-child:not(:last-child):not(.dropdown-toggle) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.btn-group>.btn:last-child:not(:first-child), .btn-group>.dropdown-toggle:not(:first-child) { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.btn-group>.btn-group { + float: left; +} + +.btn-group>.btn-group:not(:first-child):not(:last-child)>.btn { + border-radius: 0; +} + +.btn-group>.btn-group:first-child:not(:last-child)>.btn:last-child, .btn-group>.btn-group:first-child:not(:last-child)>.dropdown-toggle { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.btn-group>.btn-group:last-child:not(:first-child)>.btn:first-child { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.btn-group .dropdown-toggle:active, .btn-group.open .dropdown-toggle { + outline: 0; +} + +.btn-group>.btn+.dropdown-toggle { + padding-right: 8px; + padding-left: 8px; +} + +.btn-group>.btn-lg+.dropdown-toggle { + padding-right: 12px; + padding-left: 12px; +} + +.btn-group.open .dropdown-toggle { + -webkit-box-shadow: inset 0 3px 5px rgba(0,0,0,.125); + box-shadow: inset 0 3px 5px rgba(0,0,0,.125); +} + +.btn-group.open .dropdown-toggle.btn-link { + -webkit-box-shadow: none; + box-shadow: none; +} + +.btn .caret { + margin-left: 0; +} + +.btn-lg .caret { + border-width: 5px 5px 0; + border-bottom-width: 0; +} + +.dropup .btn-lg .caret { + border-width: 0 5px 5px; +} + +.btn-group-vertical>.btn, .btn-group-vertical>.btn-group, .btn-group-vertical>.btn-group>.btn { + display: block; + float: none; + width: 100%; + max-width: 100%; +} + +.btn-group-vertical>.btn-group>.btn { + float: none; +} + +.btn-group-vertical>.btn+.btn, .btn-group-vertical>.btn+.btn-group, .btn-group-vertical>.btn-group+.btn, .btn-group-vertical>.btn-group+.btn-group { + margin-top: -1px; + margin-left: 0; +} + +.btn-group-vertical>.btn:not(:first-child):not(:last-child) { + border-radius: 0; +} + +.btn-group-vertical>.btn:first-child:not(:last-child) { + border-top-right-radius: 4px; + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} + +.btn-group-vertical>.btn:last-child:not(:first-child) { + border-top-left-radius: 0; + border-top-right-radius: 0; + border-bottom-left-radius: 4px; +} + +.btn-group-vertical>.btn-group:not(:first-child):not(:last-child)>.btn { + border-radius: 0; +} + +.btn-group-vertical>.btn-group:first-child:not(:last-child)>.btn:last-child, .btn-group-vertical>.btn-group:first-child:not(:last-child)>.dropdown-toggle { + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} + +.btn-group-vertical>.btn-group:last-child:not(:first-child)>.btn:first-child { + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +.btn-group-justified { + display: table; + width: 100%; + table-layout: fixed; + border-collapse: separate; +} + +.btn-group-justified>.btn, .btn-group-justified>.btn-group { + display: table-cell; + float: none; + width: 1%; +} + +.btn-group-justified>.btn-group .btn { + width: 100%; +} + +.btn-group-justified>.btn-group .dropdown-menu { + left: auto; +} + +[data-toggle=buttons]>.btn input[type=checkbox], [data-toggle=buttons]>.btn input[type=radio], [data-toggle=buttons]>.btn-group>.btn input[type=checkbox], [data-toggle=buttons]>.btn-group>.btn input[type=radio] { + position: absolute; + clip: rect(0,0,0,0); + pointer-events: none; +} + +.input-group { + position: relative; + display: table; + border-collapse: separate; +} + +.input-group[class*=col-] { + float: none; + padding-right: 0; + padding-left: 0; +} + +.input-group .form-control { + position: relative; + z-index: 2; + float: left; + width: 100%; + margin-bottom: 0; +} + +.input-group-lg>.form-control, .input-group-lg>.input-group-addon, .input-group-lg>.input-group-btn>.btn { + height: 46px; + padding: 10px 16px; + font-size: 18px; + line-height: 1.3333333; + border-radius: 6px; +} + +select.input-group-lg>.form-control, select.input-group-lg>.input-group-addon, select.input-group-lg>.input-group-btn>.btn { + height: 46px; + line-height: 46px; +} + +select[multiple].input-group-lg>.form-control, select[multiple].input-group-lg>.input-group-addon, select[multiple].input-group-lg>.input-group-btn>.btn, textarea.input-group-lg>.form-control, textarea.input-group-lg>.input-group-addon, textarea.input-group-lg>.input-group-btn>.btn { + height: auto; +} + +.input-group-sm>.form-control, .input-group-sm>.input-group-addon, .input-group-sm>.input-group-btn>.btn { + height: 30px; + padding: 5px 10px; + font-size: 12px; + line-height: 1.5; + border-radius: 3px; +} + +select.input-group-sm>.form-control, select.input-group-sm>.input-group-addon, select.input-group-sm>.input-group-btn>.btn { + height: 30px; + line-height: 30px; +} + +select[multiple].input-group-sm>.form-control, select[multiple].input-group-sm>.input-group-addon, select[multiple].input-group-sm>.input-group-btn>.btn, textarea.input-group-sm>.form-control, textarea.input-group-sm>.input-group-addon, textarea.input-group-sm>.input-group-btn>.btn { + height: auto; +} + +.input-group .form-control, .input-group-addon, .input-group-btn { + display: table-cell; +} + +.input-group .form-control:not(:first-child):not(:last-child), .input-group-addon:not(:first-child):not(:last-child), .input-group-btn:not(:first-child):not(:last-child) { + border-radius: 0; +} + +.input-group-addon, .input-group-btn { + width: 1%; + white-space: nowrap; + vertical-align: middle; +} + +.input-group-addon { + padding: 6px 12px; + font-size: 14px; + font-weight: 400; + line-height: 1; + color: #555; + text-align: center; + background-color: #eee; + border: 1px solid #ccc; + border-radius: 4px; +} + +.input-group-addon.input-sm { + padding: 5px 10px; + font-size: 12px; + border-radius: 3px; +} + +.input-group-addon.input-lg { + padding: 10px 16px; + font-size: 18px; + border-radius: 6px; +} + +.input-group-addon input[type=checkbox], .input-group-addon input[type=radio] { + margin-top: 0; +} + +.input-group .form-control:first-child, .input-group-addon:first-child, .input-group-btn:first-child>.btn, .input-group-btn:first-child>.btn-group>.btn, .input-group-btn:first-child>.dropdown-toggle, .input-group-btn:last-child>.btn-group:not(:last-child)>.btn, .input-group-btn:last-child>.btn:not(:last-child):not(.dropdown-toggle) { + border-top-right-radius: 0; + border-bottom-right-radius: 0; +} + +.input-group-addon:first-child { + border-right: 0; +} + +.input-group .form-control:last-child, .input-group-addon:last-child, .input-group-btn:first-child>.btn-group:not(:first-child)>.btn, .input-group-btn:first-child>.btn:not(:first-child), .input-group-btn:last-child>.btn, .input-group-btn:last-child>.btn-group>.btn, .input-group-btn:last-child>.dropdown-toggle { + border-top-left-radius: 0; + border-bottom-left-radius: 0; +} + +.input-group-addon:last-child { + border-left: 0; +} + +.input-group-btn { + position: relative; + font-size: 0; + white-space: nowrap; +} + +.input-group-btn>.btn { + position: relative; +} + +.input-group-btn>.btn+.btn { + margin-left: -1px; +} + +.input-group-btn>.btn:active, .input-group-btn>.btn:focus, .input-group-btn>.btn:hover { + z-index: 2; +} + +.input-group-btn:first-child>.btn, .input-group-btn:first-child>.btn-group { + margin-right: -1px; +} + +.input-group-btn:last-child>.btn, .input-group-btn:last-child>.btn-group { + margin-left: -1px; +} + +.nav { + padding-left: 0; + margin-bottom: 0; + list-style: none; +} + +.nav>li { + position: relative; + display: block; +} + +.nav>li>a { + position: relative; + display: block; + padding: 10px 15px; +} + +.nav>li>a:focus, .nav>li>a:hover { + text-decoration: none; + background-color: #eee; +} + +.nav>li.disabled>a { + color: #777; +} + +.nav>li.disabled>a:focus, .nav>li.disabled>a:hover { + color: #777; + text-decoration: none; + cursor: not-allowed; + background-color: transparent; +} + +.nav .open>a, .nav .open>a:focus, .nav .open>a:hover { + background-color: #eee; + border-color: #337ab7; +} + +.nav .nav-divider { + height: 1px; + margin: 9px 0; + overflow: hidden; + background-color: #e5e5e5; +} + +.nav>li>a>img { + max-width: none; +} + +.nav-tabs { + border-bottom: 1px solid #ddd; +} + +.nav-tabs>li { + float: left; + margin-bottom: -1px; +} + +.nav-tabs>li>a { + margin-right: 2px; + line-height: 1.42857143; + border: 1px solid transparent; + border-radius: 4px 4px 0 0; +} + +.nav-tabs>li>a:hover { + border-color: #eee #eee #ddd; +} + +.nav-tabs>li.active>a, .nav-tabs>li.active>a:focus, .nav-tabs>li.active>a:hover { + color: #555; + cursor: default; + background-color: #fff; + border: 1px solid #ddd; + border-bottom-color: transparent; +} + +.nav-tabs.nav-justified { + width: 100%; + border-bottom: 0; +} + +.nav-tabs.nav-justified>li { + float: none; +} + +.nav-tabs.nav-justified>li>a { + margin-bottom: 5px; + text-align: center; +} + +.nav-tabs.nav-justified>.dropdown .dropdown-menu { + top: auto; + left: auto; +} + +@media (min-width:768px) { + .nav-tabs.nav-justified>li { + display: table-cell; + width: 1%; + } + + .nav-tabs.nav-justified>li>a { + margin-bottom: 0; + } +} + +.nav-tabs.nav-justified>li>a { + margin-right: 0; + border-radius: 4px; +} + +.nav-tabs.nav-justified>.active>a, .nav-tabs.nav-justified>.active>a:focus, .nav-tabs.nav-justified>.active>a:hover { + border: 1px solid #ddd; +} + +@media (min-width:768px) { + .nav-tabs.nav-justified>li>a { + border-bottom: 1px solid #ddd; + border-radius: 4px 4px 0 0; + } + + .nav-tabs.nav-justified>.active>a, .nav-tabs.nav-justified>.active>a:focus, .nav-tabs.nav-justified>.active>a:hover { + border-bottom-color: #fff; + } +} + +.nav-pills>li { + float: left; +} + +.nav-pills>li>a { + border-radius: 4px; +} + +.nav-pills>li+li { + margin-left: 2px; +} + +.nav-pills>li.active>a, .nav-pills>li.active>a:focus, .nav-pills>li.active>a:hover { + color: #fff; + background-color: #337ab7; +} + +.nav-stacked>li { + float: none; +} + +.nav-stacked>li+li { + margin-top: 2px; + margin-left: 0; +} + +.nav-justified { + width: 100%; +} + +.nav-justified>li { + float: none; +} + +.nav-justified>li>a { + margin-bottom: 5px; + text-align: center; +} + +.nav-justified>.dropdown .dropdown-menu { + top: auto; + left: auto; +} + +@media (min-width:768px) { + .nav-justified>li { + display: table-cell; + width: 1%; + } + + .nav-justified>li>a { + margin-bottom: 0; + } +} + +.nav-tabs-justified { + border-bottom: 0; +} + +.nav-tabs-justified>li>a { + margin-right: 0; + border-radius: 4px; +} + +.nav-tabs-justified>.active>a, .nav-tabs-justified>.active>a:focus, .nav-tabs-justified>.active>a:hover { + border: 1px solid #ddd; +} + +@media (min-width:768px) { + .nav-tabs-justified>li>a { + border-bottom: 1px solid #ddd; + border-radius: 4px 4px 0 0; + } + + .nav-tabs-justified>.active>a, .nav-tabs-justified>.active>a:focus, .nav-tabs-justified>.active>a:hover { + border-bottom-color: #fff; + } +} + +.tab-content>.tab-pane { + display: none; + visibility: hidden; +} + +.tab-content>.active { + display: block; + visibility: visible; +} + +.nav-tabs .dropdown-menu { + margin-top: -1px; + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +.navbar { + position: relative; + margin-bottom: 20px; + border: 1px solid transparent; +} + +@media (min-width:768px) { + .navbar { + border-radius: 4px; + } +} + +@media (min-width:992px) { + .navbar-header { + float: left; + } +} + +.navbar-collapse { + padding-right: 15px; + padding-left: 15px; + overflow-x: visible; + -webkit-overflow-scrolling: touch; + border-top: 1px solid transparent; + -webkit-box-shadow: inset 0 1px 0 rgba(255,255,255,.1); + box-shadow: inset 0 1px 0 rgba(255,255,255,.1); +} + +.navbar-collapse.in { + overflow-y: auto; +} + +@media (min-width:992px) { + .navbar-collapse { + width: auto; + border-top: 0; + -webkit-box-shadow: none; + box-shadow: none; + } + + .navbar-collapse.collapse { + display: block!important; + height: auto!important; + padding-bottom: 0; + overflow: visible!important; + visibility: visible!important; + } + + .navbar-collapse.in { + overflow-y: visible; + } + + .navbar-fixed-bottom .navbar-collapse, .navbar-fixed-top .navbar-collapse, .navbar-static-top .navbar-collapse { + padding-right: 0; + padding-left: 0; + } +} + +.navbar-fixed-bottom .navbar-collapse, .navbar-fixed-top .navbar-collapse { + + max-height: 340px; +} + +@media (max-device-width:480px) and (orientation:landscape) { + .navbar-fixed-bottom .navbar-collapse, .navbar-fixed-top .navbar-collapse { + max-height: 200px; + } +} + +.container-fluid>.navbar-collapse, .container-fluid>.navbar-header, .container>.navbar-collapse, .container>.navbar-header { + margin-right: -15px; + margin-left: -15px; +} + +@media (min-width:768px) { + .container-fluid>.navbar-collapse, .container-fluid>.navbar-header, .container>.navbar-collapse, .container>.navbar-header { + margin-right: 0; + margin-left: 0; + } +} + +.navbar-static-top { + z-index: 1000; + border-width: 0 0 1px; +} + +@media (min-width:768px) { + .navbar-static-top { + border-radius: 0; + } +} + +.navbar-fixed-bottom, .navbar-fixed-top { + position: fixed; + right: 0; + left: 0; + z-index: 1030; +} + +@media (min-width:768px) { + .navbar-fixed-bottom, .navbar-fixed-top { + border-radius: 0; + } +} + +.navbar-fixed-top { + top: 0; + border-width: 0 0 1px; +} + +.navbar-fixed-bottom { + bottom: 0; + margin-bottom: 0; + border-width: 1px 0 0; +} + +.navbar-brand { + float: left; + padding: 15px 15px; + font-size: 18px; + line-height: 20px; +} + +.navbar-brand:focus, .navbar-brand:hover { + text-decoration: none; +} + +.navbar-brand>img { + display: block; +} + +@media (min-width:768px) { + .navbar>.container .navbar-brand, .navbar>.container-fluid .navbar-brand { + margin-left: -15px; + } +} + +.navbar-toggle { + position: relative; + float: right; + padding: 4px 6px; + margin-top: 32px; + margin-right: 0px; + margin-bottom: 0px; + background-color: #ed1c24; + background-image: none; + border: none; + border-radius: 2px; +} + +.navbar-toggle:focus { + outline: 0; +} + +.navbar-toggle .icon-bar { + display: block; + width: 22px; + height: 2px; + border-radius: 1px; +} + +.navbar-toggle .icon-bar+.icon-bar { + margin-top: 4px; +} + +@media (min-width:992px) { + .navbar-toggle { + display: none; + } +} + +.navbar-nav { + margin: 7.5px -15px; +} + +.navbar-nav>li>a { + padding-top: 10px; + padding-bottom: 10px; + line-height: 20px; +} + +@media (max-width:767px) { + .navbar-nav .open .dropdown-menu { + position: static; + float: none; + width: auto; + margin-top: 0; + background-color: transparent; + border: 0; + -webkit-box-shadow: none; + box-shadow: none; + } + + .navbar-nav .open .dropdown-menu .dropdown-header, .navbar-nav .open .dropdown-menu>li>a { + padding: 5px 15px 5px 25px; + } + + .navbar-nav .open .dropdown-menu>li>a { + line-height: 20px; + } + + .navbar-nav .open .dropdown-menu>li>a:focus, .navbar-nav .open .dropdown-menu>li>a:hover { + background-image: none; + } +} + +@media (min-width:768px) { + .navbar-nav { + float: left; + margin: 0; + } + + .navbar-nav>li { + float: left; + } + + .navbar-nav>li>a { + padding-top: 15px; + padding-bottom: 15px; + } +} + +.navbar-form { + padding: 10px 15px; + margin-top: 8px; + margin-right: -15px; + margin-bottom: 8px; + margin-left: -15px; + border-top: 1px solid transparent; + border-bottom: 1px solid transparent; + -webkit-box-shadow: inset 0 1px 0 rgba(255,255,255,.1), 0 1px 0 rgba(255,255,255,.1); + box-shadow: inset 0 1px 0 rgba(255,255,255,.1), 0 1px 0 rgba(255,255,255,.1); +} + +@media (min-width:768px) { + .navbar-form .form-group { + display: inline-block; + margin-bottom: 0; + vertical-align: middle; + } + + .navbar-form .form-control { + display: inline-block; + width: auto; + vertical-align: middle; + } + + .navbar-form .form-control-static { + display: inline-block; + } + + .navbar-form .input-group { + display: inline-table; + vertical-align: middle; + } + + .navbar-form .input-group .form-control, .navbar-form .input-group .input-group-addon, .navbar-form .input-group .input-group-btn { + width: auto; + } + + .navbar-form .input-group>.form-control { + width: 100%; + } + + .navbar-form .control-label { + margin-bottom: 0; + vertical-align: middle; + } + + .navbar-form .checkbox, .navbar-form .radio { + display: inline-block; + margin-top: 0; + margin-bottom: 0; + vertical-align: middle; + } + + .navbar-form .checkbox label, .navbar-form .radio label { + padding-left: 0; + } + + .navbar-form .checkbox input[type=checkbox], .navbar-form .radio input[type=radio] { + position: relative; + margin-left: 0; + } + + .navbar-form .has-feedback .form-control-feedback { + top: 0; + } +} + +@media (max-width:767px) { + .navbar-form .form-group { + margin-bottom: 5px; + } + + .navbar-form .form-group:last-child { + margin-bottom: 0; + } +} + +@media (min-width:768px) { + .navbar-form { + width: auto; + padding-top: 0; + padding-bottom: 0; + margin-right: 0; + margin-left: 0; + border: 0; + -webkit-box-shadow: none; + box-shadow: none; + } +} + +.navbar-nav>li>.dropdown-menu { + margin-top: 0; + border-top-left-radius: 0; + border-top-right-radius: 0; +} + +.navbar-fixed-bottom .navbar-nav>li>.dropdown-menu { + margin-bottom: 0; + border-top-left-radius: 4px; + border-top-right-radius: 4px; + border-bottom-right-radius: 0; + border-bottom-left-radius: 0; +} + +.navbar-btn { + margin-top: 8px; + margin-bottom: 8px; +} + +.navbar-btn.btn-sm { + margin-top: 10px; + margin-bottom: 10px; +} + +.navbar-btn.btn-xs { + margin-top: 14px; + margin-bottom: 14px; +} + +.navbar-text { + margin-top: 15px; + margin-bottom: 15px; +} + +@media (min-width:768px) { + .navbar-text { + float: left; + margin-right: 15px; + margin-left: 15px; + } +} + +@media (min-width:768px) { + .navbar-left { + float: left!important; + } + + .navbar-right { + float: right!important; + margin-right: -15px; + } + + .navbar-right~.navbar-right { + margin-right: 0; + } +} + +.navbar-default { + background-color: #f8f8f8; + border-color: #e7e7e7; +} + +.navbar-default .navbar-brand { + color: #777; +} + +.navbar-default .navbar-brand:focus, .navbar-default .navbar-brand:hover { + color: #5e5e5e; + background-color: transparent; +} + +.navbar-default .navbar-text { + color: #777; +} + +.navbar-default .navbar-nav>li>a { + color: #777; +} + +.navbar-default .navbar-nav>li>a:focus, .navbar-default .navbar-nav>li>a:hover { + color: #333; + background-color: transparent; +} + +.navbar-default .navbar-nav>.active>a, .navbar-default .navbar-nav>.active>a:focus, .navbar-default .navbar-nav>.active>a:hover { + color: #555; + background-color: #e7e7e7; +} + +.navbar-default .navbar-nav>.disabled>a, .navbar-default .navbar-nav>.disabled>a:focus, .navbar-default .navbar-nav>.disabled>a:hover { + color: #ccc; + background-color: transparent; +} + +.navbar-default .navbar-toggle { + border-color: #c0070e; +} + +.navbar-default .navbar-toggle:focus, .navbar-default .navbar-toggle:hover { + background-color: #c0070e; +} + +.navbar-default .navbar-toggle .icon-bar { + background-color: #c0070e; +} + +.navbar-default .navbar-collapse, .navbar-default .navbar-form { + border-color: #e7e7e7; +} + +.navbar-default .navbar-nav>.open>a, .navbar-default .navbar-nav>.open>a:focus, .navbar-default .navbar-nav>.open>a:hover { + color: #555; + background-color: #e7e7e7; +} + +@media (max-width:767px) { + .navbar-default .navbar-nav .open .dropdown-menu>li>a { + color: #777; + } + + .navbar-default .navbar-nav .open .dropdown-menu>li>a:focus, .navbar-default .navbar-nav .open .dropdown-menu>li>a:hover { + color: #333; + background-color: transparent; + } + + .navbar-default .navbar-nav .open .dropdown-menu>.active>a, .navbar-default .navbar-nav .open .dropdown-menu>.active>a:focus, .navbar-default .navbar-nav .open .dropdown-menu>.active>a:hover { + color: #555; + background-color: #e7e7e7; + } + + .navbar-default .navbar-nav .open .dropdown-menu>.disabled>a, .navbar-default .navbar-nav .open .dropdown-menu>.disabled>a:focus, .navbar-default .navbar-nav .open .dropdown-menu>.disabled>a:hover { + color: #ccc; + background-color: transparent; + } +} + +.navbar-default .navbar-link { + color: #777; +} + +.navbar-default .navbar-link:hover { + color: #333; +} + +.navbar-default .btn-link { + color: #777; +} + +.navbar-default .btn-link:focus, .navbar-default .btn-link:hover { + color: #333; +} + +.navbar-default .btn-link[disabled]:focus, .navbar-default .btn-link[disabled]:hover, fieldset[disabled] .navbar-default .btn-link:focus, fieldset[disabled] .navbar-default .btn-link:hover { + color: #ccc; +} + +.navbar-inverse { + background-color: #222; + border-color: #080808; +} + +.navbar-inverse .navbar-brand { + color: #9d9d9d; +} + +.navbar-inverse .navbar-brand:focus, .navbar-inverse .navbar-brand:hover { + color: #fff; + background-color: transparent; +} + +.navbar-inverse .navbar-text { + color: #9d9d9d; +} + +.navbar-inverse .navbar-nav>li>a { + color: #9d9d9d; +} + +.navbar-inverse .navbar-nav>li>a:focus, .navbar-inverse .navbar-nav>li>a:hover { + color: #fff; + background-color: transparent; +} + +.navbar-inverse .navbar-nav>.active>a, .navbar-inverse .navbar-nav>.active>a:focus, .navbar-inverse .navbar-nav>.active>a:hover { + color: #fff; + background-color: #080808; +} + +.navbar-inverse .navbar-nav>.disabled>a, .navbar-inverse .navbar-nav>.disabled>a:focus, .navbar-inverse .navbar-nav>.disabled>a:hover { + color: #444; + background-color: transparent; +} + +.navbar-inverse .navbar-toggle { + border-color: #333; +} + +.navbar-inverse .navbar-toggle:focus, .navbar-inverse .navbar-toggle:hover { + background-color: #333; +} + +.navbar-inverse .navbar-toggle .icon-bar { + background-color: #fff; +} + +.navbar-inverse .navbar-collapse, .navbar-inverse .navbar-form { + border-color: #101010; +} + +.navbar-inverse .navbar-nav>.open>a, .navbar-inverse .navbar-nav>.open>a:focus, .navbar-inverse .navbar-nav>.open>a:hover { + color: #fff; + background-color: #080808; +} + +@media (max-width:767px) { + .navbar-inverse .navbar-nav .open .dropdown-menu>.dropdown-header { + border-color: #080808; + } + + .navbar-inverse .navbar-nav .open .dropdown-menu .divider { + background-color: #080808; + } + + .navbar-inverse .navbar-nav .open .dropdown-menu>li>a { + color: #9d9d9d; + } + + .navbar-inverse .navbar-nav .open .dropdown-menu>li>a:focus, .navbar-inverse .navbar-nav .open .dropdown-menu>li>a:hover { + color: #fff; + background-color: transparent; + } + + .navbar-inverse .navbar-nav .open .dropdown-menu>.active>a, .navbar-inverse .navbar-nav .open .dropdown-menu>.active>a:focus, .navbar-inverse .navbar-nav .open .dropdown-menu>.active>a:hover { + color: #fff; + background-color: #080808; + } + + .navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a, .navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a:focus, .navbar-inverse .navbar-nav .open .dropdown-menu>.disabled>a:hover { + color: #444; + background-color: transparent; + } +} + +.navbar-inverse .navbar-link { + color: #9d9d9d; +} + +.navbar-inverse .navbar-link:hover { + color: #fff; +} + +.navbar-inverse .btn-link { + color: #9d9d9d; +} + +.navbar-inverse .btn-link:focus, .navbar-inverse .btn-link:hover { + color: #fff; +} + +.navbar-inverse .btn-link[disabled]:focus, .navbar-inverse .btn-link[disabled]:hover, fieldset[disabled] .navbar-inverse .btn-link:focus, fieldset[disabled] .navbar-inverse .btn-link:hover { + color: #444; +} + +.breadcrumb { + padding: 8px 15px; + margin-bottom: 20px; + list-style: none; + background-color: #f5f5f5; + border-radius: 0px; line-height:34px; border-bottom:1px solid #cccccc; +} + +.breadcrumb>li { + display: inline-block; +} + +.breadcrumb>li+li:before { + padding: 0 5px; + color: #9c9c9c; + content: "/\00a0"; +} + +.breadcrumb>.active { + color: #333; +} + +.pagination { + display: inline-block; + padding-left: 0; + margin: 20px 0; + border-radius: 4px; +} + +.pagination>li { + display: inline; +} + +.pagination>li>a, .pagination>li>span { + position: relative; + float: left; + padding: 6px 12px; + margin-left: -1px; + line-height: 1.42857143; + color: #337ab7; + text-decoration: none; + background-color: #fff; + border: 1px solid #ddd; +} + +.pagination>li:first-child>a, .pagination>li:first-child>span { + margin-left: 0; + border-top-left-radius: 4px; + border-bottom-left-radius: 4px; +} + +.pagination>li:last-child>a, .pagination>li:last-child>span { + border-top-right-radius: 4px; + border-bottom-right-radius: 4px; +} + +.pagination>li>a:focus, .pagination>li>a:hover, .pagination>li>span:focus, .pagination>li>span:hover { + color: #23527c; + background-color: #eee; + border-color: #ddd; +} + +.pagination>.active>a, .pagination>.active>a:focus, .pagination>.active>a:hover, .pagination>.active>span, .pagination>.active>span:focus, .pagination>.active>span:hover { + z-index: 2; + color: #fff; + cursor: default; + background-color: #337ab7; + border-color: #337ab7; +} + +.pagination>.disabled>a, .pagination>.disabled>a:focus, .pagination>.disabled>a:hover, .pagination>.disabled>span, .pagination>.disabled>span:focus, .pagination>.disabled>span:hover { + color: #777; + cursor: not-allowed; + background-color: #fff; + border-color: #ddd; +} + +.pagination-lg>li>a, .pagination-lg>li>span { + padding: 10px 16px; + font-size: 18px; +} + +.pagination-lg>li:first-child>a, .pagination-lg>li:first-child>span { + border-top-left-radius: 6px; + border-bottom-left-radius: 6px; +} + +.pagination-lg>li:last-child>a, .pagination-lg>li:last-child>span { + border-top-right-radius: 6px; + border-bottom-right-radius: 6px; +} + +.pagination-sm>li>a, .pagination-sm>li>span { + padding: 5px 10px; + font-size: 12px; +} + +.pagination-sm>li:first-child>a, .pagination-sm>li:first-child>span { + border-top-left-radius: 3px; + border-bottom-left-radius: 3px; +} + +.pagination-sm>li:last-child>a, .pagination-sm>li:last-child>span { + border-top-right-radius: 3px; + border-bottom-right-radius: 3px; +} + +.pager { + padding-left: 0; + margin: 20px 0; + text-align: center; + list-style: none; +} + +.pager li { + display: inline; +} + +.pager li>a, .pager li>span { + display: inline-block; + padding: 5px 14px; + background-color: #fff; + border: 1px solid #ddd; + border-radius: 15px; +} + +.pager li>a:focus, .pager li>a:hover { + text-decoration: none; + background-color: #eee; +} + +.pager .next>a, .pager .next>span { + float: right; +} + +.pager .previous>a, .pager .previous>span { + float: left; +} + +.pager .disabled>a, .pager .disabled>a:focus, .pager .disabled>a:hover, .pager .disabled>span { + color: #777; + cursor: not-allowed; + background-color: #fff; +} + +.label { + display: inline; + padding: .2em .6em .3em; + font-size: 75%; + font-weight: 700; + line-height: 1; + color: #fff; + text-align: center; + white-space: nowrap; + vertical-align: baseline; + border-radius: .25em; +} + +a.label:focus, a.label:hover { + color: #fff; + text-decoration: none; + cursor: pointer; +} + +.label:empty { + display: none; +} + +.btn .label { + position: relative; + top: -1px; +} + +.label-default { + background-color: #777; +} + +.label-default[href]:focus, .label-default[href]:hover { + background-color: #5e5e5e; +} + +.label-primary { + background-color: #337ab7; +} + +.label-primary[href]:focus, .label-primary[href]:hover { + background-color: #286090; +} + +.label-success { + background-color: #5cb85c; +} + +.label-success[href]:focus, .label-success[href]:hover { + background-color: #449d44; +} + +.label-info { + background-color: #5bc0de; +} + +.label-info[href]:focus, .label-info[href]:hover { + background-color: #31b0d5; +} + +.label-warning { + background-color: #f0ad4e; +} + +.label-warning[href]:focus, .label-warning[href]:hover { + background-color: #ec971f; +} + +.label-danger { + background-color: #d9534f; +} + +.label-danger[href]:focus, .label-danger[href]:hover { + background-color: #c9302c; +} + +.badge { + display: inline-block; + min-width: 10px; + padding: 3px 7px; + font-size: 12px; + font-weight: 700; + line-height: 1; + color: #fff; + text-align: center; + white-space: nowrap; + vertical-align: baseline; + background-color: #777; + border-radius: 10px; +} + +.badge:empty { + display: none; +} + +.btn .badge { + position: relative; + top: -1px; +} + +.btn-xs .badge { + top: 0; + padding: 1px 5px; +} + +a.badge:focus, a.badge:hover { + color: #fff; + text-decoration: none; + cursor: pointer; +} + +.list-group-item.active>.badge, .nav-pills>.active>a>.badge { + color: #337ab7; + background-color: #fff; +} + +.list-group-item>.badge { + float: right; +} + +.list-group-item>.badge+.badge { + margin-right: 5px; +} + +.nav-pills>li>a>.badge { + margin-left: 3px; +} + +.jumbotron { + padding: 30px 15px; + margin-bottom: 30px; + color: inherit; + background-color: #eee; +} + +.jumbotron .h1, .jumbotron h1 { + color: inherit; +} + +.jumbotron p { + margin-bottom: 15px; + font-size: 21px; + font-weight: 200; +} + +.jumbotron>hr { + border-top-color: #d5d5d5; +} + +.container .jumbotron, .container-fluid .jumbotron { + border-radius: 6px; +} + +.jumbotron .container { + max-width: 100%; +} + +@media screen and (min-width:768px) { + .jumbotron { + padding: 48px 0; + } + + .container .jumbotron, .container-fluid .jumbotron { + padding-right: 60px; + padding-left: 60px; + } + + .jumbotron .h1, .jumbotron h1 { + font-size: 63px; + } +} + +.thumbnail { + display: block; + padding: 4px; + margin-bottom: 20px; + line-height: 1.42857143; + background-color: #fff; + border: 1px solid #ddd; + border-radius: 4px; + -webkit-transition: border .2s ease-in-out; + -o-transition: border .2s ease-in-out; + transition: border .2s ease-in-out; +} + +.thumbnail a>img, .thumbnail>img { + margin-right: auto; + margin-left: auto; +} + +a.thumbnail.active, a.thumbnail:focus, a.thumbnail:hover { + border-color: #337ab7; +} + +.thumbnail .caption { + padding: 9px; + color: #333; +} + +.alert { + padding: 15px; + margin-bottom: 20px; + border: 1px solid transparent; + border-radius: 4px; +} + +.alert h4 { + margin-top: 0; + color: inherit; +} + +.alert .alert-link { + font-weight: 700; +} + +.alert>p, .alert>ul { + margin-bottom: 0; +} + +.alert>p+p { + margin-top: 5px; +} + +.alert-dismissable, .alert-dismissible { + padding-right: 35px; +} + +.alert-dismissable .close, .alert-dismissible .close { + position: relative; + top: -2px; + right: -21px; + color: inherit; +} + +.alert-success { + color: #3c763d; + background-color: #dff0d8; + border-color: #d6e9c6; +} + +.alert-success hr { + border-top-color: #c9e2b3; +} + +.alert-success .alert-link { + color: #2b542c; +} + +.alert-info { + color: #31708f; + background-color: #d9edf7; + border-color: #bce8f1; +} + +.alert-info hr { + border-top-color: #a6e1ec; +} + +.alert-info .alert-link { + color: #245269; +} + +.alert-warning { + color: #8a6d3b; + background-color: #fcf8e3; + border-color: #faebcc; +} + +.alert-warning hr { + border-top-color: #f7e1b5; +} + +.alert-warning .alert-link { + color: #66512c; +} + +.alert-danger { + color: #a94442; + background-color: #f2dede; + border-color: #ebccd1; +} + +.alert-danger hr { + border-top-color: #e4b9c0; +} + +.alert-danger .alert-link { + color: #843534; +} + +@-webkit-keyframes progress-bar-stripes { + from { + background-position: 40px 0; + } + + to { + background-position: 0 0; + } +} + +@-o-keyframes progress-bar-stripes { + from { + background-position: 40px 0; + } + + to { + background-position: 0 0; + } +} + +@keyframes progress-bar-stripes { + from { + background-position: 40px 0; + } + + to { + background-position: 0 0; + } +} + +.progress { + height: 20px; + margin-bottom: 20px; + overflow: hidden; + background-color: #f5f5f5; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 2px rgba(0,0,0,.1); + box-shadow: inset 0 1px 2px rgba(0,0,0,.1); +} + +.progress-bar { + float: left; + width: 0; + height: 100%; + font-size: 12px; + line-height: 20px; + color: #fff; + text-align: center; + background-color: #337ab7; + -webkit-box-shadow: inset 0 -1px 0 rgba(0,0,0,.15); + box-shadow: inset 0 -1px 0 rgba(0,0,0,.15); + -webkit-transition: width .6s ease; + -o-transition: width .6s ease; + transition: width .6s ease; +} + +.progress-bar-striped, .progress-striped .progress-bar { + background-image: -webkit-linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); + -webkit-background-size: 40px 40px; + background-size: 40px 40px; +} + +.progress-bar.active, .progress.active .progress-bar { + -webkit-animation: progress-bar-stripes 2s linear infinite; + -o-animation: progress-bar-stripes 2s linear infinite; + animation: progress-bar-stripes 2s linear infinite; +} + +.progress-bar-success { + background-color: #5cb85c; +} + +.progress-striped .progress-bar-success { + background-image: -webkit-linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); +} + +.progress-bar-info { + background-color: #5bc0de; +} + +.progress-striped .progress-bar-info { + background-image: -webkit-linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); +} + +.progress-bar-warning { + background-color: #f0ad4e; +} + +.progress-striped .progress-bar-warning { + background-image: -webkit-linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); +} + +.progress-bar-danger { + background-color: #d9534f; +} + +.progress-striped .progress-bar-danger { + background-image: -webkit-linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); + background-image: -o-linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); + background-image: linear-gradient(45deg, rgba(255,255,255,.15) 25%, transparent 25%, transparent 50%, rgba(255,255,255,.15) 50%, rgba(255,255,255,.15) 75%, transparent 75%, transparent); +} + +.media { + margin-top: 15px; +} + +.media:first-child { + margin-top: 0; +} + +.media, .media-body { + overflow: hidden; + zoom: 1; +} + +.media-body { + width: 10000px; +} + +.media-object { + display: block; +} + +.media-right, .media>.pull-right { + padding-left: 10px; +} + +.media-left, .media>.pull-left { + padding-right: 10px; +} + +.media-body, .media-left, .media-right { + display: table-cell; + vertical-align: top; +} + +.media-middle { + vertical-align: middle; +} + +.media-bottom { + vertical-align: bottom; +} + +.media-heading { + margin-top: 0; + margin-bottom: 5px; +} + +.media-list { + padding-left: 0; + list-style: none; +} + +.list-group { + padding-left: 0; + margin-bottom: 20px; +} + +.list-group-item { + position: relative; + display: block; + padding: 10px 15px; + margin-bottom: -1px; + background-color: #fff; + border: 1px solid #ddd; +} + +.list-group-item:first-child { + border-top-left-radius: 4px; + border-top-right-radius: 4px; +} + +.list-group-item:last-child { + margin-bottom: 0; + border-bottom-right-radius: 4px; + border-bottom-left-radius: 4px; +} + +a.list-group-item { + color: #555; +} + +a.list-group-item .list-group-item-heading { + color: #333; +} + +a.list-group-item:focus, a.list-group-item:hover { + color: #555; + text-decoration: none; + background-color: #f5f5f5; +} + +.list-group-item.disabled, .list-group-item.disabled:focus, .list-group-item.disabled:hover { + color: #777; + cursor: not-allowed; + background-color: #eee; +} + +.list-group-item.disabled .list-group-item-heading, .list-group-item.disabled:focus .list-group-item-heading, .list-group-item.disabled:hover .list-group-item-heading { + color: inherit; +} + +.list-group-item.disabled .list-group-item-text, .list-group-item.disabled:focus .list-group-item-text, .list-group-item.disabled:hover .list-group-item-text { + color: #777; +} + +.list-group-item.active, .list-group-item.active:focus, .list-group-item.active:hover { + z-index: 2; + color: #fff; + background-color: #337ab7; + border-color: #337ab7; +} + +.list-group-item.active .list-group-item-heading, .list-group-item.active .list-group-item-heading>.small, .list-group-item.active .list-group-item-heading>small, .list-group-item.active:focus .list-group-item-heading, .list-group-item.active:focus .list-group-item-heading>.small, .list-group-item.active:focus .list-group-item-heading>small, .list-group-item.active:hover .list-group-item-heading, .list-group-item.active:hover .list-group-item-heading>.small, .list-group-item.active:hover .list-group-item-heading>small { + color: inherit; +} + +.list-group-item.active .list-group-item-text, .list-group-item.active:focus .list-group-item-text, .list-group-item.active:hover .list-group-item-text { + color: #c7ddef; +} + +.list-group-item-success { + color: #3c763d; + background-color: #dff0d8; +} + +a.list-group-item-success { + color: #3c763d; +} + +a.list-group-item-success .list-group-item-heading { + color: inherit; +} + +a.list-group-item-success:focus, a.list-group-item-success:hover { + color: #3c763d; + background-color: #d0e9c6; +} + +a.list-group-item-success.active, a.list-group-item-success.active:focus, a.list-group-item-success.active:hover { + color: #fff; + background-color: #3c763d; + border-color: #3c763d; +} + +.list-group-item-info { + color: #31708f; + background-color: #d9edf7; +} + +a.list-group-item-info { + color: #31708f; +} + +a.list-group-item-info .list-group-item-heading { + color: inherit; +} + +a.list-group-item-info:focus, a.list-group-item-info:hover { + color: #31708f; + background-color: #c4e3f3; +} + +a.list-group-item-info.active, a.list-group-item-info.active:focus, a.list-group-item-info.active:hover { + color: #fff; + background-color: #31708f; + border-color: #31708f; +} + +.list-group-item-warning { + color: #8a6d3b; + background-color: #fcf8e3; +} + +a.list-group-item-warning { + color: #8a6d3b; +} + +a.list-group-item-warning .list-group-item-heading { + color: inherit; +} + +a.list-group-item-warning:focus, a.list-group-item-warning:hover { + color: #8a6d3b; + background-color: #faf2cc; +} + +a.list-group-item-warning.active, a.list-group-item-warning.active:focus, a.list-group-item-warning.active:hover { + color: #fff; + background-color: #8a6d3b; + border-color: #8a6d3b; +} + +.list-group-item-danger { + color: #a94442; + background-color: #f2dede; +} + +a.list-group-item-danger { + color: #a94442; +} + +a.list-group-item-danger .list-group-item-heading { + color: inherit; +} + +a.list-group-item-danger:focus, a.list-group-item-danger:hover { + color: #a94442; + background-color: #ebcccc; +} + +a.list-group-item-danger.active, a.list-group-item-danger.active:focus, a.list-group-item-danger.active:hover { + color: #fff; + background-color: #a94442; + border-color: #a94442; +} + +.list-group-item-heading { + margin-top: 0; + margin-bottom: 5px; +} + +.list-group-item-text { + margin-bottom: 0; + line-height: 1.3; +} + +.panel { + margin-bottom: 20px; + background-color: #fff; + border: 1px solid transparent; + border-radius: 4px; + -webkit-box-shadow: 0 1px 1px rgba(0,0,0,.05); + box-shadow: 0 1px 1px rgba(0,0,0,.05); +} + +.panel-body { + padding: 15px; +} + +.panel-heading { + padding: 10px 15px; + border-bottom: 1px solid transparent; + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.panel-heading>.dropdown .dropdown-toggle { + color: inherit; +} + +.panel-title { + margin-top: 0; + margin-bottom: 0; + font-size: 16px; + color: inherit; +} + +.panel-title>.small, .panel-title>.small>a, .panel-title>a, .panel-title>small, .panel-title>small>a { + color: inherit; +} + +.panel-footer { + padding: 10px 15px; + background-color: #f5f5f5; + border-top: 1px solid #ddd; + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} + +.panel>.list-group, .panel>.panel-collapse>.list-group { + margin-bottom: 0; +} + +.panel>.list-group .list-group-item, .panel>.panel-collapse>.list-group .list-group-item { + border-width: 1px 0; + border-radius: 0; +} + +.panel>.list-group:first-child .list-group-item:first-child, .panel>.panel-collapse>.list-group:first-child .list-group-item:first-child { + border-top: 0; + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.panel>.list-group:last-child .list-group-item:last-child, .panel>.panel-collapse>.list-group:last-child .list-group-item:last-child { + border-bottom: 0; + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} + +.panel-heading+.list-group .list-group-item:first-child { + border-top-width: 0; +} + +.list-group+.panel-footer { + border-top-width: 0; +} + +.panel>.panel-collapse>.table, .panel>.table, .panel>.table-responsive>.table { + margin-bottom: 0; +} + +.panel>.panel-collapse>.table caption, .panel>.table caption, .panel>.table-responsive>.table caption { + padding-right: 15px; + padding-left: 15px; +} + +.panel>.table-responsive:first-child>.table:first-child, .panel>.table:first-child { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child, .panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child, .panel>.table:first-child>tbody:first-child>tr:first-child, .panel>.table:first-child>thead:first-child>tr:first-child { + border-top-left-radius: 3px; + border-top-right-radius: 3px; +} + +.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child td:first-child, .panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child th:first-child, .panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child td:first-child, .panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child th:first-child, .panel>.table:first-child>tbody:first-child>tr:first-child td:first-child, .panel>.table:first-child>tbody:first-child>tr:first-child th:first-child, .panel>.table:first-child>thead:first-child>tr:first-child td:first-child, .panel>.table:first-child>thead:first-child>tr:first-child th:first-child { + border-top-left-radius: 3px; +} + +.panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child td:last-child, .panel>.table-responsive:first-child>.table:first-child>tbody:first-child>tr:first-child th:last-child, .panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child td:last-child, .panel>.table-responsive:first-child>.table:first-child>thead:first-child>tr:first-child th:last-child, .panel>.table:first-child>tbody:first-child>tr:first-child td:last-child, .panel>.table:first-child>tbody:first-child>tr:first-child th:last-child, .panel>.table:first-child>thead:first-child>tr:first-child td:last-child, .panel>.table:first-child>thead:first-child>tr:first-child th:last-child { + border-top-right-radius: 3px; +} + +.panel>.table-responsive:last-child>.table:last-child, .panel>.table:last-child { + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} + +.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child, .panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child, .panel>.table:last-child>tbody:last-child>tr:last-child, .panel>.table:last-child>tfoot:last-child>tr:last-child { + border-bottom-right-radius: 3px; + border-bottom-left-radius: 3px; +} + +.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child td:first-child, .panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child th:first-child, .panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child td:first-child, .panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child th:first-child, .panel>.table:last-child>tbody:last-child>tr:last-child td:first-child, .panel>.table:last-child>tbody:last-child>tr:last-child th:first-child, .panel>.table:last-child>tfoot:last-child>tr:last-child td:first-child, .panel>.table:last-child>tfoot:last-child>tr:last-child th:first-child { + border-bottom-left-radius: 3px; +} + +.panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child td:last-child, .panel>.table-responsive:last-child>.table:last-child>tbody:last-child>tr:last-child th:last-child, .panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child td:last-child, .panel>.table-responsive:last-child>.table:last-child>tfoot:last-child>tr:last-child th:last-child, .panel>.table:last-child>tbody:last-child>tr:last-child td:last-child, .panel>.table:last-child>tbody:last-child>tr:last-child th:last-child, .panel>.table:last-child>tfoot:last-child>tr:last-child td:last-child, .panel>.table:last-child>tfoot:last-child>tr:last-child th:last-child { + border-bottom-right-radius: 3px; +} + +.panel>.panel-body+.table, .panel>.panel-body+.table-responsive, .panel>.table+.panel-body, .panel>.table-responsive+.panel-body { + border-top: 1px solid #ddd; +} + +.panel>.table>tbody:first-child>tr:first-child td, .panel>.table>tbody:first-child>tr:first-child th { + border-top: 0; +} + +.panel>.table-bordered, .panel>.table-responsive>.table-bordered { + border: 0; +} + +.panel>.table-bordered>tbody>tr>td:first-child, .panel>.table-bordered>tbody>tr>th:first-child, .panel>.table-bordered>tfoot>tr>td:first-child, .panel>.table-bordered>tfoot>tr>th:first-child, .panel>.table-bordered>thead>tr>td:first-child, .panel>.table-bordered>thead>tr>th:first-child, .panel>.table-responsive>.table-bordered>tbody>tr>td:first-child, .panel>.table-responsive>.table-bordered>tbody>tr>th:first-child, .panel>.table-responsive>.table-bordered>tfoot>tr>td:first-child, .panel>.table-responsive>.table-bordered>tfoot>tr>th:first-child, .panel>.table-responsive>.table-bordered>thead>tr>td:first-child, .panel>.table-responsive>.table-bordered>thead>tr>th:first-child { + border-left: 0; +} + +.panel>.table-bordered>tbody>tr>td:last-child, .panel>.table-bordered>tbody>tr>th:last-child, .panel>.table-bordered>tfoot>tr>td:last-child, .panel>.table-bordered>tfoot>tr>th:last-child, .panel>.table-bordered>thead>tr>td:last-child, .panel>.table-bordered>thead>tr>th:last-child, .panel>.table-responsive>.table-bordered>tbody>tr>td:last-child, .panel>.table-responsive>.table-bordered>tbody>tr>th:last-child, .panel>.table-responsive>.table-bordered>tfoot>tr>td:last-child, .panel>.table-responsive>.table-bordered>tfoot>tr>th:last-child, .panel>.table-responsive>.table-bordered>thead>tr>td:last-child, .panel>.table-responsive>.table-bordered>thead>tr>th:last-child { + border-right: 0; +} + +.panel>.table-bordered>tbody>tr:first-child>td, .panel>.table-bordered>tbody>tr:first-child>th, .panel>.table-bordered>thead>tr:first-child>td, .panel>.table-bordered>thead>tr:first-child>th, .panel>.table-responsive>.table-bordered>tbody>tr:first-child>td, .panel>.table-responsive>.table-bordered>tbody>tr:first-child>th, .panel>.table-responsive>.table-bordered>thead>tr:first-child>td, .panel>.table-responsive>.table-bordered>thead>tr:first-child>th { + border-bottom: 0; +} + +.panel>.table-bordered>tbody>tr:last-child>td, .panel>.table-bordered>tbody>tr:last-child>th, .panel>.table-bordered>tfoot>tr:last-child>td, .panel>.table-bordered>tfoot>tr:last-child>th, .panel>.table-responsive>.table-bordered>tbody>tr:last-child>td, .panel>.table-responsive>.table-bordered>tbody>tr:last-child>th, .panel>.table-responsive>.table-bordered>tfoot>tr:last-child>td, .panel>.table-responsive>.table-bordered>tfoot>tr:last-child>th { + border-bottom: 0; +} + +.panel>.table-responsive { + margin-bottom: 0; + border: 0; +} + +.panel-group { + margin-bottom: 20px; +} + +.panel-group .panel { + margin-bottom: 0; + border-radius: 4px; +} + +.panel-group .panel+.panel { + margin-top: 5px; +} + +.panel-group .panel-heading { + border-bottom: 0; +} + +.panel-group .panel-heading+.panel-collapse>.list-group, .panel-group .panel-heading+.panel-collapse>.panel-body { + border-top: 1px solid #ddd; +} + +.panel-group .panel-footer { + border-top: 0; +} + +.panel-group .panel-footer+.panel-collapse .panel-body { + border-bottom: 1px solid #ddd; +} + +.panel-default { + border-color: #ddd; +} + +.panel-default>.panel-heading { + color: #333; + background-color: #f5f5f5; + border-color: #ddd; +} + +.panel-default>.panel-heading+.panel-collapse>.panel-body { + border-top-color: #ddd; +} + +.panel-default>.panel-heading .badge { + color: #f5f5f5; + background-color: #333; +} + +.panel-default>.panel-footer+.panel-collapse>.panel-body { + border-bottom-color: #ddd; +} + +.panel-primary { + border-color: #337ab7; +} + +.panel-primary>.panel-heading { + color: #fff; + background-color: #337ab7; + border-color: #337ab7; +} + +.panel-primary>.panel-heading+.panel-collapse>.panel-body { + border-top-color: #337ab7; +} + +.panel-primary>.panel-heading .badge { + color: #337ab7; + background-color: #fff; +} + +.panel-primary>.panel-footer+.panel-collapse>.panel-body { + border-bottom-color: #337ab7; +} + +.panel-success { + border-color: #d6e9c6; +} + +.panel-success>.panel-heading { + color: #3c763d; + background-color: #dff0d8; + border-color: #d6e9c6; +} + +.panel-success>.panel-heading+.panel-collapse>.panel-body { + border-top-color: #d6e9c6; +} + +.panel-success>.panel-heading .badge { + color: #dff0d8; + background-color: #3c763d; +} + +.panel-success>.panel-footer+.panel-collapse>.panel-body { + border-bottom-color: #d6e9c6; +} + +.panel-info { + border-color: #bce8f1; +} + +.panel-info>.panel-heading { + color: #31708f; + background-color: #d9edf7; + border-color: #bce8f1; +} + +.panel-info>.panel-heading+.panel-collapse>.panel-body { + border-top-color: #bce8f1; +} + +.panel-info>.panel-heading .badge { + color: #d9edf7; + background-color: #31708f; +} + +.panel-info>.panel-footer+.panel-collapse>.panel-body { + border-bottom-color: #bce8f1; +} + +.panel-warning { + border-color: #faebcc; +} + +.panel-warning>.panel-heading { + color: #8a6d3b; + background-color: #fcf8e3; + border-color: #faebcc; +} + +.panel-warning>.panel-heading+.panel-collapse>.panel-body { + border-top-color: #faebcc; +} + +.panel-warning>.panel-heading .badge { + color: #fcf8e3; + background-color: #8a6d3b; +} + +.panel-warning>.panel-footer+.panel-collapse>.panel-body { + border-bottom-color: #faebcc; +} + +.panel-danger { + border-color: #ebccd1; +} + +.panel-danger>.panel-heading { + color: #a94442; + background-color: #f2dede; + border-color: #ebccd1; +} + +.panel-danger>.panel-heading+.panel-collapse>.panel-body { + border-top-color: #ebccd1; +} + +.panel-danger>.panel-heading .badge { + color: #f2dede; + background-color: #a94442; +} + +.panel-danger>.panel-footer+.panel-collapse>.panel-body { + border-bottom-color: #ebccd1; +} + +.embed-responsive { + position: relative; + display: block; + height: 0; + padding: 0; + overflow: hidden; +} + +.embed-responsive .embed-responsive-item, .embed-responsive embed, .embed-responsive iframe, .embed-responsive object, .embed-responsive video { + position: absolute; + top: 0; + bottom: 0; + left: 0; + width: 100%; + height: 100%; + border: 0; +} + +.embed-responsive.embed-responsive-16by9 { + padding-bottom: 56.25%; +} + +.embed-responsive.embed-responsive-4by3 { + padding-bottom: 75%; +} + +.well { + min-height: 20px; + padding: 19px; + margin-bottom: 20px; + background-color: #f5f5f5; + border: 1px solid #e3e3e3; + border-radius: 4px; + -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.05); + box-shadow: inset 0 1px 1px rgba(0,0,0,.05); +} + +.well blockquote { + border-color: #ddd; + border-color: rgba(0,0,0,.15); +} + +.well-lg { + padding: 24px; + border-radius: 6px; +} + +.well-sm { + padding: 9px; + border-radius: 3px; +} + +.close { + float: right; + font-size: 21px; + font-weight: 700; + line-height: 1; + color: #000; + text-shadow: 0 1px 0 #fff; + filter: alpha(opacity=20); + opacity: .2; +} + +.close:focus, .close:hover { + color: #000; + text-decoration: none; + cursor: pointer; + filter: alpha(opacity=50); + opacity: .5; +} + +button.close { + -webkit-appearance: none; + padding: 0; + cursor: pointer; + background: 0 0; + border: 0; +} + +.modal-open { + overflow: hidden; +} + +.modal { + position: fixed; + top: 0; + right: 0; + bottom: 0; + left: 0; + z-index: 1040; + display: none; + overflow: hidden; + -webkit-overflow-scrolling: touch; + outline: 0; +} + +.modal.fade .modal-dialog { + -webkit-transition: -webkit-transform .3s ease-out; + -o-transition: -o-transform .3s ease-out; + transition: transform .3s ease-out; + -webkit-transform: translate(0, -25%); + -ms-transform: translate(0, -25%); + -o-transform: translate(0, -25%); + transform: translate(0, -25%); +} + +.modal.in .modal-dialog { + -webkit-transform: translate(0, 0); + -ms-transform: translate(0, 0); + -o-transform: translate(0, 0); + transform: translate(0, 0); +} + +.modal-open .modal { + overflow-x: hidden; + overflow-y: auto; +} + +.modal-dialog { + position: relative; + width: auto; + margin: 10px; +} + +.modal-content { + position: relative; + background-color: #fff; + -webkit-background-clip: padding-box; + background-clip: padding-box; + border: 1px solid #999; + border: 1px solid rgba(0,0,0,.2); + border-radius: 6px; + outline: 0; + -webkit-box-shadow: 0 3px 9px rgba(0,0,0,.5); + box-shadow: 0 3px 9px rgba(0,0,0,.5); +} + +.modal-backdrop { + position: absolute; + top: 0; + right: 0; + left: 0; + background-color: #000; +} + +.modal-backdrop.fade { + filter: alpha(opacity=0); + opacity: 0; +} + +.modal-backdrop.in { + filter: alpha(opacity=50); + opacity: .5; +} + +.modal-header { + min-height: 16.43px; + padding: 15px; + border-bottom: 1px solid #e5e5e5; +} + +.modal-header .close { + margin-top: -2px; +} + +.modal-title { + margin: 0; + line-height: 1.42857143; +} + +.modal-body { + position: relative; + padding: 15px; +} + +.modal-footer { + padding: 15px; + text-align: right; + border-top: 1px solid #e5e5e5; +} + +.modal-footer .btn+.btn { + margin-bottom: 0; + margin-left: 5px; +} + +.modal-footer .btn-group .btn+.btn { + margin-left: -1px; +} + +.modal-footer .btn-block+.btn-block { + margin-left: 0; +} + +.modal-scrollbar-measure { + position: absolute; + top: -9999px; + width: 50px; + height: 50px; + overflow: scroll; +} + +@media (min-width:768px) { + .modal-dialog { + width: 600px; + margin: 30px auto; + } + + .modal-content { + -webkit-box-shadow: 0 5px 15px rgba(0,0,0,.5); + box-shadow: 0 5px 15px rgba(0,0,0,.5); + } + + .modal-sm { + width: 300px; + } +} + +@media (min-width:992px) { + .modal-lg { + width: 900px; + } +} + +.tooltip { + position: absolute; + z-index: 1070; + display: block; + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-size: 12px; + font-weight: 400; + line-height: 1.4; + visibility: visible; + filter: alpha(opacity=0); + opacity: 0; +} + +.tooltip.in { + filter: alpha(opacity=90); + opacity: .9; +} + +.tooltip.top { + padding: 5px 0; + margin-top: -3px; +} + +.tooltip.right { + padding: 0 5px; + margin-left: 3px; +} + +.tooltip.bottom { + padding: 5px 0; + margin-top: 3px; +} + +.tooltip.left { + padding: 0 5px; + margin-left: -3px; +} + +.tooltip-inner { + max-width: 200px; + padding: 3px 8px; + color: #fff; + text-align: center; + text-decoration: none; + background-color: #000; + border-radius: 4px; +} + +.tooltip-arrow { + position: absolute; + width: 0; + height: 0; + border-color: transparent; + border-style: solid; +} + +.tooltip.top .tooltip-arrow { + bottom: 0; + left: 50%; + margin-left: -5px; + border-width: 5px 5px 0; + border-top-color: #000; +} + +.tooltip.top-left .tooltip-arrow { + right: 5px; + bottom: 0; + margin-bottom: -5px; + border-width: 5px 5px 0; + border-top-color: #000; +} + +.tooltip.top-right .tooltip-arrow { + bottom: 0; + left: 5px; + margin-bottom: -5px; + border-width: 5px 5px 0; + border-top-color: #000; +} + +.tooltip.right .tooltip-arrow { + top: 50%; + left: 0; + margin-top: -5px; + border-width: 5px 5px 5px 0; + border-right-color: #000; +} + +.tooltip.left .tooltip-arrow { + top: 50%; + right: 0; + margin-top: -5px; + border-width: 5px 0 5px 5px; + border-left-color: #000; +} + +.tooltip.bottom .tooltip-arrow { + top: 0; + left: 50%; + margin-left: -5px; + border-width: 0 5px 5px; + border-bottom-color: #000; +} + +.tooltip.bottom-left .tooltip-arrow { + top: 0; + right: 5px; + margin-top: -5px; + border-width: 0 5px 5px; + border-bottom-color: #000; +} + +.tooltip.bottom-right .tooltip-arrow { + top: 0; + left: 5px; + margin-top: -5px; + border-width: 0 5px 5px; + border-bottom-color: #000; +} + +.popover { + position: absolute; + top: 0; + left: 0; + z-index: 1060; + display: none; + max-width: 276px; + padding: 1px; + font-family: "Helvetica Neue", Helvetica, Arial, sans-serif; + font-size: 14px; + font-weight: 400; + line-height: 1.42857143; + text-align: left; + white-space: normal; + background-color: #fff; + -webkit-background-clip: padding-box; + background-clip: padding-box; + border: 1px solid #ccc; + border: 1px solid rgba(0,0,0,.2); + border-radius: 6px; + -webkit-box-shadow: 0 5px 10px rgba(0,0,0,.2); + box-shadow: 0 5px 10px rgba(0,0,0,.2); +} + +.popover.top { + margin-top: -10px; +} + +.popover.right { + margin-left: 10px; +} + +.popover.bottom { + margin-top: 10px; +} + +.popover.left { + margin-left: -10px; +} + +.popover-title { + padding: 8px 14px; + margin: 0; + font-size: 14px; + background-color: #f7f7f7; + border-bottom: 1px solid #ebebeb; + border-radius: 5px 5px 0 0; +} + +.popover-content { + padding: 9px 14px; +} + +.popover>.arrow, .popover>.arrow:after { + position: absolute; + display: block; + width: 0; + height: 0; + border-color: transparent; + border-style: solid; +} + +.popover>.arrow { + border-width: 11px; +} + +.popover>.arrow:after { + content: ""; + border-width: 10px; +} + +.popover.top>.arrow { + bottom: -11px; + left: 50%; + margin-left: -11px; + border-top-color: #999; + border-top-color: rgba(0,0,0,.25); + border-bottom-width: 0; +} + +.popover.top>.arrow:after { + bottom: 1px; + margin-left: -10px; + content: " "; + border-top-color: #fff; + border-bottom-width: 0; +} + +.popover.right>.arrow { + top: 50%; + left: -11px; + margin-top: -11px; + border-right-color: #999; + border-right-color: rgba(0,0,0,.25); + border-left-width: 0; +} + +.popover.right>.arrow:after { + bottom: -10px; + left: 1px; + content: " "; + border-right-color: #fff; + border-left-width: 0; +} + +.popover.bottom>.arrow { + top: -11px; + left: 50%; + margin-left: -11px; + border-top-width: 0; + border-bottom-color: #999; + border-bottom-color: rgba(0,0,0,.25); +} + +.popover.bottom>.arrow:after { + top: 1px; + margin-left: -10px; + content: " "; + border-top-width: 0; + border-bottom-color: #fff; +} + +.popover.left>.arrow { + top: 50%; + right: -11px; + margin-top: -11px; + border-right-width: 0; + border-left-color: #999; + border-left-color: rgba(0,0,0,.25); +} + +.popover.left>.arrow:after { + right: 1px; + bottom: -10px; + content: " "; + border-right-width: 0; + border-left-color: #fff; +} + +.carousel { + position: relative; +} + +.carousel-inner { + position: relative; + width: 100%; + overflow: hidden; +} + +.carousel-inner>.item { + position: relative; + display: none; + -webkit-transition: .6s ease-in-out left; + -o-transition: .6s ease-in-out left; + transition: .6s ease-in-out left; +} + +.carousel-inner>.item>a>img, .carousel-inner>.item>img { + line-height: 1; +} + +@media all and (transform-3d), (-webkit-transform-3d) { + .carousel-inner>.item { + -webkit-transition: -webkit-transform .6s ease-in-out; + -o-transition: -o-transform .6s ease-in-out; + transition: transform .6s ease-in-out; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-perspective: 1000; + perspective: 1000; + } + + .carousel-inner>.item.active.right, .carousel-inner>.item.next { + left: 0; + -webkit-transform: translate3d(100%, 0, 0); + transform: translate3d(100%, 0, 0); + } + + .carousel-inner>.item.active.left, .carousel-inner>.item.prev { + left: 0; + -webkit-transform: translate3d(-100%, 0, 0); + transform: translate3d(-100%, 0, 0); + } + + .carousel-inner>.item.active, .carousel-inner>.item.next.left, .carousel-inner>.item.prev.right { + left: 0; + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +.carousel-inner>.active, .carousel-inner>.next, .carousel-inner>.prev { + display: block; +} + +.carousel-inner>.active { + left: 0; +} + +.carousel-inner>.next, .carousel-inner>.prev { + position: absolute; + top: 0; + width: 100%; +} + +.carousel-inner>.next { + left: 100%; +} + +.carousel-inner>.prev { + left: -100%; +} + +.carousel-inner>.next.left, .carousel-inner>.prev.right { + left: 0; +} + +.carousel-inner>.active.left { + left: -100%; +} + +.carousel-inner>.active.right { + left: 100%; +} + +.carousel-control { + position: absolute; + top: 0; + bottom: 0; + left: 0; + width: 15%; + font-size: 20px; + color: #fff; + text-align: center; + text-shadow: 0 1px 2px rgba(0,0,0,.6); + filter: alpha(opacity=50); + opacity: .5; +} + +.carousel-control.left { + background-image: -webkit-linear-gradient(left, rgba(0,0,0,.5) 0, rgba(0,0,0,.0001) 100%); + background-image: -o-linear-gradient(left, rgba(0,0,0,.5) 0, rgba(0,0,0,.0001) 100%); + background-image: -webkit-gradient(linear, left top, right top, from(rgba(0,0,0,.5)), to(rgba(0,0,0,.0001))); + background-image: linear-gradient(to right, rgba(0,0,0,.5) 0, rgba(0,0,0,.0001) 100%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#80000000', endColorstr='#00000000', GradientType=1); + background-repeat: repeat-x; +} + +.carousel-control.right { + right: 0; + left: auto; + background-image: -webkit-linear-gradient(left, rgba(0,0,0,.0001) 0, rgba(0,0,0,.5) 100%); + background-image: -o-linear-gradient(left, rgba(0,0,0,.0001) 0, rgba(0,0,0,.5) 100%); + background-image: -webkit-gradient(linear, left top, right top, from(rgba(0,0,0,.0001)), to(rgba(0,0,0,.5))); + background-image: linear-gradient(to right, rgba(0,0,0,.0001) 0, rgba(0,0,0,.5) 100%); + filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#00000000', endColorstr='#80000000', GradientType=1); + background-repeat: repeat-x; +} + +.carousel-control:focus, .carousel-control:hover { + color: #fff; + text-decoration: none; + filter: alpha(opacity=90); + outline: 0; + opacity: .9; +} + +.carousel-control .glyphicon-chevron-left, .carousel-control .glyphicon-chevron-right, .carousel-control .icon-next, .carousel-control .icon-prev { + position: absolute; + top: 50%; + z-index: 5; + display: inline-block; +} + +.carousel-control .glyphicon-chevron-left, .carousel-control .icon-prev { + left: 50%; + margin-left: -10px; +} + +.carousel-control .glyphicon-chevron-right, .carousel-control .icon-next { + right: 50%; + margin-right: -10px; +} + +.carousel-control .icon-next, .carousel-control .icon-prev { + width: 20px; + height: 20px; + margin-top: -10px; + font-family: serif; + line-height: 1; +} + +.carousel-control .icon-prev:before { + content: '\2039'; +} + +.carousel-control .icon-next:before { + content: '\203a'; +} + +.carousel-indicators { + position: absolute; + bottom: 10px; + left: 50%; + z-index: 15; + width: 60%; + padding-left: 0; + margin-left: -30%; + text-align: center; + list-style: none; +} + +.carousel-indicators li { + display: inline-block; + width: 10px; + height: 10px; + margin: 1px; + text-indent: -999px; + cursor: pointer; + background-color: #000 \9; + background-color: rgba(0,0,0,0); + border: 1px solid #fff; + border-radius: 10px; +} + +.carousel-indicators .active { + width: 12px; + height: 12px; + margin: 0; + background-color: #fff; +} + +.carousel-caption { + position: absolute; + right: 15%; + bottom: 20px; + left: 15%; + z-index: 10; + padding-top: 20px; + padding-bottom: 20px; + color: #fff; + text-align: center; + text-shadow: 0 1px 2px rgba(0,0,0,.6); +} + +.carousel-caption .btn { + text-shadow: none; +} + +@media screen and (min-width:768px) { + .carousel-control .glyphicon-chevron-left, .carousel-control .glyphicon-chevron-right, .carousel-control .icon-next, .carousel-control .icon-prev { + width: 30px; + height: 30px; + margin-top: -15px; + font-size: 30px; + } + + .carousel-control .glyphicon-chevron-left, .carousel-control .icon-prev { + margin-left: -15px; + } + + .carousel-control .glyphicon-chevron-right, .carousel-control .icon-next { + margin-right: -15px; + } + + .carousel-caption { + right: 20%; + left: 20%; + padding-bottom: 30px; + } + + .carousel-indicators { + bottom: 20px; + } +} + +.btn-group-vertical>.btn-group:after, .btn-group-vertical>.btn-group:before, .btn-toolbar:after, .btn-toolbar:before, .clearfix:after, .clearfix:before, .container-fluid:after, .container-fluid:before, .container:after, .container:before, .dl-horizontal dd:after, .dl-horizontal dd:before, .form-horizontal .form-group:after, .form-horizontal .form-group:before, .modal-footer:after, .modal-footer:before, .nav:after, .nav:before, .navbar-collapse:after, .navbar-collapse:before, .navbar-header:after, .navbar-header:before, .navbar:after, .navbar:before, .pager:after, .pager:before, .panel-body:after, .panel-body:before, .row:after, .row:before { + display: table; + content: " "; +} + +.btn-group-vertical>.btn-group:after, .btn-toolbar:after, .clearfix:after, .container-fluid:after, .container:after, .dl-horizontal dd:after, .form-horizontal .form-group:after, .modal-footer:after, .nav:after, .navbar-collapse:after, .navbar-header:after, .navbar:after, .pager:after, .panel-body:after, .row:after { + clear: both; +} + +.center-block { + display: block; + margin-right: auto; + margin-left: auto; +} + +.pull-right { + float: right!important; +} + +.pull-left { + float: left!important; +} + +.hide { + display: none!important; +} + +.show { + display: block!important; +} + +.invisible { + visibility: hidden; +} + +.text-hide { + font: 0/0 a; + color: transparent; + text-shadow: none; + background-color: transparent; + border: 0; +} + +.hidden { + display: none!important; + visibility: hidden!important; +} + +.affix { + position: fixed; +} + +@-ms-viewport { + width:device-width; +} + +.visible-lg, .visible-md, .visible-sm, .visible-xs { + display: none!important; +} + +.visible-lg-block, .visible-lg-inline, .visible-lg-inline-block, .visible-md-block, .visible-md-inline, .visible-md-inline-block, .visible-sm-block, .visible-sm-inline, .visible-sm-inline-block, .visible-xs-block, .visible-xs-inline, .visible-xs-inline-block { + display: none!important; +} + +@media (max-width:767px) { + .visible-xs { + display: block!important; + } + + table.visible-xs { + display: table; + } + + tr.visible-xs { + display: table-row!important; + } + + td.visible-xs, th.visible-xs { + display: table-cell!important; + } +} + +@media (max-width:767px) { + .visible-xs-block { + display: block!important; + } +} + +@media (max-width:767px) { + .visible-xs-inline { + display: inline!important; + } +} + +@media (max-width:767px) { + .visible-xs-inline-block { + display: inline-block!important; + } +} + +@media (min-width:768px) and (max-width:991px) { + .visible-sm { + display: block!important; + } + + table.visible-sm { + display: table; + } + + tr.visible-sm { + display: table-row!important; + } + + td.visible-sm, th.visible-sm { + display: table-cell!important; + } +} + +@media (min-width:768px) and (max-width:991px) { + .visible-sm-block { + display: block!important; + } +} + +@media (min-width:768px) and (max-width:991px) { + .visible-sm-inline { + display: inline!important; + } +} + +@media (min-width:768px) and (max-width:991px) { + .visible-sm-inline-block { + display: inline-block!important; + } +} + +@media (min-width:992px) and (max-width:1199px) { + .visible-md { + display: block!important; + } + + table.visible-md { + display: table; + } + + tr.visible-md { + display: table-row!important; + } + + td.visible-md, th.visible-md { + display: table-cell!important; + } +} + +@media (min-width:992px) and (max-width:1199px) { + .visible-md-block { + display: block!important; + } +} + +@media (min-width:992px) and (max-width:1199px) { + .visible-md-inline { + display: inline!important; + } +} + +@media (min-width:992px) and (max-width:1199px) { + .visible-md-inline-block { + display: inline-block!important; + } +} + +@media (min-width:1200px) { + .visible-lg { + display: block!important; + } + + table.visible-lg { + display: table; + } + + tr.visible-lg { + display: table-row!important; + } + + td.visible-lg, th.visible-lg { + display: table-cell!important; + } +} + +@media (min-width:1200px) { + .visible-lg-block { + display: block!important; + } +} + +@media (min-width:1200px) { + .visible-lg-inline { + display: inline!important; + } +} + +@media (min-width:1200px) { + .visible-lg-inline-block { + display: inline-block!important; + } +} + +@media (max-width:767px) { + .hidden-xs { + display: none!important; + } +} + +@media (min-width:768px) and (max-width:991px) { + .hidden-sm { + display: none!important; + } +} + +@media (min-width:992px) and (max-width:1199px) { + .hidden-md { + display: none!important; + } +} + +@media (min-width:1200px) { + .hidden-lg { + display: none!important; + } +} + +.visible-print { + display: none!important; +} + +@media print { + .visible-print { + display: block!important; + } + + table.visible-print { + display: table; + } + + tr.visible-print { + display: table-row!important; + } + + td.visible-print, th.visible-print { + display: table-cell!important; + } +} + +.visible-print-block { + display: none!important; +} + +@media print { + .visible-print-block { + display: block!important; + } +} + +.visible-print-inline { + display: none!important; +} + +@media print { + .visible-print-inline { + display: inline!important; + } +} + +.visible-print-inline-block { + display: none!important; +} + +@media print { + .visible-print-inline-block { + display: inline-block!important; + } +} + +@media print { + .hidden-print { + display: none!important; + } +} +.row-centered { + text-align:center; +} +.col-centered { + display:inline-block; + float:none; +} \ No newline at end of file diff --git a/css/css3.css b/css/css3.css new file mode 100755 index 0000000..e38644d --- /dev/null +++ b/css/css3.css @@ -0,0 +1,186 @@ +/*--- CSS3 style ---*/ +a, +.leadership-biorow .bio-imagecol .bio-image, +.bio-detail, +.contact-form .btn, +.bio-detail h5, +.bio-detail span, +.service .service-main .service-block .readmore a em, +.footer .footer-nav ul li:after, +.certification .logo-carousel ul li, +.our-markets .markets-main .markets-block, +.our-markets .markets-main .markets-block .markets-icon, +.our-markets .markets-main .markets-block .markets-content, +.service .service-main .service-block .service-thumb img, +.service .service-main .service-block .service-overlay, +.mission-vision-block .mv-image .mv-content h3, +.mission-vision-block .mv-image img, +.mission-vision-block .mv-image .mv-content, +.nav-main .nav-link .nav-ul > li > a, +.navbar-toggle, +.nav-main .nav-link .nav-ul > li ul li a, +.slick-dots li button, +.nav-main .nav-btn, +.footer-nav ul li a, +.social-icon ul li a, +.welcome-section .welcome-block .welcome-rightpart .brochure-form .btn-default, +.gallery-thumbcol em, +.contact-section .contact-cols .contact_rotate em { + transition:all 0.5s ease; + -moz-transition:all 0.5s ease; + -webkit-transition:all 0.5s ease; + -ms-transition:all 0.5s ease; + -o-transition:all 0.5s ease; +} +.mission-vision-block .mv-image .mv-content, +.service .service-main .service-block .readmore { + transform:translate(-50%,-50%); + -moz-transform:translate(-50%,-50%); + -webkit-transform:translate(-50%,-50%); + -ms-transform:translate(-50%,-50%); + -o-transform:translate(-50%,-50%); +} +.mission-vision-block .mv-image:hover img { transform:scale(1.1); -moz-transform:scale(1.1); -webkit-transform:scale(1.1); -ms-transform:scale(1.1); -o-transform:scale(1.1); } +.mission-vision-block .mv-image:hover .mv-content { border-radius:50px; -moz-border-radius:50px; -webkit-border-radius:50px; -ms-border-radius:50px; -o-border-radius:50px; } +.slider-content .view-detail { + border-radius:3px; + -moz-border-radius:3px; + -webkit-border-radius:3px; + -ms-border-radius:3px; + -o-border-radius:3px; + box-shadow:0 2px #00a9ff; + -moz-box-shadow:0 2px #00a9ff; + -webkit-box-shadow:0 2px #00a9ff; + -ms-box-shadow:0 2px #00a9ff; + -o-box-shadow:0 2px #00a9ff; +} +.slider-content .view-detail:hover { + box-shadow:0 2px #ff656a; + -moz-box-shadow:0 2px #ff656a; + -webkit-box-shadow:0 2px #ff656a; + -ms-box-shadow:0 2px #ff656a; + -o-box-shadow:0 2px #ff656a; +} +.slider-content, +.inner-banner-content { + transform:translateY(-50%); + -moz-transform:translateY(-50%); + -webkit-transform:translateY(-50%); + -ms-transform:translateY(-50%); + -o-transform:translateY(-50%); +} +.nav-main .nav-btn { + border-radius:3px; + -moz-border-radius:3px; + -webkit-border-radius:3px; + -ms-border-radius:3px; + -o-border-radius:3px; +} +.bio-detail span { transform: translateX(-50%); } +.social-icon ul li a { + border-radius:4px; + -moz-border-radius:4px; + -webkit-border-radius:4px; + -ms-border-radius:4px; + -o-border-radius:4px; +} +.social-icon ul li a:hover { + border-radius:30px; + -moz-border-radius:30px; + -webkit-border-radius:30px; + -ms-border-radius:30px; + -o-border-radius:30px; +} +.heading:after { +transform:translateX(-50%); +-moz-transform:translateX(-50%); +-webkit-transform:translateX(-50%); +-ms-transform:translateX(-50%); +-o-transform:translateX(-50%); +} +.service .service-main .service-block .readmore a:hover, +.service .service-main .service-block .readmore a:hover em { +border-radius:30px; +-moz-border-radius:30px; +-webkit-border-radius:30px; +-ms-border-radius:30px; +-o-border-radius:30px; +} +.service .service-main .service-block .service-title { +background: #00467f; +background: url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiA/Pgo8c3ZnIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyIgd2lkdGg9IjEwMCUiIGhlaWdodD0iMTAwJSIgdmlld0JveD0iMCAwIDEgMSIgcHJlc2VydmVBc3BlY3RSYXRpbz0ibm9uZSI+CiAgPGxpbmVhckdyYWRpZW50IGlkPSJncmFkLXVjZ2ctZ2VuZXJhdGVkIiBncmFkaWVudFVuaXRzPSJ1c2VyU3BhY2VPblVzZSIgeDE9IjAlIiB5MT0iMCUiIHgyPSIxMDAlIiB5Mj0iMCUiPgogICAgPHN0b3Agb2Zmc2V0PSIwJSIgc3RvcC1jb2xvcj0iIzAwNDY3ZiIgc3RvcC1vcGFjaXR5PSIxIi8+CiAgICA8c3RvcCBvZmZzZXQ9IjUwJSIgc3RvcC1jb2xvcj0iIzA4NjliOCIgc3RvcC1vcGFjaXR5PSIxIi8+CiAgICA8c3RvcCBvZmZzZXQ9IjEwMCUiIHN0b3AtY29sb3I9IiMwMDQ2N2YiIHN0b3Atb3BhY2l0eT0iMSIvPgogIDwvbGluZWFyR3JhZGllbnQ+CiAgPHJlY3QgeD0iMCIgeT0iMCIgd2lkdGg9IjEiIGhlaWdodD0iMSIgZmlsbD0idXJsKCNncmFkLXVjZ2ctZ2VuZXJhdGVkKSIgLz4KPC9zdmc+); +background: -moz-linear-gradient(left, #00467f 0%, #0869b8 50%, #00467f 100%); +background: -webkit-linear-gradient(left, #00467f 0%,#0869b8 50%,#00467f 100%); +background: linear-gradient(to right, #00467f 0%,#0869b8 50%,#00467f 100%); +filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#00467f', endColorstr='#00467f',GradientType=1 ); +} + +.service .service-main .service-block .service-title:after { + content: ''; + position: absolute; + left: 0px; + top: 0px; + right: 0px; + bottom: 0px; + background: #c30007; +background: url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiA/Pgo8c3ZnIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyIgd2lkdGg9IjEwMCUiIGhlaWdodD0iMTAwJSIgdmlld0JveD0iMCAwIDEgMSIgcHJlc2VydmVBc3BlY3RSYXRpbz0ibm9uZSI+CiAgPGxpbmVhckdyYWRpZW50IGlkPSJncmFkLXVjZ2ctZ2VuZXJhdGVkIiBncmFkaWVudFVuaXRzPSJ1c2VyU3BhY2VPblVzZSIgeDE9IjAlIiB5MT0iMCUiIHgyPSIxMDAlIiB5Mj0iMCUiPgogICAgPHN0b3Agb2Zmc2V0PSIwJSIgc3RvcC1jb2xvcj0iI2MzMDAwNyIgc3RvcC1vcGFjaXR5PSIxIi8+CiAgICA8c3RvcCBvZmZzZXQ9IjUwJSIgc3RvcC1jb2xvcj0iI2VkMWMyNCIgc3RvcC1vcGFjaXR5PSIxIi8+CiAgICA8c3RvcCBvZmZzZXQ9IjEwMCUiIHN0b3AtY29sb3I9IiNjMzAwMDciIHN0b3Atb3BhY2l0eT0iMSIvPgogIDwvbGluZWFyR3JhZGllbnQ+CiAgPHJlY3QgeD0iMCIgeT0iMCIgd2lkdGg9IjEiIGhlaWdodD0iMSIgZmlsbD0idXJsKCNncmFkLXVjZ2ctZ2VuZXJhdGVkKSIgLz4KPC9zdmc+); +background: -moz-linear-gradient(left, #c30007 0%, #ff232b 50%, #c30007 100%); +background: -webkit-linear-gradient(left, #c30007 0%,#ff232b 50%,#c30007 100%); +background: linear-gradient(to right, #c30007 0%,#ff232b 50%,#c30007 100%); +filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#c30007', endColorstr='#c30007',GradientType=1 ); + opacity: 0; + transition: all 0.5s ease-in-out; +} +.service .service-main .service-block .service-title:hover:after { opacity: 1; } +.our-markets .markets-main .markets-block:hover .markets-content { +border-radius:0 0 10px 10px; -moz-border-radius:0 0 10px 10px; -webkit-border-radius:0 0 10px 10px; -ms-border-radius:0 0 10px 10px; -o-border-radius:0 0 10px 10px; +} +.service .service-main .service-block:hover .service-thumb img { +transform:scale(1.3); +-moz-transform:scale(1.3); +-webkit-transform:scale(1.3); +-ms-transform:scale(1.3); +-o-transform:scale(1.3); +} +.our-markets .markets-main .markets-block:hover { border-radius:10px 10px 0 0; } +.nav-main .nav-link .nav-ul > li ul { + transform:translateX(-50%); + -moz-transform:translateX(-50%); + -webkit-transform:translateX(-50%); + -ms-transform:translateX(-50%); + -o-transform:translateX(-50%); +} +.our-markets .markets-main .markets-block:hover .markets-icon { + border-radius: 10px 10px 0 0; + -moz-border-radius: 10px 10px 0 0; + -webkit-border-radius: 10px 10px 0 0; + -ms-border-radius: 10px 10px 0 0; + -o-border-radius: 10px 10px 0 0; +} +.mission-vision-block .mv-image .mv-content p { + text-shadow:1px 1px #505050; -moz-text-shadow:1px 1px #505050; -webkit-text-shadow:1px 1px #505050; -ms-text-shadow:1px 1px #505050; -o-text-shadow:1px 1px #505050; +} +.gallery-thumbcol em { border-radius:4px; -moz-border-radius:4px; -webkit-border-radius:4px; -ms-border-radius:4px; -o-border-radius:4px; } +.gallery-thumbcol em:hover {border-radius:50%; -moz-border-radius:50%; -webkit-border-radius:50%; -ms-border-radius:50%; -o-border-radius:50%;} +.breadcrumb { +border-radius:4px 4px 0 0; +-moz-border-radius:4px 4px 0 0; +-webkit-border-radius:4px 4px 0 0; +-ms-border-radius:4px 4px 0 0; +-o-border-radius:4px 4px 0 0; +} +.contact-form .form-control { + border-radius: 5px; + -webkit-border-radius: 5px; + -moz-border-radius: 5px; + -ms-border-radius: 5px; + -o-border-radius: 5px; +} +.contact-form .btn { + border-radius: 3px; + -webkit-border-radius: 3px; + -moz-border-radius: 3px; + -ms-border-radius: 3px; + -o-border-radius: 3px; +} +/*--- Use only for CSS3 styles ---*/ \ No newline at end of file diff --git a/css/docs.css b/css/docs.css new file mode 100755 index 0000000..29f6f46 --- /dev/null +++ b/css/docs.css @@ -0,0 +1,1544 @@ +/*--- Font-face ---*/ +@font-face { + font-family: 'robotoregular'; + src: url('../fonts/roboto-regular-webfont-webfont.eot'); + src: url('../fonts/roboto-regular-webfont-webfont.eot?#iefix') format('embedded-opentype'), + url('../fonts/roboto-regular-webfont-webfont.woff2') format('woff2'), + url('../fonts/roboto-regular-webfont-webfont.woff') format('woff'), + url('../fonts/roboto-regular-webfont-webfont.ttf') format('truetype'), + url('../fonts/roboto-regular-webfont-webfont.svg#robotoregular') format('svg'); + font-weight: normal; + font-style: normal; +} +@font-face { + font-family: 'Roboto-Light'; + src: url('../fonts/Roboto-Light.eot?#iefix') format('embedded-opentype'), + url('../fonts/Roboto-Light.woff') format('woff'), + url('../fonts/Roboto-Light.ttf') format('truetype'), + url('../fonts/Roboto-Light.svg#Roboto-Light') format('svg'); + font-weight: normal; + font-style: normal; +} +@font-face { + font-family: 'Roboto-Medium'; + src: url('../fonts/Roboto-Medium.eot?#iefix') format('embedded-opentype'), + url('../fonts/Roboto-Medium.woff') format('woff'), + url('../fonts/Roboto-Medium.ttf') format('truetype'), + url('../fonts/Roboto-Medium.svg#Roboto-Medium') format('svg'); + font-weight: normal; + font-style: normal; +} +@font-face { + font-family: 'ParisNormal'; + src: url('../fonts/ParisNormal.eot?#iefix') format('embedded-opentype'), + url('../fonts/ParisNormal.woff') format('woff'), + url('../fonts/ParisNormal.ttf') format('truetype'), + url('../fonts/ParisNormal.svg#ParisNormal') format('svg'); + font-weight: normal; + font-style: normal; +} + + + +/* Body and General Styles Start +-------------------------------------------------- */ +body { position:relative;} +.content { display:inline-block; width:100%; vertical-align: top;} +img { max-width:100%; } +h2 { font-size:38px; text-transform:uppercase; color:#333333; font-family: 'Roboto-Light'; margin:0; } +h3 { font-size:32px; font-family: 'Roboto-Light'; margin:0; color:#333333; } +h4 { font-size:26px; font-family: 'robotoregular'; margin:10px 0 20px 0; } +h5 { font-size:22px; font-family: 'robotoregular'; margin:5px 0 20px 0; line-height:30px; } +p { + font-size: 15px; + line-height: 25px; + margin-bottom: 25px; +} +/* Body End +-------------------------------------------------- */ + +/* header Start +-------------------------------------------------- */ +header {} +.header { position:relative; z-index:11; } +.nav-main .logo { float:left; padding:10px 0; } +.nav-main .logo img { width:210px; } +.section { padding:40px 0;} +/* header End +-------------------------------------------------- */ + +/* navbar Start +-------------------------------------------------- */ +.nav-main {display:block; width:100%; background:#fff; } +.header .nav-main .container { position:relative; } +.nav-main .nav-btn {border: 1px solid #dc0009; float:right; cursor:pointer; color:#fff; position: relative; background:#dc0009;} +.nav-main .nav-btn:hover { background:#ed1c24; } +.nav-main .nav-btn .icon-bar { display: block; padding:5px 8px; } +.nav-main .nav-link {display:none; } +.nav-main .nav-link .nav-ul {padding:50px 0 0 0; margin:0px; float:left;} +.nav-main .nav-link .nav-ul > li {float:left; padding:0; list-style:none; position:relative; } +.nav-main .nav-link .nav-ul li a { font-size:14px; padding:6px 14px 20px 14px; color:#333333; text-decoration:none; text-transform:uppercase; position:relative; + display: inline-block; + vertical-align: middle; + -webkit-transform: perspective(1px) translateZ(0); + -moz-transform: perspective(1px) translateZ(0); + -ms-transform: perspective(1px) translateZ(0); + -o-transform: perspective(1px) translateZ(0); + transform: perspective(1px) translateZ(0); + position: relative; + overflow: hidden; +} +.nav-main .nav-link .nav-ul li a:before { + content: ""; + position: absolute; + z-index: -1; + left: 50%; + right: 50%; + bottom: 8px; + background: #108ae7; + height: 2px; + -webkit-transition-property: left, right; + -moz-transition-property: left, right; + -ms-transition-property: left, right; + -o-transition-property: left, right; + transition-property: left, right; + -webkit-transition-duration: 0.3s; + -moz-transition-duration: 0.3s; + -ms-transition-duration: 0.3s; + -o-transition-duration: 0.3s; + transition-duration: 0.3s; + -webkit-transition-timing-function: ease-out; + -moz-transition-timing-function: ease-out; + -ms-transition-timing-function: ease-out; + -o-transition-timing-function: ease-out; + transition-timing-function: ease-out; +} +.nav-main .nav-link .nav-ul li a:hover:before, +.nav-main .nav-link .nav-ul li a:focus:before, +.nav-main .nav-link .nav-ul li a:active:before { left: 0; right: 0;} +.nav-main .nav-link .nav-ul li.active > a:before { left:0; right:0;} +.nav-main .nav-link .nav-ul > li.active a, +.nav-main .nav-link .nav-ul > li a:hover { color:#00467f; } +.nav-main .nav-link .nav-ul > li > a .fa {padding:0 0 0 5px; display:none;} +.nav-main .nav-link .nav-ul > li.sub-menu {position:relative; } +/*.nav-main .nav-link .nav-ul > li.sub-menu > a:before { display:none;}*/ +.nav-main .nav-link .nav-ul > li.sub-menu .sub_navigation li a { color:#fff; } +.nav-main .nav-link .nav-ul > li.sub-menu .sub_navigation li a:before { bottom:0; } +.nav-main .nav-link .nav-ul > li ul {position:absolute; top:100%; left:50%; width:auto; min-width:175px; background:#005da8; padding:0px; margin:; display:none; z-index:1; } +.nav-main .nav-link .nav-ul > li ul:before{ content:""; position:absolute; left:50%; top:-8px; z-index:1;margin-left: -8px;width: 0;height: 0;border-style: solid;border-width: 0 8px 8px 8px;border-color: transparent transparent #005da8; } +.nav-main .nav-link .nav-ul > li ul li {list-style:none; display:block; border-bottom:1px solid #00467f; } +.nav-main .nav-link .nav-ul > li ul li a {white-space:nowrap; padding:8px 12px; line-height:20px; font-size:14px; text-decoration:none; display:block; color:#fff;} +.nav-main .nav-link .nav-ul > li ul li a:hover { background:#00467f; color:#fff;} +.nav-main .nav-link .nav-ul > li ul li:last-child {border:none; } +.nav-main .nav-link .nav-ul > li ul li.active a { background:#00467f;} +.nav-main .nav-link .nav-ul > li ul li:hover, +.nav-main .nav-link .nav-ul > li ul li.active { border-bottom:1px solid #005da8;} + +.header .email { float:right; padding-right:14px; position:absolute; right:0; top:4px; } +.header .email a { font-size:13px; color:#5f5f5f; } +.header .email a:hover { color:#008dd5; } +.header .email a em { font-size:14px; margin-right:6px; color:#5f5f5f;} + +/* navbar End +-------------------------------------------------- */ + +.banner { display:inline-block; width:100%; position:relative; vertical-align:top; } +.banner:after { background:url(../images/banner-shadow.png) top center no-repeat; position:absolute; content:''; width:100%; height:57px; background-size:100% auto; bottom:-56px; } +.banner img { max-width:100%; } +.slider-content { position:absolute; left:60px; top:50%; left:0; width:100%; text-align:center; } +.slider-content .heading { padding:0;} +.slider-content .heading:after { display:none;} +.slider-content p { text-align:left;} +.slider { position:relative; } +.slick-slide { position:relative;} +.slick-slide:before { position:absolute; left:0; top:0; content:''; width:100%; height:100%; background-color:rgba(0,0,0,0.1); } +.slider-content h1 { font-size:55px; font-family: 'Roboto-Light'; color:#fff; line-height:50px; padding:0px 15px; text-align:center; text-transform:uppercase; margin:0 0 35px 0; +background-color:rgba(0,0,0,0.6); padding:8px 20px !important; display:inline-block; } +.slider-content p { color:#fff; font-size:22px; line-height:28px; max-width:835px; text-transform:none; margin:0 auto 30px auto; +background-color:rgba(0,0,0,0.6); padding:10px !important; } +.slider-content .view-detail-btn { display:inline-block; width:100%; } +.slider-content .view-detail { padding:0 50px; line-height:58px; font-size:18px; color:#fff; background:#007fc0; display:inline-block; margin-top:20px; text-transform:uppercase; } +.slider-content .view-detail:hover { background:#ee272e;} + +.first-block { display:inline-block; width:100%; position:relative; overflow:hidden; vertical-align:top; } +.first-block:before { background:url(../images/line-left.png) -130px top no-repeat; width:100%; height:100%; position:absolute; left:0; top:-372px; content:''; } +.first-block:after { background:url(../images/line-right.png) 620px top no-repeat; width:100%; height:100%; position:absolute; right:0; top:330px; content:''; } + +.welcome-section { width:100%; display:inline-block; margin-bottom:45px; padding-top:60px; position:relative; z-index:1; } +.heading { position:relative; padding:0 0 30px 0; margin:0 0 38px 0; text-align:center; z-index:1; } +.heading:after { position:absolute; bottom:0; width:130px; height:9px; content:''; left:50%; background:url(../images/heading-line.png) center bottom no-repeat; } +.welcome-section h2 { margin:0;} +.welcome-section .welcome-block { display:inline-block; width:100%; } +.welcome-section .welcome-block .welcome-leftpart { width:600px; float:left; padding-right:50px; } +.welcome-section .welcome-block .welcome-leftpart p { color:#333333; font-size:16px; line-height:26px; margin-bottom:25px;} +.welcome-section .welcome-block .welcome-rightpart { float:left; width:600px; } +.welcome-section .welcome-block .welcome-rightpart .video { margin-bottom:20px;} +.welcome-section .welcome-block .welcome-rightpart .video img { width:100%;} +.welcome-section .welcome-block .welcome-rightpart .brochure-block { width:100%; border:1px solid #0a64aa; display:inline-block; position:relative; overflow:hidden; background:#fff; } +.welcome-section .welcome-block .welcome-rightpart .brochure-block:after { position:absolute; content:''; bottom:0; right:0; border-right:600px solid #cfe3f1; border-top:230px solid transparent;} +.welcome-section .welcome-block .welcome-rightpart .brochure-block .leftone { float:left; width:420px; z-index: 1; position: relative; } +.welcome-section .welcome-block .welcome-rightpart .brochure-block .leftone .title { background:#0a64aa; font-size:24px; line-height:50px; padding:0 15px; display:inline-block; color:#fff; +font-family: 'Roboto-Light'; position:relative; } +.welcome-section .welcome-block .welcome-rightpart .brochure-block .leftone .title:after { position:absolute; content:''; right:-30px; top:0; +border-left:30px solid #0a64aa; border-bottom:50px solid transparent; } +.welcome-section .welcome-block .welcome-rightpart .brochure-block .leftone p { font-size:18px; line-height:24px; color:#010101; margin:20px 0; padding:0 15px; } +.welcome-section .welcome-block .welcome-rightpart .brochure-form { padding:0 15px;} +.welcome-section .welcome-block .welcome-rightpart .brochure-form .row { margin:0 -5px;} +.welcome-section .welcome-block .welcome-rightpart .brochure-form .row [class*="col-"] { padding:0 5px; } +.welcome-section .welcome-block .welcome-rightpart .brochure-form .form-control { width:100%; margin-bottom:10px; box-shadow:none; border:1px solid #007fc0; -webkit-appearance:none; color:#333333;} +.welcome-section .welcome-block .welcome-rightpart .brochure-form .form-control:hover, +.welcome-section .welcome-block .welcome-rightpart .brochure-form .form-control:focus { border:1px solid #ed1c24;} +.welcome-section .welcome-block .welcome-rightpart .brochure-form .btn-default { background:#ed1c24; color:#fff; font-size:15px; text-transform:uppercase; border:none; width:100%;} +.welcome-section .welcome-block .welcome-rightpart .brochure-form .btn-default:hover { background:#0a64aa;} + +.welcome-section .welcome-block .welcome-rightpart .brochure-block .rightone { float:right; width:140px; padding:14px 0; position: relative; z-index: 1; } + +.mission-vision-block { display:inline-block; width:100%; margin-bottom:40px; position:relative; z-index:1; } +.mission-vision-block .mv-image { position:relative; overflow:hidden; } +.mission-vision-block .mv-image img { width:100%;} +.mission-vision-block .mv-image .mv-content { min-width:500px; background-color:rgba(0,0,0,0.3); padding:24px 15px 8px 15px; text-align:center; z-index:1; +position:absolute; left:50%; top:50%; color:#fff; border-bottom:5px solid rgba(0,129,195,0.8); } +.mission-vision-block .mv-image .mv-content h3 { margin:10px 0 16px; color:#fff; } +.mission-vision-block .mv-image .mv-content p { font-size:16px; line-height:24px; margin:10px 0; color:#fff; } +.mission-vision-block .mv-image:hover .mv-content {background-color:rgba(0,0,0,0.4); border-bottom:5px solid rgba(237,28,36,0.8);} +.mission-vision-block .mv-image .mv-content:hover h3 { color:#39b9ff;} + +.our-value { display:inline-block; width:100%; text-align:center; padding-bottom:42px; position:relative; z-index:1; } +.our-value h3 { margin:10px 0 25px 0;} +.our-value p { margin:0 auto; max-width:850px; font-size:15px; line-height:22px; text-align: justify;} +.our-value .value-infographics { text-align:center; padding-top:45px; } +.our-value .value-infographics img { width:100%;} + +.service { background:#fbfbfb; padding:50px 0 30px 0; background:url(../images/services-top-shadow.png) left top repeat-x; position:relative; overflow:hidden; } +.service:after { background:url(../images/line-left.png) -100px -620px no-repeat; width:100%; height:100%; position:absolute; left:0; top:0; content:''; } +.service h2 { text-align:center; margin:0; } +.service .service-main { position:relative; z-index:1; } +.service .service-main .service-block { position:relative; overflow:hidden; margin-bottom:30px; } +.service .service-main .service-block .service-thumb { position:relative; overflow:hidden; } +.service .service-main .service-block .service-thumb img { width:100%; } +.service .service-main .service-block .service-overlay { position:absolute; top:100%; width:100%; left:0; background-color:rgba(0,0,0,0.2); height:100%; } +.service .service-main .service-block:hover .service-overlay { top:0;} +.service .service-main .service-block .readmore { margin:0 auto; position:relative; left:50%; display:inline-block; top:50%; } +.service .service-main .service-block .readmore a {line-height:35px; padding:0 14px 0 46px; font-size:15px; color:#fff; border:1px solid #0869b8; display:inline-block; background-color:rgba(8,105,184,0.5); } +.service .service-main .service-block .readmore a em { position:absolute; left:0; top:0; font-size:18px; width:35px; height:37px; text-align:center; line-height:40px; background:#ed1c24; +color:#fff; } + +.service .service-main .service-block .readmore a:hover { background:#ed1c24; border:1px solid #ed1c24; } +.service .service-main .service-block .readmore a:hover em { background:#0869b8; } +.service .service-main .service-block .service-title { line-height:20px; padding:15px 20px; position:relative; font-size:16px; text-transform:uppercase; } +.service .service-main .service-block .service-title a { position:relative; padding-right:20px; color:#fff; z-index:1; } +.service .service-main .service-block .service-title a:hover { padding-right:30px; } +.service .service-main .service-block .service-title a:after { position:relative; content: "\f105"; font-family: 'FontAwesome'; font-size:20px; position:absolute; right:0; } + +.our-markets { position:relative; background:url(../images/our-markets-image.jpg) center top no-repeat; background-attachment:fixed; background-size:cover; padding:50px 0 30px; overflow:hidden; } +.our-markets:after { background-color:rgba(0,0,0,0.4); position:absolute; content:''; left:0; top:0; height:100%; width:100%; } +.our-markets h2 { color:#fff; margin:0; +text-shadow:2px 2px 0px #000; -moz-text-shadow:2px 2px 0px #000; -webkit-text-shadow:2px 2px 0px #000; -ms-text-shadow:2px 2px 0px #000; -o-text-shadow:2px 2px 0px #000; } +.our-markets .markets-main { position:relative; z-index:1; } +.our-markets .markets-main .markets-block { position:relative; text-align:center; color:#b6b6b6; margin-bottom:30px; } +.our-markets .markets-main .markets-block:hover { } +.our-markets .markets-main .markets-block:hover .markets-icon { background-color:rgba(0,0,0,0.4);} +.our-markets .markets-main .markets-block:hover .markets-icon em { background:#ed1c24; } +.our-markets .markets-main .markets-block:hover .markets-content {background-color:rgba(0,93,168,0.4); border-bottom:5px solid rgba(0,138,250,0.9); border-top:1px solid rgba(0,138,250,0.9); } +.our-markets .markets-main .markets-block .markets-icon { padding:15px 0 10px; position:relative; background-color:rgba(0,0,0,0.3); } +.our-markets .markets-main .markets-block a { font-size:24px; color:#fff; margin:0; font-family: 'Roboto-Light'; display:inline-block; margin:0; } +.our-markets .markets-main .markets-block a:hover { color:#bde2ff;} +.our-markets .markets-main .markets-block .markets-content { background-color:rgba(0,0,0,0.4); border-bottom:5px solid rgba(237,28,36,0.7); padding:20px 10px 15px; border-top:1px solid #5f5f5f; } +.our-markets .markets-main .markets-block .markets-content:hover { background-color:rgba(0,93,168,0.2); border-bottom:5px solid rgba(0,138,250,0.8); } +.our-markets .markets-main .markets-block .markets-content h4 { margin:0;} + +.certification { padding:50px 0; } +.certification .caroufredsel_wrapper { display:inline-block; width:100%; } +.certification .logo-carousel { margin:0 0 30px 0; width:100%; } +.certification .logo-carousel ul { margin:0; padding:0; list-style:none; display:block; } +.certification .logo-carousel ul li { float:left; margin:0 5px; +border-left:1px solid #cbcbcb; border-right:1px solid #cbcbcb; border-top:1px solid #cbcbcb; border-bottom:2px solid #ed1c24; } +.certification .logo-carousel ul li:hover { +border-left:1px solid #0766b4; border-right:1px solid #0766b4; border-top:1px solid #0766b4; border-bottom:2px solid #0766b4; +} +.certification .logo-carousel ul li:nth-child(5) { margin-right:200px !important;} + +.footer { font-size:15px; } +.footer .footer-one { display:inline-block; width:100%; padding:30px 0 20px; vertical-align:top; overflow:hidden; } +.footer .svg { margin-top:-80px; width: 100%; } +.footer .footer-logo { margin:10px 0; padding-right:40px; } +.footer .footer-logo .svg { width:100%; margin:0; } +.footer h4 { color:#12487d; text-transform:uppercase; font-size:24px; margin:0 0 16px 0; border-bottom:1px solid #aeaeae; font-family: 'Roboto-Light'; padding-bottom:12px; } +.footer .footer-nav { display:inline-block; width:100%; } +.footer .footer-nav ul { display:inline-block; padding:0; margin:0; vertical-align:top; float:left; width:33.33%;} +.footer .footer-nav ul li { list-style:none; position:relative; padding:0 8px 0 18px; font-size:15px; line-height:28px; display:inline-block; width:100%; float:left; } +.footer .footer-nav ul li:after { background:url(../images/footer-nav-dots.png) left -2px no-repeat; width:9px; height:9px; position:absolute; left:0; content:''; top:9px; } +.footer .footer-nav ul li a { color:#333;} +.footer .footer-nav ul li a:hover { color:#005ca7;} +.footer .footer-nav ul li:hover:after { background:url(../images/footer-nav-dots.png) left -15px no-repeat; } +.footer .footer-nav p { margin:6px 0 0 0;} +.footer .social-icon { margin:8px 0 15px 0; display:inline-block; width:100%; } +.footer .social-icon ul { margin:0; padding:0; display:inline-block; vertical-align:top; } +.footer .social-icon ul li { list-style:none; float:left; margin-right:10px; } +.footer .social-icon ul li a { display:inline-block; width:35px; height:35px; text-align:center; line-height:35px; } +.footer .social-icon ul li em { color:#fff; font-size:18px; display:block; line-height:36px;} +.footer .social-icon ul li a.facebook { background:#3b5998; } +.footer .social-icon ul li a.facebook:hover { background:#0d2861; } +.footer .social-icon ul li a.twitter { background:#1cb7eb; } +.footer .social-icon ul li a.twitter:hover { background:#008bb9; } +.footer .social-icon ul li a.linkedin { background:#005397; } +.footer .social-icon ul li a.linkedin:hover { background:#003866; } +.footer .call { margin:8px 0 15px 0; display:inline-block; width:100%; } +.footer .call ul { margin:0; padding:0; display:inline-block; vertical-align:top; } +.footer .call ul li { list-style:none; float:left; margin-right:10px; } +.footer .call ul li em { margin-right:5px;} +.footer .footer-last { border-top:1px solid #aeaeae; display:inline-block; width:100%; text-align:center; padding:25px 0;} +.footer .footer-last p { margin:0; } +.footer-inner { border-top:1px solid #aeaeae;} + +.under-construction { font-size:50px; text-transform:uppercase; min-height:400px; padding-top:170px; font-family: 'Roboto-Light'; line-height:60px;} +.first-block.under:before { display:none;} + +.video-popup { position:fixed; top:0; left:0; width:100%; height:100%; display:none; text-align:center; background-color:rgba(0,0,0,0.8); z-index:11; } +.close-btn { position:absolute; right:15px; top:15px; color:#fff; font-size:20px; padding:10px; background-color:rgba(0,0,0,0.6); border:1px solid #505050; } +.close-btn:hover { color:#64b7ef; } +.video-popup .video-main { height:100%; } +.video-popup .video-main .videos { top: 50%; position: relative; width:1100px; +transform:translateY(-50%); -moz-transform:translateY(-50%); -webkit-transform:translateY(-50%); -ms-transform:translateY(-50%); -o-transform:translateY(-50%); } + +.video-modal { padding:0 !important;} +.video-modal .modal-body { padding:0; text-align:center; height:100%;} +.video-modal .modal-header { padding:0; border:none; min-height:1px;} +.video-modal .close { margin:10px 10px 0 0; color:#fff; opacity:1; position:absolute; right:0; top:0; z-index:1; } +.video-modal .modal-dialog { width:100%; margin:0 auto; height:100%; } +.video-modal .modal-content { border-radius:0; border:none; box-shadow:none; height:100%; background:none; } +.video-modal .modal-content .video-main { height:100%; } +.video-modal .modal-content .video-main .videos { top: 50%; position: relative; width:1100px; +transform:translateY(-50%); -moz-transform:translateY(-50%); -webkit-transform:translateY(-50%); -ms-transform:translateY(-50%); -o-transform:translateY(-50%); } +.video-modal .modal-backdrop.in { opacity:0.8;} + +.inner-content { padding-top:60px;} +.service.service-innermain { background:none;} +.service.service-innermain:after { display:none; background:none;} + +.inner-banner { position:relative; text-align:center;} +.inner-banner img { width:100%;} +.inner-banner-content { position:absolute; top:50%; left:0; width:100%; text-align:center; } +.inner-banner-content h1 { font-size:55px; font-family: 'Roboto-Light'; color:#fff; line-height:50px; padding:0px 15px; text-align:center; text-transform:uppercase; margin:0 0 35px 0; +background-color:rgba(0,0,0,0.6); padding:8px 20px !important; display:inline-block; margin:0; } +.service-inner-content { } +.top-container { margin-top:-10px; background:#fff; position:relative;} +.sub-heading { text-align:center; padding:20px 0; } +.sub-heading h3 { font-size:32px; margin:0 0 10px 0; line-height:36px; font-family: 'robotoregular';} + +.breadcrumb-menu { position:relative;} +.breadcrumb-menu:before { position:absolute; left:-18px; top:10px; content:''; width:18px; height:90px; background:url(../images/breadcrumb-left-shadow.png) left top no-repeat; } +.breadcrumb-menu:after { position:absolute; right:-18px; top:10px; content:''; width:18px; height:90px; background:url(../images/breadcrumb-right-shadow.png) left top no-repeat; } +.breadcrumb > li em { margin-right:5px;} +.breadcrumb > li { font-size:14px;} +.breadcrumb > li a { color:#00467f; } + +.full-content h4 { display:inline-block; } +ul.listing { margin:0; padding:0; font-size:15px;} +ul.listing li { margin:0; padding:5px 0 5px 20px; position:relative; line-height:18px; list-style:none; } +ul.listing li:before { content: "\f101"; font-family: 'FontAwesome'; position:absolute; left:0; top:3px; } + +ul.listing ul { margin:0; padding:0 0 0 30px; font-size:15px;} +ul.listing ul li { margin:0; padding:5px 0 5px 20px; position:relative; line-height:18px; list-style:none; } +ul.listing ul li:before { content: "\f0da"; font-family: 'FontAwesome'; position:absolute; left:0; top:3px; } +body.leadership ul.listing li { text-align: justify; } + + +.service-gallery { padding:50px 0 30px 0; overflow:hidden; } +.gallery-thumbcol { margin-bottom:30px; position:relative; } +.gallery-thumbcol em { position:absolute; left:50%; top:50%; margin:-18px 0 0 -18px; font-size:20px; width:40px; height:40px; text-align:center; line-height:40px; background:#ed1c24; color:#fff; opacity:0; } +.gallery-thumbcol em:hover {background: #0869b8;} +.gallery-thumbcol:hover em { opacity:1; } +.gallery-thumbcol .gallery-thumb { padding:5px; border:1px solid #cbcbcb; } +.gallery-thumbcol .img-nobr { padding:5px; border:none; } + +.full-image { text-align:center; width:100%; padding:10px 0 20px 0; } +.full-image img { max-width:100%;} +.gallery-thumb { padding:5px; border:1px solid #cbcbcb; } + +.leadership-col { padding:10px 0 0 0;} +.leadership-row { padding:40px 0;} +.leadership-biorow { padding:40px 0; overflow: hidden; } +.about-col { padding:10px 0 0 0;} +.about-row { padding:40px 0;} +.about-row .content-image { float: right; margin: 0 0 20px 50px; } + +.leadership-biorow.first { background: url(../images/square-3.png) left top repeat; border-bottom: 1px solid #a3a3a3; } +.leadership-biorow.second { background: url(../images/square-4.png) left top repeat; } +.leadership-biorow .bio-imagecol { position: relative; border: 1px solid #004780;padding: 5px; } +.leadership-biorow .bio-imagecol .bio-image { position: relative; overflow: hidden; } +.leadership-biorow .bio-imagecol .bio-image img { width: 100%; } +.bio-detail { position: absolute; left: 0; top: 0; width: 100%; height: 100%; background-color: rgba(0,0,0,0.5); opacity: 0; text-align: center; } +.bio-detail h5 { color: #fff; font-size: 24px; margin: 0; position: absolute; left: 0; top: 0; width: 100%; } +.bio-detail span { color: #fff; font-size: 18px; position: absolute; left: 50%; bottom: 0; border-bottom: 2px solid #ed1c24; padding-bottom: 8px; display: inline-block; } +.leadership-biorow .bio-imagecol:hover .bio-detail { opacity: 1; top:0; } +.leadership-biorow .bio-imagecol:hover .bio-detail h5 { top: 38%; } +.leadership-biorow .bio-imagecol:hover .bio-detail span { bottom: 38%; } +.bio-content .bio-title { position: relative; margin-bottom: 25px; } +.bio-content .bio-title h5 { color: #014c88; font-size: 24px; margin: 0 0 10px 0; } +.bio-content .bio-title span { color: #000; font-size: 18px; border-bottom: 2px solid #ed1c24; padding-bottom: 8px; display: inline-block; } +.bio-content ul.listing li { line-height: 22px; } + +.current-openingrow { background: url(../images/square-4.png) left top repeat; padding: 30px 0 15px 0; } +.current-openingrow h4 {font-family: 'Roboto-Medium'; text-transform: uppercase; margin-bottom: 35px;} +.current-opening {} +.opening-list h3 { font-size: 20px; font-family: 'Roboto-Medium'; margin: 0 0 20px 0; } +.opening-list span { font-size: 15px; font-family: 'Roboto-Medium'; margin-bottom: 4px; display: inline-block; } +.opening-list ul { margin: 5px 0 10px 0; padding: 0; } +.opening-list ul li { margin:0; padding:5px 0 5px 20px; position:relative; line-height:18px; list-style:none; } +.opening-list ul li:before { content: "\f101"; font-family: 'FontAwesome'; position:absolute; left:0; top:5px; } +.opening-list ul li span { display: block; font-family: 'Roboto-Medium'; } +.opening-list ul li p { margin-bottom: 10px; } + +.contact-row { padding: 30px 0 60px 0; overflow: hidden; } +.contact-row h4 { margin: 0 0 30px 0; } +.contact-row .contact-leftcol h3 { font-family: 'robotoregular'; margin:0 0 15px 0; } +.contact-row .contact-addresscol { position: relative; padding-right: 15px; } +.contact-row .contact-addresscol:before { position: absolute; width: 1px; height: 100%; right: 0; top: 0; background: #cdcdcd; content: ''; } +.contact-row .contact-addresscol h5 { color: #636363; margin: 0 0 12px 0; } +.contact-row .contact-addresscol .contact-address { position: relative; padding-left: 20px; font-size: 17px; line-height: 26px; } +.contact-row .contact-addresscol .contact-address .fa { position: absolute; left: 0; top: 4px; color: #6c6c6c; } +.contact-row .row [class*="col-"]:last-child .contact-addresscol:before { display: none;} +.contact-form { display: inline-block; width: 100%; vertical-align: top; padding-top: 10px; } +.contact-form .form-control { border: 1px solid #d5d5d5; background: #f9f9f9; height: 45px; padding: 5px 12px; color: #000; box-shadow: none; -webkit-appearance: none; } +.contact-form textarea.form-control { height: 130px; padding: 12px; -webkit-appearance: none; resize: none; } +.contact-form .btn { background: #ed1c24; color: #fff; min-width: 140px; padding: 5px 20px; text-align: center; height: 45px; text-transform: uppercase; } +.contact-form .btn:hover { background: #00467f; } + +.contact-detail p { font-size: 17px; } +.contact-detail h5 { margin: 0px 0 10px 0; } +.contact-detail ul { margin: 0 0 20px 0; padding: 0; } +.contact-detail ul li:first-child { padding-bottom: 25px; } +.contact-detail ul li { margin: 0; padding: 0 0 5px 25px; list-style: none; position: relative; line-height: 26px; font-size: 17px; } +.contact-detail ul li em { position: absolute; left: 0; top: 3px; font-size: 18px; } +.contact-detail ul li em.fa-mobile { font-size: 24px; top: 0; left: 2px; } +.contact-detail ul li em.fa-envelope { font-size: 15px; top: 6px; } +.location { border-top: 1px solid #d5d5d5; } +.location iframe { vertical-align: top; width: 100%; height: 490px; } + + +.contact-section { padding: 60px 0 30px 0; } +.contact-section .contact-cols { border: 1px solid #d5d5d5; min-height: 330px; } +.contact-section .contact-cols h5 { padding: 25px 0; margin: 0; color: #004c87; text-align: center;} +.contact-section .contact-cols .contact_rotate { + position: relative; text-align: center; padding: 40px 0; background: #003e7e; overflow: hidden; + background: -moz-linear-gradient(top, #003e7e 0%, #005ca2 100%); + background: -webkit-linear-gradient(top, #003e7e 0%,#005ca2 100%); + background: linear-gradient(to bottom, #003e7e 0%,#005ca2 100%); + filter: progid:DXImageTransform.Microsoft.gradient( startColorstr='#003e7e', endColorstr='#005ca2',GradientType=0 ); +} +.contact-section .contact-cols .contact_rotate:before { content: ''; border-bottom: 170px solid transparent; position: absolute; + left: 0px; top: 0; border-left: 40px solid#fff; +} +.contact-section .contact-cols .contact_rotate:after { content: ''; border-bottom: 20px solid transparent; position: absolute; + left: 1px; top: 0px; border-left: 280px solid#fff; +} +.contact-section .contact-cols .contact_rotate em { display: inline-block; width: 70px; height: 70px; + color: #fff; font-size: 35px; line-height: 70px; border: 1px solid#fff; + text-align: center; position: relative; + border-radius: 15px 0 15px 0; -webkit-border-radius: 15px 0 15px 0; -moz-border-radius: 15px 0 15px 0; + -ms-border-radius: 15px 0 15px 0; -o-border-radius: 15px 0 15px 0; +} +.contact-section .contact-cols .contact_rotate em.fa-envelope { font-size: 30px; } +.contact-section .contact-cols p { font-size: 20px; line-height: 24px; margin: 0; padding: 25px 10px; text-align: center; } +.contact-section .contact-cols p a { color: #333333; display: inline-block; } +.contact-section .contact-cols p a:hover { color: #00467f; } +.contact-section .contact-cols:hover .contact_rotate em { + border-radius: 0 15px 0 15px; -webkit-border-radius: 0 15px 0 15px; -moz-border-radius: 0 15px 0 15px; + -ms-border-radius: 0 15px 0 15px; -o-border-radius: 0 15px 0 15px; + background: #108ae7; border-color: #108ae7; +} + +.contact-social .social-icon { margin: 0; display: inline-block; width: 100%; text-align: center; padding: 25px 10px; } +.contact-social .social-icon ul { margin:0; padding:0; display:inline-block; vertical-align:top; } +.contact-social .social-icon ul li { list-style:none; float:left; margin:0 5px; padding: 0; } +.contact-social .social-icon ul li a { display:inline-block; width:45px; height:45px; text-align:center; line-height:45px; } +.contact-social .social-icon ul li em { color:#fff; font-size:24px; display:block; line-height:45px; left: auto; top: auto; position: relative;} +.contact-social .social-icon ul li a.facebook { background:#3b5998; } +.contact-social .social-icon ul li a.facebook:hover { background:#0d2861; } +.contact-social .social-icon ul li a.twitter { background:#1cb7eb; } +.contact-social .social-icon ul li a.twitter:hover { background:#008bb9; } +.contact-social .social-icon ul li a.linkedin { background:#005397; } +.contact-social .social-icon ul li a.linkedin:hover { background:#003866; } + +.our-approach { padding-bottom: 50px; } +.our-approach-block { background: #f7f7f7; border: 1px solid #e7e7e7; padding: 20px; overflow: hidden; } +.our-approach-block h4 { text-align: center; } +.our-approach-block p { margin-bottom: 15px; text-align: justify; } + +ul.large-listing { margin:0; padding:0; font-size:15px;} +ul.large-listing li { margin:0; padding:6px 0 6px 30px; position:relative; line-height:26px; list-style:none; } +ul.large-listing li:before { content: "\f105"; font-family: 'FontAwesome'; position:absolute; left:0; top:6px; font-size:22px; color:#999999; } +ul.large-listing li span {font-family: 'Roboto-Medium'; font-size:17px; display:block;} + +.single-row { padding:0 0 40px 0;} +.single-row .gallery-thumbcol { margin-bottom:0; } +.single-content { margin-bottom:20px;} + +.instrumentation { overflow:hidden; } +.instrumentation .gallery-thumbcol { margin-top:20px;} +.instrumentation .single-row { padding:0; } + +.welcome-section .welcome-block .welcome-leftpart p, +.mission-vision-block .mv-image .mv-content p, +.full-content p, +.single-content p { text-align:justify; } +.gallery-top { padding-top:20px;} + +.heading1 {visibility:hidden; opacity:0;} +.heading2 {visibility :hidden; opacity:0;} + +.testimonial-col { /*padding: 50px 0 100px 0;*/ padding: 50px 0 20px 0; overflow: hidden; } +.testimonial-row { display: inline-block; width: 100%; vertical-align: top; } + +.testimonial-one { width: 520px; height: 520px; padding: 120px 72px 20px 72px; float: left; background: #ff9563; color: #fff; position: relative; +border-radius: 100%; +-webkit-border-radius: 100%; +-moz-border-radius: 100%; +-ms-border-radius: 100%; +-o-border-radius: 100%; +} +.testimonial-one p { text-align: justify; margin: 0 0 16px 0; } +.testimonial-one:before { font-family: 'ParisNormal'; font-size: 270px; content: '“'; color: #724834; position: absolute; +left: 44px; top: 10px; line-height: 270px; +text-shadow: 0 0 20px rgba(0,0,0,0.4); + -webkit-text-shadow: 0 0 20px rgba(0,0,0,0.4); + -moz-text-shadow: 0 0 20px rgba(0,0,0,0.4); + -ms-text-shadow: 0 0 20px rgba(0,0,0,0.4); + -o-text-shadow: 0 0 20px rgba(0,0,0,0.4); +} +.testimonial-one:after { font-family: 'ParisNormal'; font-size: 270px; content: '“'; color: #724834; position: absolute; +right: 70px; bottom:-10px; line-height: 270px; +text-shadow: 0 0 20px rgba(0,0,0,0.4); + -webkit-text-shadow: 0 0 20px rgba(0,0,0,0.4); + -moz-text-shadow: 0 0 20px rgba(0,0,0,0.4); + -ms-text-shadow: 0 0 20px rgba(0,0,0,0.4); + -o-text-shadow: 0 0 20px rgba(0,0,0,0.4); + +transform: rotate(180deg); + -webkit-transform: rotate(180deg); + -moz-transform: rotate(180deg); + -ms-transform: rotate(180deg); + -o-transform: rotate(180deg); +} +.testimonial-one .testimonial-onesign { font-size: 16px; line-height: 24px; color: #272727; font-family: 'Roboto-Medium'; text-align: right; } + +.testimonial-two { width: 625px; margin-left: 55px; float: left; } +.testimonial-two .testimonial-twoblock {background: #005596; color: #fff; border-radius: 15px; position: relative; padding: 60px 55px 60px 55px; + margin-bottom: 40px; + +box-shadow: 0px 5px 15px rgba(0,0,0,0.5); + -webkit-box-shadow: 0px 5px 15px rgba(0,0,0,0.5); + -moz-box-shadow: 0px 5px 15px rgba(0,0,0,0.5); + -ms-box-shadow: 0px 5px 15px rgba(0,0,0,0.5); + -o-box-shadow: 0px 5px 15px rgba(0,0,0,0.5); +} +.testimonial-two .testimonial-twoblock p { text-align: justify; margin: 0 0 16px 0; } +.testimonial-two .testimonial-twoblock:after { position: absolute; content: ''; border-top: 25px solid #005596; border-left: 20px solid transparent; +border-right: 20px solid transparent; right: 80px; top:100%; } +.testimonial-two .testimonial-twosign { font-size: 16px; line-height: 24px; color: #013c69; font-family: 'Roboto-Medium'; text-align: right; padding: 0px 55px 0px 0; +max-width: 400px; float: right; } +.testimonial-two .quote-line-top { background: #4193d1; height: 3px; width: 100%; position: relative; margin-bottom: 60px; display: inline-block; } +.testimonial-two .quote-line-top:before { background: #005596; font-size: 170px; content: '“'; color: #fe888d; position: absolute; +left: 50%; top: -2px; line-height: 110px; height: 20px; padding: 0 12px; + +text-shadow: 0 0 15px rgba(0,0,0,0.4); + -webkit-text-shadow: 0 0 15px rgba(0,0,0,0.4); + -moz-text-shadow: 0 0 15px rgba(0,0,0,0.4); + -ms-text-shadow: 0 0 15px rgba(0,0,0,0.4); + -o-text-shadow: 0 0 15px rgba(0,0,0,0.4); + +transform: translate(-50%, 0px); +-webkit-transform: translate(-50%, 0px); +-moz-transform: translate(-50%, 0px); +-ms-transform: translate(-50%, 0px); +-o-transform: translate(-50%, 0px); + } + +.testimonial-two .quote-line-bottom { margin: 50px 0 0px 0; } +.testimonial-two .quote-line-bottom:before { top: -10px; +transform: translate(-50%, 0px) rotate(180deg); +-webkit-transform: translate(-50%, 0px) rotate(180deg); +-moz-transform: translate(-50%, 0px) rotate(180deg); +-ms-transform: translate(-50%, 0px) rotate(180deg); +-o-transform: translate(-50%, 0px) rotate(180deg); + } + +.testimonial-three { width: 520px; padding: 46px 40px 40px 40px; float: left; background: #43403e; color: #fff; position: relative; } +.testimonial-three:after { position: absolute; content: ''; border-bottom: 50px solid #43403e; border-left: 36px solid transparent; +border-right: 36px solid transparent; left: 50%; bottom: 100%; +transform: translateX(-50%); +-webkit-transform: translateX(-50%); +-moz-transform: translateX(-50%); +-ms-transform: translateX(-50%); +-o-transform: translateX(-50%); +} +.testimonial-three p { text-align: justify; margin: 0 0 16px 0; } +.testimonial-three .testimonial-threesign { font-size: 16px; line-height: 24px; color: #e0c075; font-family: 'Roboto-Medium'; text-align: right; padding: 10px 0; } +.testimonial-three .quote-line-top { background: #7c7977; height: 3px; width: 100%; position: relative; margin-bottom: 40px; display: inline-block; } +.testimonial-three .quote-line-top:before { font-family: 'ParisNormal'; background: #43403e; font-size: 170px; content: '“'; color: #fff; position: absolute; +left: 0; top: -10px; line-height: 110px; height: 20px; padding: 0 12px 0 0; +margin-left: -6px; + +text-shadow: 0 0 15px rgba(0,0,0,0.4); +-webkit-text-shadow: 0 0 15px rgba(0,0,0,0.4); +-moz-text-shadow: 0 0 15px rgba(0,0,0,0.4); +-ms-text-shadow: 0 0 15px rgba(0,0,0,0.4); +-o-text-shadow: 0 0 15px rgba(0,0,0,0.4); +} + +.testimonial-three .quote-line-bottom { margin: 40px 0 0px 0; } +.testimonial-three .quote-line-bottom:before { left: auto; right: 0; padding: 0 12px 0 0px; +transform: rotate(180deg); +-webkit-transform: rotate(180deg); +-moz-transform: rotate(180deg); +-ms-transform: rotate(180deg); +-o-transform: rotate(180deg); + } + +.testimonial-four { width: 625px; margin-left: 55px; padding: 70px 55px 20px 55px; float: left; position: relative; } +.testimonial-four p { text-align: justify; margin: 0 0 16px 0; } +.testimonial-four .testimonial-foursign { font-size: 16px; line-height: 24px; color: #000; font-family: 'Roboto-Medium'; text-align: right; padding: 10px 0; } +.testimonial-four .quote-line-top { background: #005596; height: 3px; width: 100%; position: relative; margin: 60px 0; display: inline-block; } +.testimonial-four .quote-line-top .icon-top { text-align: center; color: #a93439; font-size: 100px; margin-top: -50px; position: relative; } +.testimonial-four .quote-line-top .icon-top:before { font-family: arial; font-size: 150px; content: '“'; color: #fff; position: absolute; +left: 50%; top: 35px; line-height: 100px; height: 20px; + +transform: translate(-50%, 0px); +-webkit-transform: translate(-50%, 0px); +-moz-transform: translate(-50%, 0px); +-ms-transform: translate(-50%, 0px); +-o-transform: translate(-50%, 0px); + } +.testimonial-four .quote-line-bottom .icon-top:before { top: 40px; +transform: translate(-50%, 0px) rotate(180deg); +-webkit-transform: translate(-50%, 0px) rotate(180deg); +-moz-transform: translate(-50%, 0px) rotate(180deg); +-ms-transform: translate(-50%, 0px) rotate(180deg); +-o-transform: translate(-50%, 0px) rotate(180deg); +} + +.testimonial-five { width: 625px; float: left; } +.testimonial-five .testimonial-fiveblock {background: #a93439; color: #fff; position: relative; padding: 30px 40px 30px 150px; + margin-bottom: 40px; +border-radius: 15px; +-webkit-border-radius: 15px; +-moz-border-radius: 15px; +-ms-border-radius: 15px; +-o-border-radius: 15px; + +box-shadow: 0px 5px 15px rgba(0,0,0,0.5); +-webkit-box-shadow: 0px 5px 15px rgba(0,0,0,0.5); +-moz-box-shadow: 0px 5px 15px rgba(0,0,0,0.5); +-ms-box-shadow: 0px 5px 15px rgba(0,0,0,0.5); +-o-box-shadow: 0px 5px 15px rgba(0,0,0,0.5); +} +.testimonial-five .testimonial-fiveblock p { text-align: justify; margin: 0 0 16px 0; } +.testimonial-five .testimonial-fiveblock:after { position: absolute; content: ''; border-top: 25px solid #a93439; border-left: 20px solid transparent; +border-right: 20px solid transparent; right: 80px; top:100%; } +.testimonial-five .testimonial-fiveblock:before { position: absolute; content: ''; border-bottom: 60px solid #a93439; border-left: 44px solid transparent; +border-right: 44px solid transparent; left: 40px; bottom:100%; } +.testimonial-five .testimonial-fivesign { font-size: 16px; line-height: 24px; color: #8b2125; font-family: 'Roboto-Medium'; text-align: right; +padding: 0px 40px 0px 0; max-width: 380px; float: right; } +.testimonial-five .quote-line-left { position: absolute; left: 30px; top: -12px; } +.testimonial-five .quote-line-left:before { font-family: arial; font-size: 270px; content: '“'; color: #ffc1c3; position: absolute; +left: 0; top: -10px; padding:0; margin-left: 0; +transform: rotate(180deg) scaleX(-1); +-webkit-transform: rotate(180deg) scaleX(-1); +-moz-transform: rotate(180deg) scaleX(-1); +-ms-transform: rotate(180deg) scaleX(-1); +-o-transform: rotate(180deg) scaleX(-1); + } +.testimonial-five .quote-line-bottom { margin: 50px 0 0px 0; } +.testimonial-five .quote-line-bottom:before { + transform: rotate(180deg); + -webkit-transform: rotate(180deg); + -moz-transform: rotate(180deg); + -ms-transform: rotate(180deg); + -o-transform: rotate(180deg); +} + +.testimonial-six { width: 520px; height: 520px; margin-left: 55px; padding: 130px 72px 20px 72px; float: left; background: #f8c15a; + color: #000333; border-radius: 100%; position: relative; overflow: hidden; } +.testimonial-six:before { position: absolute; content: ''; border-bottom: 52px solid #fff; border-left: 40px solid transparent; +border-right: 40px solid transparent; left: 50%; bottom: 0; +transform: translateX(-50%); +-webkit-transform: translateX(-50%); +-moz-transform: translateX(-50%); +-ms-transform: translateX(-50%); +-o-transform: translateX(-50%); +} +.testimonial-six p { text-align: justify; margin: 0 0 16px 0; } +.testimonial-six:after { font-family: 'ParisNormal'; font-size: 270px; content: '“'; color: #fff; position: absolute; +left: 50%; top:0; line-height: 20px; +transform : translate(-50%, 0px) rotate(180deg); +-webkit-transform : translate(-50%, 0px) rotate(180deg); +-moz-transform : translate(-50%, 0px) rotate(180deg); +-ms-transform : translate(-50%, 0px) rotate(180deg); +-o-transform : translate(-50%, 0px) rotate(180deg); +} +.testimonial-six .testimonial-sixsign { font-size: 16px; line-height: 24px; color: #664a16; font-family: 'Roboto-Medium'; text-align: right; } + +.testimonial-seven { width: 535px; margin-top: 100px; margin-left: 45px; padding: 35px 40px 40px 40px; float: left; background: #e4e4e4; + position: relative; } +.testimonial-seven:before { position: absolute; content: ''; border-top: 40px solid #fff; border-left: 40px solid transparent; +border-right: 0px solid transparent; right: 0; top: 0; } +.testimonial-seven:after { position: absolute; content: ''; border-bottom: 40px solid #fff; border-left: 0px solid transparent; +border-right: 40px solid transparent; left: 0; bottom: 0; } +.testimonial-seven .quote-sign-top { position: relative; left: 0; top: 0; } +.testimonial-seven .quote-sign-top:before { font-family: 'ParisNormal'; font-size: 270px; content: '“'; color: #005596; position: absolute; +left: -95px; top: 20px; +text-shadow: 0 0 20px rgba(0,0,0,0.4); +-webkit-text-shadow: 0 0 20px rgba(0,0,0,0.4); +-moz-text-shadow: 0 0 20px rgba(0,0,0,0.4); +-ms-text-shadow: 0 0 20px rgba(0,0,0,0.4); +-o-text-shadow: 0 0 20px rgba(0,0,0,0.4); +} +.testimonial-seven .quote-sign-bottom:before { left: auto; right: -95px; bottom: 10px; top: auto; +transform: rotate(180deg); +-webkit-transform: rotate(180deg); +-moz-transform: rotate(180deg); +-ms-transform: rotate(180deg); +-o-transform: rotate(180deg); +} +.testimonial-seven p { text-align: justify; margin: 0 0 16px 0;} +.testimonial-seven .testimonial-sevensign { font-size: 16px; line-height: 24px; font-family: 'Roboto-Medium'; text-align: right; padding-top: 10px; } + + +.slick-slide.slick-active .heading1{ visibility: visible; +opacity:1; +animation-duration: 2s; +animation-delay: 0s; +animation-name: headin1css; +} +.slick-slide.slick-active .heading2{ visibility: visible; +opacity:1; +animation-duration: 3s; +animation-delay: 0s; +animation-name: headin2css; +} +.slick-slide.slick-active .heading3{ visibility: visible; +opacity:1; +animation-duration: 3s; +animation-delay: 0s; +animation-name: heading3css; +} +.slick-slide.slick-active .heading4{ visibility: visible; +opacity:1; +animation-duration: 3s; +animation-delay: 0s; +animation-name: heading4css; +} +.slick-slide.slick-active .heading5{ visibility: visible; +opacity:1; +animation-duration: 3s; +animation-delay: 0s; +animation-name: heading5css; +} +.slick-slide.slick-active .heading6{ visibility: visible; +opacity:1; +animation-duration: 3s; +animation-delay: 0s; +animation-name: heading6css; +} +.slick-slide.slick-active .heading7{ visibility: visible; +opacity:1; +animation-duration: 3s; +animation-delay: 0s; +animation-name: heading7css; +} +.slick-slide.slick-active .heading8{ visibility: visible; +opacity:1; +animation-duration: 3s; +animation-delay: 0s; +animation-name: heading8css; +} +.slick-slide.slick-active .heading9{ visibility: visible; +opacity:1; +animation-duration: 3s; +animation-delay: 0s; +animation-name: heading9css; +} +.slick-slide.slick-active .heading10{ visibility: visible; +opacity:1; +animation-duration: 3s; +animation-delay: 0s; +animation-name: heading10css; +} +.slick-slide.slick-active .heading11{ visibility: visible; +opacity:1; +animation-duration: 3s; +animation-delay: 0s; +animation-name: heading11css; +} +@-webkit-keyframes heading11css { + from { + opacity: 0; + -webkit-transform: translate3d(0, -2000px, 0); + transform: translate3d(0, -2000px, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +@keyframes heading11css { + from { + opacity: 0; + -webkit-transform: translate3d(0, -2000px, 0); + transform: translate3d(0, -2000px, 0); + } + + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + +@-webkit-keyframes heading10css { + from { + opacity: 0; + -webkit-transform: scale3d(.3, .3, .3); + transform: scale3d(.3, .3, .3); + } + + 50% { + opacity: 1; + } +} + +@keyframes heading10css { + from { + opacity: 0; + -webkit-transform: scale3d(.3, .3, .3); + transform: scale3d(.3, .3, .3); + } + + 50% { + opacity: 1; + } +} + +@-webkit-keyframes heading9css { + from { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: rotate3d(0, 0, 1, -45deg); + transform: rotate3d(0, 0, 1, -45deg); + opacity: 0; + } + + to { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} +@keyframes heading9css { + from { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: rotate3d(0, 0, 1, -45deg); + transform: rotate3d(0, 0, 1, -45deg); + opacity: 0; + } + + to { + -webkit-transform-origin: left bottom; + transform-origin: left bottom; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} +@-webkit-keyframes heading8css { + from { + -webkit-transform-origin: center; + transform-origin: center; + -webkit-transform: rotate3d(0, 0, 1, -200deg); + transform: rotate3d(0, 0, 1, -200deg); + opacity: 0; + } + + to { + -webkit-transform-origin: center; + transform-origin: center; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} +@keyframes heading8css { + from { + -webkit-transform-origin: center; + transform-origin: center; + -webkit-transform: rotate3d(0, 0, 1, -200deg); + transform: rotate3d(0, 0, 1, -200deg); + opacity: 0; + } + + to { + -webkit-transform-origin: center; + transform-origin: center; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +@-webkit-keyframes heading7css { + from { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: rotate3d(0, 0, 1, 45deg); + transform: rotate3d(0, 0, 1, 45deg); + opacity: 0; + } + + to { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + +@keyframes heading7css { + from { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: rotate3d(0, 0, 1, 45deg); + transform: rotate3d(0, 0, 1, 45deg); + opacity: 0; + } + + to { + -webkit-transform-origin: right bottom; + transform-origin: right bottom; + -webkit-transform: none; + transform: none; + opacity: 1; + } +} + + +@-webkit-keyframes heading6css { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + from { + opacity: 0; + -webkit-transform: translate3d(3000px, 0, 0); + transform: translate3d(3000px, 0, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(-25px, 0, 0); + transform: translate3d(-25px, 0, 0); + } + + 75% { + -webkit-transform: translate3d(10px, 0, 0); + transform: translate3d(10px, 0, 0); + } + + 90% { + -webkit-transform: translate3d(-5px, 0, 0); + transform: translate3d(-5px, 0, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + +@keyframes heading6css { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + from { + opacity: 0; + -webkit-transform: translate3d(3000px, 0, 0); + transform: translate3d(3000px, 0, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(-25px, 0, 0); + transform: translate3d(-25px, 0, 0); + } + + 75% { + -webkit-transform: translate3d(10px, 0, 0); + transform: translate3d(10px, 0, 0); + } + + 90% { + -webkit-transform: translate3d(-5px, 0, 0); + transform: translate3d(-5px, 0, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + + +@-webkit-keyframes heading5css { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + 0% { + opacity: 0; + -webkit-transform: translate3d(-3000px, 0, 0); + transform: translate3d(-3000px, 0, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(25px, 0, 0); + transform: translate3d(25px, 0, 0); + } + + 75% { + -webkit-transform: translate3d(-10px, 0, 0); + transform: translate3d(-10px, 0, 0); + } + + 90% { + -webkit-transform: translate3d(5px, 0, 0); + transform: translate3d(5px, 0, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + +@keyframes heading5css { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + 0% { + opacity: 0; + -webkit-transform: translate3d(-3000px, 0, 0); + transform: translate3d(-3000px, 0, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(25px, 0, 0); + transform: translate3d(25px, 0, 0); + } + + 75% { + -webkit-transform: translate3d(-10px, 0, 0); + transform: translate3d(-10px, 0, 0); + } + + 90% { + -webkit-transform: translate3d(5px, 0, 0); + transform: translate3d(5px, 0, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + + +@-webkit-keyframes heading4css { + from { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0); + transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + 60% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0); + transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0); + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + +@keyframes heading4css { + from { + opacity: 0; + -webkit-transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0); + transform: scale3d(.1, .1, .1) translate3d(0, 1000px, 0); + -webkit-animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + animation-timing-function: cubic-bezier(0.550, 0.055, 0.675, 0.190); + } + + 60% { + opacity: 1; + -webkit-transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0); + transform: scale3d(.475, .475, .475) translate3d(0, -60px, 0); + -webkit-animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + animation-timing-function: cubic-bezier(0.175, 0.885, 0.320, 1); + } +} + + +@-webkit-keyframes heading3css { + from { + opacity: 0; + -webkit-transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg); + transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg); + } + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} +@keyframes heading3css { + from { + opacity: 0; + -webkit-transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg); + transform: translate3d(-100%, 0, 0) rotate3d(0, 0, 1, -120deg); + } + to { + opacity: 1; + -webkit-transform: none; + transform: none; + } +} + + +@-webkit-keyframes headin1css { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + from { + opacity: 0; + -webkit-transform: translate3d(0, 3000px, 0); + transform: translate3d(0, 3000px, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(0, -20px, 0); + transform: translate3d(0, -20px, 0); + } + + 75% { + -webkit-transform: translate3d(0, 10px, 0); + transform: translate3d(0, 10px, 0); + } + + 90% { + -webkit-transform: translate3d(0, -5px, 0); + transform: translate3d(0, -5px, 0); + } + + to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + +@keyframes headin1css { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + from { + opacity: 0; + -webkit-transform: translate3d(0, 3000px, 0); + transform: translate3d(0, 3000px, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(0, -20px, 0); + transform: translate3d(0, -20px, 0); + } + + 75% { + -webkit-transform: translate3d(0, 10px, 0); + transform: translate3d(0, 10px, 0); + } + + 90% { + -webkit-transform: translate3d(0, -5px, 0); + transform: translate3d(0, -5px, 0); + } + + to { + -webkit-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); + } +} + + +@-webkit-keyframes headin2css { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + 0% { + opacity: 0; + -webkit-transform: translate3d(0, -3000px, 0); + transform: translate3d(0, -3000px, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(0, 25px, 0); + transform: translate3d(0, 25px, 0); + } + + 75% { + -webkit-transform: translate3d(0, -10px, 0); + transform: translate3d(0, -10px, 0); + } + + 90% { + -webkit-transform: translate3d(0, 5px, 0); + transform: translate3d(0, 5px, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + +@keyframes headin2css { + from, 60%, 75%, 90%, to { + -webkit-animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + animation-timing-function: cubic-bezier(0.215, 0.610, 0.355, 1.000); + } + + 0% { + opacity: 0; + -webkit-transform: translate3d(0, -3000px, 0); + transform: translate3d(0, -3000px, 0); + } + + 60% { + opacity: 1; + -webkit-transform: translate3d(0, 25px, 0); + transform: translate3d(0, 25px, 0); + } + + 75% { + -webkit-transform: translate3d(0, -10px, 0); + transform: translate3d(0, -10px, 0); + } + + 90% { + -webkit-transform: translate3d(0, 5px, 0); + transform: translate3d(0, 5px, 0); + } + + to { + -webkit-transform: none; + transform: none; + } +} + + +.parallax-window { + min-height: 400px; + background: transparent; +} +@media (min-width:768px) { +.service-col .container {width: 730px; padding:0;} +} +@media (min-width:992px) { +.service-col .container { width:950px; padding: 0; } +} +@media (min-width: 1200px) { +.service-col .container { width:1200px; } +} + + + +@media (max-width: 1199px) { +.nav-main .logo img { width:160px;} +.nav-main .nav-link .nav-ul { padding:40px 0 0 0;} +.nav-main .nav-link .nav-ul > li > a { font-size:13px; padding:6px 10px 12px 10px; } +.nav-main .nav-link .nav-ul li a:before { bottom:0; } +.header .email { padding-right:24px; } +.welcome-section .welcome-block .welcome-leftpart { width:50%;} +.welcome-section .welcome-block .welcome-rightpart { width:50%; } +.welcome-section .welcome-block .welcome-rightpart .brochure-block:after { border-right:560px solid #cfe3f1; border-top:230px solid transparent;} +.welcome-section .welcome-block .welcome-rightpart .brochure-block .leftone { width:100%;} +.welcome-section .welcome-block .welcome-rightpart .brochure-block .rightone { width:100%; text-align:center;} +.mission-vision-block .mv-image .mv-content { min-width:400px; min-height:100px;} +.service .service-main .service-block .service-title { padding:15px 10px; font-size:13px;} +.service .service-main .service-block .service-title a { padding-right:16px; } +.service .service-main .service-block .service-title a:after { line-height:18px;} +.service .service-main .service-block .service-title a:hover { padding-right:25px;} +.first-block:before { background:url(../images/line-left.png) -280px top no-repeat; left:0; top:-300px; } +.first-block:after { background:url(../images/line-right.png) 280px top no-repeat; } +.video-popup .video-main .videos, +.video-modal .modal-content .video-main .videos { width:900px;} +.bio-detail h5 { font-size: 18px; } +.bio-detail span { font-size: 14px; } +.leadership-biorow .bio-imagecol:hover .bio-detail h5 { top: 36%; line-height: 22px; } +.leadership-biorow .bio-imagecol:hover .bio-detail span { bottom: 36%; } +/*.service-col .container { padding:0; }*/ + +.testimonial-one {width: 470px; height: 470px; padding: 90px 55px 20px 55px;} +.testimonial-one:before, +.testimonial-one:after { font-size: 220px; line-height: 200px;} +.testimonial-two { width: 440px; margin-left: 30px;} +.testimonial-two .testimonial-twoblock { padding: 50px 30px 50px 30px;} +.testimonial-two .quote-line-top { margin-bottom: 40px; } +.testimonial-two .quote-line-bottom { margin: 30px 0 0px 0; } +.testimonial-two .testimonial-twosign { padding: 0px 30px 0px 0;} +.testimonial-three { width: 470px; padding: 46px 30px 40px 30px; margin-top: -80px; } +.testimonial-four { width: 440px; margin-left: 30px; padding: 30px;} + +.testimonial-five { width: 440px; margin-top: -160px;} +.testimonial-five .quote-line-left:before { font-size: 180px; left: -10px; top: 10px; } +.testimonial-five .testimonial-fiveblock { padding: 30px 30px 15px 100px; } +.testimonial-five .testimonial-fiveblock:before { border-bottom: 50px solid #a93439; border-left: 34px solid transparent; border-right: 34px solid transparent;} +.testimonial-five .testimonial-fivesign {padding: 0px 30px 0px 0;} + +.testimonial-six { width: 470px; height: 470px; margin-left: 30px; padding: 90px 55px 20px 55px; } +.testimonial-six:after { font-size: 160px;} +.testimonial-six:before { border-bottom: 40px solid #fff; border-left: 30px solid transparent; border-right: 30px solid transparent; } + +.testimonial-seven { width: 440px; margin-top: 70px; margin-left: 40px; padding: 30px 30px 40px 30px; } +.testimonial-seven .quote-sign-top:before { font-size: 220px; left: -75px; top: 10px; } +.testimonial-seven .quote-sign-bottom:before { right: -75px; bottom: 0px; top: auto; } +.contact-section .contact-cols p { font-size: 18px;} +} + +@media (max-width: 991px) { +.slider-content h1 { font-size:40px; line-height:40px;} +.slider-content p { margin:0 auto; font-size:16px; line-height:22px; max-width:570px;} +.slider-content h1 { margin-bottom:15px;} +.slider-content .view-detail {padding: 0 30px; line-height: 40px;} +.header .email { padding-right:15px; } +.welcome-section .welcome-block .welcome-leftpart { padding-right:20px;} +.welcome-section .welcome-block .welcome-rightpart .brochure-block:after { border-right:357px solid #cfe3f1; border-top:435px solid transparent;} +.mission-vision-block { margin-bottom:10px;} +.mission-vision-block .mv-image { margin-bottom:30px;} + +.mission-vision-block .mv-image .mv-content { min-width:inherit; width:90%; padding:5px 15px; } +.mission-vision-block .mv-image .mv-content h3 { margin: 10px 0 10px; font-size: 26px; } +.mission-vision-block .mv-image img, +.mission-vision-block .mv-image.mv-image-two img { height:400px;} +.service .service-main .service-block .service-title { font-size:16px;} + +.nav-main .nav-btn { margin-top:48px;} +.nav-main .nav-link {width:100%;} +.nav-main .nav-link .nav-ul {padding:0px; width:100%; } +.nav-main .nav-link .nav-ul > li {width:100%; padding:0; line-height: 24px; border-bottom:1px solid #dadada; border-right:none; } +.nav-main .nav-link .nav-ul > li > a {padding:5px 10px; display:block;} +.nav-main .nav-link .nav-ul > li ul {position:static; border:none !important; transform:none !important; } +.nav-main .nav-link .nav-ul > li ul:before { display:none; } +.nav-main .nav-link .nav-ul > li.sub-menu a .fa {display:none; } +.nav-main .nav-link .nav-ul li .arrow { cursor:pointer; position:absolute; top:0; right:0; width:30px; height:34px; color:#fff; text-align:center; font-size:27px; line-height:34px; display:block;} +.nav-main .nav-link .nav-ul li .arrow .fa {vertical-align:top; line-height:34px; color:#005da8; } +.nav-main .logo img { width:200px;} +.nav-main .nav-link .nav-ul > li ul li a { padding:5px 20px; line-height:24px;} +.first-block:before { background:url(../images/line-left.png) -480px top no-repeat; left:0; top:-480px; } +.first-block:after { background:url(../images/line-right.png) -90px bottom no-repeat; } +.footer .footer-logo { padding-right:0; } +.footer .footer-nav ul { width:50%;} +.footer .footer-nav ul.last { width:100%;} +.footer .footer-nav ul.last li { width:50%;} +.video-popup .video-main .videos, +.video-modal .modal-content .video-main .videos { width:720px;} +.inner-banner img { min-height:200px;} +.inner-banner-content h1 { line-height:30px; font-size:35px;} +.single-row .gallery-thumbcol .two-images { margin-bottom:20px;} + +.testimonial-one:before, +.testimonial-one:after { font-size: 270px; line-height: 270px; } +.testimonial-two, +.testimonial-four, +.testimonial-six { margin-left: 0; } +.testimonial-one { width: 520px; height: 520px; padding: 120px 72px 20px 72px; float: none; margin: 0 auto 40px auto; } +.testimonial-two { width:520px; float: none; margin: 0 auto 40px auto; } +.testimonial-three { width: 520px; float: none; padding: 46px 30px 40px 30px; margin:80px auto 0 auto; } +.testimonial-four { width: 520px; float: none; margin:0 auto; } +.testimonial-five { width: 520px; float: none; margin:50px auto 0 auto; } +.testimonial-five .testimonial-fivesign { margin-bottom: 40px; } +.testimonial-six { width: 520px; height: 520px; padding: 120px 72px 20px 72px; float: none; margin: 0 auto 40px auto; } +.testimonial-six:after { font-size: 240px;} +.testimonial-seven { width: 520px; float: none; margin:0 auto; } + +.contact-section .contact-cols { margin-bottom: 30px;} +.contact-section .contact-cols .contact_rotate:after { border-left: 350px solid#fff;} +.contact-row .contact-addresscol { margin-bottom: 30px;} +.contact-row .row [class*="col-"]:nth-child(2) .contact-addresscol:before { display: none;} +.contact-section .contact-cols p { font-size: 20px;} +} + +@media (min-width: 992px) { +.nav-main .nav-link {display:block !important; float:right; } +.nav-main .nav-btn {display:none;} +.nav-main .nav-header {float:left; width:auto; } +.nav-main .nav-link .nav-ul > li:hover ul { display:block !important; } +.nav-main .nav-link .nav-ul li .arrow {display:none; } +} + +@media (max-width: 767px) { +.footer-nav ul li { float:none; display:inline; } +.footer-nav ul li:after { top:2px; right:-2px;} +.slider-content .view-detail { padding: 0 30px; line-height: 40px; font-size: 15px; } +.slider-content h1 { font-size: 30px; line-height: 30px; } + +.welcome-section .welcome-block .welcome-leftpart { width:100%; padding:0 0 20px 0; } +.welcome-section .welcome-block .welcome-rightpart { width:100%;} +.welcome-section .welcome-block .welcome-rightpart .brochure-block:after { border-right:680px solid #cfe3f1; border-top:410px solid transparent;} +.mission-vision-block .mv-image img, +.mission-vision-block .mv-image.mv-image-two img { height:auto;} +.mission-vision-block .mv-image .mv-content { width:400px;} +.service:after { background:url(../images/line-left.png) -220px -620px no-repeat; } +.service .service-main .service-block .service-title { font-size: 13px; } +.first-block:before { background:url(../images/line-left.png) -130px top no-repeat; left:0; top:-200px; } +.first-block:after { background:url(../images/line-right.png) right bottom no-repeat; left:0; top:0; } +.footer .footer-logo .svg { width:200px; } +.footer .footer-logo { margin: 0 0 25px 0; } +.footer .footer-nav ul.last { margin-bottom:18px;} +.video-popup .video-main .videos, +.video-modal .modal-content .video-main .videos { width:90%; } + +.under-construction { font-size: 35px; line-height: 50px; } +.gallery-thumbcol .gallery-thumb, +.gallery-thumbcol .img-nobr { width:100%;} +.inner-banner img { min-height:170px;} +.inner-banner-content h1 {line-height: 18px; font-size: 22px; padding: 8px 10px !important; } +.service-col .container { padding:0 18px;} +.top-container { background-color:transparent;} +.service-gallery { padding:30px 0 20px 0;} +.breadcrumb { margin-bottom: 15px; } +.sub-heading h3 { margin:0; } +.service-gallery [class*="col-"].col-centered { width:100%;} +.leadership-biorow .bio-imagecol { max-width: 270px; margin: 0 auto 30px auto; } +.bio-detail h5 { font-size: 22px; } +.bio-detail span { font-size: 18px; } +.leadership-biorow .bio-imagecol:hover .bio-detail h5 { top: 38%; } +.leadership-biorow .bio-imagecol:hover .bio-detail span { bottom: 38%; } +.bio-content .bio-title { text-align: center; } +.contact-form { margin-bottom: 20px; } + +.testimonial-seven { width: 440px; float: none; margin:0 auto; } +.contact-section { padding: 50px 0 10px 0;} +.contact-section .contact-cols { min-height: 1px; } +.contact-section .contact-cols h5 { padding: 25px 0 10px 0; } +.contact-section .contact-cols .contact_rotate:after { border-left: 900px solid#fff;} +.contact-row { padding: 20px 0;} +.contact-row .contact-addresscol:before { display: none;} +.contact-section .contact-cols p { line-height: 28px;} +} + +@media (max-width: 620px) { +.slider-content p { display:none; } +.service [class*="col-"], +.our-markets [class*="col-"] { width:100%;} +.our-markets { background-position: center center !important; } +} + +@media (max-width: 570px) { +.slider-content p { display:none; } +} + +@media (max-width: 560px) { +.testimonial-one:before, +.testimonial-one:after { font-size: 150px; line-height: 20px;} +.testimonial-one:before { left: -10px; top: 25px; } +.testimonial-one:after { right: -10px; bottom: 25px; } +.testimonial-one { width: 100%; height: auto; border-radius: 0; padding: 20px;} + +.testimonial-two { width: 100%; } +.testimonial-two .testimonial-twoblock { padding: 50px 20px 50px 20px;} +.testimonial-two .quote-line-top:before { line-height: 150px; height: 50px; top: -25px; } + +.testimonial-three { width: 100%; padding: 40px 20px 40px 20px; } +.testimonial-three .quote-line-top:before { font-size: 150px; top: -16px; line-height: 110px; height: 40px; } +.testimonial-three .quote-line-bottom:before { top: auto; bottom: -15px; right: 0; } +.testimonial-three:after {border-bottom: 40px solid #43403e; border-left: 30px solid transparent; border-right: 30px solid transparent;} + +.testimonial-four { width: 100%; padding: 30px 20px; } +.testimonial-five { width: 100%; } +.testimonial-five .quote-line-left { left: 15px; top: 12px;} +.testimonial-five .quote-line-left:before { font-size: 100px; left: 0; top: 0;} +.testimonial-five .testimonial-fiveblock { padding: 30px 20px 15px 60px;} +.testimonial-five .testimonial-fiveblock:before { border-bottom: 40px solid #a93439; border-left: 30px solid transparent; border-right: 30px solid transparent; } + +.testimonial-six { width: 100%; height: auto; border-radius: 0; padding: 80px 20px 50px 20px;} +.testimonial-six:after { font-size: 170px; height: 50px; line-height: 135px; top: 15px; } + +.testimonial-seven { width: 100%; padding: 30px 20px; margin-top: 20px; } +.testimonial-seven .quote-sign-top:before { font-size: 150px; left: -30px;top: -4px;} +.testimonial-seven .quote-sign-bottom:before { right: -30px; bottom: -4px; left: auto; } + +} + +@media (max-width: 479px) { +.content-image { width:100%; text-align:center; margin-bottom:15px;} +.banner .banner-shadow { background-size:100% 12px;} +.slider-content .view-detail { padding: 0 10px; line-height: 30px; font-size: 13px; margin:0; } +.slider-content h1 { margin-bottom:10px; font-size:15px; line-height:15px;} +.header .email { position:relative; float:none; padding-right: 0px; text-align: right; display:none; } +.nav-main .logo img { width: 160px; } +.nav-main .nav-btn { margin-top: 30px; } +.welcome-section .welcome-block .welcome-rightpart .brochure-form .row [class*="col-"] { width:100%;} +.mission-vision-block .mv-image .mv-content { width:90%;} +.mission-vision-block .mv-image.mv-image-two img { height:400px;} +.service .service-main .service-block .service-title { font-size:14px;} +.service .service-main .service-block .service-title a:hover { padding-right: 22px; } +.certification .logo-carousel ul li:nth-child(5) { margin-right:5px !important;} + +.footer .footer-logo, +.footer h4, +.footer .social-icon, +.footer .call { text-align:center;} +h2 { font-size: 32px; } +.banner:after { background-size:100% 40%; bottom:-57px; } +.welcome-section .welcome-block .welcome-rightpart .brochure-block .leftone .title { font-size:23px; padding:0 20px 0 15px;} +.breadcrumb { padding:8px;} +.breadcrumb > li + li:before { padding:0 2px;} +.about-row .content-image { float: none; margin: 0 0 20px 0px; text-align: center; } +body.leadership .inner-banner img, +body.careers .inner-banner img, +body.contact .inner-banner img, +body.about .inner-banner img { min-height:120px;} + +body.government .inner-banner img, +body.utilities-and-renewable-energy .inner-banner img, +body.institutional .inner-banner img, +body.transportation .inner-banner img, +body.commercial .inner-banner img, +body.industrial .inner-banner img { min-height:140px;} +} + + + diff --git a/css/font-awesome.css b/css/font-awesome.css new file mode 100755 index 0000000..e38cc6f --- /dev/null +++ b/css/font-awesome.css @@ -0,0 +1,2337 @@ +/*! + * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome + * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License) + */ +/* FONT PATH + * -------------------------- */ +@font-face { + font-family: 'FontAwesome'; + src: url('../fonts/fontawesome-webfont.eot?v=4.7.0'); + src: url('../fonts/fontawesome-webfont.eot?#iefix&v=4.7.0') format('embedded-opentype'), url('../fonts/fontawesome-webfont.woff2?v=4.7.0') format('woff2'), url('../fonts/fontawesome-webfont.woff?v=4.7.0') format('woff'), url('../fonts/fontawesome-webfont.ttf?v=4.7.0') format('truetype'), url('../fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular') format('svg'); + font-weight: normal; + font-style: normal; +} +.fa { + display: inline-block; + font: normal normal normal 14px/1 FontAwesome; + font-size: inherit; + text-rendering: auto; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} +/* makes the font 33% larger relative to the icon container */ +.fa-lg { + font-size: 1.33333333em; + line-height: 0.75em; + vertical-align: -15%; +} +.fa-2x { + font-size: 2em; +} +.fa-3x { + font-size: 3em; +} +.fa-4x { + font-size: 4em; +} +.fa-5x { + font-size: 5em; +} +.fa-fw { + width: 1.28571429em; + text-align: center; +} +.fa-ul { + padding-left: 0; + margin-left: 2.14285714em; + list-style-type: none; +} +.fa-ul > li { + position: relative; +} +.fa-li { + position: absolute; + left: -2.14285714em; + width: 2.14285714em; + top: 0.14285714em; + text-align: center; +} +.fa-li.fa-lg { + left: -1.85714286em; +} +.fa-border { + padding: .2em .25em .15em; + border: solid 0.08em #eeeeee; + border-radius: .1em; +} +.fa-pull-left { + float: left; +} +.fa-pull-right { + float: right; +} +.fa.fa-pull-left { + margin-right: .3em; +} +.fa.fa-pull-right { + margin-left: .3em; +} +/* Deprecated as of 4.4.0 */ +.pull-right { + float: right; +} +.pull-left { + float: left; +} +.fa.pull-left { + margin-right: .3em; +} +.fa.pull-right { + margin-left: .3em; +} +.fa-spin { + -webkit-animation: fa-spin 2s infinite linear; + animation: fa-spin 2s infinite linear; +} +.fa-pulse { + -webkit-animation: fa-spin 1s infinite steps(8); + animation: fa-spin 1s infinite steps(8); +} +@-webkit-keyframes fa-spin { + 0% { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + 100% { + -webkit-transform: rotate(359deg); + transform: rotate(359deg); + } +} +@keyframes fa-spin { + 0% { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); + } + 100% { + -webkit-transform: rotate(359deg); + transform: rotate(359deg); + } +} +.fa-rotate-90 { + -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=1)"; + -webkit-transform: rotate(90deg); + -ms-transform: rotate(90deg); + transform: rotate(90deg); +} +.fa-rotate-180 { + -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2)"; + -webkit-transform: rotate(180deg); + -ms-transform: rotate(180deg); + transform: rotate(180deg); +} +.fa-rotate-270 { + -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=3)"; + -webkit-transform: rotate(270deg); + -ms-transform: rotate(270deg); + transform: rotate(270deg); +} +.fa-flip-horizontal { + -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)"; + -webkit-transform: scale(-1, 1); + -ms-transform: scale(-1, 1); + transform: scale(-1, 1); +} +.fa-flip-vertical { + -ms-filter: "progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)"; + -webkit-transform: scale(1, -1); + -ms-transform: scale(1, -1); + transform: scale(1, -1); +} +:root .fa-rotate-90, +:root .fa-rotate-180, +:root .fa-rotate-270, +:root .fa-flip-horizontal, +:root .fa-flip-vertical { + filter: none; +} +.fa-stack { + position: relative; + display: inline-block; + width: 2em; + height: 2em; + line-height: 2em; + vertical-align: middle; +} +.fa-stack-1x, +.fa-stack-2x { + position: absolute; + left: 0; + width: 100%; + text-align: center; +} +.fa-stack-1x { + line-height: inherit; +} +.fa-stack-2x { + font-size: 2em; +} +.fa-inverse { + color: #ffffff; +} +/* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen + readers do not read off random characters that represent icons */ +.fa-glass:before { + content: "\f000"; +} +.fa-music:before { + content: "\f001"; +} +.fa-search:before { + content: "\f002"; +} +.fa-envelope-o:before { + content: "\f003"; +} +.fa-heart:before { + content: "\f004"; +} +.fa-star:before { + content: "\f005"; +} +.fa-star-o:before { + content: "\f006"; +} +.fa-user:before { + content: "\f007"; +} +.fa-film:before { + content: "\f008"; +} +.fa-th-large:before { + content: "\f009"; +} +.fa-th:before { + content: "\f00a"; +} +.fa-th-list:before { + content: "\f00b"; +} +.fa-check:before { + content: "\f00c"; +} +.fa-remove:before, +.fa-close:before, +.fa-times:before { + content: "\f00d"; +} +.fa-search-plus:before { + content: "\f00e"; +} +.fa-search-minus:before { + content: "\f010"; +} +.fa-power-off:before { + content: "\f011"; +} +.fa-signal:before { + content: "\f012"; +} +.fa-gear:before, +.fa-cog:before { + content: "\f013"; +} +.fa-trash-o:before { + content: "\f014"; +} +.fa-home:before { + content: "\f015"; +} +.fa-file-o:before { + content: "\f016"; +} +.fa-clock-o:before { + content: "\f017"; +} +.fa-road:before { + content: "\f018"; +} +.fa-download:before { + content: "\f019"; +} +.fa-arrow-circle-o-down:before { + content: "\f01a"; +} +.fa-arrow-circle-o-up:before { + content: "\f01b"; +} +.fa-inbox:before { + content: "\f01c"; +} +.fa-play-circle-o:before { + content: "\f01d"; +} +.fa-rotate-right:before, +.fa-repeat:before { + content: "\f01e"; +} +.fa-refresh:before { + content: "\f021"; +} +.fa-list-alt:before { + content: "\f022"; +} +.fa-lock:before { + content: "\f023"; +} +.fa-flag:before { + content: "\f024"; +} +.fa-headphones:before { + content: "\f025"; +} +.fa-volume-off:before { + content: "\f026"; +} +.fa-volume-down:before { + content: "\f027"; +} +.fa-volume-up:before { + content: "\f028"; +} +.fa-qrcode:before { + content: "\f029"; +} +.fa-barcode:before { + content: "\f02a"; +} +.fa-tag:before { + content: "\f02b"; +} +.fa-tags:before { + content: "\f02c"; +} +.fa-book:before { + content: "\f02d"; +} +.fa-bookmark:before { + content: "\f02e"; +} +.fa-print:before { + content: "\f02f"; +} +.fa-camera:before { + content: "\f030"; +} +.fa-font:before { + content: "\f031"; +} +.fa-bold:before { + content: "\f032"; +} +.fa-italic:before { + content: "\f033"; +} +.fa-text-height:before { + content: "\f034"; +} +.fa-text-width:before { + content: "\f035"; +} +.fa-align-left:before { + content: "\f036"; +} +.fa-align-center:before { + content: "\f037"; +} +.fa-align-right:before { + content: "\f038"; +} +.fa-align-justify:before { + content: "\f039"; +} +.fa-list:before { + content: "\f03a"; +} +.fa-dedent:before, +.fa-outdent:before { + content: "\f03b"; +} +.fa-indent:before { + content: "\f03c"; +} +.fa-video-camera:before { + content: "\f03d"; +} +.fa-photo:before, +.fa-image:before, +.fa-picture-o:before { + content: "\f03e"; +} +.fa-pencil:before { + content: "\f040"; +} +.fa-map-marker:before { + content: "\f041"; +} +.fa-adjust:before { + content: "\f042"; +} +.fa-tint:before { + content: "\f043"; +} +.fa-edit:before, +.fa-pencil-square-o:before { + content: "\f044"; +} +.fa-share-square-o:before { + content: "\f045"; +} +.fa-check-square-o:before { + content: "\f046"; +} +.fa-arrows:before { + content: "\f047"; +} +.fa-step-backward:before { + content: "\f048"; +} +.fa-fast-backward:before { + content: "\f049"; +} +.fa-backward:before { + content: "\f04a"; +} +.fa-play:before { + content: "\f04b"; +} +.fa-pause:before { + content: "\f04c"; +} +.fa-stop:before { + content: "\f04d"; +} +.fa-forward:before { + content: "\f04e"; +} +.fa-fast-forward:before { + content: "\f050"; +} +.fa-step-forward:before { + content: "\f051"; +} +.fa-eject:before { + content: "\f052"; +} +.fa-chevron-left:before { + content: "\f053"; +} +.fa-chevron-right:before { + content: "\f054"; +} +.fa-plus-circle:before { + content: "\f055"; +} +.fa-minus-circle:before { + content: "\f056"; +} +.fa-times-circle:before { + content: "\f057"; +} +.fa-check-circle:before { + content: "\f058"; +} +.fa-question-circle:before { + content: "\f059"; +} +.fa-info-circle:before { + content: "\f05a"; +} +.fa-crosshairs:before { + content: "\f05b"; +} +.fa-times-circle-o:before { + content: "\f05c"; +} +.fa-check-circle-o:before { + content: "\f05d"; +} +.fa-ban:before { + content: "\f05e"; +} +.fa-arrow-left:before { + content: "\f060"; +} +.fa-arrow-right:before { + content: "\f061"; +} +.fa-arrow-up:before { + content: "\f062"; +} +.fa-arrow-down:before { + content: "\f063"; +} +.fa-mail-forward:before, +.fa-share:before { + content: "\f064"; +} +.fa-expand:before { + content: "\f065"; +} +.fa-compress:before { + content: "\f066"; +} +.fa-plus:before { + content: "\f067"; +} +.fa-minus:before { + content: "\f068"; +} +.fa-asterisk:before { + content: "\f069"; +} +.fa-exclamation-circle:before { + content: "\f06a"; +} +.fa-gift:before { + content: "\f06b"; +} +.fa-leaf:before { + content: "\f06c"; +} +.fa-fire:before { + content: "\f06d"; +} +.fa-eye:before { + content: "\f06e"; +} +.fa-eye-slash:before { + content: "\f070"; +} +.fa-warning:before, +.fa-exclamation-triangle:before { + content: "\f071"; +} +.fa-plane:before { + content: "\f072"; +} +.fa-calendar:before { + content: "\f073"; +} +.fa-random:before { + content: "\f074"; +} +.fa-comment:before { + content: "\f075"; +} +.fa-magnet:before { + content: "\f076"; +} +.fa-chevron-up:before { + content: "\f077"; +} +.fa-chevron-down:before { + content: "\f078"; +} +.fa-retweet:before { + content: "\f079"; +} +.fa-shopping-cart:before { + content: "\f07a"; +} +.fa-folder:before { + content: "\f07b"; +} +.fa-folder-open:before { + content: "\f07c"; +} +.fa-arrows-v:before { + content: "\f07d"; +} +.fa-arrows-h:before { + content: "\f07e"; +} +.fa-bar-chart-o:before, +.fa-bar-chart:before { + content: "\f080"; +} +.fa-twitter-square:before { + content: "\f081"; +} +.fa-facebook-square:before { + content: "\f082"; +} +.fa-camera-retro:before { + content: "\f083"; +} +.fa-key:before { + content: "\f084"; +} +.fa-gears:before, +.fa-cogs:before { + content: "\f085"; +} +.fa-comments:before { + content: "\f086"; +} +.fa-thumbs-o-up:before { + content: "\f087"; +} +.fa-thumbs-o-down:before { + content: "\f088"; +} +.fa-star-half:before { + content: "\f089"; +} +.fa-heart-o:before { + content: "\f08a"; +} +.fa-sign-out:before { + content: "\f08b"; +} +.fa-linkedin-square:before { + content: "\f08c"; +} +.fa-thumb-tack:before { + content: "\f08d"; +} +.fa-external-link:before { + content: "\f08e"; +} +.fa-sign-in:before { + content: "\f090"; +} +.fa-trophy:before { + content: "\f091"; +} +.fa-github-square:before { + content: "\f092"; +} +.fa-upload:before { + content: "\f093"; +} +.fa-lemon-o:before { + content: "\f094"; +} +.fa-phone:before { + content: "\f095"; +} +.fa-square-o:before { + content: "\f096"; +} +.fa-bookmark-o:before { + content: "\f097"; +} +.fa-phone-square:before { + content: "\f098"; +} +.fa-twitter:before { + content: "\f099"; +} +.fa-facebook-f:before, +.fa-facebook:before { + content: "\f09a"; +} +.fa-github:before { + content: "\f09b"; +} +.fa-unlock:before { + content: "\f09c"; +} +.fa-credit-card:before { + content: "\f09d"; +} +.fa-feed:before, +.fa-rss:before { + content: "\f09e"; +} +.fa-hdd-o:before { + content: "\f0a0"; +} +.fa-bullhorn:before { + content: "\f0a1"; +} +.fa-bell:before { + content: "\f0f3"; +} +.fa-certificate:before { + content: "\f0a3"; +} +.fa-hand-o-right:before { + content: "\f0a4"; +} +.fa-hand-o-left:before { + content: "\f0a5"; +} +.fa-hand-o-up:before { + content: "\f0a6"; +} +.fa-hand-o-down:before { + content: "\f0a7"; +} +.fa-arrow-circle-left:before { + content: "\f0a8"; +} +.fa-arrow-circle-right:before { + content: "\f0a9"; +} +.fa-arrow-circle-up:before { + content: "\f0aa"; +} +.fa-arrow-circle-down:before { + content: "\f0ab"; +} +.fa-globe:before { + content: "\f0ac"; +} +.fa-wrench:before { + content: "\f0ad"; +} +.fa-tasks:before { + content: "\f0ae"; +} +.fa-filter:before { + content: "\f0b0"; +} +.fa-briefcase:before { + content: "\f0b1"; +} +.fa-arrows-alt:before { + content: "\f0b2"; +} +.fa-group:before, +.fa-users:before { + content: "\f0c0"; +} +.fa-chain:before, +.fa-link:before { + content: "\f0c1"; +} +.fa-cloud:before { + content: "\f0c2"; +} +.fa-flask:before { + content: "\f0c3"; +} +.fa-cut:before, +.fa-scissors:before { + content: "\f0c4"; +} +.fa-copy:before, +.fa-files-o:before { + content: "\f0c5"; +} +.fa-paperclip:before { + content: "\f0c6"; +} +.fa-save:before, +.fa-floppy-o:before { + content: "\f0c7"; +} +.fa-square:before { + content: "\f0c8"; +} +.fa-navicon:before, +.fa-reorder:before, +.fa-bars:before { + content: "\f0c9"; +} +.fa-list-ul:before { + content: "\f0ca"; +} +.fa-list-ol:before { + content: "\f0cb"; +} +.fa-strikethrough:before { + content: "\f0cc"; +} +.fa-underline:before { + content: "\f0cd"; +} +.fa-table:before { + content: "\f0ce"; +} +.fa-magic:before { + content: "\f0d0"; +} +.fa-truck:before { + content: "\f0d1"; +} +.fa-pinterest:before { + content: "\f0d2"; +} +.fa-pinterest-square:before { + content: "\f0d3"; +} +.fa-google-plus-square:before { + content: "\f0d4"; +} +.fa-google-plus:before { + content: "\f0d5"; +} +.fa-money:before { + content: "\f0d6"; +} +.fa-caret-down:before { + content: "\f0d7"; +} +.fa-caret-up:before { + content: "\f0d8"; +} +.fa-caret-left:before { + content: "\f0d9"; +} +.fa-caret-right:before { + content: "\f0da"; +} +.fa-columns:before { + content: "\f0db"; +} +.fa-unsorted:before, +.fa-sort:before { + content: "\f0dc"; +} +.fa-sort-down:before, +.fa-sort-desc:before { + content: "\f0dd"; +} +.fa-sort-up:before, +.fa-sort-asc:before { + content: "\f0de"; +} +.fa-envelope:before { + content: "\f0e0"; +} +.fa-linkedin:before { + content: "\f0e1"; +} +.fa-rotate-left:before, +.fa-undo:before { + content: "\f0e2"; +} +.fa-legal:before, +.fa-gavel:before { + content: "\f0e3"; +} +.fa-dashboard:before, +.fa-tachometer:before { + content: "\f0e4"; +} +.fa-comment-o:before { + content: "\f0e5"; +} +.fa-comments-o:before { + content: "\f0e6"; +} +.fa-flash:before, +.fa-bolt:before { + content: "\f0e7"; +} +.fa-sitemap:before { + content: "\f0e8"; +} +.fa-umbrella:before { + content: "\f0e9"; +} +.fa-paste:before, +.fa-clipboard:before { + content: "\f0ea"; +} +.fa-lightbulb-o:before { + content: "\f0eb"; +} +.fa-exchange:before { + content: "\f0ec"; +} +.fa-cloud-download:before { + content: "\f0ed"; +} +.fa-cloud-upload:before { + content: "\f0ee"; +} +.fa-user-md:before { + content: "\f0f0"; +} +.fa-stethoscope:before { + content: "\f0f1"; +} +.fa-suitcase:before { + content: "\f0f2"; +} +.fa-bell-o:before { + content: "\f0a2"; +} +.fa-coffee:before { + content: "\f0f4"; +} +.fa-cutlery:before { + content: "\f0f5"; +} +.fa-file-text-o:before { + content: "\f0f6"; +} +.fa-building-o:before { + content: "\f0f7"; +} +.fa-hospital-o:before { + content: "\f0f8"; +} +.fa-ambulance:before { + content: "\f0f9"; +} +.fa-medkit:before { + content: "\f0fa"; +} +.fa-fighter-jet:before { + content: "\f0fb"; +} +.fa-beer:before { + content: "\f0fc"; +} +.fa-h-square:before { + content: "\f0fd"; +} +.fa-plus-square:before { + content: "\f0fe"; +} +.fa-angle-double-left:before { + content: "\f100"; +} +.fa-angle-double-right:before { + content: "\f101"; +} +.fa-angle-double-up:before { + content: "\f102"; +} +.fa-angle-double-down:before { + content: "\f103"; +} +.fa-angle-left:before { + content: "\f104"; +} +.fa-angle-right:before { + content: "\f105"; +} +.fa-angle-up:before { + content: "\f106"; +} +.fa-angle-down:before { + content: "\f107"; +} +.fa-desktop:before { + content: "\f108"; +} +.fa-laptop:before { + content: "\f109"; +} +.fa-tablet:before { + content: "\f10a"; +} +.fa-mobile-phone:before, +.fa-mobile:before { + content: "\f10b"; +} +.fa-circle-o:before { + content: "\f10c"; +} +.fa-quote-left:before { + content: "\f10d"; +} +.fa-quote-right:before { + content: "\f10e"; +} +.fa-spinner:before { + content: "\f110"; +} +.fa-circle:before { + content: "\f111"; +} +.fa-mail-reply:before, +.fa-reply:before { + content: "\f112"; +} +.fa-github-alt:before { + content: "\f113"; +} +.fa-folder-o:before { + content: "\f114"; +} +.fa-folder-open-o:before { + content: "\f115"; +} +.fa-smile-o:before { + content: "\f118"; +} +.fa-frown-o:before { + content: "\f119"; +} +.fa-meh-o:before { + content: "\f11a"; +} +.fa-gamepad:before { + content: "\f11b"; +} +.fa-keyboard-o:before { + content: "\f11c"; +} +.fa-flag-o:before { + content: "\f11d"; +} +.fa-flag-checkered:before { + content: "\f11e"; +} +.fa-terminal:before { + content: "\f120"; +} +.fa-code:before { + content: "\f121"; +} +.fa-mail-reply-all:before, +.fa-reply-all:before { + content: "\f122"; +} +.fa-star-half-empty:before, +.fa-star-half-full:before, +.fa-star-half-o:before { + content: "\f123"; +} +.fa-location-arrow:before { + content: "\f124"; +} +.fa-crop:before { + content: "\f125"; +} +.fa-code-fork:before { + content: "\f126"; +} +.fa-unlink:before, +.fa-chain-broken:before { + content: "\f127"; +} +.fa-question:before { + content: "\f128"; +} +.fa-info:before { + content: "\f129"; +} +.fa-exclamation:before { + content: "\f12a"; +} +.fa-superscript:before { + content: "\f12b"; +} +.fa-subscript:before { + content: "\f12c"; +} +.fa-eraser:before { + content: "\f12d"; +} +.fa-puzzle-piece:before { + content: "\f12e"; +} +.fa-microphone:before { + content: "\f130"; +} +.fa-microphone-slash:before { + content: "\f131"; +} +.fa-shield:before { + content: "\f132"; +} +.fa-calendar-o:before { + content: "\f133"; +} +.fa-fire-extinguisher:before { + content: "\f134"; +} +.fa-rocket:before { + content: "\f135"; +} +.fa-maxcdn:before { + content: "\f136"; +} +.fa-chevron-circle-left:before { + content: "\f137"; +} +.fa-chevron-circle-right:before { + content: "\f138"; +} +.fa-chevron-circle-up:before { + content: "\f139"; +} +.fa-chevron-circle-down:before { + content: "\f13a"; +} +.fa-html5:before { + content: "\f13b"; +} +.fa-css3:before { + content: "\f13c"; +} +.fa-anchor:before { + content: "\f13d"; +} +.fa-unlock-alt:before { + content: "\f13e"; +} +.fa-bullseye:before { + content: "\f140"; +} +.fa-ellipsis-h:before { + content: "\f141"; +} +.fa-ellipsis-v:before { + content: "\f142"; +} +.fa-rss-square:before { + content: "\f143"; +} +.fa-play-circle:before { + content: "\f144"; +} +.fa-ticket:before { + content: "\f145"; +} +.fa-minus-square:before { + content: "\f146"; +} +.fa-minus-square-o:before { + content: "\f147"; +} +.fa-level-up:before { + content: "\f148"; +} +.fa-level-down:before { + content: "\f149"; +} +.fa-check-square:before { + content: "\f14a"; +} +.fa-pencil-square:before { + content: "\f14b"; +} +.fa-external-link-square:before { + content: "\f14c"; +} +.fa-share-square:before { + content: "\f14d"; +} +.fa-compass:before { + content: "\f14e"; +} +.fa-toggle-down:before, +.fa-caret-square-o-down:before { + content: "\f150"; +} +.fa-toggle-up:before, +.fa-caret-square-o-up:before { + content: "\f151"; +} +.fa-toggle-right:before, +.fa-caret-square-o-right:before { + content: "\f152"; +} +.fa-euro:before, +.fa-eur:before { + content: "\f153"; +} +.fa-gbp:before { + content: "\f154"; +} +.fa-dollar:before, +.fa-usd:before { + content: "\f155"; +} +.fa-rupee:before, +.fa-inr:before { + content: "\f156"; +} +.fa-cny:before, +.fa-rmb:before, +.fa-yen:before, +.fa-jpy:before { + content: "\f157"; +} +.fa-ruble:before, +.fa-rouble:before, +.fa-rub:before { + content: "\f158"; +} +.fa-won:before, +.fa-krw:before { + content: "\f159"; +} +.fa-bitcoin:before, +.fa-btc:before { + content: "\f15a"; +} +.fa-file:before { + content: "\f15b"; +} +.fa-file-text:before { + content: "\f15c"; +} +.fa-sort-alpha-asc:before { + content: "\f15d"; +} +.fa-sort-alpha-desc:before { + content: "\f15e"; +} +.fa-sort-amount-asc:before { + content: "\f160"; +} +.fa-sort-amount-desc:before { + content: "\f161"; +} +.fa-sort-numeric-asc:before { + content: "\f162"; +} +.fa-sort-numeric-desc:before { + content: "\f163"; +} +.fa-thumbs-up:before { + content: "\f164"; +} +.fa-thumbs-down:before { + content: "\f165"; +} +.fa-youtube-square:before { + content: "\f166"; +} +.fa-youtube:before { + content: "\f167"; +} +.fa-xing:before { + content: "\f168"; +} +.fa-xing-square:before { + content: "\f169"; +} +.fa-youtube-play:before { + content: "\f16a"; +} +.fa-dropbox:before { + content: "\f16b"; +} +.fa-stack-overflow:before { + content: "\f16c"; +} +.fa-instagram:before { + content: "\f16d"; +} +.fa-flickr:before { + content: "\f16e"; +} +.fa-adn:before { + content: "\f170"; +} +.fa-bitbucket:before { + content: "\f171"; +} +.fa-bitbucket-square:before { + content: "\f172"; +} +.fa-tumblr:before { + content: "\f173"; +} +.fa-tumblr-square:before { + content: "\f174"; +} +.fa-long-arrow-down:before { + content: "\f175"; +} +.fa-long-arrow-up:before { + content: "\f176"; +} +.fa-long-arrow-left:before { + content: "\f177"; +} +.fa-long-arrow-right:before { + content: "\f178"; +} +.fa-apple:before { + content: "\f179"; +} +.fa-windows:before { + content: "\f17a"; +} +.fa-android:before { + content: "\f17b"; +} +.fa-linux:before { + content: "\f17c"; +} +.fa-dribbble:before { + content: "\f17d"; +} +.fa-skype:before { + content: "\f17e"; +} +.fa-foursquare:before { + content: "\f180"; +} +.fa-trello:before { + content: "\f181"; +} +.fa-female:before { + content: "\f182"; +} +.fa-male:before { + content: "\f183"; +} +.fa-gittip:before, +.fa-gratipay:before { + content: "\f184"; +} +.fa-sun-o:before { + content: "\f185"; +} +.fa-moon-o:before { + content: "\f186"; +} +.fa-archive:before { + content: "\f187"; +} +.fa-bug:before { + content: "\f188"; +} +.fa-vk:before { + content: "\f189"; +} +.fa-weibo:before { + content: "\f18a"; +} +.fa-renren:before { + content: "\f18b"; +} +.fa-pagelines:before { + content: "\f18c"; +} +.fa-stack-exchange:before { + content: "\f18d"; +} +.fa-arrow-circle-o-right:before { + content: "\f18e"; +} +.fa-arrow-circle-o-left:before { + content: "\f190"; +} +.fa-toggle-left:before, +.fa-caret-square-o-left:before { + content: "\f191"; +} +.fa-dot-circle-o:before { + content: "\f192"; +} +.fa-wheelchair:before { + content: "\f193"; +} +.fa-vimeo-square:before { + content: "\f194"; +} +.fa-turkish-lira:before, +.fa-try:before { + content: "\f195"; +} +.fa-plus-square-o:before { + content: "\f196"; +} +.fa-space-shuttle:before { + content: "\f197"; +} +.fa-slack:before { + content: "\f198"; +} +.fa-envelope-square:before { + content: "\f199"; +} +.fa-wordpress:before { + content: "\f19a"; +} +.fa-openid:before { + content: "\f19b"; +} +.fa-institution:before, +.fa-bank:before, +.fa-university:before { + content: "\f19c"; +} +.fa-mortar-board:before, +.fa-graduation-cap:before { + content: "\f19d"; +} +.fa-yahoo:before { + content: "\f19e"; +} +.fa-google:before { + content: "\f1a0"; +} +.fa-reddit:before { + content: "\f1a1"; +} +.fa-reddit-square:before { + content: "\f1a2"; +} +.fa-stumbleupon-circle:before { + content: "\f1a3"; +} +.fa-stumbleupon:before { + content: "\f1a4"; +} +.fa-delicious:before { + content: "\f1a5"; +} +.fa-digg:before { + content: "\f1a6"; +} +.fa-pied-piper-pp:before { + content: "\f1a7"; +} +.fa-pied-piper-alt:before { + content: "\f1a8"; +} +.fa-drupal:before { + content: "\f1a9"; +} +.fa-joomla:before { + content: "\f1aa"; +} +.fa-language:before { + content: "\f1ab"; +} +.fa-fax:before { + content: "\f1ac"; +} +.fa-building:before { + content: "\f1ad"; +} +.fa-child:before { + content: "\f1ae"; +} +.fa-paw:before { + content: "\f1b0"; +} +.fa-spoon:before { + content: "\f1b1"; +} +.fa-cube:before { + content: "\f1b2"; +} +.fa-cubes:before { + content: "\f1b3"; +} +.fa-behance:before { + content: "\f1b4"; +} +.fa-behance-square:before { + content: "\f1b5"; +} +.fa-steam:before { + content: "\f1b6"; +} +.fa-steam-square:before { + content: "\f1b7"; +} +.fa-recycle:before { + content: "\f1b8"; +} +.fa-automobile:before, +.fa-car:before { + content: "\f1b9"; +} +.fa-cab:before, +.fa-taxi:before { + content: "\f1ba"; +} +.fa-tree:before { + content: "\f1bb"; +} +.fa-spotify:before { + content: "\f1bc"; +} +.fa-deviantart:before { + content: "\f1bd"; +} +.fa-soundcloud:before { + content: "\f1be"; +} +.fa-database:before { + content: "\f1c0"; +} +.fa-file-pdf-o:before { + content: "\f1c1"; +} +.fa-file-word-o:before { + content: "\f1c2"; +} +.fa-file-excel-o:before { + content: "\f1c3"; +} +.fa-file-powerpoint-o:before { + content: "\f1c4"; +} +.fa-file-photo-o:before, +.fa-file-picture-o:before, +.fa-file-image-o:before { + content: "\f1c5"; +} +.fa-file-zip-o:before, +.fa-file-archive-o:before { + content: "\f1c6"; +} +.fa-file-sound-o:before, +.fa-file-audio-o:before { + content: "\f1c7"; +} +.fa-file-movie-o:before, +.fa-file-video-o:before { + content: "\f1c8"; +} +.fa-file-code-o:before { + content: "\f1c9"; +} +.fa-vine:before { + content: "\f1ca"; +} +.fa-codepen:before { + content: "\f1cb"; +} +.fa-jsfiddle:before { + content: "\f1cc"; +} +.fa-life-bouy:before, +.fa-life-buoy:before, +.fa-life-saver:before, +.fa-support:before, +.fa-life-ring:before { + content: "\f1cd"; +} +.fa-circle-o-notch:before { + content: "\f1ce"; +} +.fa-ra:before, +.fa-resistance:before, +.fa-rebel:before { + content: "\f1d0"; +} +.fa-ge:before, +.fa-empire:before { + content: "\f1d1"; +} +.fa-git-square:before { + content: "\f1d2"; +} +.fa-git:before { + content: "\f1d3"; +} +.fa-y-combinator-square:before, +.fa-yc-square:before, +.fa-hacker-news:before { + content: "\f1d4"; +} +.fa-tencent-weibo:before { + content: "\f1d5"; +} +.fa-qq:before { + content: "\f1d6"; +} +.fa-wechat:before, +.fa-weixin:before { + content: "\f1d7"; +} +.fa-send:before, +.fa-paper-plane:before { + content: "\f1d8"; +} +.fa-send-o:before, +.fa-paper-plane-o:before { + content: "\f1d9"; +} +.fa-history:before { + content: "\f1da"; +} +.fa-circle-thin:before { + content: "\f1db"; +} +.fa-header:before { + content: "\f1dc"; +} +.fa-paragraph:before { + content: "\f1dd"; +} +.fa-sliders:before { + content: "\f1de"; +} +.fa-share-alt:before { + content: "\f1e0"; +} +.fa-share-alt-square:before { + content: "\f1e1"; +} +.fa-bomb:before { + content: "\f1e2"; +} +.fa-soccer-ball-o:before, +.fa-futbol-o:before { + content: "\f1e3"; +} +.fa-tty:before { + content: "\f1e4"; +} +.fa-binoculars:before { + content: "\f1e5"; +} +.fa-plug:before { + content: "\f1e6"; +} +.fa-slideshare:before { + content: "\f1e7"; +} +.fa-twitch:before { + content: "\f1e8"; +} +.fa-yelp:before { + content: "\f1e9"; +} +.fa-newspaper-o:before { + content: "\f1ea"; +} +.fa-wifi:before { + content: "\f1eb"; +} +.fa-calculator:before { + content: "\f1ec"; +} +.fa-paypal:before { + content: "\f1ed"; +} +.fa-google-wallet:before { + content: "\f1ee"; +} +.fa-cc-visa:before { + content: "\f1f0"; +} +.fa-cc-mastercard:before { + content: "\f1f1"; +} +.fa-cc-discover:before { + content: "\f1f2"; +} +.fa-cc-amex:before { + content: "\f1f3"; +} +.fa-cc-paypal:before { + content: "\f1f4"; +} +.fa-cc-stripe:before { + content: "\f1f5"; +} +.fa-bell-slash:before { + content: "\f1f6"; +} +.fa-bell-slash-o:before { + content: "\f1f7"; +} +.fa-trash:before { + content: "\f1f8"; +} +.fa-copyright:before { + content: "\f1f9"; +} +.fa-at:before { + content: "\f1fa"; +} +.fa-eyedropper:before { + content: "\f1fb"; +} +.fa-paint-brush:before { + content: "\f1fc"; +} +.fa-birthday-cake:before { + content: "\f1fd"; +} +.fa-area-chart:before { + content: "\f1fe"; +} +.fa-pie-chart:before { + content: "\f200"; +} +.fa-line-chart:before { + content: "\f201"; +} +.fa-lastfm:before { + content: "\f202"; +} +.fa-lastfm-square:before { + content: "\f203"; +} +.fa-toggle-off:before { + content: "\f204"; +} +.fa-toggle-on:before { + content: "\f205"; +} +.fa-bicycle:before { + content: "\f206"; +} +.fa-bus:before { + content: "\f207"; +} +.fa-ioxhost:before { + content: "\f208"; +} +.fa-angellist:before { + content: "\f209"; +} +.fa-cc:before { + content: "\f20a"; +} +.fa-shekel:before, +.fa-sheqel:before, +.fa-ils:before { + content: "\f20b"; +} +.fa-meanpath:before { + content: "\f20c"; +} +.fa-buysellads:before { + content: "\f20d"; +} +.fa-connectdevelop:before { + content: "\f20e"; +} +.fa-dashcube:before { + content: "\f210"; +} +.fa-forumbee:before { + content: "\f211"; +} +.fa-leanpub:before { + content: "\f212"; +} +.fa-sellsy:before { + content: "\f213"; +} +.fa-shirtsinbulk:before { + content: "\f214"; +} +.fa-simplybuilt:before { + content: "\f215"; +} +.fa-skyatlas:before { + content: "\f216"; +} +.fa-cart-plus:before { + content: "\f217"; +} +.fa-cart-arrow-down:before { + content: "\f218"; +} +.fa-diamond:before { + content: "\f219"; +} +.fa-ship:before { + content: "\f21a"; +} +.fa-user-secret:before { + content: "\f21b"; +} +.fa-motorcycle:before { + content: "\f21c"; +} +.fa-street-view:before { + content: "\f21d"; +} +.fa-heartbeat:before { + content: "\f21e"; +} +.fa-venus:before { + content: "\f221"; +} +.fa-mars:before { + content: "\f222"; +} +.fa-mercury:before { + content: "\f223"; +} +.fa-intersex:before, +.fa-transgender:before { + content: "\f224"; +} +.fa-transgender-alt:before { + content: "\f225"; +} +.fa-venus-double:before { + content: "\f226"; +} +.fa-mars-double:before { + content: "\f227"; +} +.fa-venus-mars:before { + content: "\f228"; +} +.fa-mars-stroke:before { + content: "\f229"; +} +.fa-mars-stroke-v:before { + content: "\f22a"; +} +.fa-mars-stroke-h:before { + content: "\f22b"; +} +.fa-neuter:before { + content: "\f22c"; +} +.fa-genderless:before { + content: "\f22d"; +} +.fa-facebook-official:before { + content: "\f230"; +} +.fa-pinterest-p:before { + content: "\f231"; +} +.fa-whatsapp:before { + content: "\f232"; +} +.fa-server:before { + content: "\f233"; +} +.fa-user-plus:before { + content: "\f234"; +} +.fa-user-times:before { + content: "\f235"; +} +.fa-hotel:before, +.fa-bed:before { + content: "\f236"; +} +.fa-viacoin:before { + content: "\f237"; +} +.fa-train:before { + content: "\f238"; +} +.fa-subway:before { + content: "\f239"; +} +.fa-medium:before { + content: "\f23a"; +} +.fa-yc:before, +.fa-y-combinator:before { + content: "\f23b"; +} +.fa-optin-monster:before { + content: "\f23c"; +} +.fa-opencart:before { + content: "\f23d"; +} +.fa-expeditedssl:before { + content: "\f23e"; +} +.fa-battery-4:before, +.fa-battery:before, +.fa-battery-full:before { + content: "\f240"; +} +.fa-battery-3:before, +.fa-battery-three-quarters:before { + content: "\f241"; +} +.fa-battery-2:before, +.fa-battery-half:before { + content: "\f242"; +} +.fa-battery-1:before, +.fa-battery-quarter:before { + content: "\f243"; +} +.fa-battery-0:before, +.fa-battery-empty:before { + content: "\f244"; +} +.fa-mouse-pointer:before { + content: "\f245"; +} +.fa-i-cursor:before { + content: "\f246"; +} +.fa-object-group:before { + content: "\f247"; +} +.fa-object-ungroup:before { + content: "\f248"; +} +.fa-sticky-note:before { + content: "\f249"; +} +.fa-sticky-note-o:before { + content: "\f24a"; +} +.fa-cc-jcb:before { + content: "\f24b"; +} +.fa-cc-diners-club:before { + content: "\f24c"; +} +.fa-clone:before { + content: "\f24d"; +} +.fa-balance-scale:before { + content: "\f24e"; +} +.fa-hourglass-o:before { + content: "\f250"; +} +.fa-hourglass-1:before, +.fa-hourglass-start:before { + content: "\f251"; +} +.fa-hourglass-2:before, +.fa-hourglass-half:before { + content: "\f252"; +} +.fa-hourglass-3:before, +.fa-hourglass-end:before { + content: "\f253"; +} +.fa-hourglass:before { + content: "\f254"; +} +.fa-hand-grab-o:before, +.fa-hand-rock-o:before { + content: "\f255"; +} +.fa-hand-stop-o:before, +.fa-hand-paper-o:before { + content: "\f256"; +} +.fa-hand-scissors-o:before { + content: "\f257"; +} +.fa-hand-lizard-o:before { + content: "\f258"; +} +.fa-hand-spock-o:before { + content: "\f259"; +} +.fa-hand-pointer-o:before { + content: "\f25a"; +} +.fa-hand-peace-o:before { + content: "\f25b"; +} +.fa-trademark:before { + content: "\f25c"; +} +.fa-registered:before { + content: "\f25d"; +} +.fa-creative-commons:before { + content: "\f25e"; +} +.fa-gg:before { + content: "\f260"; +} +.fa-gg-circle:before { + content: "\f261"; +} +.fa-tripadvisor:before { + content: "\f262"; +} +.fa-odnoklassniki:before { + content: "\f263"; +} +.fa-odnoklassniki-square:before { + content: "\f264"; +} +.fa-get-pocket:before { + content: "\f265"; +} +.fa-wikipedia-w:before { + content: "\f266"; +} +.fa-safari:before { + content: "\f267"; +} +.fa-chrome:before { + content: "\f268"; +} +.fa-firefox:before { + content: "\f269"; +} +.fa-opera:before { + content: "\f26a"; +} +.fa-internet-explorer:before { + content: "\f26b"; +} +.fa-tv:before, +.fa-television:before { + content: "\f26c"; +} +.fa-contao:before { + content: "\f26d"; +} +.fa-500px:before { + content: "\f26e"; +} +.fa-amazon:before { + content: "\f270"; +} +.fa-calendar-plus-o:before { + content: "\f271"; +} +.fa-calendar-minus-o:before { + content: "\f272"; +} +.fa-calendar-times-o:before { + content: "\f273"; +} +.fa-calendar-check-o:before { + content: "\f274"; +} +.fa-industry:before { + content: "\f275"; +} +.fa-map-pin:before { + content: "\f276"; +} +.fa-map-signs:before { + content: "\f277"; +} +.fa-map-o:before { + content: "\f278"; +} +.fa-map:before { + content: "\f279"; +} +.fa-commenting:before { + content: "\f27a"; +} +.fa-commenting-o:before { + content: "\f27b"; +} +.fa-houzz:before { + content: "\f27c"; +} +.fa-vimeo:before { + content: "\f27d"; +} +.fa-black-tie:before { + content: "\f27e"; +} +.fa-fonticons:before { + content: "\f280"; +} +.fa-reddit-alien:before { + content: "\f281"; +} +.fa-edge:before { + content: "\f282"; +} +.fa-credit-card-alt:before { + content: "\f283"; +} +.fa-codiepie:before { + content: "\f284"; +} +.fa-modx:before { + content: "\f285"; +} +.fa-fort-awesome:before { + content: "\f286"; +} +.fa-usb:before { + content: "\f287"; +} +.fa-product-hunt:before { + content: "\f288"; +} +.fa-mixcloud:before { + content: "\f289"; +} +.fa-scribd:before { + content: "\f28a"; +} +.fa-pause-circle:before { + content: "\f28b"; +} +.fa-pause-circle-o:before { + content: "\f28c"; +} +.fa-stop-circle:before { + content: "\f28d"; +} +.fa-stop-circle-o:before { + content: "\f28e"; +} +.fa-shopping-bag:before { + content: "\f290"; +} +.fa-shopping-basket:before { + content: "\f291"; +} +.fa-hashtag:before { + content: "\f292"; +} +.fa-bluetooth:before { + content: "\f293"; +} +.fa-bluetooth-b:before { + content: "\f294"; +} +.fa-percent:before { + content: "\f295"; +} +.fa-gitlab:before { + content: "\f296"; +} +.fa-wpbeginner:before { + content: "\f297"; +} +.fa-wpforms:before { + content: "\f298"; +} +.fa-envira:before { + content: "\f299"; +} +.fa-universal-access:before { + content: "\f29a"; +} +.fa-wheelchair-alt:before { + content: "\f29b"; +} +.fa-question-circle-o:before { + content: "\f29c"; +} +.fa-blind:before { + content: "\f29d"; +} +.fa-audio-description:before { + content: "\f29e"; +} +.fa-volume-control-phone:before { + content: "\f2a0"; +} +.fa-braille:before { + content: "\f2a1"; +} +.fa-assistive-listening-systems:before { + content: "\f2a2"; +} +.fa-asl-interpreting:before, +.fa-american-sign-language-interpreting:before { + content: "\f2a3"; +} +.fa-deafness:before, +.fa-hard-of-hearing:before, +.fa-deaf:before { + content: "\f2a4"; +} +.fa-glide:before { + content: "\f2a5"; +} +.fa-glide-g:before { + content: "\f2a6"; +} +.fa-signing:before, +.fa-sign-language:before { + content: "\f2a7"; +} +.fa-low-vision:before { + content: "\f2a8"; +} +.fa-viadeo:before { + content: "\f2a9"; +} +.fa-viadeo-square:before { + content: "\f2aa"; +} +.fa-snapchat:before { + content: "\f2ab"; +} +.fa-snapchat-ghost:before { + content: "\f2ac"; +} +.fa-snapchat-square:before { + content: "\f2ad"; +} +.fa-pied-piper:before { + content: "\f2ae"; +} +.fa-first-order:before { + content: "\f2b0"; +} +.fa-yoast:before { + content: "\f2b1"; +} +.fa-themeisle:before { + content: "\f2b2"; +} +.fa-google-plus-circle:before, +.fa-google-plus-official:before { + content: "\f2b3"; +} +.fa-fa:before, +.fa-font-awesome:before { + content: "\f2b4"; +} +.fa-handshake-o:before { + content: "\f2b5"; +} +.fa-envelope-open:before { + content: "\f2b6"; +} +.fa-envelope-open-o:before { + content: "\f2b7"; +} +.fa-linode:before { + content: "\f2b8"; +} +.fa-address-book:before { + content: "\f2b9"; +} +.fa-address-book-o:before { + content: "\f2ba"; +} +.fa-vcard:before, +.fa-address-card:before { + content: "\f2bb"; +} +.fa-vcard-o:before, +.fa-address-card-o:before { + content: "\f2bc"; +} +.fa-user-circle:before { + content: "\f2bd"; +} +.fa-user-circle-o:before { + content: "\f2be"; +} +.fa-user-o:before { + content: "\f2c0"; +} +.fa-id-badge:before { + content: "\f2c1"; +} +.fa-drivers-license:before, +.fa-id-card:before { + content: "\f2c2"; +} +.fa-drivers-license-o:before, +.fa-id-card-o:before { + content: "\f2c3"; +} +.fa-quora:before { + content: "\f2c4"; +} +.fa-free-code-camp:before { + content: "\f2c5"; +} +.fa-telegram:before { + content: "\f2c6"; +} +.fa-thermometer-4:before, +.fa-thermometer:before, +.fa-thermometer-full:before { + content: "\f2c7"; +} +.fa-thermometer-3:before, +.fa-thermometer-three-quarters:before { + content: "\f2c8"; +} +.fa-thermometer-2:before, +.fa-thermometer-half:before { + content: "\f2c9"; +} +.fa-thermometer-1:before, +.fa-thermometer-quarter:before { + content: "\f2ca"; +} +.fa-thermometer-0:before, +.fa-thermometer-empty:before { + content: "\f2cb"; +} +.fa-shower:before { + content: "\f2cc"; +} +.fa-bathtub:before, +.fa-s15:before, +.fa-bath:before { + content: "\f2cd"; +} +.fa-podcast:before { + content: "\f2ce"; +} +.fa-window-maximize:before { + content: "\f2d0"; +} +.fa-window-minimize:before { + content: "\f2d1"; +} +.fa-window-restore:before { + content: "\f2d2"; +} +.fa-times-rectangle:before, +.fa-window-close:before { + content: "\f2d3"; +} +.fa-times-rectangle-o:before, +.fa-window-close-o:before { + content: "\f2d4"; +} +.fa-bandcamp:before { + content: "\f2d5"; +} +.fa-grav:before { + content: "\f2d6"; +} +.fa-etsy:before { + content: "\f2d7"; +} +.fa-imdb:before { + content: "\f2d8"; +} +.fa-ravelry:before { + content: "\f2d9"; +} +.fa-eercast:before { + content: "\f2da"; +} +.fa-microchip:before { + content: "\f2db"; +} +.fa-snowflake-o:before { + content: "\f2dc"; +} +.fa-superpowers:before { + content: "\f2dd"; +} +.fa-wpexplorer:before { + content: "\f2de"; +} +.fa-meetup:before { + content: "\f2e0"; +} +.sr-only { + position: absolute; + width: 1px; + height: 1px; + padding: 0; + margin: -1px; + overflow: hidden; + clip: rect(0, 0, 0, 0); + border: 0; +} +.sr-only-focusable:active, +.sr-only-focusable:focus { + position: static; + width: auto; + height: auto; + margin: 0; + overflow: visible; + clip: auto; +} diff --git a/css/ie8.css b/css/ie8.css new file mode 100755 index 0000000..47be0f0 --- /dev/null +++ b/css/ie8.css @@ -0,0 +1,28 @@ +/****** General Styles *********/ +body {...} +h1, h2, h3 {..} +p {...} +a {...} + +/****** Header Style *********/ +header {...} + +/****** Navigation Style *********/ +nav {...} + +/****** Footer Style *********/ +footer {...} + +/****** Responsive Style *********/ + +@media (min-width: 768px) { + +} + +@media (max-width: 480px) { + +} + +@media (max-width: 320px) { + +} \ No newline at end of file diff --git a/css/jquery.fancybox.css b/css/jquery.fancybox.css new file mode 100755 index 0000000..1f08f7a --- /dev/null +++ b/css/jquery.fancybox.css @@ -0,0 +1,616 @@ +@charset "UTF-8"; +.fancybox-enabled { + overflow: hidden; } + +.fancybox-enabled body { + overflow: visible; + height: 100%; } + +.fancybox-container { + position: fixed; + top: 0; + left: 0; + width: 100%; + height: 100%; + z-index: 99993; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; } + +/* Make sure that the first one is on the top */ +.fancybox-container ~ .fancybox-container { + z-index: 99992; } + +.fancybox-bg { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + background: #0f0f11; + opacity: 0; + transition-timing-function: cubic-bezier(0.55, 0.06, 0.68, 0.19); + -webkit-backface-visibility: hidden; + backface-visibility: hidden; } + +.fancybox-container--ready .fancybox-bg { + opacity: 0.87; + transition-timing-function: cubic-bezier(0.22, 0.61, 0.36, 1); } + +.fancybox-controls { + position: absolute; + top: 0; + left: 0; + right: 0; + text-align: center; + opacity: 0; + z-index: 99994; + transition: opacity .2s; + pointer-events: none; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + direction: ltr; } + +.fancybox-show-controls .fancybox-controls { + opacity: 1; } + +.fancybox-infobar { + display: none; } + +.fancybox-show-infobar .fancybox-infobar { + display: inline-block; + pointer-events: all; } + +.fancybox-infobar__body { + display: inline-block; + width: 70px; + line-height: 44px; + font-size: 13px; + font-family: "Helvetica Neue",Helvetica,Arial,sans-serif; + text-align: center; + color: #ddd; + background-color: rgba(30, 30, 30, 0.7); + pointer-events: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + -webkit-touch-callout: none; + -webkit-tap-highlight-color: transparent; + -webkit-font-smoothing: subpixel-antialiased; } + +.fancybox-buttons { + position: absolute; + top: 0; + right: 0; + display: none; + pointer-events: all; } + +.fancybox-show-buttons .fancybox-buttons { + display: block; } + +.fancybox-slider-wrap { + overflow: hidden; + direction: ltr; } + +.fancybox-slider-wrap, +.fancybox-slider { + position: absolute; + top: 0; + left: 0; + bottom: 0; + right: 0; + padding: 0; + margin: 0; + z-index: 99993; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + -webkit-tap-highlight-color: transparent; } + +.fancybox-slide { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 100%; + margin: 0; + padding: 0; + overflow: auto; + outline: none; + white-space: normal; + box-sizing: border-box; + text-align: center; + z-index: 99994; + -webkit-overflow-scrolling: touch; } + +.fancybox-slide::before { + content: ''; + display: inline-block; + vertical-align: middle; + height: 100%; + width: 0; } + +.fancybox-slide > * { + display: inline-block; + position: relative; + padding: 24px; + margin: 44px 0 44px; + border-width: 0; + vertical-align: middle; + text-align: left; + background-color: #fff; + overflow: auto; + box-sizing: border-box; } + +.fancybox-slide--image { + overflow: hidden; } + +.fancybox-slide--image::before { + display: none; } + +.fancybox-content { + display: inline-block; + position: relative; + margin: 44px auto; + padding: 0; + border: 0; + width: 80%; + height: calc(100% - 88px); + vertical-align: middle; + line-height: normal; + text-align: left; + white-space: normal; + outline: none; + font-size: 16px; + font-family: Arial, sans-serif; + box-sizing: border-box; + -webkit-tap-highlight-color: transparent; + -webkit-overflow-scrolling: touch; } + +.fancybox-iframe { + display: block; + margin: 0; + padding: 0; + border: 0; + width: 100%; + height: 100%; + background: #fff; } + +.fancybox-slide--video .fancybox-content, +.fancybox-slide--video .fancybox-iframe { + background: transparent; } + +.fancybox-placeholder { + position: absolute; + top: 0; + left: 0; + margin: 0; + padding: 0; + border: 0; + z-index: 99995; + background: transparent; + cursor: default; + overflow: visible; + -webkit-transform-origin: top left; + -ms-transform-origin: top left; + transform-origin: top left; + background-size: 100% 100%; + background-repeat: no-repeat; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; } + +.fancybox-image, +.fancybox-spaceball { + position: absolute; + top: 0; + left: 0; + width: 100%; + height: 100%; + margin: 0; + padding: 0; + border: 0; + max-width: none; + max-height: none; + background: transparent; + background-size: 100% 100%; } + +.fancybox-controls--canzoomOut .fancybox-placeholder { + cursor: -webkit-zoom-out; + cursor: zoom-out; } + +.fancybox-controls--canzoomIn .fancybox-placeholder { + cursor: -webkit-zoom-in; + cursor: zoom-in; } + +.fancybox-controls--canGrab .fancybox-placeholder { + cursor: -webkit-grab; + cursor: grab; } + +.fancybox-controls--isGrabbing .fancybox-placeholder { + cursor: -webkit-grabbing; + cursor: grabbing; } + +.fancybox-spaceball { + z-index: 1; } + +.fancybox-tmp { + position: absolute; + top: -9999px; + left: -9999px; + visibility: hidden; } + +.fancybox-error { + position: absolute; + margin: 0; + padding: 40px; + top: 50%; + left: 50%; + width: 380px; + max-width: 100%; + -webkit-transform: translate(-50%, -50%); + -ms-transform: translate(-50%, -50%); + transform: translate(-50%, -50%); + background: #fff; + cursor: default; } + +.fancybox-error p { + margin: 0; + padding: 0; + color: #444; + font: 16px/20px "Helvetica Neue",Helvetica,Arial,sans-serif; } + +.fancybox-close-small { + position: absolute; + top: 0; + right: 0; + width: 44px; + height: 44px; + padding: 0; + margin: 0; + border: 0; + border-radius: 0; + outline: none; + background: transparent; + z-index: 10; + cursor: pointer; } + +.fancybox-close-small:after { + content: '×'; + position: absolute; + top: 5px; + right: 5px; + width: 30px; + height: 30px; + font: 20px/30px Arial,"Helvetica Neue",Helvetica,sans-serif; + color: #888; + font-weight: 300; + text-align: center; + border-radius: 50%; + border-width: 0; + background: #fff; + transition: background .2s; + box-sizing: border-box; + z-index: 2; } + +.fancybox-close-small:focus:after { + outline: 1px dotted #888; } + +.fancybox-slide--video .fancybox-close-small { + top: -36px; + right: -36px; + background: transparent; } + +.fancybox-close-small:hover:after { + color: #555; + background: #eee; } + +/* Caption */ +.fancybox-caption-wrap { + position: absolute; + bottom: 0; + left: 0; + right: 0; + padding: 60px 30px 0 30px; + z-index: 99998; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + box-sizing: border-box; + background: linear-gradient(to bottom, transparent 0%, rgba(0, 0, 0, 0.1) 20%, rgba(0, 0, 0, 0.2) 40%, rgba(0, 0, 0, 0.6) 80%, rgba(0, 0, 0, 0.8) 100%); + opacity: 0; + transition: opacity .2s; + pointer-events: none; } + +.fancybox-show-caption .fancybox-caption-wrap { + opacity: 1; } + +.fancybox-caption { + padding: 30px 0; + border-top: 1px solid rgba(255, 255, 255, 0.4); + font-size: 14px; + font-family: "Helvetica Neue",Helvetica,Arial,sans-serif; + color: #fff; + line-height: 20px; + -webkit-text-size-adjust: none; } + +.fancybox-caption a, +.fancybox-caption button { + pointer-events: all; } + +.fancybox-caption a { + color: #fff; + text-decoration: underline; } + +/* Buttons */ +.fancybox-button { + display: inline-block; + position: relative; + width: 44px; + height: 44px; + line-height: 44px; + margin: 0; + padding: 0; + border: 0; + border-radius: 0; + cursor: pointer; + background: transparent; + color: #fff; + box-sizing: border-box; + vertical-align: top; + outline: none; } + +.fancybox-button--disabled { + cursor: default; + pointer-events: none; } + +.fancybox-infobar__body, .fancybox-button { + background: rgba(30, 30, 30, 0.6); } + +.fancybox-button:hover { + background: rgba(0, 0, 0, 0.8); } + +.fancybox-button::before, +.fancybox-button::after { + content: ''; + pointer-events: none; + position: absolute; + border-color: #fff; + background-color: currentColor; + color: currentColor; + opacity: 0.9; + box-sizing: border-box; + display: inline-block; } + +.fancybox-button--disabled::before, +.fancybox-button--disabled::after { + opacity: 0.5; } + +.fancybox-button--left::after { + left: 20px; + top: 18px; + width: 6px; + height: 6px; + background: transparent; + border-top: solid 2px currentColor; + border-right: solid 2px currentColor; + -webkit-transform: rotate(-135deg); + -ms-transform: rotate(-135deg); + transform: rotate(-135deg); } + +.fancybox-button--right::after { + right: 20px; + top: 18px; + width: 6px; + height: 6px; + background: transparent; + border-top: solid 2px currentColor; + border-right: solid 2px currentColor; + -webkit-transform: rotate(45deg); + -ms-transform: rotate(45deg); + transform: rotate(45deg); } + +.fancybox-button--left { + border-bottom-left-radius: 5px; } + +.fancybox-button--right { + border-bottom-right-radius: 5px; } + +.fancybox-button--close { + float: right; } + +.fancybox-button--close::before, .fancybox-button--close::after { + content: ''; + display: inline-block; + position: absolute; + height: 2px; + width: 16px; + top: calc(50% - 1px); + left: calc(50% - 8px); } + +.fancybox-button--close::before { + -webkit-transform: rotate(45deg); + -ms-transform: rotate(45deg); + transform: rotate(45deg); } + +.fancybox-button--close::after { + -webkit-transform: rotate(-45deg); + -ms-transform: rotate(-45deg); + transform: rotate(-45deg); } + +/* Loading spinner */ +.fancybox-loading { + border: 6px solid rgba(100, 100, 100, 0.4); + border-top: 6px solid rgba(255, 255, 255, 0.6); + border-radius: 100%; + height: 50px; + width: 50px; + -webkit-animation: fancybox-rotate .8s infinite linear; + animation: fancybox-rotate .8s infinite linear; + background: transparent; + position: absolute; + top: 50%; + left: 50%; + margin-top: -25px; + margin-left: -25px; + z-index: 99999; } + +@-webkit-keyframes fancybox-rotate { + from { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); } + to { + -webkit-transform: rotate(359deg); + transform: rotate(359deg); } } + +@keyframes fancybox-rotate { + from { + -webkit-transform: rotate(0deg); + transform: rotate(0deg); } + to { + -webkit-transform: rotate(359deg); + transform: rotate(359deg); } } + +/* Styling for Small-Screen Devices */ +@media all and (max-width: 800px) { + .fancybox-controls { + text-align: left; } + .fancybox-button--left, + .fancybox-button--right, + .fancybox-buttons button:not(.fancybox-button--close) { + display: none !important; } + .fancybox-caption { + padding: 20px 0; + margin: 0; } } + +/* Fullscreen */ +.fancybox-button--fullscreen::before { + width: 15px; + height: 11px; + left: 15px; + top: 16px; + border: 2px solid; + background: none; } + +/* Slideshow button */ +.fancybox-button--play::before { + top: 16px; + left: 18px; + width: 0; + height: 0; + border-top: 6px inset transparent; + border-bottom: 6px inset transparent; + border-left: 10px solid; + border-radius: 1px; + background: transparent; } + +.fancybox-button--pause::before { + top: 16px; + left: 18px; + width: 7px; + height: 11px; + border-style: solid; + border-width: 0 2px 0 2px; + background: transparent; } + +/* Thumbs */ +.fancybox-button--thumbs span { + font-size: 23px; } + +.fancybox-button--thumbs::before { + top: 20px; + left: 21px; + width: 3px; + height: 3px; + box-shadow: 0 -4px 0, -4px -4px 0, 4px -4px 0, 0 0 0 32px inset, -4px 0 0, 4px 0 0, 0 4px 0, -4px 4px 0, 4px 4px 0; } + +.fancybox-container--thumbs .fancybox-controls, +.fancybox-container--thumbs .fancybox-slider-wrap, +.fancybox-container--thumbs .fancybox-caption-wrap { + right: 220px; } + +.fancybox-thumbs { + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: auto; + width: 220px; + margin: 0; + padding: 5px 5px 0 0; + background: #fff; + z-index: 99993; + word-break: normal; + -webkit-overflow-scrolling: touch; + -webkit-tap-highlight-color: transparent; + box-sizing: border-box; } + +.fancybox-thumbs > ul { + list-style: none; + position: absolute; + position: relative; + width: 100%; + height: 100%; + margin: 0; + padding: 0; + overflow-x: hidden; + overflow-y: auto; + font-size: 0; } + +.fancybox-thumbs > ul > li { + float: left; + overflow: hidden; + max-width: 50%; + padding: 0; + margin: 0; + width: 105px; + height: 75px; + position: relative; + cursor: pointer; + outline: none; + border: 5px solid #fff; + border-top-width: 0; + border-right-width: 0; + -webkit-tap-highlight-color: transparent; + -webkit-backface-visibility: hidden; + backface-visibility: hidden; + box-sizing: border-box; } + +li.fancybox-thumbs-loading { + background: rgba(0, 0, 0, 0.1); } + +.fancybox-thumbs > ul > li > img { + position: absolute; + top: 0; + left: 0; + min-width: 100%; + min-height: 100%; + max-width: none; + max-height: none; + -webkit-touch-callout: none; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; } + +.fancybox-thumbs > ul > li:before { + content: ''; + position: absolute; + top: 0; + right: 0; + bottom: 0; + left: 0; + border-radius: 2px; + border: 4px solid #4ea7f9; + z-index: 99991; + opacity: 0; + transition: all 0.2s cubic-bezier(0.25, 0.46, 0.45, 0.94); } + +.fancybox-thumbs > ul > li.fancybox-thumbs-active:before { + opacity: 1; } + +/* Styling for Small-Screen Devices */ +@media all and (max-width: 800px) { + .fancybox-thumbs { + display: none !important; } + .fancybox-container--thumbs .fancybox-controls, + .fancybox-container--thumbs .fancybox-slider-wrap, + .fancybox-container--thumbs .fancybox-caption-wrap { + right: 0; } } diff --git a/css/slick.css b/css/slick.css new file mode 100755 index 0000000..2fb99c2 --- /dev/null +++ b/css/slick.css @@ -0,0 +1,191 @@ +/* Slider */ +.slick-slider { + position: relative; + display: block; + box-sizing: border-box; + -webkit-user-select: none; + -moz-user-select: none; + -ms-user-select: none; + user-select: none; + -webkit-touch-callout: none; + -khtml-user-select: none; + -ms-touch-action: pan-y; + touch-action: pan-y; + -webkit-tap-highlight-color: transparent; +} +.slick-list { position: relative; display: block; overflow: hidden; margin: 0; padding: 0;} +.slick-list:focus{ outline: none;} +.slick-list.dragging{ cursor: pointer; cursor: hand;} +.slick-slider .slick-track, +.slick-slider .slick-list{ + -webkit-transform: translate3d(0, 0, 0); + -moz-transform: translate3d(0, 0, 0); + -ms-transform: translate3d(0, 0, 0); + -o-transform: translate3d(0, 0, 0); + transform: translate3d(0, 0, 0); +} +.slick-track{ position: relative; top: 0; left: 0; display: block;} +.slick-track:before, +.slick-track:after{ display: table; content: '';} +.slick-track:after{ clear: both;} +.slick-loading .slick-track{ visibility: hidden;} +.slick-slide{ display: none; float: left; height: 100%; min-height: 1px;} +[dir='rtl'] .slick-slide{ float: right;} +.slick-slide img{ display: block; width:100%; } +.slick-slide.slick-loading img{ display: none;} +.slick-slide.dragging img{ pointer-events: none;} +.slick-initialized .slick-slide{ display: block;} +.slick-loading .slick-slide{ visibility: hidden;} +.slick-vertical .slick-slide{ display: block; height: auto; border: 1px solid transparent;} +.slick-arrow.slick-hidden { display: none;} + + +@font-face { + font-family: 'slick'; + src: url('../fonts/slick.eot'); + src: url('../fonts/slick.eot?#iefix') format('embedded-opentype'), + url('../fonts/slick.woff') format('woff'), + url('../fonts/slick.ttf') format('truetype'), + url('../fonts/slick.svg#slick') format('svg'); + font-weight: normal; + font-style: normal; +} +/* Arrows */ +.slick-prev, +.slick-next { + font-size: 0; + line-height: 0; + position: absolute; + top: 50%; + display: block; + width: 35px; + height: 60px; + padding: 0; + -webkit-transform: translate(0, -50%); + -ms-transform: translate(0, -50%); + transform: translate(0, -50%); + cursor: pointer; + color: transparent; + border: none; + outline: none; + background: transparent; +} +.slick-prev:hover, +.slick-prev:focus, +.slick-next:hover, +.slick-next:focus +{ + color: #fff; + outline: none; + background-color:rgba(0,70,127,0.8); +} +.slick-prev:hover:before, +.slick-prev:focus:before, +.slick-next:hover:before, +.slick-next:focus:before +{ + opacity: 1; +} +.slick-prev.slick-disabled:before, +.slick-next.slick-disabled:before +{ + opacity: .25; +} +.slick-prev:before, +.slick-next:before { + font-family: 'slick'; + font-size: 20px; + line-height: 1; + opacity: 1; + color: white; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} +.slick-prev:before, +.slick-next:before { } +.single-item .slick-prev { left: 10px; +background-image:url(../images/prev-arrow.png); +background-position:left top; +background-repeat:no-repeat; +background-color:rgba(0,0,0,0.6); } +.single-item .slick-prev:hover { background-position:left bottom; } +.single-item .slick-next { right: 10px; +background-image:url(../images/next-arrow.png); +background-position:right top; +background-repeat:no-repeat; +background-color:rgba(0,0,0,0.6); } +.single-item .slick-next:hover { background-position:right bottom; } +.slick-prev, +.slick-next { z-index:1; width:40px; height:80px; +transition:all 0.5s ease; -moz-transition:all 0.5s ease; -webkit-transition:all 0.5s ease; -ms-transition:all 0.5s ease; -o-transition:all 0.5s ease; +border-radius:5px; -moz-border-radius:5px; -webkit-border-radius:5px; -ms-border-radius:5px; -o-border-radius:5px; } +/* Dots */ +.slick-dotted.slick-slider { margin-bottom:0; } +.slick-dots { position: absolute; bottom:10px; + display: block; + width: 100%; + padding: 0; + margin: 0; + list-style: none; + text-align: center; } +.slick-dots li { + position: relative; vertical-align:top; + display: inline-block; + width: 20px; + height: 7px; + margin: 0 4px; + padding: 0; + cursor: pointer; +} +.slick-dots li button { + font-size: 0; + line-height: 0; + display: block; + width: 20px; + height: 7px; + padding: 0px; + cursor: pointer; + border: 0; + outline: none; + background: #fff; + border:none; +} +.slick-dots li button:hover, +.slick-dots li button:focus { outline: none;background:#ed1c24; } +.slick-dots li button:hover:before, +.slick-dots li button:focus:before { opacity: 1; } +.slick-dots li.slick-active button { background:#ed1c24; border-color:#ed1c24; } +/*.slick-dots li button:before { + font-family: 'slick'; + font-size: 6px; + line-height: 20px; + position: absolute; + top: 0; + left: 0; + width: 20px; + height: 20px; + content: '•'; + text-align: center; + opacity: .25; + color: black; + -webkit-font-smoothing: antialiased; + -moz-osx-font-smoothing: grayscale; +} +.slick-dots li.slick-active button:before { opacity: .75; color: black; }*/ + + +@media (max-width: 991px) { +.slick-dots { bottom:0; } +} +@media (max-width: 767px) { +.slick-prev, .slick-next { width:30px; height:60px;} +.single-item .slick-prev { background-size:30px;} +.single-item .slick-next { background-size:30px;} +} +@media (max-width: 479px) { +.slick-slide img { min-height:150px; } +.slick-prev, .slick-next { width:20px; height:40px;} +.single-item .slick-prev { background-size:20px;} +.single-item .slick-next { background-size:20px;} +} + diff --git a/field-services.html b/field-services.html new file mode 100755 index 0000000..76ea559 --- /dev/null +++ b/field-services.html @@ -0,0 +1,287 @@ + + + + + + + + + + + Astute Engineering - Field Services + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ + +
+ + +
+
+
+
+
    +
  1. Home
    2. +
  2. Services
    3. +
  3. Field Services
    4. +
+
+
+

Field Services

+
+ +
+
+

Astute offers a comprehensive portfolio of field services tailored for every segment of a power system. Our services integrate and optimize the elements of a power system to make sure it is aligned with design criteria and your business goals. Our strong team of power system experts help make your power system safe, efficient, reliable, and up-to-date. We help our clients diagnose problems, identify ways to improve performance, or transform concepts into flexible, practical solutions that can lead to better efficiencies and capital utilization.

+

Our power system assessment services are aimed at reducing your facility's risk from Reliability issues, Process disruptions, Code violations, Outdated equipment, and enhance workplace safety.

+ +
+
+
+
+ +
+
+
+
+
+
+
Power Quality Analysis
+

We perform power monitoring and measurements to detect symptoms of problems and deficiencies, analyze data and provide recommendations to improve power quality & system performance.

+
+
+
+
+ + + + +
+
+
+
+
+
+
+
+
Power System Grounding Evaluation
+

Lack of proper grounding often results in failures or accidents, data & equipment losses, process anomalies, plant shutdowns, and workplace safety hazards. We perform studies and recommend mitigating measures to improve grounding efficiency, effectiveness and overall system safety & reliability.

+
+
+
+
+ + + + +
+
+
+
+
+
+
+
+
Equipment Condition Evaluation, Risk Assessment and Contingency Planning
+

Electrical distribution equipment is subject to degradation due to age, environmental stresses, and wear & tear. We perform a thorough equipment condition evaluation by visual inspections & testing and provide recommendations for refurbishment, repair, retrofitting or replacement, as appropriate for your business.

+
+
+
+
+ + + + +
+
+
+
+
+
+
+
+
Inspections
+

We perform equipment and system inspections to verify/confirm congruence with design documents and compliance with codes, standards and document & report discrepancies/deficiencies noticed.

+
+
+
+
+ + + + +
+
+
+
+
+
+
+
+
Field Testing Oversight
+

We have discovered several issues during field testing oversight, which significantly benefited owners and contractors. We develop testing plans, assist testing company during complex testing and analyze test results. Our hands-on equipment handling experience puts us heads & shoulders above our competition. We witness factory and field testing of equipment to ensure your precious assets are thoroughly tested and examined at all stages. Our diligent inspection has prevented major setbacks & problems for our clients.

+
+
+
+
+ + + + +
+
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + diff --git a/fonts/FontAwesome.otf b/fonts/FontAwesome.otf new file mode 100755 index 0000000..401ec0f Binary files /dev/null and b/fonts/FontAwesome.otf differ diff --git a/fonts/ParisNormal.eot b/fonts/ParisNormal.eot new file mode 100755 index 0000000..ee1fa81 Binary files /dev/null and b/fonts/ParisNormal.eot differ diff --git a/fonts/ParisNormal.svg b/fonts/ParisNormal.svg new file mode 100755 index 0000000..32ee20b --- /dev/null +++ b/fonts/ParisNormal.svg @@ -0,0 +1,680 @@ + + + + +Created by FontForge 20090622 at Sat Aug 19 05:35:51 2017 + By deploy user +Copyright 1994 Bay Animation Inc. All Rights Reserved. + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/fonts/ParisNormal.ttf b/fonts/ParisNormal.ttf new file mode 100755 index 0000000..52b953e Binary files /dev/null and b/fonts/ParisNormal.ttf differ diff --git a/fonts/ParisNormal.woff b/fonts/ParisNormal.woff new file mode 100755 index 0000000..e0b0fa8 Binary files /dev/null and b/fonts/ParisNormal.woff differ diff --git a/fonts/Roboto-Light.eot b/fonts/Roboto-Light.eot new file mode 100755 index 0000000..ad9bfd6 Binary files /dev/null and b/fonts/Roboto-Light.eot differ diff --git a/fonts/Roboto-Light.svg b/fonts/Roboto-Light.svg new file mode 100755 index 0000000..3e0d3e9 --- /dev/null +++ b/fonts/Roboto-Light.svg @@ -0,0 +1,1330 @@ + + + + +Created by FontForge 20090622 at Mon Feb 27 15:35:58 2017 + By deploy user +Font data copyright Google 2012 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/fonts/Roboto-Light.ttf b/fonts/Roboto-Light.ttf new file mode 100755 index 0000000..d5c666d Binary files /dev/null and b/fonts/Roboto-Light.ttf differ diff --git a/fonts/Roboto-Light.woff b/fonts/Roboto-Light.woff new file mode 100755 index 0000000..f5eaa50 Binary files /dev/null and b/fonts/Roboto-Light.woff differ diff --git a/fonts/Roboto-Medium.eot b/fonts/Roboto-Medium.eot new file mode 100755 index 0000000..1b2e003 Binary files /dev/null and b/fonts/Roboto-Medium.eot differ diff --git a/fonts/Roboto-Medium.svg b/fonts/Roboto-Medium.svg new file mode 100755 index 0000000..7c02043 --- /dev/null +++ b/fonts/Roboto-Medium.svg @@ -0,0 +1,1181 @@ + + + + +Created by FontForge 20090622 at Sat May 27 04:58:12 2017 + By deploy user +Font data copyright Google 2012 + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/fonts/Roboto-Medium.ttf b/fonts/Roboto-Medium.ttf new file mode 100755 index 0000000..9555934 Binary files /dev/null and b/fonts/Roboto-Medium.ttf differ diff --git a/fonts/Roboto-Medium.woff b/fonts/Roboto-Medium.woff new file mode 100755 index 0000000..d2052b4 Binary files /dev/null and b/fonts/Roboto-Medium.woff differ diff --git a/fonts/fontawesome-webfont.eot b/fonts/fontawesome-webfont.eot new file mode 100755 index 0000000..e9f60ca Binary files /dev/null and b/fonts/fontawesome-webfont.eot differ diff --git a/fonts/fontawesome-webfont.svg b/fonts/fontawesome-webfont.svg new file mode 100755 index 0000000..d7534c9 --- /dev/null +++ b/fonts/fontawesome-webfont.svg @@ -0,0 +1,2671 @@ + + + + +Created by FontForge 20120731 at Mon Oct 24 17:37:40 2016 + By ,,, +Copyright Dave Gandy 2016. All rights reserved. + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/fonts/fontawesome-webfont.ttf b/fonts/fontawesome-webfont.ttf new file mode 100755 index 0000000..35acda2 Binary files /dev/null and b/fonts/fontawesome-webfont.ttf differ diff --git a/fonts/fontawesome-webfont.woff b/fonts/fontawesome-webfont.woff new file mode 100755 index 0000000..400014a Binary files /dev/null and b/fonts/fontawesome-webfont.woff differ diff --git a/fonts/fontawesome-webfont.woff2 b/fonts/fontawesome-webfont.woff2 new file mode 100755 index 0000000..4d13fc6 Binary files /dev/null and b/fonts/fontawesome-webfont.woff2 differ diff --git a/fonts/glyphicons-halflings-regular.eot b/fonts/glyphicons-halflings-regular.eot new file mode 100755 index 0000000..b93a495 Binary files /dev/null and b/fonts/glyphicons-halflings-regular.eot differ diff --git a/fonts/glyphicons-halflings-regular.svg b/fonts/glyphicons-halflings-regular.svg new file mode 100755 index 0000000..8376c0f --- /dev/null +++ b/fonts/glyphicons-halflings-regular.svg @@ -0,0 +1,288 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/fonts/glyphicons-halflings-regular.ttf b/fonts/glyphicons-halflings-regular.ttf new file mode 100755 index 0000000..1413fc6 Binary files /dev/null and b/fonts/glyphicons-halflings-regular.ttf differ diff --git a/fonts/glyphicons-halflings-regular.woff b/fonts/glyphicons-halflings-regular.woff new file mode 100755 index 0000000..9e61285 Binary files /dev/null and b/fonts/glyphicons-halflings-regular.woff differ diff --git a/fonts/glyphicons-halflings-regular.woff2 b/fonts/glyphicons-halflings-regular.woff2 new file mode 100755 index 0000000..64539b5 Binary files /dev/null and b/fonts/glyphicons-halflings-regular.woff2 differ diff --git a/fonts/roboto-regular-webfont-webfont.eot b/fonts/roboto-regular-webfont-webfont.eot new file mode 100755 index 0000000..10d9e83 Binary files /dev/null and b/fonts/roboto-regular-webfont-webfont.eot differ diff --git a/fonts/roboto-regular-webfont-webfont.svg b/fonts/roboto-regular-webfont-webfont.svg new file mode 100755 index 0000000..5ee05ff --- /dev/null +++ b/fonts/roboto-regular-webfont-webfont.svg @@ -0,0 +1,627 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + \ No newline at end of file diff --git a/fonts/roboto-regular-webfont-webfont.ttf b/fonts/roboto-regular-webfont-webfont.ttf new file mode 100755 index 0000000..81e530e Binary files /dev/null and b/fonts/roboto-regular-webfont-webfont.ttf differ diff --git a/fonts/roboto-regular-webfont-webfont.woff b/fonts/roboto-regular-webfont-webfont.woff new file mode 100755 index 0000000..97fd586 Binary files /dev/null and b/fonts/roboto-regular-webfont-webfont.woff differ diff --git a/fonts/roboto-regular-webfont-webfont.woff2 b/fonts/roboto-regular-webfont-webfont.woff2 new file mode 100755 index 0000000..4e69e12 Binary files /dev/null and b/fonts/roboto-regular-webfont-webfont.woff2 differ diff --git a/government.html b/government.html new file mode 100755 index 0000000..1bacd3d --- /dev/null +++ b/government.html @@ -0,0 +1,268 @@ + + + + + + + + + + + Astute Engineering - Government + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ + +
+ + +
+
+
+
+
    +
  1. Home
    2. +
  2. Markets
    3. +
  3. Government
    4. +
+
+
+

Government

+
+
+
+

Astute provides engineering services for various initiatives and projects undertaken by federal government agencies such as the General Services Agency (GSA), courts and Judiciary Service buildings, government office buildings, central power plants housing steam & chilled water systems, Army, Air Force & Naval establishments, etc. We work with state agencies like the Department of General Services, city & county government offices, and safety & support services like Police Stations, Fire Stations, and other administrative offices.

+

Our broad range of services include system studies, condition assessment, design of upgrades, modifications & new projects and oversight of installations, inspections and testing & commissioning. We provide robust systems ensuring availability of reliable power to the facilities.

+
+
+
+
+
+
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + diff --git a/images/Astute-Engineering-Leaflet.pdf b/images/Astute-Engineering-Leaflet.pdf new file mode 100755 index 0000000..463d6bd Binary files /dev/null and b/images/Astute-Engineering-Leaflet.pdf differ diff --git a/images/Ser_Studies_Analysis.jpg b/images/Ser_Studies_Analysis.jpg new file mode 100755 index 0000000..89addba Binary files /dev/null and b/images/Ser_Studies_Analysis.jpg differ diff --git a/images/about-banner.jpg b/images/about-banner.jpg new file mode 100755 index 0000000..5efb625 Binary files /dev/null and b/images/about-banner.jpg differ diff --git a/images/about-image1.jpg b/images/about-image1.jpg new file mode 100755 index 0000000..7c8f3ae Binary files /dev/null and b/images/about-image1.jpg differ diff --git a/images/banner-1.jpg b/images/banner-1.jpg new file mode 100755 index 0000000..df10b39 Binary files /dev/null and b/images/banner-1.jpg differ diff --git a/images/banner-2.jpg b/images/banner-2.jpg new file mode 100755 index 0000000..609e159 Binary files /dev/null and b/images/banner-2.jpg differ diff --git a/images/banner-3.jpg b/images/banner-3.jpg new file mode 100755 index 0000000..8a6edf3 Binary files /dev/null and b/images/banner-3.jpg differ diff --git a/images/banner-4.jpg b/images/banner-4.jpg new file mode 100755 index 0000000..c0814c1 Binary files /dev/null and b/images/banner-4.jpg differ diff --git a/images/banner-shadow.png b/images/banner-shadow.png new file mode 100755 index 0000000..cb29430 Binary files /dev/null and b/images/banner-shadow.png differ diff --git a/images/bio-photo-1.jpg b/images/bio-photo-1.jpg new file mode 100755 index 0000000..7927c57 Binary files /dev/null and b/images/bio-photo-1.jpg differ diff --git a/images/bio-photo-2.jpg b/images/bio-photo-2.jpg new file mode 100755 index 0000000..1be3ad4 Binary files /dev/null and b/images/bio-photo-2.jpg differ diff --git a/images/breadcrumb-left-shadow.png b/images/breadcrumb-left-shadow.png new file mode 100755 index 0000000..139dd24 Binary files /dev/null and b/images/breadcrumb-left-shadow.png differ diff --git a/images/breadcrumb-right-shadow.png b/images/breadcrumb-right-shadow.png new file mode 100755 index 0000000..8fc5bf8 Binary files /dev/null and b/images/breadcrumb-right-shadow.png differ diff --git a/images/brochure-image.png b/images/brochure-image.png new file mode 100755 index 0000000..14dc497 Binary files /dev/null and b/images/brochure-image.png differ diff --git a/images/careers-banner.jpg b/images/careers-banner.jpg new file mode 100755 index 0000000..6e13498 Binary files /dev/null and b/images/careers-banner.jpg differ diff --git a/images/certificate-logo-1.jpg b/images/certificate-logo-1.jpg new file mode 100755 index 0000000..13cebe9 Binary files /dev/null and b/images/certificate-logo-1.jpg differ diff --git a/images/certificate-logo-2.jpg b/images/certificate-logo-2.jpg new file mode 100755 index 0000000..85a2c2c Binary files /dev/null and b/images/certificate-logo-2.jpg differ diff --git a/images/certificate-logo-3.jpg b/images/certificate-logo-3.jpg new file mode 100755 index 0000000..7e0fd50 Binary files /dev/null and b/images/certificate-logo-3.jpg differ diff --git a/images/certificate-logo-4.jpg b/images/certificate-logo-4.jpg new file mode 100755 index 0000000..560fae7 Binary files /dev/null and b/images/certificate-logo-4.jpg differ diff --git a/images/certificate-logo-5.jpg b/images/certificate-logo-5.jpg new file mode 100755 index 0000000..8ee1a5c Binary files /dev/null and b/images/certificate-logo-5.jpg differ diff --git a/images/certificate-logo-6.jpg b/images/certificate-logo-6.jpg new file mode 100755 index 0000000..b7b513f Binary files /dev/null and b/images/certificate-logo-6.jpg differ diff --git a/images/commercial-banner.jpg b/images/commercial-banner.jpg new file mode 100755 index 0000000..a6fc43d Binary files /dev/null and b/images/commercial-banner.jpg differ diff --git a/images/commercial-large-1.jpg b/images/commercial-large-1.jpg new file mode 100755 index 0000000..57408f6 Binary files /dev/null and b/images/commercial-large-1.jpg differ diff --git a/images/commercial-large-2.jpg b/images/commercial-large-2.jpg new file mode 100755 index 0000000..372354f Binary files /dev/null and b/images/commercial-large-2.jpg differ diff --git a/images/commercial-large-3.jpg b/images/commercial-large-3.jpg new file mode 100755 index 0000000..0ee63dd Binary files /dev/null and b/images/commercial-large-3.jpg differ diff --git a/images/commercial-large-4.jpg b/images/commercial-large-4.jpg new file mode 100755 index 0000000..dce0bd8 Binary files /dev/null and b/images/commercial-large-4.jpg differ diff --git a/images/commercial-large-5.jpg b/images/commercial-large-5.jpg new file mode 100755 index 0000000..13c1d2a Binary files /dev/null and b/images/commercial-large-5.jpg differ diff --git a/images/commercial-large-6.jpg b/images/commercial-large-6.jpg new file mode 100755 index 0000000..ae28429 Binary files /dev/null and b/images/commercial-large-6.jpg differ diff --git a/images/commercial-thumb-1.jpg b/images/commercial-thumb-1.jpg new file mode 100755 index 0000000..10372c4 Binary files /dev/null and b/images/commercial-thumb-1.jpg differ diff --git a/images/commercial-thumb-2.jpg b/images/commercial-thumb-2.jpg new file mode 100755 index 0000000..03eead8 Binary files /dev/null and b/images/commercial-thumb-2.jpg differ diff --git a/images/commercial-thumb-3.jpg b/images/commercial-thumb-3.jpg new file mode 100755 index 0000000..50beca3 Binary files /dev/null and b/images/commercial-thumb-3.jpg differ diff --git a/images/commercial-thumb-4.jpg b/images/commercial-thumb-4.jpg new file mode 100755 index 0000000..18b49ec Binary files /dev/null and b/images/commercial-thumb-4.jpg differ diff --git a/images/commercial-thumb-5.jpg b/images/commercial-thumb-5.jpg new file mode 100755 index 0000000..029b415 Binary files /dev/null and b/images/commercial-thumb-5.jpg differ diff --git a/images/commercial-thumb-6.jpg b/images/commercial-thumb-6.jpg new file mode 100755 index 0000000..4bbb644 Binary files /dev/null and b/images/commercial-thumb-6.jpg differ diff --git a/images/commercial.svg b/images/commercial.svg new file mode 100755 index 0000000..cdbd0ef --- /dev/null +++ b/images/commercial.svg @@ -0,0 +1,24050 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/images/contact-banner.jpg b/images/contact-banner.jpg new file mode 100755 index 0000000..bb8ca13 Binary files /dev/null and b/images/contact-banner.jpg differ diff --git a/images/energy-and-utilities-banner.jpg b/images/energy-and-utilities-banner.jpg new file mode 100755 index 0000000..0f3ee1b Binary files /dev/null and b/images/energy-and-utilities-banner.jpg differ diff --git a/images/energy-and-utilities-large-1.jpg b/images/energy-and-utilities-large-1.jpg new file mode 100755 index 0000000..2737fca Binary files /dev/null and b/images/energy-and-utilities-large-1.jpg differ diff --git a/images/energy-and-utilities-large-2.jpg b/images/energy-and-utilities-large-2.jpg new file mode 100755 index 0000000..24bbe26 Binary files /dev/null and b/images/energy-and-utilities-large-2.jpg differ diff --git a/images/energy-and-utilities-large-3.jpg b/images/energy-and-utilities-large-3.jpg new file mode 100755 index 0000000..d4b205e Binary files /dev/null and b/images/energy-and-utilities-large-3.jpg differ diff --git a/images/energy-and-utilities-large-4.jpg b/images/energy-and-utilities-large-4.jpg new file mode 100755 index 0000000..637002b Binary files /dev/null and b/images/energy-and-utilities-large-4.jpg differ diff --git a/images/energy-and-utilities-thumb-1.jpg b/images/energy-and-utilities-thumb-1.jpg new file mode 100755 index 0000000..504c76c Binary files /dev/null and b/images/energy-and-utilities-thumb-1.jpg differ diff --git a/images/energy-and-utilities-thumb-2.jpg b/images/energy-and-utilities-thumb-2.jpg new file mode 100755 index 0000000..1a5e786 Binary files /dev/null and b/images/energy-and-utilities-thumb-2.jpg differ diff --git a/images/energy-and-utilities-thumb-3.jpg b/images/energy-and-utilities-thumb-3.jpg new file mode 100755 index 0000000..ab85c91 Binary files /dev/null and b/images/energy-and-utilities-thumb-3.jpg differ diff --git a/images/energy-and-utilities-thumb-4.jpg b/images/energy-and-utilities-thumb-4.jpg new file mode 100755 index 0000000..27aa297 Binary files /dev/null and b/images/energy-and-utilities-thumb-4.jpg differ diff --git a/images/energy-utilities.svg b/images/energy-utilities.svg new file mode 100755 index 0000000..7b992ba --- /dev/null +++ b/images/energy-utilities.svg @@ -0,0 +1,8117 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/images/favicon.ico b/images/favicon.ico new file mode 100755 index 0000000..91116fe Binary files /dev/null and b/images/favicon.ico differ diff --git a/images/field-services-banner.jpg b/images/field-services-banner.jpg new file mode 100755 index 0000000..6550ded Binary files /dev/null and b/images/field-services-banner.jpg differ diff --git a/images/field-services-large-1.jpg b/images/field-services-large-1.jpg new file mode 100755 index 0000000..459fc8c Binary files /dev/null and b/images/field-services-large-1.jpg differ diff --git a/images/field-services-large-2.jpg b/images/field-services-large-2.jpg new file mode 100755 index 0000000..344751d Binary files /dev/null and b/images/field-services-large-2.jpg differ diff --git a/images/field-services-large-3.jpg b/images/field-services-large-3.jpg new file mode 100755 index 0000000..ea06b07 Binary files /dev/null and b/images/field-services-large-3.jpg differ diff --git a/images/field-services-large-4.jpg b/images/field-services-large-4.jpg new file mode 100755 index 0000000..7471233 Binary files /dev/null and b/images/field-services-large-4.jpg differ diff --git a/images/field-services-large-5.jpg b/images/field-services-large-5.jpg new file mode 100755 index 0000000..f10f5a9 Binary files /dev/null and b/images/field-services-large-5.jpg differ diff --git a/images/field-services-thumb-1.jpg b/images/field-services-thumb-1.jpg new file mode 100755 index 0000000..66a4eca Binary files /dev/null and b/images/field-services-thumb-1.jpg differ diff --git a/images/field-services-thumb-2.jpg b/images/field-services-thumb-2.jpg new file mode 100755 index 0000000..3e4ee8e Binary files /dev/null and b/images/field-services-thumb-2.jpg differ diff --git a/images/field-services-thumb-3.jpg b/images/field-services-thumb-3.jpg new file mode 100755 index 0000000..b2b3ec5 Binary files /dev/null and b/images/field-services-thumb-3.jpg differ diff --git a/images/field-services-thumb-4.jpg b/images/field-services-thumb-4.jpg new file mode 100755 index 0000000..1465838 Binary files /dev/null and b/images/field-services-thumb-4.jpg differ diff --git a/images/field-services-thumb-5.jpg b/images/field-services-thumb-5.jpg new file mode 100755 index 0000000..1733ca4 Binary files /dev/null and b/images/field-services-thumb-5.jpg differ diff --git a/images/field-services.jpg b/images/field-services.jpg new file mode 100755 index 0000000..04a7179 Binary files /dev/null and b/images/field-services.jpg differ diff --git a/images/footer-nav-dots.png b/images/footer-nav-dots.png new file mode 100755 index 0000000..aa5d3d5 Binary files /dev/null and b/images/footer-nav-dots.png differ diff --git a/images/government-banner.jpg b/images/government-banner.jpg new file mode 100755 index 0000000..fd3c6ce Binary files /dev/null and b/images/government-banner.jpg differ diff --git a/images/government-large-1.jpg b/images/government-large-1.jpg new file mode 100755 index 0000000..a86f125 Binary files /dev/null and b/images/government-large-1.jpg differ diff --git a/images/government-large-2.jpg b/images/government-large-2.jpg new file mode 100755 index 0000000..b30c4a0 Binary files /dev/null and b/images/government-large-2.jpg differ diff --git a/images/government-large-3.jpg b/images/government-large-3.jpg new file mode 100755 index 0000000..6e592c6 Binary files /dev/null and b/images/government-large-3.jpg differ diff --git a/images/government-large-4.jpg b/images/government-large-4.jpg new file mode 100755 index 0000000..869975b Binary files /dev/null and b/images/government-large-4.jpg differ diff --git a/images/government-large-5.jpg b/images/government-large-5.jpg new file mode 100755 index 0000000..fb0a74e Binary files /dev/null and b/images/government-large-5.jpg differ diff --git a/images/government-large-6.jpg b/images/government-large-6.jpg new file mode 100755 index 0000000..bba3b71 Binary files /dev/null and b/images/government-large-6.jpg differ diff --git a/images/government-large-7.jpg b/images/government-large-7.jpg new file mode 100755 index 0000000..6d84959 Binary files /dev/null and b/images/government-large-7.jpg differ diff --git a/images/government-large-8.jpg b/images/government-large-8.jpg new file mode 100755 index 0000000..3b6fbe5 Binary files /dev/null and b/images/government-large-8.jpg differ diff --git a/images/government-large-9.jpg b/images/government-large-9.jpg new file mode 100755 index 0000000..e20ac80 Binary files /dev/null and b/images/government-large-9.jpg differ diff --git a/images/government-thumb-1.jpg b/images/government-thumb-1.jpg new file mode 100755 index 0000000..736a998 Binary files /dev/null and b/images/government-thumb-1.jpg differ diff --git a/images/government-thumb-2.jpg b/images/government-thumb-2.jpg new file mode 100755 index 0000000..9b0f428 Binary files /dev/null and b/images/government-thumb-2.jpg differ diff --git a/images/government-thumb-3.jpg b/images/government-thumb-3.jpg new file mode 100755 index 0000000..3221b97 Binary files /dev/null and b/images/government-thumb-3.jpg differ diff --git a/images/government-thumb-4.jpg b/images/government-thumb-4.jpg new file mode 100755 index 0000000..8d5e708 Binary files /dev/null and b/images/government-thumb-4.jpg differ diff --git a/images/government-thumb-5.jpg b/images/government-thumb-5.jpg new file mode 100755 index 0000000..b4b8967 Binary files /dev/null and b/images/government-thumb-5.jpg differ diff --git a/images/government-thumb-6.jpg b/images/government-thumb-6.jpg new file mode 100755 index 0000000..83deecf Binary files /dev/null and b/images/government-thumb-6.jpg differ diff --git a/images/government-thumb-7.jpg b/images/government-thumb-7.jpg new file mode 100755 index 0000000..237d7b9 Binary files /dev/null and b/images/government-thumb-7.jpg differ diff --git a/images/government-thumb-8.jpg b/images/government-thumb-8.jpg new file mode 100755 index 0000000..baeb891 Binary files /dev/null and b/images/government-thumb-8.jpg differ diff --git a/images/government-thumb-9.jpg b/images/government-thumb-9.jpg new file mode 100755 index 0000000..1634a0e Binary files /dev/null and b/images/government-thumb-9.jpg differ diff --git a/images/government.svg b/images/government.svg new file mode 100755 index 0000000..d1f0625 --- /dev/null +++ b/images/government.svg @@ -0,0 +1,1116 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/images/heading-line.png b/images/heading-line.png new file mode 100755 index 0000000..8f3b3c9 Binary files /dev/null and b/images/heading-line.png differ diff --git a/images/industrial-banner.jpg b/images/industrial-banner.jpg new file mode 100755 index 0000000..35942a4 Binary files /dev/null and b/images/industrial-banner.jpg differ diff --git a/images/industrial-large-1.jpg b/images/industrial-large-1.jpg new file mode 100755 index 0000000..5bfd610 Binary files /dev/null and b/images/industrial-large-1.jpg differ diff --git a/images/industrial-large-2.jpg b/images/industrial-large-2.jpg new file mode 100755 index 0000000..c4dc190 Binary files /dev/null and b/images/industrial-large-2.jpg differ diff --git a/images/industrial-thumb-1.jpg b/images/industrial-thumb-1.jpg new file mode 100755 index 0000000..aa93791 Binary files /dev/null and b/images/industrial-thumb-1.jpg differ diff --git a/images/industrial-thumb-2.jpg b/images/industrial-thumb-2.jpg new file mode 100755 index 0000000..e515c41 Binary files /dev/null and b/images/industrial-thumb-2.jpg differ diff --git a/images/industrial.svg b/images/industrial.svg new file mode 100755 index 0000000..4d5c39a --- /dev/null +++ b/images/industrial.svg @@ -0,0 +1,828 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/images/infographic.svg b/images/infographic.svg new file mode 100755 index 0000000..27311b7 --- /dev/null +++ b/images/infographic.svg @@ -0,0 +1,1125 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/images/institutional-banner.jpg b/images/institutional-banner.jpg new file mode 100755 index 0000000..dfc0df6 Binary files /dev/null and b/images/institutional-banner.jpg differ diff --git a/images/institutional-large-1.jpg b/images/institutional-large-1.jpg new file mode 100755 index 0000000..453c8ed Binary files /dev/null and b/images/institutional-large-1.jpg differ diff --git a/images/institutional-large-2.jpg b/images/institutional-large-2.jpg new file mode 100755 index 0000000..494695b Binary files /dev/null and b/images/institutional-large-2.jpg differ diff --git a/images/institutional-large-3.jpg b/images/institutional-large-3.jpg new file mode 100755 index 0000000..1b27524 Binary files /dev/null and b/images/institutional-large-3.jpg differ diff --git a/images/institutional-large-4.jpg b/images/institutional-large-4.jpg new file mode 100755 index 0000000..b2907c8 Binary files /dev/null and b/images/institutional-large-4.jpg differ diff --git a/images/institutional-large-5.jpg b/images/institutional-large-5.jpg new file mode 100755 index 0000000..01846c7 Binary files /dev/null and b/images/institutional-large-5.jpg differ diff --git a/images/institutional-thumb-1.jpg b/images/institutional-thumb-1.jpg new file mode 100755 index 0000000..b89ac5d Binary files /dev/null and b/images/institutional-thumb-1.jpg differ diff --git a/images/institutional-thumb-2.jpg b/images/institutional-thumb-2.jpg new file mode 100755 index 0000000..92c2cb4 Binary files /dev/null and b/images/institutional-thumb-2.jpg differ diff --git a/images/institutional-thumb-3.jpg b/images/institutional-thumb-3.jpg new file mode 100755 index 0000000..d451b49 Binary files /dev/null and b/images/institutional-thumb-3.jpg differ diff --git a/images/institutional-thumb-4.jpg b/images/institutional-thumb-4.jpg new file mode 100755 index 0000000..e48fb95 Binary files /dev/null and b/images/institutional-thumb-4.jpg differ diff --git a/images/institutional-thumb-5.jpg b/images/institutional-thumb-5.jpg new file mode 100755 index 0000000..8feb27d Binary files /dev/null and b/images/institutional-thumb-5.jpg differ diff --git a/images/institutional.svg b/images/institutional.svg new file mode 100755 index 0000000..0630315 --- /dev/null +++ b/images/institutional.svg @@ -0,0 +1,775 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/images/instrumentation-and-controls-large-1.jpg b/images/instrumentation-and-controls-large-1.jpg new file mode 100755 index 0000000..ee75867 Binary files /dev/null and b/images/instrumentation-and-controls-large-1.jpg differ diff --git a/images/instrumentation-and-controls-large-2.jpg b/images/instrumentation-and-controls-large-2.jpg new file mode 100755 index 0000000..88abce7 Binary files /dev/null and b/images/instrumentation-and-controls-large-2.jpg differ diff --git a/images/instrumentation-and-controls-thumb-1.jpg b/images/instrumentation-and-controls-thumb-1.jpg new file mode 100755 index 0000000..19c61de Binary files /dev/null and b/images/instrumentation-and-controls-thumb-1.jpg differ diff --git a/images/instrumentation-and-controls-thumb-2.jpg b/images/instrumentation-and-controls-thumb-2.jpg new file mode 100755 index 0000000..1e03a2c Binary files /dev/null and b/images/instrumentation-and-controls-thumb-2.jpg differ diff --git a/images/instrumentation-and-controls.jpg b/images/instrumentation-and-controls.jpg new file mode 100755 index 0000000..7f6eb66 Binary files /dev/null and b/images/instrumentation-and-controls.jpg differ diff --git a/images/instrumentation-controls-banner.jpg b/images/instrumentation-controls-banner.jpg new file mode 100755 index 0000000..40fa43d Binary files /dev/null and b/images/instrumentation-controls-banner.jpg differ diff --git a/images/leadership-banner.jpg b/images/leadership-banner.jpg new file mode 100755 index 0000000..c980dc7 Binary files /dev/null and b/images/leadership-banner.jpg differ diff --git a/images/line-left.png b/images/line-left.png new file mode 100755 index 0000000..f6e032c Binary files /dev/null and b/images/line-left.png differ diff --git a/images/line-right.png b/images/line-right.png new file mode 100755 index 0000000..c24c3cf Binary files /dev/null and b/images/line-right.png differ diff --git a/images/logo.svg b/images/logo.svg new file mode 100755 index 0000000..e9f3b09 --- /dev/null +++ b/images/logo.svg @@ -0,0 +1,566 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/images/market-banner1.jpg b/images/market-banner1.jpg new file mode 100755 index 0000000..a7d85bc Binary files /dev/null and b/images/market-banner1.jpg differ diff --git a/images/market-banner2.jpg b/images/market-banner2.jpg new file mode 100755 index 0000000..8a1db77 Binary files /dev/null and b/images/market-banner2.jpg differ diff --git a/images/market-banner3.jpg b/images/market-banner3.jpg new file mode 100755 index 0000000..910e907 Binary files /dev/null and b/images/market-banner3.jpg differ diff --git a/images/next-arrow.png b/images/next-arrow.png new file mode 100755 index 0000000..9a07561 Binary files /dev/null and b/images/next-arrow.png differ diff --git a/images/our-markets-image.jpg b/images/our-markets-image.jpg new file mode 100755 index 0000000..69d9be4 Binary files /dev/null and b/images/our-markets-image.jpg differ diff --git a/images/our-mission.jpg b/images/our-mission.jpg new file mode 100755 index 0000000..9c539e1 Binary files /dev/null and b/images/our-mission.jpg differ diff --git a/images/our-vision.jpg b/images/our-vision.jpg new file mode 100755 index 0000000..500fe4a Binary files /dev/null and b/images/our-vision.jpg differ diff --git a/images/power-distribution-systems-banner.jpg b/images/power-distribution-systems-banner.jpg new file mode 100755 index 0000000..0f3ee1b Binary files /dev/null and b/images/power-distribution-systems-banner.jpg differ diff --git a/images/power-distribution-systems-banner1.jpg b/images/power-distribution-systems-banner1.jpg new file mode 100755 index 0000000..58d1510 Binary files /dev/null and b/images/power-distribution-systems-banner1.jpg differ diff --git a/images/power-distribution-systems-large-1.jpg b/images/power-distribution-systems-large-1.jpg new file mode 100755 index 0000000..548729c Binary files /dev/null and b/images/power-distribution-systems-large-1.jpg differ diff --git a/images/power-distribution-systems-large-2.jpg b/images/power-distribution-systems-large-2.jpg new file mode 100755 index 0000000..4f2267a Binary files /dev/null and b/images/power-distribution-systems-large-2.jpg differ diff --git a/images/power-distribution-systems-large-3.jpg b/images/power-distribution-systems-large-3.jpg new file mode 100755 index 0000000..6a9455c Binary files /dev/null and b/images/power-distribution-systems-large-3.jpg differ diff --git a/images/power-distribution-systems-large-4.jpg b/images/power-distribution-systems-large-4.jpg new file mode 100755 index 0000000..d3059a8 Binary files /dev/null and b/images/power-distribution-systems-large-4.jpg differ diff --git a/images/power-distribution-systems-large-5.jpg b/images/power-distribution-systems-large-5.jpg new file mode 100755 index 0000000..07febe7 Binary files /dev/null and b/images/power-distribution-systems-large-5.jpg differ diff --git a/images/power-distribution-systems-large-6.jpg b/images/power-distribution-systems-large-6.jpg new file mode 100755 index 0000000..b3bc3c5 Binary files /dev/null and b/images/power-distribution-systems-large-6.jpg differ diff --git a/images/power-distribution-systems-large-7.jpg b/images/power-distribution-systems-large-7.jpg new file mode 100755 index 0000000..b9adce9 Binary files /dev/null and b/images/power-distribution-systems-large-7.jpg differ diff --git a/images/power-distribution-systems-large-8.jpg b/images/power-distribution-systems-large-8.jpg new file mode 100755 index 0000000..53f093b Binary files /dev/null and b/images/power-distribution-systems-large-8.jpg differ diff --git a/images/power-distribution-systems-large-9.jpg b/images/power-distribution-systems-large-9.jpg new file mode 100755 index 0000000..a6404f0 Binary files /dev/null and b/images/power-distribution-systems-large-9.jpg differ diff --git a/images/power-distribution-systems-thumb-1.jpg b/images/power-distribution-systems-thumb-1.jpg new file mode 100755 index 0000000..7499250 Binary files /dev/null and b/images/power-distribution-systems-thumb-1.jpg differ diff --git a/images/power-distribution-systems-thumb-2.jpg b/images/power-distribution-systems-thumb-2.jpg new file mode 100755 index 0000000..e2a2042 Binary files /dev/null and b/images/power-distribution-systems-thumb-2.jpg differ diff --git a/images/power-distribution-systems-thumb-3.jpg b/images/power-distribution-systems-thumb-3.jpg new file mode 100755 index 0000000..23c9ff8 Binary files /dev/null and b/images/power-distribution-systems-thumb-3.jpg differ diff --git a/images/power-distribution-systems-thumb-4.jpg b/images/power-distribution-systems-thumb-4.jpg new file mode 100755 index 0000000..e6e0a2f Binary files /dev/null and b/images/power-distribution-systems-thumb-4.jpg differ diff --git a/images/power-distribution-systems-thumb-5.jpg b/images/power-distribution-systems-thumb-5.jpg new file mode 100755 index 0000000..2a68604 Binary files /dev/null and b/images/power-distribution-systems-thumb-5.jpg differ diff --git a/images/power-distribution-systems-thumb-6.jpg b/images/power-distribution-systems-thumb-6.jpg new file mode 100755 index 0000000..351e66c Binary files /dev/null and b/images/power-distribution-systems-thumb-6.jpg differ diff --git a/images/power-distribution-systems-thumb-7.jpg b/images/power-distribution-systems-thumb-7.jpg new file mode 100755 index 0000000..5cd8351 Binary files /dev/null and b/images/power-distribution-systems-thumb-7.jpg differ diff --git a/images/power-distribution-systems-thumb-8.jpg b/images/power-distribution-systems-thumb-8.jpg new file mode 100755 index 0000000..2d3c17a Binary files /dev/null and b/images/power-distribution-systems-thumb-8.jpg differ diff --git a/images/power-distribution-systems-thumb-9.jpg b/images/power-distribution-systems-thumb-9.jpg new file mode 100755 index 0000000..76806d1 Binary files /dev/null and b/images/power-distribution-systems-thumb-9.jpg differ diff --git a/images/power-distribution-systems.jpg b/images/power-distribution-systems.jpg new file mode 100755 index 0000000..4ccee16 Binary files /dev/null and b/images/power-distribution-systems.jpg differ diff --git a/images/preload-circle.png b/images/preload-circle.png new file mode 100755 index 0000000..f106176 Binary files /dev/null and b/images/preload-circle.png differ diff --git a/images/prev-arrow.png b/images/prev-arrow.png new file mode 100755 index 0000000..e8574bb Binary files /dev/null and b/images/prev-arrow.png differ diff --git a/images/security-surveillance-systems-banner.jpg b/images/security-surveillance-systems-banner.jpg new file mode 100755 index 0000000..0f3ee1b Binary files /dev/null and b/images/security-surveillance-systems-banner.jpg differ diff --git a/images/security-surveillance-systems.jpg b/images/security-surveillance-systems.jpg new file mode 100755 index 0000000..d0cf336 Binary files /dev/null and b/images/security-surveillance-systems.jpg differ diff --git a/images/service-banner1.jpg b/images/service-banner1.jpg new file mode 100755 index 0000000..af49041 Binary files /dev/null and b/images/service-banner1.jpg differ diff --git a/images/service-banner2.jpg b/images/service-banner2.jpg new file mode 100755 index 0000000..4a8f749 Binary files /dev/null and b/images/service-banner2.jpg differ diff --git a/images/service-banner3.jpg b/images/service-banner3.jpg new file mode 100755 index 0000000..376f909 Binary files /dev/null and b/images/service-banner3.jpg differ diff --git a/images/service-banner4.jpg b/images/service-banner4.jpg new file mode 100755 index 0000000..b5e2b49 Binary files /dev/null and b/images/service-banner4.jpg differ diff --git a/images/services-top-shadow.png b/images/services-top-shadow.png new file mode 100755 index 0000000..580fd17 Binary files /dev/null and b/images/services-top-shadow.png differ diff --git a/images/slider-next-arrow.png b/images/slider-next-arrow.png new file mode 100755 index 0000000..d29b04f Binary files /dev/null and b/images/slider-next-arrow.png differ diff --git a/images/slider-prev-arrow.png b/images/slider-prev-arrow.png new file mode 100755 index 0000000..2c84a9c Binary files /dev/null and b/images/slider-prev-arrow.png differ diff --git a/images/square-3.png b/images/square-3.png new file mode 100755 index 0000000..07dca8a Binary files /dev/null and b/images/square-3.png differ diff --git a/images/square-4.png b/images/square-4.png new file mode 100755 index 0000000..a6bdfd4 Binary files /dev/null and b/images/square-4.png differ diff --git a/images/ss-system-large-1.jpg b/images/ss-system-large-1.jpg new file mode 100755 index 0000000..8ffbb4d Binary files /dev/null and b/images/ss-system-large-1.jpg differ diff --git a/images/ss-system-large-2.jpg b/images/ss-system-large-2.jpg new file mode 100755 index 0000000..fe27441 Binary files /dev/null and b/images/ss-system-large-2.jpg differ diff --git a/images/ss-system-large-3.jpg b/images/ss-system-large-3.jpg new file mode 100755 index 0000000..6da66a5 Binary files /dev/null and b/images/ss-system-large-3.jpg differ diff --git a/images/ss-system-large-4.jpg b/images/ss-system-large-4.jpg new file mode 100755 index 0000000..bc918bf Binary files /dev/null and b/images/ss-system-large-4.jpg differ diff --git a/images/ss-system-thumb-1.jpg b/images/ss-system-thumb-1.jpg new file mode 100755 index 0000000..2286c71 Binary files /dev/null and b/images/ss-system-thumb-1.jpg differ diff --git a/images/ss-system-thumb-2.jpg b/images/ss-system-thumb-2.jpg new file mode 100755 index 0000000..bea3c8a Binary files /dev/null and b/images/ss-system-thumb-2.jpg differ diff --git a/images/ss-system-thumb-3.jpg b/images/ss-system-thumb-3.jpg new file mode 100755 index 0000000..df928cb Binary files /dev/null and b/images/ss-system-thumb-3.jpg differ diff --git a/images/ss-system-thumb-4.jpg b/images/ss-system-thumb-4.jpg new file mode 100755 index 0000000..88a60d5 Binary files /dev/null and b/images/ss-system-thumb-4.jpg differ diff --git a/images/studies-analysis.jpg b/images/studies-analysis.jpg new file mode 100755 index 0000000..75fd944 Binary files /dev/null and b/images/studies-analysis.jpg differ diff --git a/images/system-studies-analysis-banner.jpg b/images/system-studies-analysis-banner.jpg new file mode 100755 index 0000000..3fcad60 Binary files /dev/null and b/images/system-studies-analysis-banner.jpg differ diff --git a/images/system-studies-large-1.jpg b/images/system-studies-large-1.jpg new file mode 100755 index 0000000..364f911 Binary files /dev/null and b/images/system-studies-large-1.jpg differ diff --git a/images/system-studies-large-2.jpg b/images/system-studies-large-2.jpg new file mode 100755 index 0000000..6fc4818 Binary files /dev/null and b/images/system-studies-large-2.jpg differ diff --git a/images/system-studies-large-3.jpg b/images/system-studies-large-3.jpg new file mode 100755 index 0000000..70e3b97 Binary files /dev/null and b/images/system-studies-large-3.jpg differ diff --git a/images/system-studies-large-4.jpg b/images/system-studies-large-4.jpg new file mode 100755 index 0000000..3bab2b2 Binary files /dev/null and b/images/system-studies-large-4.jpg differ diff --git a/images/system-studies-large-5.jpg b/images/system-studies-large-5.jpg new file mode 100755 index 0000000..d409526 Binary files /dev/null and b/images/system-studies-large-5.jpg differ diff --git a/images/system-studies-thumb-1.jpg b/images/system-studies-thumb-1.jpg new file mode 100755 index 0000000..ddd20ab Binary files /dev/null and b/images/system-studies-thumb-1.jpg differ diff --git a/images/system-studies-thumb-2.jpg b/images/system-studies-thumb-2.jpg new file mode 100755 index 0000000..0aad9ad Binary files /dev/null and b/images/system-studies-thumb-2.jpg differ diff --git a/images/system-studies-thumb-3.jpg b/images/system-studies-thumb-3.jpg new file mode 100755 index 0000000..5ae2957 Binary files /dev/null and b/images/system-studies-thumb-3.jpg differ diff --git a/images/system-studies-thumb-4.jpg b/images/system-studies-thumb-4.jpg new file mode 100755 index 0000000..1204cc5 Binary files /dev/null and b/images/system-studies-thumb-4.jpg differ diff --git a/images/system-studies-thumb-5.jpg b/images/system-studies-thumb-5.jpg new file mode 100755 index 0000000..c4eec0e Binary files /dev/null and b/images/system-studies-thumb-5.jpg differ diff --git a/images/testimonial-banner.jpg b/images/testimonial-banner.jpg new file mode 100755 index 0000000..99374f7 Binary files /dev/null and b/images/testimonial-banner.jpg differ diff --git a/images/transportation-banner.jpg b/images/transportation-banner.jpg new file mode 100755 index 0000000..de8523b Binary files /dev/null and b/images/transportation-banner.jpg differ diff --git a/images/transportation-large-1.jpg b/images/transportation-large-1.jpg new file mode 100755 index 0000000..5222edb Binary files /dev/null and b/images/transportation-large-1.jpg differ diff --git a/images/transportation-large-2.jpg b/images/transportation-large-2.jpg new file mode 100755 index 0000000..eda18d7 Binary files /dev/null and b/images/transportation-large-2.jpg differ diff --git a/images/transportation-large-3.jpg b/images/transportation-large-3.jpg new file mode 100755 index 0000000..04e94fe Binary files /dev/null and b/images/transportation-large-3.jpg differ diff --git a/images/transportation-large-4.jpg b/images/transportation-large-4.jpg new file mode 100755 index 0000000..a7535a8 Binary files /dev/null and b/images/transportation-large-4.jpg differ diff --git a/images/transportation-large-5.jpg b/images/transportation-large-5.jpg new file mode 100755 index 0000000..8bd23e0 Binary files /dev/null and b/images/transportation-large-5.jpg differ diff --git a/images/transportation-thumb-1.jpg b/images/transportation-thumb-1.jpg new file mode 100755 index 0000000..bc2d915 Binary files /dev/null and b/images/transportation-thumb-1.jpg differ diff --git a/images/transportation-thumb-2.jpg b/images/transportation-thumb-2.jpg new file mode 100755 index 0000000..d7d4e55 Binary files /dev/null and b/images/transportation-thumb-2.jpg differ diff --git a/images/transportation-thumb-3.jpg b/images/transportation-thumb-3.jpg new file mode 100755 index 0000000..486e0a0 Binary files /dev/null and b/images/transportation-thumb-3.jpg differ diff --git a/images/transportation-thumb-4.jpg b/images/transportation-thumb-4.jpg new file mode 100755 index 0000000..f40c730 Binary files /dev/null and b/images/transportation-thumb-4.jpg differ diff --git a/images/transportation-thumb-5.jpg b/images/transportation-thumb-5.jpg new file mode 100755 index 0000000..309fbdb Binary files /dev/null and b/images/transportation-thumb-5.jpg differ diff --git a/images/transportation.svg b/images/transportation.svg new file mode 100755 index 0000000..bdea180 --- /dev/null +++ b/images/transportation.svg @@ -0,0 +1,275 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/images/utilities-and-renewable-energy-banner.jpg b/images/utilities-and-renewable-energy-banner.jpg new file mode 100755 index 0000000..bbaf8d9 Binary files /dev/null and b/images/utilities-and-renewable-energy-banner.jpg differ diff --git a/images/value-added-services-banner.jpg b/images/value-added-services-banner.jpg new file mode 100755 index 0000000..0f3ee1b Binary files /dev/null and b/images/value-added-services-banner.jpg differ diff --git a/images/value-added-services-large-1.jpg b/images/value-added-services-large-1.jpg new file mode 100755 index 0000000..2b7564e Binary files /dev/null and b/images/value-added-services-large-1.jpg differ diff --git a/images/value-added-services-large-2.jpg b/images/value-added-services-large-2.jpg new file mode 100755 index 0000000..0ec086b Binary files /dev/null and b/images/value-added-services-large-2.jpg differ diff --git a/images/value-added-services-large-3.jpg b/images/value-added-services-large-3.jpg new file mode 100755 index 0000000..da4985d Binary files /dev/null and b/images/value-added-services-large-3.jpg differ diff --git a/images/value-added-services-large-4.jpg b/images/value-added-services-large-4.jpg new file mode 100755 index 0000000..edae047 Binary files /dev/null and b/images/value-added-services-large-4.jpg differ diff --git a/images/value-added-services-large-5.jpg b/images/value-added-services-large-5.jpg new file mode 100755 index 0000000..1a18f04 Binary files /dev/null and b/images/value-added-services-large-5.jpg differ diff --git a/images/value-added-services-thumb-1.jpg b/images/value-added-services-thumb-1.jpg new file mode 100755 index 0000000..cd7f859 Binary files /dev/null and b/images/value-added-services-thumb-1.jpg differ diff --git a/images/value-added-services-thumb-2.jpg b/images/value-added-services-thumb-2.jpg new file mode 100755 index 0000000..19d2b2e Binary files /dev/null and b/images/value-added-services-thumb-2.jpg differ diff --git a/images/value-added-services-thumb-3.jpg b/images/value-added-services-thumb-3.jpg new file mode 100755 index 0000000..c46a781 Binary files /dev/null and b/images/value-added-services-thumb-3.jpg differ diff --git a/images/value-added-services-thumb-4.jpg b/images/value-added-services-thumb-4.jpg new file mode 100755 index 0000000..fb410f3 Binary files /dev/null and b/images/value-added-services-thumb-4.jpg differ diff --git a/images/value-added-services-thumb-5.jpg b/images/value-added-services-thumb-5.jpg new file mode 100755 index 0000000..ba11067 Binary files /dev/null and b/images/value-added-services-thumb-5.jpg differ diff --git a/images/value-added-services.jpg b/images/value-added-services.jpg new file mode 100755 index 0000000..c9b7e8c Binary files /dev/null and b/images/value-added-services.jpg differ diff --git a/images/video-image.jpg b/images/video-image.jpg new file mode 100755 index 0000000..6ed7525 Binary files /dev/null and b/images/video-image.jpg differ diff --git a/images/waves.svg b/images/waves.svg new file mode 100755 index 0000000..03e205e --- /dev/null +++ b/images/waves.svg @@ -0,0 +1,37 @@ + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + + diff --git a/index.html b/index.html new file mode 100755 index 0000000..c6429c4 --- /dev/null +++ b/index.html @@ -0,0 +1,525 @@ + + + + + + + + + + Astute Engineering + + + + + + + + + + + + + + + + +
+ +
+ + + +
+ X +
+ +
+
+ + + +
+
+
+
+
+

Astute Engineering

+
+
+
+

Astute Engineering, established in the Commonwealth of Virginia, is strategically located to serve federal, state and municipal clients within Virginia, DC, Maryland, West Virginia, Pennsylvania and in the vicinity.

+

We provide end-to-end services in Electrical Engineering, ranging from study & schematic phase to final installation, commissioning & commercial operation. Our deep involvement in projects, right from inception and through various stages of design, helps us and our clients alike. Our background, knowledge, skills and experience are the corner stones of our organization.

+

Every project, small or big, earns equal importance from us. We find uniqueness in every assignment we accept and we tailor our services to the needs and demands of our projects and clients. Flexibility is our strength.

+

Our thorough knowledge of products, further strengthened by our erection-commissioning experience and ability to intelligently interface with our clients and assimilating their valuable inputs results in comprehensive, innovative and accomplished designs/installations. Thoroughness is our virtue.

+

All the qualities we possess, such as knowledge base, skills, experience, flexibility and thoroughness, together bring out the excellence in our designs & services.

+
+
+
+ +
+
+
+
Need Our Brochure?
+

Download Here

+
+
+
+
+ +
+
+ +
+
+
+
+ +
+
+ +
+
+
+
+
+
+
+
+
+
+ +
+
+
+
+ +
+

Our Mission

+

Provide value based, astutely engineered solutions for economical, safe and reliable power distribution systems.

+
+
+
+
+
+ +
+

Our Vision

+

Develop enduring partnerships with our clients based on relationships built upon excellence in work and mutual trust. Deliver affordable but innovative designs and provide solid support services extending upto and beyond project implementation through our astute, involved and empowered employees.

+
+
+
+
+
+ +
+

Our Values

+

At astute, we are committed to a set of core values that not only define who we are, but also serve as guide-poste to help us become the company we would like to be. And we aspire to live these values every day.

+
+
+ +
+
+ +
+
+
+

Our Services

+
+
+
+
+
+
+ +
+
+ Read More +
+
+
+
+ Power Distribution Systems +
+ +
+
+
+
+
+ +
+
+ Read More +
+
+
+
+ SYSTEM STUDIES/ANALYSES +
+ +
+
+
+
+
+ +
+
+ Read More +
+
+
+
+ Field Services +
+ +
+
+
+
+
+ +
+
+ Read More +
+
+
+
+ Instrumentation and Controls +
+ +
+
+
+
+
+ +
+
+ Read More +
+
+
+
+ Value Added Services +
+ +
+
+
+
+
+ +
+
+ Read More +
+
+
+
+ Security & Surveillance Systems +
+ +
+
+
+
+
+
+ +
+ +
+
+

Our Markets

+
+
+
+
+
+
+ +
+
+ Government +
+
+
+
+
+
+ +
+
+ Utilities & Renewable Energy +
+
+
+
+
+
+ +
+
+ Institutional +
+
+
+
+
+
+ +
+
+ Transportation +
+
+
+
+
+
+ +
+
+ Commercial +
+
+
+
+
+
+ +
+
+ Industrial +
+
+
+
+
+
+
+ +
+
+
+

Our CERTIFICATIONS

+
+
+
+
    +
    • +
    • +
    • +
    • +
    • +
    • +
    • +
    • +
    • +
    • +
    • +
    • +
+
+
+
+
+ +
+ + + + + + + + + + + + + + + + + + + + diff --git a/industrial.html b/industrial.html new file mode 100755 index 0000000..fcc86d5 --- /dev/null +++ b/industrial.html @@ -0,0 +1,240 @@ + + + + + + + + + + + Astute Engineering - Industrial + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ + +
+ + +
+
+
+
+
    +
  1. Home
    2. +
  2. Markets
    3. +
  3. Industrial
    4. +
+
+
+

Industrial

+
+ +
+
+

Our ingenious power distribution system designs are conducive and congenial for all industrial environments from high power for heavy industries to small power for light industries.

+
+
+
+
+ +
+
+
+
+
+
+
We meet varied needs of power & controls for:
+
    +
  • Smart stacking systems in expansive industrial warehouses
    • +
  • Demands of a busy freight transfer facility
    • +
  • The rigors of a heavy manufacturing plant
    • +
  • Finesse of delicate process industry
    • +
+
+
+
+
+ + + + +
+
+
+
+
+
+
+
+
We provide enduring but economical solutions for:
+
    +
  • Somber & uniform lighting for a heavy manufacturing unit
    • +
  • Bright and focused lighting for consumer retail industry outlets
    • +
  • Exterior lighting around buildings and parking lots
    • +
+
+
+
+
+ + + + +
+
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + diff --git a/institutional.html b/institutional.html new file mode 100755 index 0000000..e4267f8 --- /dev/null +++ b/institutional.html @@ -0,0 +1,243 @@ + + + + + + + + + + + Astute Engineering - Institutional + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ + +
+ + +
+
+
+
+
    +
  1. Home
    2. +
  2. Markets
    3. +
  3. Institutional
    4. +
+
+
+

Institutional

+
+
+
+

Astute recognizes and strives to understand the unique needs of Institutional facilities and caters to their specific requirements. We listen carefully and provide thoughtful, responsive solutions to meet with ambitious programs, challenging budgets, and tight schedules. We comprehend the different drivers and performance parameters of our institutional clients and align with their systems to produce designs befitting to their needs.

+

Our target market in the institutional segment includes:

+
    +
  • Schools, Colleges & Universities
    • +
  • Libraries, Laboratories
    • +
  • Recreation facilities
    • +
  • Hospitals, Pharmacies & Healthcare facilities
    • +
  • Museums & Historical Buildings
    • +
+
+
+
+
+
+
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+ + + + +
+
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + diff --git a/instrumentation-and-control.html b/instrumentation-and-control.html new file mode 100755 index 0000000..5d10187 --- /dev/null +++ b/instrumentation-and-control.html @@ -0,0 +1,238 @@ + + + + + + + + + + + Astute Engineering - Instrumentation and Controls + + + + + + + + + + + + + + + + + + +
+ +
+ +
+ + +
+ + +
+
+
+
+
    +
  1. Home
    2. +
  2. Services
    3. +
  3. Instrumentation and Controls
    4. +
+
+
+

Instrumentation and Controls

+
+
+
+

Astute has capability to handle projects involving intricate Instrumentation & Control systems, SCADA & Communication projects.

+

Our engineers are adept at evolving complex process control schematics based on P&IDs, functional descriptions and Sequence of Operations.

+

We work with our clients through all phases of a project beginning with conceptualization, studies, design, engineering and construction/installation of individual systems. Our thorough & diligent support during the crucial phases of system integration and Start-up & Commissioning is highly valued by our clients.

+
+
+ +
+
+
+
+
+
+
+
+

Following are our areas of expertise:

+
    +
  • Instrumentation Design
    • +
  • Control System Design and Engineering
    • +
  • Design & Integration of:
    • +
      +
    • Automation Systems
      • +
    • Distributed Control Systems
      • +
    • Supervisory Control and Data Acquisition (SCADA) Systems
      • +
    +
  • Plant/facility wide Intercom system
    • +
  • Communication Systems Design using protocols like:
    • +
      +
    • Field bus, Process network, Profibus, Modbus, Industrial Ethernet, Fiber Optics and more
      • +
    +
  • Pre-Commissioning, Commissioning and Start-up Assistance
    • +
  • Smoke Detection & Fire Alarm Systems
    • +
+
+
+
+
+ + + + +
+
+
+
+
+
+ + + + +
+
+
+
+
+ + + + + + + + + + + + + + + + + + + + + diff --git a/js/bootstrap.min.js b/js/bootstrap.min.js new file mode 100755 index 0000000..3a88c3f --- /dev/null +++ b/js/bootstrap.min.js @@ -0,0 +1,7 @@ +/*! + * Bootstrap v3.3.2 (http://getbootstrap.com) + * Copyright 2011-2015 Twitter, Inc. + * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE) + */ +if("undefined"==typeof jQuery)throw new Error("Bootstrap's JavaScript requires jQuery");+function(a){"use strict";var b=a.fn.jquery.split(" ")[0].split(".");if(b[0]<2&&b[1]<9||1==b[0]&&9==b[1]&&b[2]<1)throw new Error("Bootstrap's JavaScript requires jQuery version 1.9.1 or higher")}(jQuery),+function(a){"use strict";function b(){var a=document.createElement("bootstrap"),b={WebkitTransition:"webkitTransitionEnd",MozTransition:"transitionend",OTransition:"oTransitionEnd otransitionend",transition:"transitionend"};for(var c in b)if(void 0!==a.style[c])return{end:b[c]};return!1}a.fn.emulateTransitionEnd=function(b){var c=!1,d=this;a(this).one("bsTransitionEnd",function(){c=!0});var e=function(){c||a(d).trigger(a.support.transition.end)};return setTimeout(e,b),this},a(function(){a.support.transition=b(),a.support.transition&&(a.event.special.bsTransitionEnd={bindType:a.support.transition.end,delegateType:a.support.transition.end,handle:function(b){return a(b.target).is(this)?b.handleObj.handler.apply(this,arguments):void 0}})})}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var c=a(this),e=c.data("bs.alert");e||c.data("bs.alert",e=new d(this)),"string"==typeof b&&e[b].call(c)})}var c='[data-dismiss="alert"]',d=function(b){a(b).on("click",c,this.close)};d.VERSION="3.3.2",d.TRANSITION_DURATION=150,d.prototype.close=function(b){function c(){g.detach().trigger("closed.bs.alert").remove()}var e=a(this),f=e.attr("data-target");f||(f=e.attr("href"),f=f&&f.replace(/.*(?=#[^\s]*$)/,""));var g=a(f);b&&b.preventDefault(),g.length||(g=e.closest(".alert")),g.trigger(b=a.Event("close.bs.alert")),b.isDefaultPrevented()||(g.removeClass("in"),a.support.transition&&g.hasClass("fade")?g.one("bsTransitionEnd",c).emulateTransitionEnd(d.TRANSITION_DURATION):c())};var e=a.fn.alert;a.fn.alert=b,a.fn.alert.Constructor=d,a.fn.alert.noConflict=function(){return a.fn.alert=e,this},a(document).on("click.bs.alert.data-api",c,d.prototype.close)}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.button"),f="object"==typeof b&&b;e||d.data("bs.button",e=new c(this,f)),"toggle"==b?e.toggle():b&&e.setState(b)})}var c=function(b,d){this.$element=a(b),this.options=a.extend({},c.DEFAULTS,d),this.isLoading=!1};c.VERSION="3.3.2",c.DEFAULTS={loadingText:"loading..."},c.prototype.setState=function(b){var c="disabled",d=this.$element,e=d.is("input")?"val":"html",f=d.data();b+="Text",null==f.resetText&&d.data("resetText",d[e]()),setTimeout(a.proxy(function(){d[e](null==f[b]?this.options[b]:f[b]),"loadingText"==b?(this.isLoading=!0,d.addClass(c).attr(c,c)):this.isLoading&&(this.isLoading=!1,d.removeClass(c).removeAttr(c))},this),0)},c.prototype.toggle=function(){var a=!0,b=this.$element.closest('[data-toggle="buttons"]');if(b.length){var c=this.$element.find("input");"radio"==c.prop("type")&&(c.prop("checked")&&this.$element.hasClass("active")?a=!1:b.find(".active").removeClass("active")),a&&c.prop("checked",!this.$element.hasClass("active")).trigger("change")}else this.$element.attr("aria-pressed",!this.$element.hasClass("active"));a&&this.$element.toggleClass("active")};var d=a.fn.button;a.fn.button=b,a.fn.button.Constructor=c,a.fn.button.noConflict=function(){return a.fn.button=d,this},a(document).on("click.bs.button.data-api",'[data-toggle^="button"]',function(c){var d=a(c.target);d.hasClass("btn")||(d=d.closest(".btn")),b.call(d,"toggle"),c.preventDefault()}).on("focus.bs.button.data-api blur.bs.button.data-api",'[data-toggle^="button"]',function(b){a(b.target).closest(".btn").toggleClass("focus",/^focus(in)?$/.test(b.type))})}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.carousel"),f=a.extend({},c.DEFAULTS,d.data(),"object"==typeof b&&b),g="string"==typeof b?b:f.slide;e||d.data("bs.carousel",e=new c(this,f)),"number"==typeof b?e.to(b):g?e[g]():f.interval&&e.pause().cycle()})}var c=function(b,c){this.$element=a(b),this.$indicators=this.$element.find(".carousel-indicators"),this.options=c,this.paused=this.sliding=this.interval=this.$active=this.$items=null,this.options.keyboard&&this.$element.on("keydown.bs.carousel",a.proxy(this.keydown,this)),"hover"==this.options.pause&&!("ontouchstart"in document.documentElement)&&this.$element.on("mouseenter.bs.carousel",a.proxy(this.pause,this)).on("mouseleave.bs.carousel",a.proxy(this.cycle,this))};c.VERSION="3.3.2",c.TRANSITION_DURATION=600,c.DEFAULTS={interval:5e3,pause:"hover",wrap:!0,keyboard:!0},c.prototype.keydown=function(a){if(!/input|textarea/i.test(a.target.tagName)){switch(a.which){case 37:this.prev();break;case 39:this.next();break;default:return}a.preventDefault()}},c.prototype.cycle=function(b){return b||(this.paused=!1),this.interval&&clearInterval(this.interval),this.options.interval&&!this.paused&&(this.interval=setInterval(a.proxy(this.next,this),this.options.interval)),this},c.prototype.getItemIndex=function(a){return this.$items=a.parent().children(".item"),this.$items.index(a||this.$active)},c.prototype.getItemForDirection=function(a,b){var c=this.getItemIndex(b),d="prev"==a&&0===c||"next"==a&&c==this.$items.length-1;if(d&&!this.options.wrap)return b;var e="prev"==a?-1:1,f=(c+e)%this.$items.length;return this.$items.eq(f)},c.prototype.to=function(a){var b=this,c=this.getItemIndex(this.$active=this.$element.find(".item.active"));return a>this.$items.length-1||0>a?void 0:this.sliding?this.$element.one("slid.bs.carousel",function(){b.to(a)}):c==a?this.pause().cycle():this.slide(a>c?"next":"prev",this.$items.eq(a))},c.prototype.pause=function(b){return b||(this.paused=!0),this.$element.find(".next, .prev").length&&a.support.transition&&(this.$element.trigger(a.support.transition.end),this.cycle(!0)),this.interval=clearInterval(this.interval),this},c.prototype.next=function(){return this.sliding?void 0:this.slide("next")},c.prototype.prev=function(){return this.sliding?void 0:this.slide("prev")},c.prototype.slide=function(b,d){var e=this.$element.find(".item.active"),f=d||this.getItemForDirection(b,e),g=this.interval,h="next"==b?"left":"right",i=this;if(f.hasClass("active"))return this.sliding=!1;var j=f[0],k=a.Event("slide.bs.carousel",{relatedTarget:j,direction:h});if(this.$element.trigger(k),!k.isDefaultPrevented()){if(this.sliding=!0,g&&this.pause(),this.$indicators.length){this.$indicators.find(".active").removeClass("active");var l=a(this.$indicators.children()[this.getItemIndex(f)]);l&&l.addClass("active")}var m=a.Event("slid.bs.carousel",{relatedTarget:j,direction:h});return a.support.transition&&this.$element.hasClass("slide")?(f.addClass(b),f[0].offsetWidth,e.addClass(h),f.addClass(h),e.one("bsTransitionEnd",function(){f.removeClass([b,h].join(" ")).addClass("active"),e.removeClass(["active",h].join(" ")),i.sliding=!1,setTimeout(function(){i.$element.trigger(m)},0)}).emulateTransitionEnd(c.TRANSITION_DURATION)):(e.removeClass("active"),f.addClass("active"),this.sliding=!1,this.$element.trigger(m)),g&&this.cycle(),this}};var d=a.fn.carousel;a.fn.carousel=b,a.fn.carousel.Constructor=c,a.fn.carousel.noConflict=function(){return a.fn.carousel=d,this};var e=function(c){var d,e=a(this),f=a(e.attr("data-target")||(d=e.attr("href"))&&d.replace(/.*(?=#[^\s]+$)/,""));if(f.hasClass("carousel")){var g=a.extend({},f.data(),e.data()),h=e.attr("data-slide-to");h&&(g.interval=!1),b.call(f,g),h&&f.data("bs.carousel").to(h),c.preventDefault()}};a(document).on("click.bs.carousel.data-api","[data-slide]",e).on("click.bs.carousel.data-api","[data-slide-to]",e),a(window).on("load",function(){a('[data-ride="carousel"]').each(function(){var c=a(this);b.call(c,c.data())})})}(jQuery),+function(a){"use strict";function b(b){var c,d=b.attr("data-target")||(c=b.attr("href"))&&c.replace(/.*(?=#[^\s]+$)/,"");return a(d)}function c(b){return this.each(function(){var c=a(this),e=c.data("bs.collapse"),f=a.extend({},d.DEFAULTS,c.data(),"object"==typeof b&&b);!e&&f.toggle&&"show"==b&&(f.toggle=!1),e||c.data("bs.collapse",e=new d(this,f)),"string"==typeof b&&e[b]()})}var d=function(b,c){this.$element=a(b),this.options=a.extend({},d.DEFAULTS,c),this.$trigger=a(this.options.trigger).filter('[href="#'+b.id+'"], [data-target="#'+b.id+'"]'),this.transitioning=null,this.options.parent?this.$parent=this.getParent():this.addAriaAndCollapsedClass(this.$element,this.$trigger),this.options.toggle&&this.toggle()};d.VERSION="3.3.2",d.TRANSITION_DURATION=350,d.DEFAULTS={toggle:!0,trigger:'[data-toggle="collapse"]'},d.prototype.dimension=function(){var a=this.$element.hasClass("width");return a?"width":"height"},d.prototype.show=function(){if(!this.transitioning&&!this.$element.hasClass("in")){var b,e=this.$parent&&this.$parent.children(".panel").children(".in, .collapsing");if(!(e&&e.length&&(b=e.data("bs.collapse"),b&&b.transitioning))){var f=a.Event("show.bs.collapse");if(this.$element.trigger(f),!f.isDefaultPrevented()){e&&e.length&&(c.call(e,"hide"),b||e.data("bs.collapse",null));var g=this.dimension();this.$element.removeClass("collapse").addClass("collapsing")[g](0).attr("aria-expanded",!0),this.$trigger.removeClass("collapsed").attr("aria-expanded",!0),this.transitioning=1;var h=function(){this.$element.removeClass("collapsing").addClass("collapse in")[g](""),this.transitioning=0,this.$element.trigger("shown.bs.collapse")};if(!a.support.transition)return h.call(this);var i=a.camelCase(["scroll",g].join("-"));this.$element.one("bsTransitionEnd",a.proxy(h,this)).emulateTransitionEnd(d.TRANSITION_DURATION)[g](this.$element[0][i])}}}},d.prototype.hide=function(){if(!this.transitioning&&this.$element.hasClass("in")){var b=a.Event("hide.bs.collapse");if(this.$element.trigger(b),!b.isDefaultPrevented()){var c=this.dimension();this.$element[c](this.$element[c]())[0].offsetHeight,this.$element.addClass("collapsing").removeClass("collapse in").attr("aria-expanded",!1),this.$trigger.addClass("collapsed").attr("aria-expanded",!1),this.transitioning=1;var e=function(){this.transitioning=0,this.$element.removeClass("collapsing").addClass("collapse").trigger("hidden.bs.collapse")};return a.support.transition?void this.$element[c](0).one("bsTransitionEnd",a.proxy(e,this)).emulateTransitionEnd(d.TRANSITION_DURATION):e.call(this)}}},d.prototype.toggle=function(){this[this.$element.hasClass("in")?"hide":"show"]()},d.prototype.getParent=function(){return a(this.options.parent).find('[data-toggle="collapse"][data-parent="'+this.options.parent+'"]').each(a.proxy(function(c,d){var e=a(d);this.addAriaAndCollapsedClass(b(e),e)},this)).end()},d.prototype.addAriaAndCollapsedClass=function(a,b){var c=a.hasClass("in");a.attr("aria-expanded",c),b.toggleClass("collapsed",!c).attr("aria-expanded",c)};var e=a.fn.collapse;a.fn.collapse=c,a.fn.collapse.Constructor=d,a.fn.collapse.noConflict=function(){return a.fn.collapse=e,this},a(document).on("click.bs.collapse.data-api",'[data-toggle="collapse"]',function(d){var e=a(this);e.attr("data-target")||d.preventDefault();var f=b(e),g=f.data("bs.collapse"),h=g?"toggle":a.extend({},e.data(),{trigger:this});c.call(f,h)})}(jQuery),+function(a){"use strict";function b(b){b&&3===b.which||(a(e).remove(),a(f).each(function(){var d=a(this),e=c(d),f={relatedTarget:this};e.hasClass("open")&&(e.trigger(b=a.Event("hide.bs.dropdown",f)),b.isDefaultPrevented()||(d.attr("aria-expanded","false"),e.removeClass("open").trigger("hidden.bs.dropdown",f)))}))}function c(b){var c=b.attr("data-target");c||(c=b.attr("href"),c=c&&/#[A-Za-z]/.test(c)&&c.replace(/.*(?=#[^\s]*$)/,""));var d=c&&a(c);return d&&d.length?d:b.parent()}function d(b){return this.each(function(){var c=a(this),d=c.data("bs.dropdown");d||c.data("bs.dropdown",d=new g(this)),"string"==typeof b&&d[b].call(c)})}var e=".dropdown-backdrop",f='[data-toggle="dropdown"]',g=function(b){a(b).on("click.bs.dropdown",this.toggle)};g.VERSION="3.3.2",g.prototype.toggle=function(d){var e=a(this);if(!e.is(".disabled, :disabled")){var f=c(e),g=f.hasClass("open");if(b(),!g){"ontouchstart"in document.documentElement&&!f.closest(".navbar-nav").length&&a('
').insertAfter(a(this)).on("click",b);var h={relatedTarget:this};if(f.trigger(d=a.Event("show.bs.dropdown",h)),d.isDefaultPrevented())return;e.trigger("focus").attr("aria-expanded","true"),f.toggleClass("open").trigger("shown.bs.dropdown",h)}return!1}},g.prototype.keydown=function(b){if(/(38|40|27|32)/.test(b.which)&&!/input|textarea/i.test(b.target.tagName)){var d=a(this);if(b.preventDefault(),b.stopPropagation(),!d.is(".disabled, :disabled")){var e=c(d),g=e.hasClass("open");if(!g&&27!=b.which||g&&27==b.which)return 27==b.which&&e.find(f).trigger("focus"),d.trigger("click");var h=" li:not(.divider):visible a",i=e.find('[role="menu"]'+h+', [role="listbox"]'+h);if(i.length){var j=i.index(b.target);38==b.which&&j>0&&j--,40==b.which&&j').prependTo(this.$element).on("click.dismiss.bs.modal",a.proxy(function(a){a.target===a.currentTarget&&("static"==this.options.backdrop?this.$element[0].focus.call(this.$element[0]):this.hide.call(this))},this)),f&&this.$backdrop[0].offsetWidth,this.$backdrop.addClass("in"),!b)return;f?this.$backdrop.one("bsTransitionEnd",b).emulateTransitionEnd(c.BACKDROP_TRANSITION_DURATION):b()}else if(!this.isShown&&this.$backdrop){this.$backdrop.removeClass("in");var g=function(){d.removeBackdrop(),b&&b()};a.support.transition&&this.$element.hasClass("fade")?this.$backdrop.one("bsTransitionEnd",g).emulateTransitionEnd(c.BACKDROP_TRANSITION_DURATION):g()}else b&&b()},c.prototype.handleUpdate=function(){this.options.backdrop&&this.adjustBackdrop(),this.adjustDialog()},c.prototype.adjustBackdrop=function(){this.$backdrop.css("height",0).css("height",this.$element[0].scrollHeight)},c.prototype.adjustDialog=function(){var a=this.$element[0].scrollHeight>document.documentElement.clientHeight;this.$element.css({paddingLeft:!this.bodyIsOverflowing&&a?this.scrollbarWidth:"",paddingRight:this.bodyIsOverflowing&&!a?this.scrollbarWidth:""})},c.prototype.resetAdjustments=function(){this.$element.css({paddingLeft:"",paddingRight:""})},c.prototype.checkScrollbar=function(){this.bodyIsOverflowing=document.body.scrollHeight>document.documentElement.clientHeight,this.scrollbarWidth=this.measureScrollbar()},c.prototype.setScrollbar=function(){var a=parseInt(this.$body.css("padding-right")||0,10);this.bodyIsOverflowing&&this.$body.css("padding-right",a+this.scrollbarWidth)},c.prototype.resetScrollbar=function(){this.$body.css("padding-right","")},c.prototype.measureScrollbar=function(){var a=document.createElement("div");a.className="modal-scrollbar-measure",this.$body.append(a);var b=a.offsetWidth-a.clientWidth;return this.$body[0].removeChild(a),b};var d=a.fn.modal;a.fn.modal=b,a.fn.modal.Constructor=c,a.fn.modal.noConflict=function(){return a.fn.modal=d,this},a(document).on("click.bs.modal.data-api",'[data-toggle="modal"]',function(c){var d=a(this),e=d.attr("href"),f=a(d.attr("data-target")||e&&e.replace(/.*(?=#[^\s]+$)/,"")),g=f.data("bs.modal")?"toggle":a.extend({remote:!/#/.test(e)&&e},f.data(),d.data());d.is("a")&&c.preventDefault(),f.one("show.bs.modal",function(a){a.isDefaultPrevented()||f.one("hidden.bs.modal",function(){d.is(":visible")&&d.trigger("focus")})}),b.call(f,g,this)})}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.tooltip"),f="object"==typeof b&&b;(e||"destroy"!=b)&&(e||d.data("bs.tooltip",e=new c(this,f)),"string"==typeof b&&e[b]())})}var c=function(a,b){this.type=this.options=this.enabled=this.timeout=this.hoverState=this.$element=null,this.init("tooltip",a,b)};c.VERSION="3.3.2",c.TRANSITION_DURATION=150,c.DEFAULTS={animation:!0,placement:"top",selector:!1,template:'',trigger:"hover focus",title:"",delay:0,html:!1,container:!1,viewport:{selector:"body",padding:0}},c.prototype.init=function(b,c,d){this.enabled=!0,this.type=b,this.$element=a(c),this.options=this.getOptions(d),this.$viewport=this.options.viewport&&a(this.options.viewport.selector||this.options.viewport);for(var e=this.options.trigger.split(" "),f=e.length;f--;){var g=e[f];if("click"==g)this.$element.on("click."+this.type,this.options.selector,a.proxy(this.toggle,this));else if("manual"!=g){var h="hover"==g?"mouseenter":"focusin",i="hover"==g?"mouseleave":"focusout";this.$element.on(h+"."+this.type,this.options.selector,a.proxy(this.enter,this)),this.$element.on(i+"."+this.type,this.options.selector,a.proxy(this.leave,this))}}this.options.selector?this._options=a.extend({},this.options,{trigger:"manual",selector:""}):this.fixTitle()},c.prototype.getDefaults=function(){return c.DEFAULTS},c.prototype.getOptions=function(b){return b=a.extend({},this.getDefaults(),this.$element.data(),b),b.delay&&"number"==typeof b.delay&&(b.delay={show:b.delay,hide:b.delay}),b},c.prototype.getDelegateOptions=function(){var b={},c=this.getDefaults();return this._options&&a.each(this._options,function(a,d){c[a]!=d&&(b[a]=d)}),b},c.prototype.enter=function(b){var c=b instanceof this.constructor?b:a(b.currentTarget).data("bs."+this.type);return c&&c.$tip&&c.$tip.is(":visible")?void(c.hoverState="in"):(c||(c=new this.constructor(b.currentTarget,this.getDelegateOptions()),a(b.currentTarget).data("bs."+this.type,c)),clearTimeout(c.timeout),c.hoverState="in",c.options.delay&&c.options.delay.show?void(c.timeout=setTimeout(function(){"in"==c.hoverState&&c.show()},c.options.delay.show)):c.show())},c.prototype.leave=function(b){var c=b instanceof this.constructor?b:a(b.currentTarget).data("bs."+this.type);return c||(c=new this.constructor(b.currentTarget,this.getDelegateOptions()),a(b.currentTarget).data("bs."+this.type,c)),clearTimeout(c.timeout),c.hoverState="out",c.options.delay&&c.options.delay.hide?void(c.timeout=setTimeout(function(){"out"==c.hoverState&&c.hide()},c.options.delay.hide)):c.hide()},c.prototype.show=function(){var b=a.Event("show.bs."+this.type);if(this.hasContent()&&this.enabled){this.$element.trigger(b);var d=a.contains(this.$element[0].ownerDocument.documentElement,this.$element[0]);if(b.isDefaultPrevented()||!d)return;var e=this,f=this.tip(),g=this.getUID(this.type);this.setContent(),f.attr("id",g),this.$element.attr("aria-describedby",g),this.options.animation&&f.addClass("fade");var h="function"==typeof this.options.placement?this.options.placement.call(this,f[0],this.$element[0]):this.options.placement,i=/\s?auto?\s?/i,j=i.test(h);j&&(h=h.replace(i,"")||"top"),f.detach().css({top:0,left:0,display:"block"}).addClass(h).data("bs."+this.type,this),this.options.container?f.appendTo(this.options.container):f.insertAfter(this.$element);var k=this.getPosition(),l=f[0].offsetWidth,m=f[0].offsetHeight;if(j){var n=h,o=this.options.container?a(this.options.container):this.$element.parent(),p=this.getPosition(o);h="bottom"==h&&k.bottom+m>p.bottom?"top":"top"==h&&k.top-mp.width?"left":"left"==h&&k.left-lg.top+g.height&&(e.top=g.top+g.height-i)}else{var j=b.left-f,k=b.left+f+c;jg.width&&(e.left=g.left+g.width-k)}return e},c.prototype.getTitle=function(){var a,b=this.$element,c=this.options;return a=b.attr("data-original-title")||("function"==typeof c.title?c.title.call(b[0]):c.title)},c.prototype.getUID=function(a){do a+=~~(1e6*Math.random());while(document.getElementById(a));return a},c.prototype.tip=function(){return this.$tip=this.$tip||a(this.options.template)},c.prototype.arrow=function(){return this.$arrow=this.$arrow||this.tip().find(".tooltip-arrow")},c.prototype.enable=function(){this.enabled=!0},c.prototype.disable=function(){this.enabled=!1},c.prototype.toggleEnabled=function(){this.enabled=!this.enabled},c.prototype.toggle=function(b){var c=this;b&&(c=a(b.currentTarget).data("bs."+this.type),c||(c=new this.constructor(b.currentTarget,this.getDelegateOptions()),a(b.currentTarget).data("bs."+this.type,c))),c.tip().hasClass("in")?c.leave(c):c.enter(c)},c.prototype.destroy=function(){var a=this;clearTimeout(this.timeout),this.hide(function(){a.$element.off("."+a.type).removeData("bs."+a.type)})};var d=a.fn.tooltip;a.fn.tooltip=b,a.fn.tooltip.Constructor=c,a.fn.tooltip.noConflict=function(){return a.fn.tooltip=d,this}}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.popover"),f="object"==typeof b&&b;(e||"destroy"!=b)&&(e||d.data("bs.popover",e=new c(this,f)),"string"==typeof b&&e[b]())})}var c=function(a,b){this.init("popover",a,b)};if(!a.fn.tooltip)throw new Error("Popover requires tooltip.js");c.VERSION="3.3.2",c.DEFAULTS=a.extend({},a.fn.tooltip.Constructor.DEFAULTS,{placement:"right",trigger:"click",content:"",template:''}),c.prototype=a.extend({},a.fn.tooltip.Constructor.prototype),c.prototype.constructor=c,c.prototype.getDefaults=function(){return c.DEFAULTS},c.prototype.setContent=function(){var a=this.tip(),b=this.getTitle(),c=this.getContent();a.find(".popover-title")[this.options.html?"html":"text"](b),a.find(".popover-content").children().detach().end()[this.options.html?"string"==typeof c?"html":"append":"text"](c),a.removeClass("fade top bottom left right in"),a.find(".popover-title").html()||a.find(".popover-title").hide()},c.prototype.hasContent=function(){return this.getTitle()||this.getContent()},c.prototype.getContent=function(){var a=this.$element,b=this.options;return a.attr("data-content")||("function"==typeof b.content?b.content.call(a[0]):b.content)},c.prototype.arrow=function(){return this.$arrow=this.$arrow||this.tip().find(".arrow")},c.prototype.tip=function(){return this.$tip||(this.$tip=a(this.options.template)),this.$tip};var d=a.fn.popover;a.fn.popover=b,a.fn.popover.Constructor=c,a.fn.popover.noConflict=function(){return a.fn.popover=d,this}}(jQuery),+function(a){"use strict";function b(c,d){var e=a.proxy(this.process,this);this.$body=a("body"),this.$scrollElement=a(a(c).is("body")?window:c),this.options=a.extend({},b.DEFAULTS,d),this.selector=(this.options.target||"")+" .nav li > a",this.offsets=[],this.targets=[],this.activeTarget=null,this.scrollHeight=0,this.$scrollElement.on("scroll.bs.scrollspy",e),this.refresh(),this.process()}function c(c){return this.each(function(){var d=a(this),e=d.data("bs.scrollspy"),f="object"==typeof c&&c;e||d.data("bs.scrollspy",e=new b(this,f)),"string"==typeof c&&e[c]()})}b.VERSION="3.3.2",b.DEFAULTS={offset:10},b.prototype.getScrollHeight=function(){return this.$scrollElement[0].scrollHeight||Math.max(this.$body[0].scrollHeight,document.documentElement.scrollHeight)},b.prototype.refresh=function(){var b="offset",c=0;a.isWindow(this.$scrollElement[0])||(b="position",c=this.$scrollElement.scrollTop()),this.offsets=[],this.targets=[],this.scrollHeight=this.getScrollHeight();var d=this;this.$body.find(this.selector).map(function(){var d=a(this),e=d.data("target")||d.attr("href"),f=/^#./.test(e)&&a(e);return f&&f.length&&f.is(":visible")&&[[f[b]().top+c,e]]||null}).sort(function(a,b){return a[0]-b[0]}).each(function(){d.offsets.push(this[0]),d.targets.push(this[1])})},b.prototype.process=function(){var a,b=this.$scrollElement.scrollTop()+this.options.offset,c=this.getScrollHeight(),d=this.options.offset+c-this.$scrollElement.height(),e=this.offsets,f=this.targets,g=this.activeTarget;if(this.scrollHeight!=c&&this.refresh(),b>=d)return g!=(a=f[f.length-1])&&this.activate(a);if(g&&b=e[a]&&(!e[a+1]||b<=e[a+1])&&this.activate(f[a])},b.prototype.activate=function(b){this.activeTarget=b,this.clear();var c=this.selector+'[data-target="'+b+'"],'+this.selector+'[href="'+b+'"]',d=a(c).parents("li").addClass("active");d.parent(".dropdown-menu").length&&(d=d.closest("li.dropdown").addClass("active")),d.trigger("activate.bs.scrollspy")},b.prototype.clear=function(){a(this.selector).parentsUntil(this.options.target,".active").removeClass("active")};var d=a.fn.scrollspy;a.fn.scrollspy=c,a.fn.scrollspy.Constructor=b,a.fn.scrollspy.noConflict=function(){return a.fn.scrollspy=d,this},a(window).on("load.bs.scrollspy.data-api",function(){a('[data-spy="scroll"]').each(function(){var b=a(this);c.call(b,b.data())})})}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.tab");e||d.data("bs.tab",e=new c(this)),"string"==typeof b&&e[b]()})}var c=function(b){this.element=a(b)};c.VERSION="3.3.2",c.TRANSITION_DURATION=150,c.prototype.show=function(){var b=this.element,c=b.closest("ul:not(.dropdown-menu)"),d=b.data("target");if(d||(d=b.attr("href"),d=d&&d.replace(/.*(?=#[^\s]*$)/,"")),!b.parent("li").hasClass("active")){var e=c.find(".active:last a"),f=a.Event("hide.bs.tab",{relatedTarget:b[0]}),g=a.Event("show.bs.tab",{relatedTarget:e[0]});if(e.trigger(f),b.trigger(g),!g.isDefaultPrevented()&&!f.isDefaultPrevented()){var h=a(d);this.activate(b.closest("li"),c),this.activate(h,h.parent(),function(){e.trigger({type:"hidden.bs.tab",relatedTarget:b[0]}),b.trigger({type:"shown.bs.tab",relatedTarget:e[0]})})}}},c.prototype.activate=function(b,d,e){function f(){g.removeClass("active").find("> .dropdown-menu > .active").removeClass("active").end().find('[data-toggle="tab"]').attr("aria-expanded",!1),b.addClass("active").find('[data-toggle="tab"]').attr("aria-expanded",!0),h?(b[0].offsetWidth,b.addClass("in")):b.removeClass("fade"),b.parent(".dropdown-menu")&&b.closest("li.dropdown").addClass("active").end().find('[data-toggle="tab"]').attr("aria-expanded",!0),e&&e() +}var g=d.find("> .active"),h=e&&a.support.transition&&(g.length&&g.hasClass("fade")||!!d.find("> .fade").length);g.length&&h?g.one("bsTransitionEnd",f).emulateTransitionEnd(c.TRANSITION_DURATION):f(),g.removeClass("in")};var d=a.fn.tab;a.fn.tab=b,a.fn.tab.Constructor=c,a.fn.tab.noConflict=function(){return a.fn.tab=d,this};var e=function(c){c.preventDefault(),b.call(a(this),"show")};a(document).on("click.bs.tab.data-api",'[data-toggle="tab"]',e).on("click.bs.tab.data-api",'[data-toggle="pill"]',e)}(jQuery),+function(a){"use strict";function b(b){return this.each(function(){var d=a(this),e=d.data("bs.affix"),f="object"==typeof b&&b;e||d.data("bs.affix",e=new c(this,f)),"string"==typeof b&&e[b]()})}var c=function(b,d){this.options=a.extend({},c.DEFAULTS,d),this.$target=a(this.options.target).on("scroll.bs.affix.data-api",a.proxy(this.checkPosition,this)).on("click.bs.affix.data-api",a.proxy(this.checkPositionWithEventLoop,this)),this.$element=a(b),this.affixed=this.unpin=this.pinnedOffset=null,this.checkPosition()};c.VERSION="3.3.2",c.RESET="affix affix-top affix-bottom",c.DEFAULTS={offset:0,target:window},c.prototype.getState=function(a,b,c,d){var e=this.$target.scrollTop(),f=this.$element.offset(),g=this.$target.height();if(null!=c&&"top"==this.affixed)return c>e?"top":!1;if("bottom"==this.affixed)return null!=c?e+this.unpin<=f.top?!1:"bottom":a-d>=e+g?!1:"bottom";var h=null==this.affixed,i=h?e:f.top,j=h?g:b;return null!=c&&c>=e?"top":null!=d&&i+j>=a-d?"bottom":!1},c.prototype.getPinnedOffset=function(){if(this.pinnedOffset)return this.pinnedOffset;this.$element.removeClass(c.RESET).addClass("affix");var a=this.$target.scrollTop(),b=this.$element.offset();return this.pinnedOffset=b.top-a},c.prototype.checkPositionWithEventLoop=function(){setTimeout(a.proxy(this.checkPosition,this),1)},c.prototype.checkPosition=function(){if(this.$element.is(":visible")){var b=this.$element.height(),d=this.options.offset,e=d.top,f=d.bottom,g=a("body").height();"object"!=typeof d&&(f=e=d),"function"==typeof e&&(e=d.top(this.$element)),"function"==typeof f&&(f=d.bottom(this.$element));var h=this.getState(g,b,e,f);if(this.affixed!=h){null!=this.unpin&&this.$element.css("top","");var i="affix"+(h?"-"+h:""),j=a.Event(i+".bs.affix");if(this.$element.trigger(j),j.isDefaultPrevented())return;this.affixed=h,this.unpin="bottom"==h?this.getPinnedOffset():null,this.$element.removeClass(c.RESET).addClass(i).trigger(i.replace("affix","affixed")+".bs.affix")}"bottom"==h&&this.$element.offset({top:g-b-f})}};var d=a.fn.affix;a.fn.affix=b,a.fn.affix.Constructor=c,a.fn.affix.noConflict=function(){return a.fn.affix=d,this},a(window).on("load",function(){a('[data-spy="affix"]').each(function(){var c=a(this),d=c.data();d.offset=d.offset||{},null!=d.offsetBottom&&(d.offset.bottom=d.offsetBottom),null!=d.offsetTop&&(d.offset.top=d.offsetTop),b.call(c,d)})})}(jQuery); \ No newline at end of file diff --git a/js/custom.js b/js/custom.js new file mode 100755 index 0000000..8f621b2 --- /dev/null +++ b/js/custom.js @@ -0,0 +1,122 @@ +$(document).ready(function(){ + $('.single-item').slick({ + infinite: true, + dots: true, + autoplay: true, + autoplaySpeed: 7000, + slidesToShow: 1, + slidesToScroll: 1 + }); + + new WOW().init(); + materials(); + + $(".nav-btn").click(function(){ + $(".nav-link").slideToggle(); + }); + $(".nav-link .nav-ul > li.sub-menu").each(function() { + $(this).children("a").after(""); + }); + $(".nav-link .nav-ul li.sub-menu span").click(function(){ + if($(this).next("ul").is(":visible")) + { + $(this).next("ul").slideUp(); + $(this).children(".fa").addClass("fa-angle-down").removeClass("fa-angle-up"); + } + else + { + $(".nav-link .nav-ul li.sub-menu ul").slideUp(); + $(".nav-link .nav-ul li.sub-menu .fa").addClass("fa-angle-down").removeClass("fa-angle-up"); + $(this).children(".fa").addClass("fa-angle-up").removeClass("fa-angle-down"); + $(this).next("ul").slideDown(); + } + }); + + + // Parallex js + $.fn.parallax = function(options) { + var windowHeight = $(window).height(); + // Establish default settings + var settings = $.extend({ + speed : 0.5 + }, options); + // Iterate over each object in collection + return this.each( function() { + // Save a reference to the element + var $this = $(this); + // Set up Scroll Handler + $(document).scroll(function(){ + var scrollTop = $(window).scrollTop(); + var offset = $this.offset().top; + var height = $this.outerHeight(); + // Check if above or below viewport + if (offset + height <= scrollTop || offset >= scrollTop + windowHeight) { + return; + } + var yBgPosition = Math.round((offset - scrollTop) * settings.speed); + // Apply the Y Background Position to Set the Parallax Effect + $this.css('background-position', 'center ' + yBgPosition + 'px'); + }); + }); + } + // Parallax call + $('.our-markets').parallax({ + speed : 0.5 + }); + + + +}); + + +$('#myModal').on('hidden.bs.modal', function () { + location.reload(); +}); +/*$(document).ready(function(){ + $('.venobox').venobox(); +});*/ + +function materials(){ + $(".video-thumb").click(function(){ + $("body").addClass("video-open"); + $(".video-popup").slideDown(); + }); + $(".close-btn").click(function(){ + $(".video-popup").slideUp(); + $("body").removeClass("video-open"); + }); +} + +$(window).load (function() { + $(function() { + $(".logo-carousel ul").carouFredSel({ + items: { + visible: 5, + minimum: 7 + }, + scroll: { + pauseOnHover: 'immediate', + easing: 'linear', + duration: 20000 + }, + auto: { + timeoutDuration: 0 + }, + swipe: true, + width: "100%" + }); + }); +}); + + +/*$(window).scroll(function(){ + if($(window).scrollTop() > 700 ) + { + $("body").addClass("sticky"); + } + else + { + $("body").removeClass("sticky"); + } +});*/ + diff --git a/js/jquery-1.11.2.min.js b/js/jquery-1.11.2.min.js new file mode 100755 index 0000000..45581e3 --- /dev/null +++ b/js/jquery-1.11.2.min.js @@ -0,0 +1,4 @@ +/*! jQuery v1.11.2 | (c) 2005, 2014 jQuery Foundation, Inc. | jquery.org/license */ +!function(a,b){"object"==typeof module&&"object"==typeof module.exports?module.exports=a.document?b(a,!0):function(a){if(!a.document)throw new Error("jQuery requires a window with a document");return b(a)}:b(a)}("undefined"!=typeof window?window:this,function(a,b){var c=[],d=c.slice,e=c.concat,f=c.push,g=c.indexOf,h={},i=h.toString,j=h.hasOwnProperty,k={},l="1.11.2",m=function(a,b){return new m.fn.init(a,b)},n=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,o=/^-ms-/,p=/-([\da-z])/gi,q=function(a,b){return b.toUpperCase()};m.fn=m.prototype={jquery:l,constructor:m,selector:"",length:0,toArray:function(){return d.call(this)},get:function(a){return null!=a?0>a?this[a+this.length]:this[a]:d.call(this)},pushStack:function(a){var b=m.merge(this.constructor(),a);return b.prevObject=this,b.context=this.context,b},each:function(a,b){return m.each(this,a,b)},map:function(a){return this.pushStack(m.map(this,function(b,c){return a.call(b,c,b)}))},slice:function(){return this.pushStack(d.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(a){var b=this.length,c=+a+(0>a?b:0);return this.pushStack(c>=0&&b>c?[this[c]]:[])},end:function(){return this.prevObject||this.constructor(null)},push:f,sort:c.sort,splice:c.splice},m.extend=m.fn.extend=function(){var a,b,c,d,e,f,g=arguments[0]||{},h=1,i=arguments.length,j=!1;for("boolean"==typeof g&&(j=g,g=arguments[h]||{},h++),"object"==typeof g||m.isFunction(g)||(g={}),h===i&&(g=this,h--);i>h;h++)if(null!=(e=arguments[h]))for(d in e)a=g[d],c=e[d],g!==c&&(j&&c&&(m.isPlainObject(c)||(b=m.isArray(c)))?(b?(b=!1,f=a&&m.isArray(a)?a:[]):f=a&&m.isPlainObject(a)?a:{},g[d]=m.extend(j,f,c)):void 0!==c&&(g[d]=c));return g},m.extend({expando:"jQuery"+(l+Math.random()).replace(/\D/g,""),isReady:!0,error:function(a){throw new Error(a)},noop:function(){},isFunction:function(a){return"function"===m.type(a)},isArray:Array.isArray||function(a){return"array"===m.type(a)},isWindow:function(a){return null!=a&&a==a.window},isNumeric:function(a){return!m.isArray(a)&&a-parseFloat(a)+1>=0},isEmptyObject:function(a){var b;for(b in a)return!1;return!0},isPlainObject:function(a){var b;if(!a||"object"!==m.type(a)||a.nodeType||m.isWindow(a))return!1;try{if(a.constructor&&!j.call(a,"constructor")&&!j.call(a.constructor.prototype,"isPrototypeOf"))return!1}catch(c){return!1}if(k.ownLast)for(b in a)return j.call(a,b);for(b in a);return void 0===b||j.call(a,b)},type:function(a){return null==a?a+"":"object"==typeof a||"function"==typeof a?h[i.call(a)]||"object":typeof a},globalEval:function(b){b&&m.trim(b)&&(a.execScript||function(b){a.eval.call(a,b)})(b)},camelCase:function(a){return a.replace(o,"ms-").replace(p,q)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toLowerCase()===b.toLowerCase()},each:function(a,b,c){var d,e=0,f=a.length,g=r(a);if(c){if(g){for(;f>e;e++)if(d=b.apply(a[e],c),d===!1)break}else for(e in a)if(d=b.apply(a[e],c),d===!1)break}else if(g){for(;f>e;e++)if(d=b.call(a[e],e,a[e]),d===!1)break}else for(e in a)if(d=b.call(a[e],e,a[e]),d===!1)break;return a},trim:function(a){return null==a?"":(a+"").replace(n,"")},makeArray:function(a,b){var c=b||[];return null!=a&&(r(Object(a))?m.merge(c,"string"==typeof a?[a]:a):f.call(c,a)),c},inArray:function(a,b,c){var d;if(b){if(g)return g.call(b,a,c);for(d=b.length,c=c?0>c?Math.max(0,d+c):c:0;d>c;c++)if(c in b&&b[c]===a)return c}return-1},merge:function(a,b){var c=+b.length,d=0,e=a.length;while(c>d)a[e++]=b[d++];if(c!==c)while(void 0!==b[d])a[e++]=b[d++];return a.length=e,a},grep:function(a,b,c){for(var d,e=[],f=0,g=a.length,h=!c;g>f;f++)d=!b(a[f],f),d!==h&&e.push(a[f]);return e},map:function(a,b,c){var d,f=0,g=a.length,h=r(a),i=[];if(h)for(;g>f;f++)d=b(a[f],f,c),null!=d&&i.push(d);else for(f in a)d=b(a[f],f,c),null!=d&&i.push(d);return e.apply([],i)},guid:1,proxy:function(a,b){var c,e,f;return"string"==typeof b&&(f=a[b],b=a,a=f),m.isFunction(a)?(c=d.call(arguments,2),e=function(){return a.apply(b||this,c.concat(d.call(arguments)))},e.guid=a.guid=a.guid||m.guid++,e):void 0},now:function(){return+new Date},support:k}),m.each("Boolean Number String Function Array Date RegExp Object Error".split(" "),function(a,b){h["[object "+b+"]"]=b.toLowerCase()});function r(a){var b=a.length,c=m.type(a);return"function"===c||m.isWindow(a)?!1:1===a.nodeType&&b?!0:"array"===c||0===b||"number"==typeof b&&b>0&&b-1 in a}var s=function(a){var b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u="sizzle"+1*new Date,v=a.document,w=0,x=0,y=hb(),z=hb(),A=hb(),B=function(a,b){return a===b&&(l=!0),0},C=1<<31,D={}.hasOwnProperty,E=[],F=E.pop,G=E.push,H=E.push,I=E.slice,J=function(a,b){for(var c=0,d=a.length;d>c;c++)if(a[c]===b)return c;return-1},K="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",L="[\\x20\\t\\r\\n\\f]",M="(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",N=M.replace("w","w#"),O="\\["+L+"*("+M+")(?:"+L+"*([*^$|!~]?=)"+L+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+N+"))|)"+L+"*\\]",P=":("+M+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+O+")*)|.*)\\)|)",Q=new RegExp(L+"+","g"),R=new RegExp("^"+L+"+|((?:^|[^\\\\])(?:\\\\.)*)"+L+"+$","g"),S=new RegExp("^"+L+"*,"+L+"*"),T=new RegExp("^"+L+"*([>+~]|"+L+")"+L+"*"),U=new RegExp("="+L+"*([^\\]'\"]*?)"+L+"*\\]","g"),V=new RegExp(P),W=new RegExp("^"+N+"$"),X={ID:new RegExp("^#("+M+")"),CLASS:new RegExp("^\\.("+M+")"),TAG:new RegExp("^("+M.replace("w","w*")+")"),ATTR:new RegExp("^"+O),PSEUDO:new RegExp("^"+P),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+L+"*(even|odd|(([+-]|)(\\d*)n|)"+L+"*(?:([+-]|)"+L+"*(\\d+)|))"+L+"*\\)|)","i"),bool:new RegExp("^(?:"+K+")$","i"),needsContext:new RegExp("^"+L+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+L+"*((?:-\\d)?\\d*)"+L+"*\\)|)(?=[^-]|$)","i")},Y=/^(?:input|select|textarea|button)$/i,Z=/^h\d$/i,$=/^[^{]+\{\s*\[native \w/,_=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,ab=/[+~]/,bb=/'|\\/g,cb=new RegExp("\\\\([\\da-f]{1,6}"+L+"?|("+L+")|.)","ig"),db=function(a,b,c){var d="0x"+b-65536;return d!==d||c?b:0>d?String.fromCharCode(d+65536):String.fromCharCode(d>>10|55296,1023&d|56320)},eb=function(){m()};try{H.apply(E=I.call(v.childNodes),v.childNodes),E[v.childNodes.length].nodeType}catch(fb){H={apply:E.length?function(a,b){G.apply(a,I.call(b))}:function(a,b){var c=a.length,d=0;while(a[c++]=b[d++]);a.length=c-1}}}function gb(a,b,d,e){var f,h,j,k,l,o,r,s,w,x;if((b?b.ownerDocument||b:v)!==n&&m(b),b=b||n,d=d||[],k=b.nodeType,"string"!=typeof a||!a||1!==k&&9!==k&&11!==k)return d;if(!e&&p){if(11!==k&&(f=_.exec(a)))if(j=f[1]){if(9===k){if(h=b.getElementById(j),!h||!h.parentNode)return d;if(h.id===j)return d.push(h),d}else if(b.ownerDocument&&(h=b.ownerDocument.getElementById(j))&&t(b,h)&&h.id===j)return d.push(h),d}else{if(f[2])return H.apply(d,b.getElementsByTagName(a)),d;if((j=f[3])&&c.getElementsByClassName)return H.apply(d,b.getElementsByClassName(j)),d}if(c.qsa&&(!q||!q.test(a))){if(s=r=u,w=b,x=1!==k&&a,1===k&&"object"!==b.nodeName.toLowerCase()){o=g(a),(r=b.getAttribute("id"))?s=r.replace(bb,"\\$&"):b.setAttribute("id",s),s="[id='"+s+"'] ",l=o.length;while(l--)o[l]=s+rb(o[l]);w=ab.test(a)&&pb(b.parentNode)||b,x=o.join(",")}if(x)try{return H.apply(d,w.querySelectorAll(x)),d}catch(y){}finally{r||b.removeAttribute("id")}}}return i(a.replace(R,"$1"),b,d,e)}function hb(){var a=[];function b(c,e){return a.push(c+" ")>d.cacheLength&&delete b[a.shift()],b[c+" "]=e}return b}function ib(a){return a[u]=!0,a}function jb(a){var b=n.createElement("div");try{return!!a(b)}catch(c){return!1}finally{b.parentNode&&b.parentNode.removeChild(b),b=null}}function kb(a,b){var c=a.split("|"),e=a.length;while(e--)d.attrHandle[c[e]]=b}function lb(a,b){var c=b&&a,d=c&&1===a.nodeType&&1===b.nodeType&&(~b.sourceIndex||C)-(~a.sourceIndex||C);if(d)return d;if(c)while(c=c.nextSibling)if(c===b)return-1;return a?1:-1}function mb(a){return function(b){var c=b.nodeName.toLowerCase();return"input"===c&&b.type===a}}function nb(a){return function(b){var c=b.nodeName.toLowerCase();return("input"===c||"button"===c)&&b.type===a}}function ob(a){return ib(function(b){return b=+b,ib(function(c,d){var e,f=a([],c.length,b),g=f.length;while(g--)c[e=f[g]]&&(c[e]=!(d[e]=c[e]))})})}function pb(a){return a&&"undefined"!=typeof a.getElementsByTagName&&a}c=gb.support={},f=gb.isXML=function(a){var b=a&&(a.ownerDocument||a).documentElement;return b?"HTML"!==b.nodeName:!1},m=gb.setDocument=function(a){var b,e,g=a?a.ownerDocument||a:v;return g!==n&&9===g.nodeType&&g.documentElement?(n=g,o=g.documentElement,e=g.defaultView,e&&e!==e.top&&(e.addEventListener?e.addEventListener("unload",eb,!1):e.attachEvent&&e.attachEvent("onunload",eb)),p=!f(g),c.attributes=jb(function(a){return a.className="i",!a.getAttribute("className")}),c.getElementsByTagName=jb(function(a){return a.appendChild(g.createComment("")),!a.getElementsByTagName("*").length}),c.getElementsByClassName=$.test(g.getElementsByClassName),c.getById=jb(function(a){return o.appendChild(a).id=u,!g.getElementsByName||!g.getElementsByName(u).length}),c.getById?(d.find.ID=function(a,b){if("undefined"!=typeof b.getElementById&&p){var c=b.getElementById(a);return c&&c.parentNode?[c]:[]}},d.filter.ID=function(a){var b=a.replace(cb,db);return function(a){return a.getAttribute("id")===b}}):(delete d.find.ID,d.filter.ID=function(a){var b=a.replace(cb,db);return function(a){var c="undefined"!=typeof a.getAttributeNode&&a.getAttributeNode("id");return c&&c.value===b}}),d.find.TAG=c.getElementsByTagName?function(a,b){return"undefined"!=typeof b.getElementsByTagName?b.getElementsByTagName(a):c.qsa?b.querySelectorAll(a):void 0}:function(a,b){var c,d=[],e=0,f=b.getElementsByTagName(a);if("*"===a){while(c=f[e++])1===c.nodeType&&d.push(c);return d}return f},d.find.CLASS=c.getElementsByClassName&&function(a,b){return p?b.getElementsByClassName(a):void 0},r=[],q=[],(c.qsa=$.test(g.querySelectorAll))&&(jb(function(a){o.appendChild(a).innerHTML="",a.querySelectorAll("[msallowcapture^='']").length&&q.push("[*^$]="+L+"*(?:''|\"\")"),a.querySelectorAll("[selected]").length||q.push("\\["+L+"*(?:value|"+K+")"),a.querySelectorAll("[id~="+u+"-]").length||q.push("~="),a.querySelectorAll(":checked").length||q.push(":checked"),a.querySelectorAll("a#"+u+"+*").length||q.push(".#.+[+~]")}),jb(function(a){var b=g.createElement("input");b.setAttribute("type","hidden"),a.appendChild(b).setAttribute("name","D"),a.querySelectorAll("[name=d]").length&&q.push("name"+L+"*[*^$|!~]?="),a.querySelectorAll(":enabled").length||q.push(":enabled",":disabled"),a.querySelectorAll("*,:x"),q.push(",.*:")})),(c.matchesSelector=$.test(s=o.matches||o.webkitMatchesSelector||o.mozMatchesSelector||o.oMatchesSelector||o.msMatchesSelector))&&jb(function(a){c.disconnectedMatch=s.call(a,"div"),s.call(a,"[s!='']:x"),r.push("!=",P)}),q=q.length&&new RegExp(q.join("|")),r=r.length&&new RegExp(r.join("|")),b=$.test(o.compareDocumentPosition),t=b||$.test(o.contains)?function(a,b){var c=9===a.nodeType?a.documentElement:a,d=b&&b.parentNode;return a===d||!(!d||1!==d.nodeType||!(c.contains?c.contains(d):a.compareDocumentPosition&&16&a.compareDocumentPosition(d)))}:function(a,b){if(b)while(b=b.parentNode)if(b===a)return!0;return!1},B=b?function(a,b){if(a===b)return l=!0,0;var d=!a.compareDocumentPosition-!b.compareDocumentPosition;return d?d:(d=(a.ownerDocument||a)===(b.ownerDocument||b)?a.compareDocumentPosition(b):1,1&d||!c.sortDetached&&b.compareDocumentPosition(a)===d?a===g||a.ownerDocument===v&&t(v,a)?-1:b===g||b.ownerDocument===v&&t(v,b)?1:k?J(k,a)-J(k,b):0:4&d?-1:1)}:function(a,b){if(a===b)return l=!0,0;var c,d=0,e=a.parentNode,f=b.parentNode,h=[a],i=[b];if(!e||!f)return a===g?-1:b===g?1:e?-1:f?1:k?J(k,a)-J(k,b):0;if(e===f)return lb(a,b);c=a;while(c=c.parentNode)h.unshift(c);c=b;while(c=c.parentNode)i.unshift(c);while(h[d]===i[d])d++;return d?lb(h[d],i[d]):h[d]===v?-1:i[d]===v?1:0},g):n},gb.matches=function(a,b){return gb(a,null,null,b)},gb.matchesSelector=function(a,b){if((a.ownerDocument||a)!==n&&m(a),b=b.replace(U,"='$1']"),!(!c.matchesSelector||!p||r&&r.test(b)||q&&q.test(b)))try{var d=s.call(a,b);if(d||c.disconnectedMatch||a.document&&11!==a.document.nodeType)return d}catch(e){}return gb(b,n,null,[a]).length>0},gb.contains=function(a,b){return(a.ownerDocument||a)!==n&&m(a),t(a,b)},gb.attr=function(a,b){(a.ownerDocument||a)!==n&&m(a);var e=d.attrHandle[b.toLowerCase()],f=e&&D.call(d.attrHandle,b.toLowerCase())?e(a,b,!p):void 0;return void 0!==f?f:c.attributes||!p?a.getAttribute(b):(f=a.getAttributeNode(b))&&f.specified?f.value:null},gb.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)},gb.uniqueSort=function(a){var b,d=[],e=0,f=0;if(l=!c.detectDuplicates,k=!c.sortStable&&a.slice(0),a.sort(B),l){while(b=a[f++])b===a[f]&&(e=d.push(f));while(e--)a.splice(d[e],1)}return k=null,a},e=gb.getText=function(a){var b,c="",d=0,f=a.nodeType;if(f){if(1===f||9===f||11===f){if("string"==typeof a.textContent)return a.textContent;for(a=a.firstChild;a;a=a.nextSibling)c+=e(a)}else if(3===f||4===f)return a.nodeValue}else while(b=a[d++])c+=e(b);return c},d=gb.selectors={cacheLength:50,createPseudo:ib,match:X,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(a){return a[1]=a[1].replace(cb,db),a[3]=(a[3]||a[4]||a[5]||"").replace(cb,db),"~="===a[2]&&(a[3]=" "+a[3]+" "),a.slice(0,4)},CHILD:function(a){return a[1]=a[1].toLowerCase(),"nth"===a[1].slice(0,3)?(a[3]||gb.error(a[0]),a[4]=+(a[4]?a[5]+(a[6]||1):2*("even"===a[3]||"odd"===a[3])),a[5]=+(a[7]+a[8]||"odd"===a[3])):a[3]&&gb.error(a[0]),a},PSEUDO:function(a){var b,c=!a[6]&&a[2];return X.CHILD.test(a[0])?null:(a[3]?a[2]=a[4]||a[5]||"":c&&V.test(c)&&(b=g(c,!0))&&(b=c.indexOf(")",c.length-b)-c.length)&&(a[0]=a[0].slice(0,b),a[2]=c.slice(0,b)),a.slice(0,3))}},filter:{TAG:function(a){var b=a.replace(cb,db).toLowerCase();return"*"===a?function(){return!0}:function(a){return a.nodeName&&a.nodeName.toLowerCase()===b}},CLASS:function(a){var b=y[a+" "];return b||(b=new RegExp("(^|"+L+")"+a+"("+L+"|$)"))&&y(a,function(a){return b.test("string"==typeof a.className&&a.className||"undefined"!=typeof a.getAttribute&&a.getAttribute("class")||"")})},ATTR:function(a,b,c){return function(d){var e=gb.attr(d,a);return null==e?"!="===b:b?(e+="","="===b?e===c:"!="===b?e!==c:"^="===b?c&&0===e.indexOf(c):"*="===b?c&&e.indexOf(c)>-1:"$="===b?c&&e.slice(-c.length)===c:"~="===b?(" "+e.replace(Q," ")+" ").indexOf(c)>-1:"|="===b?e===c||e.slice(0,c.length+1)===c+"-":!1):!0}},CHILD:function(a,b,c,d,e){var f="nth"!==a.slice(0,3),g="last"!==a.slice(-4),h="of-type"===b;return 1===d&&0===e?function(a){return!!a.parentNode}:function(b,c,i){var j,k,l,m,n,o,p=f!==g?"nextSibling":"previousSibling",q=b.parentNode,r=h&&b.nodeName.toLowerCase(),s=!i&&!h;if(q){if(f){while(p){l=b;while(l=l[p])if(h?l.nodeName.toLowerCase()===r:1===l.nodeType)return!1;o=p="only"===a&&!o&&"nextSibling"}return!0}if(o=[g?q.firstChild:q.lastChild],g&&s){k=q[u]||(q[u]={}),j=k[a]||[],n=j[0]===w&&j[1],m=j[0]===w&&j[2],l=n&&q.childNodes[n];while(l=++n&&l&&l[p]||(m=n=0)||o.pop())if(1===l.nodeType&&++m&&l===b){k[a]=[w,n,m];break}}else if(s&&(j=(b[u]||(b[u]={}))[a])&&j[0]===w)m=j[1];else while(l=++n&&l&&l[p]||(m=n=0)||o.pop())if((h?l.nodeName.toLowerCase()===r:1===l.nodeType)&&++m&&(s&&((l[u]||(l[u]={}))[a]=[w,m]),l===b))break;return m-=e,m===d||m%d===0&&m/d>=0}}},PSEUDO:function(a,b){var c,e=d.pseudos[a]||d.setFilters[a.toLowerCase()]||gb.error("unsupported pseudo: "+a);return e[u]?e(b):e.length>1?(c=[a,a,"",b],d.setFilters.hasOwnProperty(a.toLowerCase())?ib(function(a,c){var d,f=e(a,b),g=f.length;while(g--)d=J(a,f[g]),a[d]=!(c[d]=f[g])}):function(a){return e(a,0,c)}):e}},pseudos:{not:ib(function(a){var b=[],c=[],d=h(a.replace(R,"$1"));return d[u]?ib(function(a,b,c,e){var f,g=d(a,null,e,[]),h=a.length;while(h--)(f=g[h])&&(a[h]=!(b[h]=f))}):function(a,e,f){return b[0]=a,d(b,null,f,c),b[0]=null,!c.pop()}}),has:ib(function(a){return function(b){return gb(a,b).length>0}}),contains:ib(function(a){return a=a.replace(cb,db),function(b){return(b.textContent||b.innerText||e(b)).indexOf(a)>-1}}),lang:ib(function(a){return W.test(a||"")||gb.error("unsupported lang: "+a),a=a.replace(cb,db).toLowerCase(),function(b){var c;do if(c=p?b.lang:b.getAttribute("xml:lang")||b.getAttribute("lang"))return c=c.toLowerCase(),c===a||0===c.indexOf(a+"-");while((b=b.parentNode)&&1===b.nodeType);return!1}}),target:function(b){var c=a.location&&a.location.hash;return c&&c.slice(1)===b.id},root:function(a){return a===o},focus:function(a){return a===n.activeElement&&(!n.hasFocus||n.hasFocus())&&!!(a.type||a.href||~a.tabIndex)},enabled:function(a){return a.disabled===!1},disabled:function(a){return a.disabled===!0},checked:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&!!a.checked||"option"===b&&!!a.selected},selected:function(a){return a.parentNode&&a.parentNode.selectedIndex,a.selected===!0},empty:function(a){for(a=a.firstChild;a;a=a.nextSibling)if(a.nodeType<6)return!1;return!0},parent:function(a){return!d.pseudos.empty(a)},header:function(a){return Z.test(a.nodeName)},input:function(a){return Y.test(a.nodeName)},button:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&"button"===a.type||"button"===b},text:function(a){var b;return"input"===a.nodeName.toLowerCase()&&"text"===a.type&&(null==(b=a.getAttribute("type"))||"text"===b.toLowerCase())},first:ob(function(){return[0]}),last:ob(function(a,b){return[b-1]}),eq:ob(function(a,b,c){return[0>c?c+b:c]}),even:ob(function(a,b){for(var c=0;b>c;c+=2)a.push(c);return a}),odd:ob(function(a,b){for(var c=1;b>c;c+=2)a.push(c);return a}),lt:ob(function(a,b,c){for(var d=0>c?c+b:c;--d>=0;)a.push(d);return a}),gt:ob(function(a,b,c){for(var d=0>c?c+b:c;++db;b++)d+=a[b].value;return d}function sb(a,b,c){var d=b.dir,e=c&&"parentNode"===d,f=x++;return b.first?function(b,c,f){while(b=b[d])if(1===b.nodeType||e)return a(b,c,f)}:function(b,c,g){var h,i,j=[w,f];if(g){while(b=b[d])if((1===b.nodeType||e)&&a(b,c,g))return!0}else while(b=b[d])if(1===b.nodeType||e){if(i=b[u]||(b[u]={}),(h=i[d])&&h[0]===w&&h[1]===f)return j[2]=h[2];if(i[d]=j,j[2]=a(b,c,g))return!0}}}function tb(a){return a.length>1?function(b,c,d){var e=a.length;while(e--)if(!a[e](b,c,d))return!1;return!0}:a[0]}function ub(a,b,c){for(var d=0,e=b.length;e>d;d++)gb(a,b[d],c);return c}function vb(a,b,c,d,e){for(var f,g=[],h=0,i=a.length,j=null!=b;i>h;h++)(f=a[h])&&(!c||c(f,d,e))&&(g.push(f),j&&b.push(h));return g}function wb(a,b,c,d,e,f){return d&&!d[u]&&(d=wb(d)),e&&!e[u]&&(e=wb(e,f)),ib(function(f,g,h,i){var j,k,l,m=[],n=[],o=g.length,p=f||ub(b||"*",h.nodeType?[h]:h,[]),q=!a||!f&&b?p:vb(p,m,a,h,i),r=c?e||(f?a:o||d)?[]:g:q;if(c&&c(q,r,h,i),d){j=vb(r,n),d(j,[],h,i),k=j.length;while(k--)(l=j[k])&&(r[n[k]]=!(q[n[k]]=l))}if(f){if(e||a){if(e){j=[],k=r.length;while(k--)(l=r[k])&&j.push(q[k]=l);e(null,r=[],j,i)}k=r.length;while(k--)(l=r[k])&&(j=e?J(f,l):m[k])>-1&&(f[j]=!(g[j]=l))}}else r=vb(r===g?r.splice(o,r.length):r),e?e(null,g,r,i):H.apply(g,r)})}function xb(a){for(var b,c,e,f=a.length,g=d.relative[a[0].type],h=g||d.relative[" "],i=g?1:0,k=sb(function(a){return a===b},h,!0),l=sb(function(a){return J(b,a)>-1},h,!0),m=[function(a,c,d){var e=!g&&(d||c!==j)||((b=c).nodeType?k(a,c,d):l(a,c,d));return b=null,e}];f>i;i++)if(c=d.relative[a[i].type])m=[sb(tb(m),c)];else{if(c=d.filter[a[i].type].apply(null,a[i].matches),c[u]){for(e=++i;f>e;e++)if(d.relative[a[e].type])break;return wb(i>1&&tb(m),i>1&&rb(a.slice(0,i-1).concat({value:" "===a[i-2].type?"*":""})).replace(R,"$1"),c,e>i&&xb(a.slice(i,e)),f>e&&xb(a=a.slice(e)),f>e&&rb(a))}m.push(c)}return tb(m)}function yb(a,b){var c=b.length>0,e=a.length>0,f=function(f,g,h,i,k){var l,m,o,p=0,q="0",r=f&&[],s=[],t=j,u=f||e&&d.find.TAG("*",k),v=w+=null==t?1:Math.random()||.1,x=u.length;for(k&&(j=g!==n&&g);q!==x&&null!=(l=u[q]);q++){if(e&&l){m=0;while(o=a[m++])if(o(l,g,h)){i.push(l);break}k&&(w=v)}c&&((l=!o&&l)&&p--,f&&r.push(l))}if(p+=q,c&&q!==p){m=0;while(o=b[m++])o(r,s,g,h);if(f){if(p>0)while(q--)r[q]||s[q]||(s[q]=F.call(i));s=vb(s)}H.apply(i,s),k&&!f&&s.length>0&&p+b.length>1&&gb.uniqueSort(i)}return k&&(w=v,j=t),r};return c?ib(f):f}return h=gb.compile=function(a,b){var c,d=[],e=[],f=A[a+" "];if(!f){b||(b=g(a)),c=b.length;while(c--)f=xb(b[c]),f[u]?d.push(f):e.push(f);f=A(a,yb(e,d)),f.selector=a}return f},i=gb.select=function(a,b,e,f){var i,j,k,l,m,n="function"==typeof a&&a,o=!f&&g(a=n.selector||a);if(e=e||[],1===o.length){if(j=o[0]=o[0].slice(0),j.length>2&&"ID"===(k=j[0]).type&&c.getById&&9===b.nodeType&&p&&d.relative[j[1].type]){if(b=(d.find.ID(k.matches[0].replace(cb,db),b)||[])[0],!b)return e;n&&(b=b.parentNode),a=a.slice(j.shift().value.length)}i=X.needsContext.test(a)?0:j.length;while(i--){if(k=j[i],d.relative[l=k.type])break;if((m=d.find[l])&&(f=m(k.matches[0].replace(cb,db),ab.test(j[0].type)&&pb(b.parentNode)||b))){if(j.splice(i,1),a=f.length&&rb(j),!a)return H.apply(e,f),e;break}}}return(n||h(a,o))(f,b,!p,e,ab.test(a)&&pb(b.parentNode)||b),e},c.sortStable=u.split("").sort(B).join("")===u,c.detectDuplicates=!!l,m(),c.sortDetached=jb(function(a){return 1&a.compareDocumentPosition(n.createElement("div"))}),jb(function(a){return a.innerHTML="","#"===a.firstChild.getAttribute("href")})||kb("type|href|height|width",function(a,b,c){return c?void 0:a.getAttribute(b,"type"===b.toLowerCase()?1:2)}),c.attributes&&jb(function(a){return a.innerHTML="",a.firstChild.setAttribute("value",""),""===a.firstChild.getAttribute("value")})||kb("value",function(a,b,c){return c||"input"!==a.nodeName.toLowerCase()?void 0:a.defaultValue}),jb(function(a){return null==a.getAttribute("disabled")})||kb(K,function(a,b,c){var d;return c?void 0:a[b]===!0?b.toLowerCase():(d=a.getAttributeNode(b))&&d.specified?d.value:null}),gb}(a);m.find=s,m.expr=s.selectors,m.expr[":"]=m.expr.pseudos,m.unique=s.uniqueSort,m.text=s.getText,m.isXMLDoc=s.isXML,m.contains=s.contains;var t=m.expr.match.needsContext,u=/^<(\w+)\s*\/?>(?:<\/\1>|)$/,v=/^.[^:#\[\.,]*$/;function w(a,b,c){if(m.isFunction(b))return m.grep(a,function(a,d){return!!b.call(a,d,a)!==c});if(b.nodeType)return m.grep(a,function(a){return a===b!==c});if("string"==typeof b){if(v.test(b))return m.filter(b,a,c);b=m.filter(b,a)}return m.grep(a,function(a){return m.inArray(a,b)>=0!==c})}m.filter=function(a,b,c){var d=b[0];return c&&(a=":not("+a+")"),1===b.length&&1===d.nodeType?m.find.matchesSelector(d,a)?[d]:[]:m.find.matches(a,m.grep(b,function(a){return 1===a.nodeType}))},m.fn.extend({find:function(a){var b,c=[],d=this,e=d.length;if("string"!=typeof a)return this.pushStack(m(a).filter(function(){for(b=0;e>b;b++)if(m.contains(d[b],this))return!0}));for(b=0;e>b;b++)m.find(a,d[b],c);return c=this.pushStack(e>1?m.unique(c):c),c.selector=this.selector?this.selector+" "+a:a,c},filter:function(a){return this.pushStack(w(this,a||[],!1))},not:function(a){return this.pushStack(w(this,a||[],!0))},is:function(a){return!!w(this,"string"==typeof a&&t.test(a)?m(a):a||[],!1).length}});var x,y=a.document,z=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/,A=m.fn.init=function(a,b){var c,d;if(!a)return this;if("string"==typeof a){if(c="<"===a.charAt(0)&&">"===a.charAt(a.length-1)&&a.length>=3?[null,a,null]:z.exec(a),!c||!c[1]&&b)return!b||b.jquery?(b||x).find(a):this.constructor(b).find(a);if(c[1]){if(b=b instanceof m?b[0]:b,m.merge(this,m.parseHTML(c[1],b&&b.nodeType?b.ownerDocument||b:y,!0)),u.test(c[1])&&m.isPlainObject(b))for(c in b)m.isFunction(this[c])?this[c](b[c]):this.attr(c,b[c]);return this}if(d=y.getElementById(c[2]),d&&d.parentNode){if(d.id!==c[2])return x.find(a);this.length=1,this[0]=d}return this.context=y,this.selector=a,this}return a.nodeType?(this.context=this[0]=a,this.length=1,this):m.isFunction(a)?"undefined"!=typeof x.ready?x.ready(a):a(m):(void 0!==a.selector&&(this.selector=a.selector,this.context=a.context),m.makeArray(a,this))};A.prototype=m.fn,x=m(y);var B=/^(?:parents|prev(?:Until|All))/,C={children:!0,contents:!0,next:!0,prev:!0};m.extend({dir:function(a,b,c){var d=[],e=a[b];while(e&&9!==e.nodeType&&(void 0===c||1!==e.nodeType||!m(e).is(c)))1===e.nodeType&&d.push(e),e=e[b];return d},sibling:function(a,b){for(var c=[];a;a=a.nextSibling)1===a.nodeType&&a!==b&&c.push(a);return c}}),m.fn.extend({has:function(a){var b,c=m(a,this),d=c.length;return this.filter(function(){for(b=0;d>b;b++)if(m.contains(this,c[b]))return!0})},closest:function(a,b){for(var c,d=0,e=this.length,f=[],g=t.test(a)||"string"!=typeof a?m(a,b||this.context):0;e>d;d++)for(c=this[d];c&&c!==b;c=c.parentNode)if(c.nodeType<11&&(g?g.index(c)>-1:1===c.nodeType&&m.find.matchesSelector(c,a))){f.push(c);break}return this.pushStack(f.length>1?m.unique(f):f)},index:function(a){return a?"string"==typeof a?m.inArray(this[0],m(a)):m.inArray(a.jquery?a[0]:a,this):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(a,b){return this.pushStack(m.unique(m.merge(this.get(),m(a,b))))},addBack:function(a){return this.add(null==a?this.prevObject:this.prevObject.filter(a))}});function D(a,b){do a=a[b];while(a&&1!==a.nodeType);return a}m.each({parent:function(a){var b=a.parentNode;return b&&11!==b.nodeType?b:null},parents:function(a){return m.dir(a,"parentNode")},parentsUntil:function(a,b,c){return m.dir(a,"parentNode",c)},next:function(a){return D(a,"nextSibling")},prev:function(a){return D(a,"previousSibling")},nextAll:function(a){return m.dir(a,"nextSibling")},prevAll:function(a){return m.dir(a,"previousSibling")},nextUntil:function(a,b,c){return m.dir(a,"nextSibling",c)},prevUntil:function(a,b,c){return m.dir(a,"previousSibling",c)},siblings:function(a){return m.sibling((a.parentNode||{}).firstChild,a)},children:function(a){return m.sibling(a.firstChild)},contents:function(a){return m.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:m.merge([],a.childNodes)}},function(a,b){m.fn[a]=function(c,d){var e=m.map(this,b,c);return"Until"!==a.slice(-5)&&(d=c),d&&"string"==typeof d&&(e=m.filter(d,e)),this.length>1&&(C[a]||(e=m.unique(e)),B.test(a)&&(e=e.reverse())),this.pushStack(e)}});var E=/\S+/g,F={};function G(a){var b=F[a]={};return m.each(a.match(E)||[],function(a,c){b[c]=!0}),b}m.Callbacks=function(a){a="string"==typeof a?F[a]||G(a):m.extend({},a);var b,c,d,e,f,g,h=[],i=!a.once&&[],j=function(l){for(c=a.memory&&l,d=!0,f=g||0,g=0,e=h.length,b=!0;h&&e>f;f++)if(h[f].apply(l[0],l[1])===!1&&a.stopOnFalse){c=!1;break}b=!1,h&&(i?i.length&&j(i.shift()):c?h=[]:k.disable())},k={add:function(){if(h){var d=h.length;!function f(b){m.each(b,function(b,c){var d=m.type(c);"function"===d?a.unique&&k.has(c)||h.push(c):c&&c.length&&"string"!==d&&f(c)})}(arguments),b?e=h.length:c&&(g=d,j(c))}return this},remove:function(){return h&&m.each(arguments,function(a,c){var d;while((d=m.inArray(c,h,d))>-1)h.splice(d,1),b&&(e>=d&&e--,f>=d&&f--)}),this},has:function(a){return a?m.inArray(a,h)>-1:!(!h||!h.length)},empty:function(){return h=[],e=0,this},disable:function(){return h=i=c=void 0,this},disabled:function(){return!h},lock:function(){return i=void 0,c||k.disable(),this},locked:function(){return!i},fireWith:function(a,c){return!h||d&&!i||(c=c||[],c=[a,c.slice?c.slice():c],b?i.push(c):j(c)),this},fire:function(){return k.fireWith(this,arguments),this},fired:function(){return!!d}};return k},m.extend({Deferred:function(a){var b=[["resolve","done",m.Callbacks("once memory"),"resolved"],["reject","fail",m.Callbacks("once memory"),"rejected"],["notify","progress",m.Callbacks("memory")]],c="pending",d={state:function(){return c},always:function(){return e.done(arguments).fail(arguments),this},then:function(){var a=arguments;return m.Deferred(function(c){m.each(b,function(b,f){var g=m.isFunction(a[b])&&a[b];e[f[1]](function(){var a=g&&g.apply(this,arguments);a&&m.isFunction(a.promise)?a.promise().done(c.resolve).fail(c.reject).progress(c.notify):c[f[0]+"With"](this===d?c.promise():this,g?[a]:arguments)})}),a=null}).promise()},promise:function(a){return null!=a?m.extend(a,d):d}},e={};return d.pipe=d.then,m.each(b,function(a,f){var g=f[2],h=f[3];d[f[1]]=g.add,h&&g.add(function(){c=h},b[1^a][2].disable,b[2][2].lock),e[f[0]]=function(){return e[f[0]+"With"](this===e?d:this,arguments),this},e[f[0]+"With"]=g.fireWith}),d.promise(e),a&&a.call(e,e),e},when:function(a){var b=0,c=d.call(arguments),e=c.length,f=1!==e||a&&m.isFunction(a.promise)?e:0,g=1===f?a:m.Deferred(),h=function(a,b,c){return function(e){b[a]=this,c[a]=arguments.length>1?d.call(arguments):e,c===i?g.notifyWith(b,c):--f||g.resolveWith(b,c)}},i,j,k;if(e>1)for(i=new Array(e),j=new Array(e),k=new Array(e);e>b;b++)c[b]&&m.isFunction(c[b].promise)?c[b].promise().done(h(b,k,c)).fail(g.reject).progress(h(b,j,i)):--f;return f||g.resolveWith(k,c),g.promise()}});var H;m.fn.ready=function(a){return m.ready.promise().done(a),this},m.extend({isReady:!1,readyWait:1,holdReady:function(a){a?m.readyWait++:m.ready(!0)},ready:function(a){if(a===!0?!--m.readyWait:!m.isReady){if(!y.body)return setTimeout(m.ready);m.isReady=!0,a!==!0&&--m.readyWait>0||(H.resolveWith(y,[m]),m.fn.triggerHandler&&(m(y).triggerHandler("ready"),m(y).off("ready")))}}});function I(){y.addEventListener?(y.removeEventListener("DOMContentLoaded",J,!1),a.removeEventListener("load",J,!1)):(y.detachEvent("onreadystatechange",J),a.detachEvent("onload",J))}function J(){(y.addEventListener||"load"===event.type||"complete"===y.readyState)&&(I(),m.ready())}m.ready.promise=function(b){if(!H)if(H=m.Deferred(),"complete"===y.readyState)setTimeout(m.ready);else if(y.addEventListener)y.addEventListener("DOMContentLoaded",J,!1),a.addEventListener("load",J,!1);else{y.attachEvent("onreadystatechange",J),a.attachEvent("onload",J);var c=!1;try{c=null==a.frameElement&&y.documentElement}catch(d){}c&&c.doScroll&&!function e(){if(!m.isReady){try{c.doScroll("left")}catch(a){return setTimeout(e,50)}I(),m.ready()}}()}return H.promise(b)};var K="undefined",L;for(L in m(k))break;k.ownLast="0"!==L,k.inlineBlockNeedsLayout=!1,m(function(){var a,b,c,d;c=y.getElementsByTagName("body")[0],c&&c.style&&(b=y.createElement("div"),d=y.createElement("div"),d.style.cssText="position:absolute;border:0;width:0;height:0;top:0;left:-9999px",c.appendChild(d).appendChild(b),typeof b.style.zoom!==K&&(b.style.cssText="display:inline;margin:0;border:0;padding:1px;width:1px;zoom:1",k.inlineBlockNeedsLayout=a=3===b.offsetWidth,a&&(c.style.zoom=1)),c.removeChild(d))}),function(){var a=y.createElement("div");if(null==k.deleteExpando){k.deleteExpando=!0;try{delete a.test}catch(b){k.deleteExpando=!1}}a=null}(),m.acceptData=function(a){var b=m.noData[(a.nodeName+" ").toLowerCase()],c=+a.nodeType||1;return 1!==c&&9!==c?!1:!b||b!==!0&&a.getAttribute("classid")===b};var M=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,N=/([A-Z])/g;function O(a,b,c){if(void 0===c&&1===a.nodeType){var d="data-"+b.replace(N,"-$1").toLowerCase();if(c=a.getAttribute(d),"string"==typeof c){try{c="true"===c?!0:"false"===c?!1:"null"===c?null:+c+""===c?+c:M.test(c)?m.parseJSON(c):c}catch(e){}m.data(a,b,c)}else c=void 0}return c}function P(a){var b;for(b in a)if(("data"!==b||!m.isEmptyObject(a[b]))&&"toJSON"!==b)return!1; +return!0}function Q(a,b,d,e){if(m.acceptData(a)){var f,g,h=m.expando,i=a.nodeType,j=i?m.cache:a,k=i?a[h]:a[h]&&h;if(k&&j[k]&&(e||j[k].data)||void 0!==d||"string"!=typeof b)return k||(k=i?a[h]=c.pop()||m.guid++:h),j[k]||(j[k]=i?{}:{toJSON:m.noop}),("object"==typeof b||"function"==typeof b)&&(e?j[k]=m.extend(j[k],b):j[k].data=m.extend(j[k].data,b)),g=j[k],e||(g.data||(g.data={}),g=g.data),void 0!==d&&(g[m.camelCase(b)]=d),"string"==typeof b?(f=g[b],null==f&&(f=g[m.camelCase(b)])):f=g,f}}function R(a,b,c){if(m.acceptData(a)){var d,e,f=a.nodeType,g=f?m.cache:a,h=f?a[m.expando]:m.expando;if(g[h]){if(b&&(d=c?g[h]:g[h].data)){m.isArray(b)?b=b.concat(m.map(b,m.camelCase)):b in d?b=[b]:(b=m.camelCase(b),b=b in d?[b]:b.split(" ")),e=b.length;while(e--)delete d[b[e]];if(c?!P(d):!m.isEmptyObject(d))return}(c||(delete g[h].data,P(g[h])))&&(f?m.cleanData([a],!0):k.deleteExpando||g!=g.window?delete g[h]:g[h]=null)}}}m.extend({cache:{},noData:{"applet ":!0,"embed ":!0,"object ":"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000"},hasData:function(a){return a=a.nodeType?m.cache[a[m.expando]]:a[m.expando],!!a&&!P(a)},data:function(a,b,c){return Q(a,b,c)},removeData:function(a,b){return R(a,b)},_data:function(a,b,c){return Q(a,b,c,!0)},_removeData:function(a,b){return R(a,b,!0)}}),m.fn.extend({data:function(a,b){var c,d,e,f=this[0],g=f&&f.attributes;if(void 0===a){if(this.length&&(e=m.data(f),1===f.nodeType&&!m._data(f,"parsedAttrs"))){c=g.length;while(c--)g[c]&&(d=g[c].name,0===d.indexOf("data-")&&(d=m.camelCase(d.slice(5)),O(f,d,e[d])));m._data(f,"parsedAttrs",!0)}return e}return"object"==typeof a?this.each(function(){m.data(this,a)}):arguments.length>1?this.each(function(){m.data(this,a,b)}):f?O(f,a,m.data(f,a)):void 0},removeData:function(a){return this.each(function(){m.removeData(this,a)})}}),m.extend({queue:function(a,b,c){var d;return a?(b=(b||"fx")+"queue",d=m._data(a,b),c&&(!d||m.isArray(c)?d=m._data(a,b,m.makeArray(c)):d.push(c)),d||[]):void 0},dequeue:function(a,b){b=b||"fx";var c=m.queue(a,b),d=c.length,e=c.shift(),f=m._queueHooks(a,b),g=function(){m.dequeue(a,b)};"inprogress"===e&&(e=c.shift(),d--),e&&("fx"===b&&c.unshift("inprogress"),delete f.stop,e.call(a,g,f)),!d&&f&&f.empty.fire()},_queueHooks:function(a,b){var c=b+"queueHooks";return m._data(a,c)||m._data(a,c,{empty:m.Callbacks("once memory").add(function(){m._removeData(a,b+"queue"),m._removeData(a,c)})})}}),m.fn.extend({queue:function(a,b){var c=2;return"string"!=typeof a&&(b=a,a="fx",c--),arguments.lengthh;h++)b(a[h],c,g?d:d.call(a[h],h,b(a[h],c)));return e?a:j?b.call(a):i?b(a[0],c):f},W=/^(?:checkbox|radio)$/i;!function(){var a=y.createElement("input"),b=y.createElement("div"),c=y.createDocumentFragment();if(b.innerHTML="
a",k.leadingWhitespace=3===b.firstChild.nodeType,k.tbody=!b.getElementsByTagName("tbody").length,k.htmlSerialize=!!b.getElementsByTagName("link").length,k.html5Clone="<:nav>"!==y.createElement("nav").cloneNode(!0).outerHTML,a.type="checkbox",a.checked=!0,c.appendChild(a),k.appendChecked=a.checked,b.innerHTML="",k.noCloneChecked=!!b.cloneNode(!0).lastChild.defaultValue,c.appendChild(b),b.innerHTML="",k.checkClone=b.cloneNode(!0).cloneNode(!0).lastChild.checked,k.noCloneEvent=!0,b.attachEvent&&(b.attachEvent("onclick",function(){k.noCloneEvent=!1}),b.cloneNode(!0).click()),null==k.deleteExpando){k.deleteExpando=!0;try{delete b.test}catch(d){k.deleteExpando=!1}}}(),function(){var b,c,d=y.createElement("div");for(b in{submit:!0,change:!0,focusin:!0})c="on"+b,(k[b+"Bubbles"]=c in a)||(d.setAttribute(c,"t"),k[b+"Bubbles"]=d.attributes[c].expando===!1);d=null}();var X=/^(?:input|select|textarea)$/i,Y=/^key/,Z=/^(?:mouse|pointer|contextmenu)|click/,$=/^(?:focusinfocus|focusoutblur)$/,_=/^([^.]*)(?:\.(.+)|)$/;function ab(){return!0}function bb(){return!1}function cb(){try{return y.activeElement}catch(a){}}m.event={global:{},add:function(a,b,c,d,e){var f,g,h,i,j,k,l,n,o,p,q,r=m._data(a);if(r){c.handler&&(i=c,c=i.handler,e=i.selector),c.guid||(c.guid=m.guid++),(g=r.events)||(g=r.events={}),(k=r.handle)||(k=r.handle=function(a){return typeof m===K||a&&m.event.triggered===a.type?void 0:m.event.dispatch.apply(k.elem,arguments)},k.elem=a),b=(b||"").match(E)||[""],h=b.length;while(h--)f=_.exec(b[h])||[],o=q=f[1],p=(f[2]||"").split(".").sort(),o&&(j=m.event.special[o]||{},o=(e?j.delegateType:j.bindType)||o,j=m.event.special[o]||{},l=m.extend({type:o,origType:q,data:d,handler:c,guid:c.guid,selector:e,needsContext:e&&m.expr.match.needsContext.test(e),namespace:p.join(".")},i),(n=g[o])||(n=g[o]=[],n.delegateCount=0,j.setup&&j.setup.call(a,d,p,k)!==!1||(a.addEventListener?a.addEventListener(o,k,!1):a.attachEvent&&a.attachEvent("on"+o,k))),j.add&&(j.add.call(a,l),l.handler.guid||(l.handler.guid=c.guid)),e?n.splice(n.delegateCount++,0,l):n.push(l),m.event.global[o]=!0);a=null}},remove:function(a,b,c,d,e){var f,g,h,i,j,k,l,n,o,p,q,r=m.hasData(a)&&m._data(a);if(r&&(k=r.events)){b=(b||"").match(E)||[""],j=b.length;while(j--)if(h=_.exec(b[j])||[],o=q=h[1],p=(h[2]||"").split(".").sort(),o){l=m.event.special[o]||{},o=(d?l.delegateType:l.bindType)||o,n=k[o]||[],h=h[2]&&new RegExp("(^|\\.)"+p.join("\\.(?:.*\\.|)")+"(\\.|$)"),i=f=n.length;while(f--)g=n[f],!e&&q!==g.origType||c&&c.guid!==g.guid||h&&!h.test(g.namespace)||d&&d!==g.selector&&("**"!==d||!g.selector)||(n.splice(f,1),g.selector&&n.delegateCount--,l.remove&&l.remove.call(a,g));i&&!n.length&&(l.teardown&&l.teardown.call(a,p,r.handle)!==!1||m.removeEvent(a,o,r.handle),delete k[o])}else for(o in k)m.event.remove(a,o+b[j],c,d,!0);m.isEmptyObject(k)&&(delete r.handle,m._removeData(a,"events"))}},trigger:function(b,c,d,e){var f,g,h,i,k,l,n,o=[d||y],p=j.call(b,"type")?b.type:b,q=j.call(b,"namespace")?b.namespace.split("."):[];if(h=l=d=d||y,3!==d.nodeType&&8!==d.nodeType&&!$.test(p+m.event.triggered)&&(p.indexOf(".")>=0&&(q=p.split("."),p=q.shift(),q.sort()),g=p.indexOf(":")<0&&"on"+p,b=b[m.expando]?b:new m.Event(p,"object"==typeof b&&b),b.isTrigger=e?2:3,b.namespace=q.join("."),b.namespace_re=b.namespace?new RegExp("(^|\\.)"+q.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,b.result=void 0,b.target||(b.target=d),c=null==c?[b]:m.makeArray(c,[b]),k=m.event.special[p]||{},e||!k.trigger||k.trigger.apply(d,c)!==!1)){if(!e&&!k.noBubble&&!m.isWindow(d)){for(i=k.delegateType||p,$.test(i+p)||(h=h.parentNode);h;h=h.parentNode)o.push(h),l=h;l===(d.ownerDocument||y)&&o.push(l.defaultView||l.parentWindow||a)}n=0;while((h=o[n++])&&!b.isPropagationStopped())b.type=n>1?i:k.bindType||p,f=(m._data(h,"events")||{})[b.type]&&m._data(h,"handle"),f&&f.apply(h,c),f=g&&h[g],f&&f.apply&&m.acceptData(h)&&(b.result=f.apply(h,c),b.result===!1&&b.preventDefault());if(b.type=p,!e&&!b.isDefaultPrevented()&&(!k._default||k._default.apply(o.pop(),c)===!1)&&m.acceptData(d)&&g&&d[p]&&!m.isWindow(d)){l=d[g],l&&(d[g]=null),m.event.triggered=p;try{d[p]()}catch(r){}m.event.triggered=void 0,l&&(d[g]=l)}return b.result}},dispatch:function(a){a=m.event.fix(a);var b,c,e,f,g,h=[],i=d.call(arguments),j=(m._data(this,"events")||{})[a.type]||[],k=m.event.special[a.type]||{};if(i[0]=a,a.delegateTarget=this,!k.preDispatch||k.preDispatch.call(this,a)!==!1){h=m.event.handlers.call(this,a,j),b=0;while((f=h[b++])&&!a.isPropagationStopped()){a.currentTarget=f.elem,g=0;while((e=f.handlers[g++])&&!a.isImmediatePropagationStopped())(!a.namespace_re||a.namespace_re.test(e.namespace))&&(a.handleObj=e,a.data=e.data,c=((m.event.special[e.origType]||{}).handle||e.handler).apply(f.elem,i),void 0!==c&&(a.result=c)===!1&&(a.preventDefault(),a.stopPropagation()))}return k.postDispatch&&k.postDispatch.call(this,a),a.result}},handlers:function(a,b){var c,d,e,f,g=[],h=b.delegateCount,i=a.target;if(h&&i.nodeType&&(!a.button||"click"!==a.type))for(;i!=this;i=i.parentNode||this)if(1===i.nodeType&&(i.disabled!==!0||"click"!==a.type)){for(e=[],f=0;h>f;f++)d=b[f],c=d.selector+" ",void 0===e[c]&&(e[c]=d.needsContext?m(c,this).index(i)>=0:m.find(c,this,null,[i]).length),e[c]&&e.push(d);e.length&&g.push({elem:i,handlers:e})}return h]","i"),hb=/^\s+/,ib=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/gi,jb=/<([\w:]+)/,kb=/\s*$/g,rb={option:[1,""],legend:[1,"
","
"],area:[1,"",""],param:[1,"",""],thead:[1,"","
"],tr:[2,"","
"],col:[2,"","
"],td:[3,"","
"],_default:k.htmlSerialize?[0,"",""]:[1,"X
","
"]},sb=db(y),tb=sb.appendChild(y.createElement("div"));rb.optgroup=rb.option,rb.tbody=rb.tfoot=rb.colgroup=rb.caption=rb.thead,rb.th=rb.td;function ub(a,b){var c,d,e=0,f=typeof a.getElementsByTagName!==K?a.getElementsByTagName(b||"*"):typeof a.querySelectorAll!==K?a.querySelectorAll(b||"*"):void 0;if(!f)for(f=[],c=a.childNodes||a;null!=(d=c[e]);e++)!b||m.nodeName(d,b)?f.push(d):m.merge(f,ub(d,b));return void 0===b||b&&m.nodeName(a,b)?m.merge([a],f):f}function vb(a){W.test(a.type)&&(a.defaultChecked=a.checked)}function wb(a,b){return m.nodeName(a,"table")&&m.nodeName(11!==b.nodeType?b:b.firstChild,"tr")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function xb(a){return a.type=(null!==m.find.attr(a,"type"))+"/"+a.type,a}function yb(a){var b=pb.exec(a.type);return b?a.type=b[1]:a.removeAttribute("type"),a}function zb(a,b){for(var c,d=0;null!=(c=a[d]);d++)m._data(c,"globalEval",!b||m._data(b[d],"globalEval"))}function Ab(a,b){if(1===b.nodeType&&m.hasData(a)){var c,d,e,f=m._data(a),g=m._data(b,f),h=f.events;if(h){delete g.handle,g.events={};for(c in h)for(d=0,e=h[c].length;e>d;d++)m.event.add(b,c,h[c][d])}g.data&&(g.data=m.extend({},g.data))}}function Bb(a,b){var c,d,e;if(1===b.nodeType){if(c=b.nodeName.toLowerCase(),!k.noCloneEvent&&b[m.expando]){e=m._data(b);for(d in e.events)m.removeEvent(b,d,e.handle);b.removeAttribute(m.expando)}"script"===c&&b.text!==a.text?(xb(b).text=a.text,yb(b)):"object"===c?(b.parentNode&&(b.outerHTML=a.outerHTML),k.html5Clone&&a.innerHTML&&!m.trim(b.innerHTML)&&(b.innerHTML=a.innerHTML)):"input"===c&&W.test(a.type)?(b.defaultChecked=b.checked=a.checked,b.value!==a.value&&(b.value=a.value)):"option"===c?b.defaultSelected=b.selected=a.defaultSelected:("input"===c||"textarea"===c)&&(b.defaultValue=a.defaultValue)}}m.extend({clone:function(a,b,c){var d,e,f,g,h,i=m.contains(a.ownerDocument,a);if(k.html5Clone||m.isXMLDoc(a)||!gb.test("<"+a.nodeName+">")?f=a.cloneNode(!0):(tb.innerHTML=a.outerHTML,tb.removeChild(f=tb.firstChild)),!(k.noCloneEvent&&k.noCloneChecked||1!==a.nodeType&&11!==a.nodeType||m.isXMLDoc(a)))for(d=ub(f),h=ub(a),g=0;null!=(e=h[g]);++g)d[g]&&Bb(e,d[g]);if(b)if(c)for(h=h||ub(a),d=d||ub(f),g=0;null!=(e=h[g]);g++)Ab(e,d[g]);else Ab(a,f);return d=ub(f,"script"),d.length>0&&zb(d,!i&&ub(a,"script")),d=h=e=null,f},buildFragment:function(a,b,c,d){for(var e,f,g,h,i,j,l,n=a.length,o=db(b),p=[],q=0;n>q;q++)if(f=a[q],f||0===f)if("object"===m.type(f))m.merge(p,f.nodeType?[f]:f);else if(lb.test(f)){h=h||o.appendChild(b.createElement("div")),i=(jb.exec(f)||["",""])[1].toLowerCase(),l=rb[i]||rb._default,h.innerHTML=l[1]+f.replace(ib,"<$1>")+l[2],e=l[0];while(e--)h=h.lastChild;if(!k.leadingWhitespace&&hb.test(f)&&p.push(b.createTextNode(hb.exec(f)[0])),!k.tbody){f="table"!==i||kb.test(f)?""!==l[1]||kb.test(f)?0:h:h.firstChild,e=f&&f.childNodes.length;while(e--)m.nodeName(j=f.childNodes[e],"tbody")&&!j.childNodes.length&&f.removeChild(j)}m.merge(p,h.childNodes),h.textContent="";while(h.firstChild)h.removeChild(h.firstChild);h=o.lastChild}else p.push(b.createTextNode(f));h&&o.removeChild(h),k.appendChecked||m.grep(ub(p,"input"),vb),q=0;while(f=p[q++])if((!d||-1===m.inArray(f,d))&&(g=m.contains(f.ownerDocument,f),h=ub(o.appendChild(f),"script"),g&&zb(h),c)){e=0;while(f=h[e++])ob.test(f.type||"")&&c.push(f)}return h=null,o},cleanData:function(a,b){for(var d,e,f,g,h=0,i=m.expando,j=m.cache,l=k.deleteExpando,n=m.event.special;null!=(d=a[h]);h++)if((b||m.acceptData(d))&&(f=d[i],g=f&&j[f])){if(g.events)for(e in g.events)n[e]?m.event.remove(d,e):m.removeEvent(d,e,g.handle);j[f]&&(delete j[f],l?delete d[i]:typeof d.removeAttribute!==K?d.removeAttribute(i):d[i]=null,c.push(f))}}}),m.fn.extend({text:function(a){return V(this,function(a){return void 0===a?m.text(this):this.empty().append((this[0]&&this[0].ownerDocument||y).createTextNode(a))},null,a,arguments.length)},append:function(){return this.domManip(arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=wb(this,a);b.appendChild(a)}})},prepend:function(){return this.domManip(arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=wb(this,a);b.insertBefore(a,b.firstChild)}})},before:function(){return this.domManip(arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this)})},after:function(){return this.domManip(arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this.nextSibling)})},remove:function(a,b){for(var c,d=a?m.filter(a,this):this,e=0;null!=(c=d[e]);e++)b||1!==c.nodeType||m.cleanData(ub(c)),c.parentNode&&(b&&m.contains(c.ownerDocument,c)&&zb(ub(c,"script")),c.parentNode.removeChild(c));return this},empty:function(){for(var a,b=0;null!=(a=this[b]);b++){1===a.nodeType&&m.cleanData(ub(a,!1));while(a.firstChild)a.removeChild(a.firstChild);a.options&&m.nodeName(a,"select")&&(a.options.length=0)}return this},clone:function(a,b){return a=null==a?!1:a,b=null==b?a:b,this.map(function(){return m.clone(this,a,b)})},html:function(a){return V(this,function(a){var b=this[0]||{},c=0,d=this.length;if(void 0===a)return 1===b.nodeType?b.innerHTML.replace(fb,""):void 0;if(!("string"!=typeof a||mb.test(a)||!k.htmlSerialize&&gb.test(a)||!k.leadingWhitespace&&hb.test(a)||rb[(jb.exec(a)||["",""])[1].toLowerCase()])){a=a.replace(ib,"<$1>");try{for(;d>c;c++)b=this[c]||{},1===b.nodeType&&(m.cleanData(ub(b,!1)),b.innerHTML=a);b=0}catch(e){}}b&&this.empty().append(a)},null,a,arguments.length)},replaceWith:function(){var a=arguments[0];return this.domManip(arguments,function(b){a=this.parentNode,m.cleanData(ub(this)),a&&a.replaceChild(b,this)}),a&&(a.length||a.nodeType)?this:this.remove()},detach:function(a){return this.remove(a,!0)},domManip:function(a,b){a=e.apply([],a);var c,d,f,g,h,i,j=0,l=this.length,n=this,o=l-1,p=a[0],q=m.isFunction(p);if(q||l>1&&"string"==typeof p&&!k.checkClone&&nb.test(p))return this.each(function(c){var d=n.eq(c);q&&(a[0]=p.call(this,c,d.html())),d.domManip(a,b)});if(l&&(i=m.buildFragment(a,this[0].ownerDocument,!1,this),c=i.firstChild,1===i.childNodes.length&&(i=c),c)){for(g=m.map(ub(i,"script"),xb),f=g.length;l>j;j++)d=i,j!==o&&(d=m.clone(d,!0,!0),f&&m.merge(g,ub(d,"script"))),b.call(this[j],d,j);if(f)for(h=g[g.length-1].ownerDocument,m.map(g,yb),j=0;f>j;j++)d=g[j],ob.test(d.type||"")&&!m._data(d,"globalEval")&&m.contains(h,d)&&(d.src?m._evalUrl&&m._evalUrl(d.src):m.globalEval((d.text||d.textContent||d.innerHTML||"").replace(qb,"")));i=c=null}return this}}),m.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){m.fn[a]=function(a){for(var c,d=0,e=[],g=m(a),h=g.length-1;h>=d;d++)c=d===h?this:this.clone(!0),m(g[d])[b](c),f.apply(e,c.get());return this.pushStack(e)}});var Cb,Db={};function Eb(b,c){var d,e=m(c.createElement(b)).appendTo(c.body),f=a.getDefaultComputedStyle&&(d=a.getDefaultComputedStyle(e[0]))?d.display:m.css(e[0],"display");return e.detach(),f}function Fb(a){var b=y,c=Db[a];return c||(c=Eb(a,b),"none"!==c&&c||(Cb=(Cb||m("',preload:!0,scrolling:"no",css:{}},baseClass:"",slideClass:"",baseTpl:'',spinnerTpl:'
',errorTpl:'

The requested content cannot be loaded.
Please try again later.

',closeTpl:'',parentEl:"body",touch:!0,keyboard:!0,focus:!0,closeClickOutside:!0,beforeLoad:n.noop,afterLoad:n.noop,beforeMove:n.noop,afterMove:n.noop,onComplete:n.noop,onInit:n.noop,beforeClose:n.noop,afterClose:n.noop,onActivate:n.noop,onDeactivate:n.noop},a=n(t),r=n(e),c=0,l=function(t){return t&&t.hasOwnProperty&&t instanceof n},u=function(){return t.requestAnimationFrame||t.webkitRequestAnimationFrame||t.mozRequestAnimationFrame||function(e){t.setTimeout(e,1e3/60)}}(),d=function(o){var s;return"function"==typeof n&&o instanceof n&&(o=o[0]),s=o.getBoundingClientRect(),s.bottom>0&&s.right>0&&s.left<(t.innerWidth||e.documentElement.clientWidth)&&s.top<(t.innerHeight||e.documentElement.clientHeight)},p=function(t,o,s){var a=this;a.opts=n.extend(!0,{index:s},i,o||{}),a.id=a.opts.id||++c,a.group=[],a.currIndex=parseInt(a.opts.index,10)||0,a.prevIndex=null,a.prevPos=null,a.currPos=0,a.firstRun=null,a.createGroup(t),a.group.length&&(a.$lastFocus=n(e.activeElement).blur(),a.slides={},a.init(t))};n.extend(p.prototype,{init:function(){var t,e,o=this,s=!1;o.scrollTop=r.scrollTop(),o.scrollLeft=r.scrollLeft(),n.fancybox.getInstance()||(t=n("body").width(),n("html").addClass("fancybox-enabled"),n.fancybox.isTouch?(n.each(o.group,function(t,e){if("image"!==e.type&&"iframe"!==e.type)return s=!0,!1}),s&&n("body").css({position:"fixed",width:t,top:o.scrollTop*-1})):(t=n("body").width()-t,t>1&&n('"].join(""),l.id=h,(m?l:n).innerHTML+=f,n.appendChild(l),m||(n.style.background="",n.style.overflow="hidden",k=g.style.overflow,g.style.overflow="hidden",g.appendChild(n)),i=c(l,a),m?l.parentNode.removeChild(l):(n.parentNode.removeChild(n),g.style.overflow=k),!!i},z=function(b){var c=a.matchMedia||a.msMatchMedia;if(c)return c(b)&&c(b).matches||!1;var d;return y("@media "+b+" { #"+h+" { position: absolute; } }",function(b){d=(a.getComputedStyle?getComputedStyle(b,null):b.currentStyle)["position"]=="absolute"}),d},A=function(){function d(d,e){e=e||b.createElement(a[d]||"div"),d="on"+d;var f=d in e;return f||(e.setAttribute||(e=b.createElement("div")),e.setAttribute&&e.removeAttribute&&(e.setAttribute(d,""),f=F(e[d],"function"),F(e[d],"undefined")||(e[d]=c),e.removeAttribute(d))),e=null,f}var a={select:"input",change:"input",submit:"form",reset:"form",error:"img",load:"img",abort:"img"};return d}(),B={}.hasOwnProperty,C;!F(B,"undefined")&&!F(B.call,"undefined")?C=function(a,b){return B.call(a,b)}:C=function(a,b){return b in a&&F(a.constructor.prototype[b],"undefined")},Function.prototype.bind||(Function.prototype.bind=function(b){var c=this;if(typeof c!="function")throw new TypeError;var d=w.call(arguments,1),e=function(){if(this instanceof e){var a=function(){};a.prototype=c.prototype;var f=new a,g=c.apply(f,d.concat(w.call(arguments)));return Object(g)===g?g:f}return c.apply(b,d.concat(w.call(arguments)))};return e}),s.flexbox=function(){return J("flexWrap")},s.canvas=function(){var a=b.createElement("canvas");return!!a.getContext&&!!a.getContext("2d")},s.canvastext=function(){return!!e.canvas&&!!F(b.createElement("canvas").getContext("2d").fillText,"function")},s.webgl=function(){return!!a.WebGLRenderingContext},s.touch=function(){var c;return"ontouchstart"in a||a.DocumentTouch&&b instanceof DocumentTouch?c=!0:y(["@media (",n.join("touch-enabled),("),h,")","{#modernizr{top:9px;position:absolute}}"].join(""),function(a){c=a.offsetTop===9}),c},s.geolocation=function(){return"geolocation"in navigator},s.postmessage=function(){return!!a.postMessage},s.websqldatabase=function(){return!!a.openDatabase},s.indexedDB=function(){return!!J("indexedDB",a)},s.hashchange=function(){return A("hashchange",a)&&(b.documentMode===c||b.documentMode>7)},s.history=function(){return!!a.history&&!!history.pushState},s.draganddrop=function(){var a=b.createElement("div");return"draggable"in a||"ondragstart"in a&&"ondrop"in a},s.websockets=function(){return"WebSocket"in a||"MozWebSocket"in a},s.rgba=function(){return D("background-color:rgba(150,255,150,.5)"),G(j.backgroundColor,"rgba")},s.hsla=function(){return D("background-color:hsla(120,40%,100%,.5)"),G(j.backgroundColor,"rgba")||G(j.backgroundColor,"hsla")},s.multiplebgs=function(){return D("background:url(https://),url(https://),red url(https://)"),/(url\s*\(.*?){3}/.test(j.background)},s.backgroundsize=function(){return J("backgroundSize")},s.borderimage=function(){return J("borderImage")},s.borderradius=function(){return J("borderRadius")},s.boxshadow=function(){return J("boxShadow")},s.textshadow=function(){return b.createElement("div").style.textShadow===""},s.opacity=function(){return E("opacity:.55"),/^0.55$/.test(j.opacity)},s.cssanimations=function(){return J("animationName")},s.csscolumns=function(){return J("columnCount")},s.cssgradients=function(){var a="background-image:",b="gradient(linear,left top,right bottom,from(#9f9),to(white));",c="linear-gradient(left top,#9f9, white);";return D((a+"-webkit- ".split(" ").join(b+a)+n.join(c+a)).slice(0,-a.length)),G(j.backgroundImage,"gradient")},s.cssreflections=function(){return J("boxReflect")},s.csstransforms=function(){return!!J("transform")},s.csstransforms3d=function(){var a=!!J("perspective");return a&&"webkitPerspective"in g.style&&y("@media (transform-3d),(-webkit-transform-3d){#modernizr{left:9px;position:absolute;height:3px;}}",function(b,c){a=b.offsetLeft===9&&b.offsetHeight===3}),a},s.csstransitions=function(){return J("transition")},s.fontface=function(){var a;return y('@font-face {font-family:"font";src:url("https://")}',function(c,d){var e=b.getElementById("smodernizr"),f=e.sheet||e.styleSheet,g=f?f.cssRules&&f.cssRules[0]?f.cssRules[0].cssText:f.cssText||"":"";a=/src/i.test(g)&&g.indexOf(d.split(" ")[0])===0}),a},s.generatedcontent=function(){var a;return y(["#",h,"{font:0/0 a}#",h,':after{content:"',l,'";visibility:hidden;font:3px/1 a}'].join(""),function(b){a=b.offsetHeight>=3}),a},s.video=function(){var a=b.createElement("video"),c=!1;try{if(c=!!a.canPlayType)c=new Boolean(c),c.ogg=a.canPlayType('video/ogg; codecs="theora"').replace(/^no$/,""),c.h264=a.canPlayType('video/mp4; codecs="avc1.42E01E"').replace(/^no$/,""),c.webm=a.canPlayType('video/webm; codecs="vp8, vorbis"').replace(/^no$/,"")}catch(d){}return c},s.audio=function(){var a=b.createElement("audio"),c=!1;try{if(c=!!a.canPlayType)c=new Boolean(c),c.ogg=a.canPlayType('audio/ogg; codecs="vorbis"').replace(/^no$/,""),c.mp3=a.canPlayType("audio/mpeg;").replace(/^no$/,""),c.wav=a.canPlayType('audio/wav; codecs="1"').replace(/^no$/,""),c.m4a=(a.canPlayType("audio/x-m4a;")||a.canPlayType("audio/aac;")).replace(/^no$/,"")}catch(d){}return c},s.localstorage=function(){try{return localStorage.setItem(h,h),localStorage.removeItem(h),!0}catch(a){return!1}},s.sessionstorage=function(){try{return sessionStorage.setItem(h,h),sessionStorage.removeItem(h),!0}catch(a){return!1}},s.webworkers=function(){return!!a.Worker},s.applicationcache=function(){return!!a.applicationCache},s.svg=function(){return!!b.createElementNS&&!!b.createElementNS(r.svg,"svg").createSVGRect},s.inlinesvg=function(){var a=b.createElement("div");return a.innerHTML="",(a.firstChild&&a.firstChild.namespaceURI)==r.svg},s.smil=function(){return!!b.createElementNS&&/SVGAnimate/.test(m.call(b.createElementNS(r.svg,"animate")))},s.svgclippaths=function(){return!!b.createElementNS&&/SVGClipPath/.test(m.call(b.createElementNS(r.svg,"clipPath")))};for(var L in s)C(s,L)&&(x=L.toLowerCase(),e[x]=s[L](),v.push((e[x]?"":"no-")+x));return e.input||K(),e.addTest=function(a,b){if(typeof a=="object")for(var d in a)C(a,d)&&e.addTest(d,a[d]);else{a=a.toLowerCase();if(e[a]!==c)return e;b=typeof b=="function"?b():b,typeof f!="undefined"&&f&&(g.className+=" "+(b?"":"no-")+a),e[a]=b}return e},D(""),i=k=null,function(a,b){function l(a,b){var c=a.createElement("p"),d=a.getElementsByTagName("head")[0]||a.documentElement;return c.innerHTML="x",d.insertBefore(c.lastChild,d.firstChild)}function m(){var a=s.elements;return typeof a=="string"?a.split(" "):a}function n(a){var b=j[a[h]];return b||(b={},i++,a[h]=i,j[i]=b),b}function o(a,c,d){c||(c=b);if(k)return c.createElement(a);d||(d=n(c));var g;return d.cache[a]?g=d.cache[a].cloneNode():f.test(a)?g=(d.cache[a]=d.createElem(a)).cloneNode():g=d.createElem(a),g.canHaveChildren&&!e.test(a)&&!g.tagUrn?d.frag.appendChild(g):g}function p(a,c){a||(a=b);if(k)return a.createDocumentFragment();c=c||n(a);var d=c.frag.cloneNode(),e=0,f=m(),g=f.length;for(;e",g="hidden"in a,k=a.childNodes.length==1||function(){b.createElement("a");var a=b.createDocumentFragment();return typeof a.cloneNode=="undefined"||typeof a.createDocumentFragment=="undefined"||typeof a.createElement=="undefined"}()}catch(c){g=!0,k=!0}})();var s={elements:d.elements||"abbr article aside audio bdi canvas data datalist details dialog figcaption figure footer header hgroup main mark meter nav output progress section summary template time video",version:c,shivCSS:d.shivCSS!==!1,supportsUnknownElements:k,shivMethods:d.shivMethods!==!1,type:"default",shivDocument:r,createElement:o,createDocumentFragment:p};a.html5=s,r(b)}(this,b),e._version=d,e._prefixes=n,e._domPrefixes=q,e._cssomPrefixes=p,e.mq=z,e.hasEvent=A,e.testProp=function(a){return H([a])},e.testAllProps=J,e.testStyles=y,e.prefixed=function(a,b,c){return b?J(a,b,c):J(a,"pfx")},g.className=g.className.replace(/(^|\s)no-js(\s|$)/,"$1$2")+(f?" js "+v.join(" "):""),e}(this,this.document),function(a,b,c){function d(a){return"[object Function]"==o.call(a)}function e(a){return"string"==typeof a}function f(){}function g(a){return!a||"loaded"==a||"complete"==a||"uninitialized"==a}function h(){var a=p.shift();q=1,a?a.t?m(function(){("c"==a.t?B.injectCss:B.injectJs)(a.s,0,a.a,a.x,a.e,1)},0):(a(),h()):q=0}function i(a,c,d,e,f,i,j){function k(b){if(!o&&g(l.readyState)&&(u.r=o=1,!q&&h(),l.onload=l.onreadystatechange=null,b)){"img"!=a&&m(function(){t.removeChild(l)},50);for(var d in y[c])y[c].hasOwnProperty(d)&&y[c][d].onload()}}var j=j||B.errorTimeout,l=b.createElement(a),o=0,r=0,u={t:d,s:c,e:f,a:i,x:j};1===y[c]&&(r=1,y[c]=[]),"object"==a?l.data=c:(l.src=c,l.type=a),l.width=l.height="0",l.onerror=l.onload=l.onreadystatechange=function(){k.call(this,r)},p.splice(e,0,u),"img"!=a&&(r||2===y[c]?(t.insertBefore(l,s?null:n),m(k,j)):y[c].push(l))}function j(a,b,c,d,f){return q=0,b=b||"j",e(a)?i("c"==b?v:u,a,b,this.i++,c,d,f):(p.splice(this.i++,0,a),1==p.length&&h()),this}function k(){var a=B;return a.loader={load:j,i:0},a}var l=b.documentElement,m=a.setTimeout,n=b.getElementsByTagName("script")[0],o={}.toString,p=[],q=0,r="MozAppearance"in l.style,s=r&&!!b.createRange().compareNode,t=s?l:n.parentNode,l=a.opera&&"[object Opera]"==o.call(a.opera),l=!!b.attachEvent&&!l,u=r?"object":l?"script":"img",v=l?"script":u,w=Array.isArray||function(a){return"[object Array]"==o.call(a)},x=[],y={},z={timeout:function(a,b){return b.length&&(a.timeout=b[0]),a}},A,B;B=function(a){function b(a){var a=a.split("!"),b=x.length,c=a.pop(),d=a.length,c={url:c,origUrl:c,prefixes:a},e,f,g;for(f=0;fPrevious', + nextArrow: '', + autoplay: false, + autoplaySpeed: 3000, + centerMode: false, + centerPadding: '50px', + cssEase: 'ease', + customPaging: function(slider, i) { + return $('